aboutsummaryrefslogtreecommitdiff
path: root/third_party/abseil-cpp/absl/time/internal
diff options
context:
space:
mode:
authorAndroid Build Coastguard Worker <android-build-coastguard-worker@google.com>2021-07-15 01:37:59 +0000
committerAndroid Build Coastguard Worker <android-build-coastguard-worker@google.com>2021-07-15 01:37:59 +0000
commit7bf96aa3117550167f576d02ec25e9b56a29a9fc (patch)
treecb306ffb64819f95c080c3cb6bfcdfb45a7b3a76 /third_party/abseil-cpp/absl/time/internal
parent661e84967bb2600427cb65715caeeba112b94244 (diff)
parentb7c9dafe99969a4e9d5ffa101bb9a8d6e1df69df (diff)
downloadwebrtc-7bf96aa3117550167f576d02ec25e9b56a29a9fc.tar.gz
Change-Id: I7acf6f66154d007b4e7bf9fb5dd9f27aee123429
Diffstat (limited to 'third_party/abseil-cpp/absl/time/internal')
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/BUILD.bazel166
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time.h332
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h622
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/time_zone.h384
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h102
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/cctz_benchmark.cc1029
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_detail.cc94
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_test.cc1056
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.cc140
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.h52
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format.cc922
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format_test.cc1500
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.cc45
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.h76
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.cc121
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.h93
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.cc958
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.h138
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.cc308
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.h55
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup.cc187
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc1437
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.cc159
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.h132
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/tzfile.h122
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/src/zone_info_source.cc115
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/README.zoneinfo37
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/version1
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjanbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accrabin0 -> 816 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Abababin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiersbin0 -> 735 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmarabin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmerabin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamakobin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banguibin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjulbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissaubin0 -> 194 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyrebin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzavillebin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumburabin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairobin0 -> 1955 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablancabin0 -> 2429 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceutabin0 -> 2036 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakrybin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakarbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaambin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djiboutibin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Doualabin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiunbin0 -> 2295 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetownbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaboronebin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Hararebin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburgbin0 -> 246 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Jubabin0 -> 653 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampalabin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoumbin0 -> 679 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigalibin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasabin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagosbin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Librevillebin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lomebin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luandabin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashibin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusakabin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabobin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputobin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maserubin0 -> 246 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabanebin0 -> 246 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishubin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monroviabin0 -> 208 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobibin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamenabin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niameybin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchottbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougoubin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novobin0 -> 149 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tomebin0 -> 254 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktubin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripolibin0 -> 625 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunisbin0 -> 689 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoekbin0 -> 955 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adakbin0 -> 2356 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchoragebin0 -> 2371 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguillabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antiguabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguainabin0 -> 884 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Airesbin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarcabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadaviabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordobabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuybin0 -> 1048 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Riojabin0 -> 1090 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendozabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegosbin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Saltabin0 -> 1048 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juanbin0 -> 1090 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luisbin0 -> 1102 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucumanbin0 -> 1104 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaiabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Arubabin0 -> 186 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncionbin0 -> 2044 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokanbin0 -> 336 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atkabin0 -> 2356 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahiabin0 -> 1024 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderasbin0 -> 1546 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbadosbin0 -> 314 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belembin0 -> 576 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belizebin0 -> 948 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablonbin0 -> 298 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vistabin0 -> 632 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogotabin0 -> 246 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boisebin0 -> 2394 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Airesbin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Baybin0 -> 2084 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grandebin0 -> 1444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancunbin0 -> 782 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracasbin0 -> 264 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarcabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayennebin0 -> 198 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caymanbin0 -> 182 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicagobin0 -> 3576 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahuabin0 -> 1484 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbourbin0 -> 336 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordobabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Ricabin0 -> 316 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Crestonbin0 -> 208 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiababin0 -> 1416 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacaobin0 -> 186 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavnbin0 -> 698 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawsonbin0 -> 2084 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creekbin0 -> 1050 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denverbin0 -> 2444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroitbin0 -> 2230 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominicabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmontonbin0 -> 2332 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepebin0 -> 656 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvadorbin0 -> 224 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenadabin0 -> 2342 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelsonbin0 -> 2240 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Waynebin0 -> 1666 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortalezabin0 -> 716 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Baybin0 -> 2192 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthabbin0 -> 1878 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Baybin0 -> 3210 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turkbin0 -> 1848 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenadabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupebin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemalabin0 -> 280 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquilbin0 -> 246 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyanabin0 -> 236 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifaxbin0 -> 3424 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havanabin0 -> 2416 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillobin0 -> 416 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolisbin0 -> 1666 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knoxbin0 -> 2428 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengobin0 -> 1722 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburgbin0 -> 1904 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_Citybin0 -> 1684 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevaybin0 -> 1414 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennesbin0 -> 1694 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamacbin0 -> 1778 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolisbin0 -> 1666 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvikbin0 -> 1894 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluitbin0 -> 2032 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaicabin0 -> 482 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuybin0 -> 1048 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneaubin0 -> 2353 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisvillebin0 -> 2772 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticellobin0 -> 2352 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_INbin0 -> 2428 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijkbin0 -> 186 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Pazbin0 -> 232 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Limabin0 -> 406 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angelesbin0 -> 2836 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisvillebin0 -> 2772 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princesbin0 -> 186 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceiobin0 -> 744 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managuabin0 -> 430 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manausbin0 -> 604 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigotbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martiniquebin0 -> 232 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamorosbin0 -> 1390 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlanbin0 -> 1526 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendozabin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menomineebin0 -> 2274 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Meridabin0 -> 1422 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatlabin0 -> 1423 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_Citybin0 -> 1584 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelonbin0 -> 1666 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monctonbin0 -> 3154 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterreybin0 -> 1390 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideobin0 -> 1510 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montrealbin0 -> 3494 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserratbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassaubin0 -> 2258 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_Yorkbin0 -> 3536 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigonbin0 -> 2122 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nomebin0 -> 2367 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronhabin0 -> 716 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulahbin0 -> 2380 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Centerbin0 -> 2380 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salembin0 -> 2380 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinagabin0 -> 1484 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panamabin0 -> 182 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtungbin0 -> 2094 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribobin0 -> 262 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenixbin0 -> 328 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Princebin0 -> 1434 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spainbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acrebin0 -> 628 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velhobin0 -> 576 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Ricobin0 -> 246 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenasbin0 -> 1902 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_Riverbin0 -> 2122 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inletbin0 -> 1892 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recifebin0 -> 716 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Reginabin0 -> 980 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolutebin0 -> 1892 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Brancobin0 -> 628 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosariobin0 -> 1076 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabelbin0 -> 2342 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarembin0 -> 602 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiagobin0 -> 2529 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingobin0 -> 458 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulobin0 -> 1444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysundbin0 -> 1916 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprockbin0 -> 2444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitkabin0 -> 2329 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemybin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johnsbin0 -> 3655 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kittsbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Luciabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomasbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincentbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Currentbin0 -> 560 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpabin0 -> 252 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thulebin0 -> 1502 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Baybin0 -> 2202 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuanabin0 -> 2342 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Torontobin0 -> 3494 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortolabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouverbin0 -> 2892 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virginbin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorsebin0 -> 2084 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipegbin0 -> 2868 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutatbin0 -> 2305 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknifebin0 -> 1966 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Caseybin0 -> 297 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davisbin0 -> 297 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrvillebin0 -> 194 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquariebin0 -> 1520 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawsonbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdobin0 -> 2437 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmerbin0 -> 1418 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rotherabin0 -> 164 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Polebin0 -> 2437 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowabin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Trollbin0 -> 1162 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostokbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyenbin0 -> 2228 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Adenbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almatybin0 -> 997 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ammanbin0 -> 1853 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyrbin0 -> 1188 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtaubin0 -> 983 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobebin0 -> 1011 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabatbin0 -> 619 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabadbin0 -> 619 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyraubin0 -> 991 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdadbin0 -> 983 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrainbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bakubin0 -> 1227 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkokbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaulbin0 -> 1221 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirutbin0 -> 2154 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkekbin0 -> 983 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bruneibin0 -> 203 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcuttabin0 -> 285 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chitabin0 -> 1221 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsanbin0 -> 949 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqingbin0 -> 533 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungkingbin0 -> 533 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombobin0 -> 372 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Daccabin0 -> 337 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascusbin0 -> 2294 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhakabin0 -> 337 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dilibin0 -> 227 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubaibin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbebin0 -> 591 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagustabin0 -> 2028 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gazabin0 -> 2316 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbinbin0 -> 533 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebronbin0 -> 2344 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minhbin0 -> 351 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kongbin0 -> 1203 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovdbin0 -> 891 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutskbin0 -> 1243 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbulbin0 -> 1947 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakartabin0 -> 355 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapurabin0 -> 221 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalembin0 -> 2288 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabulbin0 -> 208 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatkabin0 -> 1166 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachibin0 -> 379 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgarbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandubin0 -> 212 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandubin0 -> 212 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandygabin0 -> 1271 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkatabin0 -> 285 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarskbin0 -> 1207 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpurbin0 -> 383 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuchingbin0 -> 483 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwaitbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macaobin0 -> 1227 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macaubin0 -> 1227 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadanbin0 -> 1222 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassarbin0 -> 254 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manilabin0 -> 328 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscatbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosiabin0 -> 2002 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetskbin0 -> 1165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirskbin0 -> 1221 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omskbin0 -> 1207 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oralbin0 -> 1005 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penhbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianakbin0 -> 353 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyangbin0 -> 237 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatarbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanaybin0 -> 1011 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylordabin0 -> 1025 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoonbin0 -> 268 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadhbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigonbin0 -> 351 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalinbin0 -> 1202 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkandbin0 -> 577 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoulbin0 -> 617 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghaibin0 -> 533 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singaporebin0 -> 383 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymskbin0 -> 1208 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipeibin0 -> 761 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkentbin0 -> 591 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisibin0 -> 1035 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehranbin0 -> 2582 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Avivbin0 -> 2288 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbubin0 -> 203 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphubin0 -> 203 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyobin0 -> 309 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomskbin0 -> 1221 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandangbin0 -> 254 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatarbin0 -> 891 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Batorbin0 -> 891 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqibin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nerabin0 -> 1252 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientianebin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostokbin0 -> 1208 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutskbin0 -> 1207 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangonbin0 -> 268 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburgbin0 -> 1243 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevanbin0 -> 1151 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azoresbin0 -> 3484 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermudabin0 -> 1978 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canarybin0 -> 1897 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verdebin0 -> 270 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroebin0 -> 1815 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroebin0 -> 1815 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayenbin0 -> 2228 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeirabin0 -> 3475 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavikbin0 -> 1162 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgiabin0 -> 164 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helenabin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanleybin0 -> 1214 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACTbin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaidebin0 -> 2222 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbanebin0 -> 433 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hillbin0 -> 2243 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberrabin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Curriebin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwinbin0 -> 304 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Euclabin0 -> 484 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobartbin0 -> 2316 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHIbin0 -> 1860 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindemanbin0 -> 489 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howebin0 -> 1860 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbournebin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSWbin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Northbin0 -> 304 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perthbin0 -> 460 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queenslandbin0 -> 433 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Southbin0 -> 2222 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydneybin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmaniabin0 -> 2316 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoriabin0 -> 2204 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Westbin0 -> 460 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinnabin0 -> 2243 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acrebin0 -> 628 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronhabin0 -> 716 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Eastbin0 -> 1444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Westbin0 -> 604 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CETbin0 -> 2094 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlanticbin0 -> 3424 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Centralbin0 -> 2868 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Easternbin0 -> 3494 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountainbin0 -> 2332 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundlandbin0 -> 3655 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacificbin0 -> 2892 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewanbin0 -> 980 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukonbin0 -> 2084 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continentalbin0 -> 2529 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIslandbin0 -> 2233 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Cubabin0 -> 2416 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EETbin0 -> 1908 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ESTbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Egyptbin0 -> 1955 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Eirebin0 -> 3492 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMTbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0bin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9bin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0bin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10bin0 -> 118 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11bin0 -> 118 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12bin0 -> 118 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13bin0 -> 118 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14bin0 -> 118 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9bin0 -> 117 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0bin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwichbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCTbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTCbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universalbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulubin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdambin0 -> 2910 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorrabin0 -> 1742 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhanbin0 -> 1165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athensbin0 -> 2262 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfastbin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgradebin0 -> 1920 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlinbin0 -> 2298 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislavabin0 -> 2301 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brusselsbin0 -> 2933 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharestbin0 -> 2184 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapestbin0 -> 2368 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingenbin0 -> 1909 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinaubin0 -> 2390 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagenbin0 -> 2137 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublinbin0 -> 3492 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltarbin0 -> 3052 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernseybin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinkibin0 -> 1900 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Manbin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbulbin0 -> 1947 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jerseybin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningradbin0 -> 1493 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kievbin0 -> 2088 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirovbin0 -> 1153 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbonbin0 -> 3469 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljanabin0 -> 1920 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Londonbin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourgbin0 -> 2946 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madridbin0 -> 2614 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Maltabin0 -> 2620 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamnbin0 -> 1900 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minskbin0 -> 1321 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monacobin0 -> 2944 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscowbin0 -> 1535 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosiabin0 -> 2002 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslobin0 -> 2228 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Parisbin0 -> 2962 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgoricabin0 -> 1920 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Praguebin0 -> 2301 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rigabin0 -> 2198 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Romebin0 -> 2641 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samarabin0 -> 1215 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marinobin0 -> 2641 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevobin0 -> 1920 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratovbin0 -> 1183 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopolbin0 -> 1453 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopjebin0 -> 1920 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofiabin0 -> 2077 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholmbin0 -> 1909 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinnbin0 -> 2148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiranebin0 -> 2084 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspolbin0 -> 2390 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovskbin0 -> 1267 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorodbin0 -> 2050 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduzbin0 -> 1909 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaticanbin0 -> 2641 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Viennabin0 -> 2200 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilniusbin0 -> 2162 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgogradbin0 -> 1165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsawbin0 -> 2654 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagrebbin0 -> 1920 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhyebin0 -> 2106 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurichbin0 -> 1909 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Factorybin0 -> 116 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GBbin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eirebin0 -> 3648 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMTbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0bin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0bin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0bin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwichbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/HSTbin0 -> 115 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkongbin0 -> 1203 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Icelandbin0 -> 1162 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivobin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagosbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmasbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocosbin0 -> 174 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comorobin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelenbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahebin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldivesbin0 -> 199 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritiusbin0 -> 241 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayottebin0 -> 251 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunionbin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iranbin0 -> 2582 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Israelbin0 -> 2288 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaicabin0 -> 482 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Japanbin0 -> 309 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajaleinbin0 -> 316 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Libyabin0 -> 625 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/METbin0 -> 2094 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MSTbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNortebin0 -> 2342 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSurbin0 -> 1526 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/Generalbin0 -> 1584 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZbin0 -> 2437 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHATbin0 -> 2068 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajobin0 -> 2444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PRCbin0 -> 533 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apiabin0 -> 1097 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Aucklandbin0 -> 2437 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainvillebin0 -> 268 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chathambin0 -> 2068 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuukbin0 -> 269 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easterbin0 -> 2233 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efatebin0 -> 466 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderburybin0 -> 234 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofobin0 -> 200 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fijibin0 -> 1077 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafutibin0 -> 166 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagosbin0 -> 238 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambierbin0 -> 164 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanalbin0 -> 166 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guambin0 -> 494 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulubin0 -> 329 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnstonbin0 -> 329 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimatibin0 -> 238 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosraebin0 -> 351 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajaleinbin0 -> 316 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majurobin0 -> 310 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesasbin0 -> 173 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midwaybin0 -> 175 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Naurubin0 -> 252 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niuebin0 -> 241 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolkbin0 -> 880 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumeabin0 -> 304 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pagobin0 -> 175 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palaubin0 -> 180 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairnbin0 -> 202 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpeibin0 -> 303 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponapebin0 -> 303 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresbybin0 -> 186 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotongabin0 -> 577 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipanbin0 -> 494 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoabin0 -> 175 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahitibin0 -> 165 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawabin0 -> 166 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapubin0 -> 372 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Trukbin0 -> 269 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wakebin0 -> 166 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallisbin0 -> 166 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yapbin0 -> 269 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Polandbin0 -> 2654 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugalbin0 -> 3469 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROCbin0 -> 761 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROKbin0 -> 617 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Singaporebin0 -> 383 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkeybin0 -> 1947 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UCTbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaskabin0 -> 2371 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutianbin0 -> 2356 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizonabin0 -> 328 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Centralbin0 -> 3576 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indianabin0 -> 1666 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Easternbin0 -> 3536 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaiibin0 -> 329 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starkebin0 -> 2428 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michiganbin0 -> 2230 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountainbin0 -> 2444 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacificbin0 -> 2836 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoabin0 -> 175 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UTCbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Universalbin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SUbin0 -> 1535 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/WETbin0 -> 1905 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulubin0 -> 114 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab274
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/localtimebin0 -> 148 bytes
-rw-r--r--third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab384
-rw-r--r--third_party/abseil-cpp/absl/time/internal/get_current_time_chrono.inc31
-rw-r--r--third_party/abseil-cpp/absl/time/internal/get_current_time_posix.inc24
-rw-r--r--third_party/abseil-cpp/absl/time/internal/test_util.cc130
-rw-r--r--third_party/abseil-cpp/absl/time/internal/test_util.h33
-rw-r--r--third_party/abseil-cpp/absl/time/internal/zoneinfo.inc729
629 files changed, 11988 insertions, 0 deletions
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/BUILD.bazel b/third_party/abseil-cpp/absl/time/internal/cctz/BUILD.bazel
new file mode 100644
index 0000000000..7a53c815b9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/BUILD.bazel
@@ -0,0 +1,166 @@
+# Copyright 2016 Google Inc. All Rights Reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# https://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+load("@rules_cc//cc:defs.bzl", "cc_library", "cc_test")
+
+package(features = ["-parse_headers"])
+
+licenses(["notice"]) # Apache License
+
+filegroup(
+ name = "zoneinfo",
+ srcs = glob(["testdata/zoneinfo/**"]),
+)
+
+config_setting(
+ name = "osx",
+ constraint_values = [
+ "@bazel_tools//platforms:osx",
+ ],
+)
+
+config_setting(
+ name = "ios",
+ constraint_values = [
+ "@bazel_tools//platforms:ios",
+ ],
+)
+
+### libraries
+
+cc_library(
+ name = "civil_time",
+ srcs = ["src/civil_time_detail.cc"],
+ hdrs = [
+ "include/cctz/civil_time.h",
+ ],
+ textual_hdrs = ["include/cctz/civil_time_detail.h"],
+ visibility = ["//visibility:public"],
+ deps = ["//absl/base:config"],
+)
+
+cc_library(
+ name = "time_zone",
+ srcs = [
+ "src/time_zone_fixed.cc",
+ "src/time_zone_fixed.h",
+ "src/time_zone_format.cc",
+ "src/time_zone_if.cc",
+ "src/time_zone_if.h",
+ "src/time_zone_impl.cc",
+ "src/time_zone_impl.h",
+ "src/time_zone_info.cc",
+ "src/time_zone_info.h",
+ "src/time_zone_libc.cc",
+ "src/time_zone_libc.h",
+ "src/time_zone_lookup.cc",
+ "src/time_zone_posix.cc",
+ "src/time_zone_posix.h",
+ "src/tzfile.h",
+ "src/zone_info_source.cc",
+ ],
+ hdrs = [
+ "include/cctz/time_zone.h",
+ "include/cctz/zone_info_source.h",
+ ],
+ linkopts = select({
+ ":osx": [
+ "-framework Foundation",
+ ],
+ ":ios": [
+ "-framework Foundation",
+ ],
+ "//conditions:default": [],
+ }),
+ visibility = ["//visibility:public"],
+ deps = [
+ ":civil_time",
+ "//absl/base:config",
+ ],
+)
+
+### tests
+
+cc_test(
+ name = "civil_time_test",
+ size = "small",
+ srcs = ["src/civil_time_test.cc"],
+ deps = [
+ ":civil_time",
+ "//absl/base:config",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "time_zone_format_test",
+ size = "small",
+ srcs = ["src/time_zone_format_test.cc"],
+ data = [":zoneinfo"],
+ tags = [
+ "no_test_android_arm",
+ "no_test_android_arm64",
+ "no_test_android_x86",
+ ],
+ deps = [
+ ":civil_time",
+ ":time_zone",
+ "//absl/base:config",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "time_zone_lookup_test",
+ size = "small",
+ timeout = "moderate",
+ srcs = ["src/time_zone_lookup_test.cc"],
+ data = [":zoneinfo"],
+ tags = [
+ "no_test_android_arm",
+ "no_test_android_arm64",
+ "no_test_android_x86",
+ ],
+ deps = [
+ ":civil_time",
+ ":time_zone",
+ "//absl/base:config",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+### benchmarks
+
+cc_test(
+ name = "cctz_benchmark",
+ srcs = [
+ "src/cctz_benchmark.cc",
+ "src/time_zone_if.h",
+ "src/time_zone_impl.h",
+ "src/time_zone_info.h",
+ "src/tzfile.h",
+ ],
+ linkstatic = 1,
+ tags = ["benchmark"],
+ deps = [
+ ":civil_time",
+ ":time_zone",
+ "//absl/base:config",
+ "@com_github_google_benchmark//:benchmark_main",
+ ],
+)
+
+### examples
+
+### binaries
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time.h b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time.h
new file mode 100644
index 0000000000..d47ff86fe4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time.h
@@ -0,0 +1,332 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
+#define ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time_detail.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// The term "civil time" refers to the legally recognized human-scale time
+// that is represented by the six fields YYYY-MM-DD hh:mm:ss. Modern-day civil
+// time follows the Gregorian Calendar and is a time-zone-independent concept.
+// A "date" is perhaps the most common example of a civil time (represented in
+// this library as cctz::civil_day). This library provides six classes and a
+// handful of functions that help with rounding, iterating, and arithmetic on
+// civil times while avoiding complications like daylight-saving time (DST).
+//
+// The following six classes form the core of this civil-time library:
+//
+// * civil_second
+// * civil_minute
+// * civil_hour
+// * civil_day
+// * civil_month
+// * civil_year
+//
+// Each class is a simple value type with the same interface for construction
+// and the same six accessors for each of the civil fields (year, month, day,
+// hour, minute, and second, aka YMDHMS). These classes differ only in their
+// alignment, which is indicated by the type name and specifies the field on
+// which arithmetic operates.
+//
+// Each class can be constructed by passing up to six optional integer
+// arguments representing the YMDHMS fields (in that order) to the
+// constructor. Omitted fields are assigned their minimum valid value. Hours,
+// minutes, and seconds will be set to 0, month and day will be set to 1, and
+// since there is no minimum valid year, it will be set to 1970. So, a
+// default-constructed civil-time object will have YMDHMS fields representing
+// "1970-01-01 00:00:00". Fields that are out-of-range are normalized (e.g.,
+// October 32 -> November 1) so that all civil-time objects represent valid
+// values.
+//
+// Each civil-time class is aligned to the civil-time field indicated in the
+// class's name after normalization. Alignment is performed by setting all the
+// inferior fields to their minimum valid value (as described above). The
+// following are examples of how each of the six types would align the fields
+// representing November 22, 2015 at 12:34:56 in the afternoon. (Note: the
+// string format used here is not important; it's just a shorthand way of
+// showing the six YMDHMS fields.)
+//
+// civil_second 2015-11-22 12:34:56
+// civil_minute 2015-11-22 12:34:00
+// civil_hour 2015-11-22 12:00:00
+// civil_day 2015-11-22 00:00:00
+// civil_month 2015-11-01 00:00:00
+// civil_year 2015-01-01 00:00:00
+//
+// Each civil-time type performs arithmetic on the field to which it is
+// aligned. This means that adding 1 to a civil_day increments the day field
+// (normalizing as necessary), and subtracting 7 from a civil_month operates
+// on the month field (normalizing as necessary). All arithmetic produces a
+// valid civil time. Difference requires two similarly aligned civil-time
+// objects and returns the scalar answer in units of the objects' alignment.
+// For example, the difference between two civil_hour objects will give an
+// answer in units of civil hours.
+//
+// In addition to the six civil-time types just described, there are
+// a handful of helper functions and algorithms for performing common
+// calculations. These are described below.
+//
+// Note: In C++14 and later, this library is usable in a constexpr context.
+//
+// CONSTRUCTION:
+//
+// Each of the civil-time types can be constructed in two ways: by directly
+// passing to the constructor up to six (optional) integers representing the
+// YMDHMS fields, or by copying the YMDHMS fields from a differently aligned
+// civil-time type.
+//
+// civil_day default_value; // 1970-01-01 00:00:00
+//
+// civil_day a(2015, 2, 3); // 2015-02-03 00:00:00
+// civil_day b(2015, 2, 3, 4, 5, 6); // 2015-02-03 00:00:00
+// civil_day c(2015); // 2015-01-01 00:00:00
+//
+// civil_second ss(2015, 2, 3, 4, 5, 6); // 2015-02-03 04:05:06
+// civil_minute mm(ss); // 2015-02-03 04:05:00
+// civil_hour hh(mm); // 2015-02-03 04:00:00
+// civil_day d(hh); // 2015-02-03 00:00:00
+// civil_month m(d); // 2015-02-01 00:00:00
+// civil_year y(m); // 2015-01-01 00:00:00
+//
+// m = civil_month(y); // 2015-01-01 00:00:00
+// d = civil_day(m); // 2015-01-01 00:00:00
+// hh = civil_hour(d); // 2015-01-01 00:00:00
+// mm = civil_minute(hh); // 2015-01-01 00:00:00
+// ss = civil_second(mm); // 2015-01-01 00:00:00
+//
+// ALIGNMENT CONVERSION:
+//
+// The alignment of a civil-time object cannot change, but the object may be
+// used to construct a new object with a different alignment. This is referred
+// to as "realigning". When realigning to a type with the same or more
+// precision (e.g., civil_day -> civil_second), the conversion may be
+// performed implicitly since no information is lost. However, if information
+// could be discarded (e.g., civil_second -> civil_day), the conversion must
+// be explicit at the call site.
+//
+// void fun(const civil_day& day);
+//
+// civil_second cs;
+// fun(cs); // Won't compile because data may be discarded
+// fun(civil_day(cs)); // OK: explicit conversion
+//
+// civil_day cd;
+// fun(cd); // OK: no conversion needed
+//
+// civil_month cm;
+// fun(cm); // OK: implicit conversion to civil_day
+//
+// NORMALIZATION:
+//
+// Integer arguments passed to the constructor may be out-of-range, in which
+// case they are normalized to produce a valid civil-time object. This enables
+// natural arithmetic on constructor arguments without worrying about the
+// field's range. Normalization guarantees that there are no invalid
+// civil-time objects.
+//
+// civil_day d(2016, 10, 32); // Out-of-range day; normalized to 2016-11-01
+//
+// Note: If normalization is undesired, you can signal an error by comparing
+// the constructor arguments to the normalized values returned by the YMDHMS
+// properties.
+//
+// PROPERTIES:
+//
+// All civil-time types have accessors for all six of the civil-time fields:
+// year, month, day, hour, minute, and second. Recall that fields inferior to
+// the type's alignment will be set to their minimum valid value.
+//
+// civil_day d(2015, 6, 28);
+// // d.year() == 2015
+// // d.month() == 6
+// // d.day() == 28
+// // d.hour() == 0
+// // d.minute() == 0
+// // d.second() == 0
+//
+// COMPARISON:
+//
+// Comparison always considers all six YMDHMS fields, regardless of the type's
+// alignment. Comparison between differently aligned civil-time types is
+// allowed.
+//
+// civil_day feb_3(2015, 2, 3); // 2015-02-03 00:00:00
+// civil_day mar_4(2015, 3, 4); // 2015-03-04 00:00:00
+// // feb_3 < mar_4
+// // civil_year(feb_3) == civil_year(mar_4)
+//
+// civil_second feb_3_noon(2015, 2, 3, 12, 0, 0); // 2015-02-03 12:00:00
+// // feb_3 < feb_3_noon
+// // feb_3 == civil_day(feb_3_noon)
+//
+// // Iterates all the days of February 2015.
+// for (civil_day d(2015, 2, 1); d < civil_month(2015, 3); ++d) {
+// // ...
+// }
+//
+// STREAMING:
+//
+// Each civil-time type may be sent to an output stream using operator<<().
+// The output format follows the pattern "YYYY-MM-DDThh:mm:ss" where fields
+// inferior to the type's alignment are omitted.
+//
+// civil_second cs(2015, 2, 3, 4, 5, 6);
+// std::cout << cs << "\n"; // Outputs: 2015-02-03T04:05:06
+//
+// civil_day cd(cs);
+// std::cout << cd << "\n"; // Outputs: 2015-02-03
+//
+// civil_year cy(cs);
+// std::cout << cy << "\n"; // Outputs: 2015
+//
+// ARITHMETIC:
+//
+// Civil-time types support natural arithmetic operators such as addition,
+// subtraction, and difference. Arithmetic operates on the civil-time field
+// indicated in the type's name. Difference requires arguments with the same
+// alignment and returns the answer in units of the alignment.
+//
+// civil_day a(2015, 2, 3);
+// ++a; // 2015-02-04 00:00:00
+// --a; // 2015-02-03 00:00:00
+// civil_day b = a + 1; // 2015-02-04 00:00:00
+// civil_day c = 1 + b; // 2015-02-05 00:00:00
+// int n = c - a; // n = 2 (civil days)
+// int m = c - civil_month(c); // Won't compile: different types.
+//
+// EXAMPLE: Adding a month to January 31.
+//
+// One of the classic questions that arises when considering a civil-time
+// library (or a date library or a date/time library) is this: "What happens
+// when you add a month to January 31?" This is an interesting question
+// because there could be a number of possible answers:
+//
+// 1. March 3 (or 2 if a leap year). This may make sense if the operation
+// wants the equivalent of February 31.
+// 2. February 28 (or 29 if a leap year). This may make sense if the operation
+// wants the last day of January to go to the last day of February.
+// 3. Error. The caller may get some error, an exception, an invalid date
+// object, or maybe false is returned. This may make sense because there is
+// no single unambiguously correct answer to the question.
+//
+// Practically speaking, any answer that is not what the programmer intended
+// is the wrong answer.
+//
+// This civil-time library avoids the problem by making it impossible to ask
+// ambiguous questions. All civil-time objects are aligned to a particular
+// civil-field boundary (such as aligned to a year, month, day, hour, minute,
+// or second), and arithmetic operates on the field to which the object is
+// aligned. This means that in order to "add a month" the object must first be
+// aligned to a month boundary, which is equivalent to the first day of that
+// month.
+//
+// Of course, there are ways to compute an answer the question at hand using
+// this civil-time library, but they require the programmer to be explicit
+// about the answer they expect. To illustrate, let's see how to compute all
+// three of the above possible answers to the question of "Jan 31 plus 1
+// month":
+//
+// const civil_day d(2015, 1, 31);
+//
+// // Answer 1:
+// // Add 1 to the month field in the constructor, and rely on normalization.
+// const auto ans_normalized = civil_day(d.year(), d.month() + 1, d.day());
+// // ans_normalized == 2015-03-03 (aka Feb 31)
+//
+// // Answer 2:
+// // Add 1 to month field, capping to the end of next month.
+// const auto next_month = civil_month(d) + 1;
+// const auto last_day_of_next_month = civil_day(next_month + 1) - 1;
+// const auto ans_capped = std::min(ans_normalized, last_day_of_next_month);
+// // ans_capped == 2015-02-28
+//
+// // Answer 3:
+// // Signal an error if the normalized answer is not in next month.
+// if (civil_month(ans_normalized) != next_month) {
+// // error, month overflow
+// }
+//
+using civil_year = detail::civil_year;
+using civil_month = detail::civil_month;
+using civil_day = detail::civil_day;
+using civil_hour = detail::civil_hour;
+using civil_minute = detail::civil_minute;
+using civil_second = detail::civil_second;
+
+// An enum class with members monday, tuesday, wednesday, thursday, friday,
+// saturday, and sunday. These enum values may be sent to an output stream
+// using operator<<(). The result is the full weekday name in English with a
+// leading capital letter.
+//
+// weekday wd = weekday::thursday;
+// std::cout << wd << "\n"; // Outputs: Thursday
+//
+using detail::weekday;
+
+// Returns the weekday for the given civil-time value.
+//
+// civil_day a(2015, 8, 13);
+// weekday wd = get_weekday(a); // wd == weekday::thursday
+//
+using detail::get_weekday;
+
+// Returns the civil_day that strictly follows or precedes the given
+// civil_day, and that falls on the given weekday.
+//
+// For example, given:
+//
+// August 2015
+// Su Mo Tu We Th Fr Sa
+// 1
+// 2 3 4 5 6 7 8
+// 9 10 11 12 13 14 15
+// 16 17 18 19 20 21 22
+// 23 24 25 26 27 28 29
+// 30 31
+//
+// civil_day a(2015, 8, 13); // get_weekday(a) == weekday::thursday
+// civil_day b = next_weekday(a, weekday::thursday); // b = 2015-08-20
+// civil_day c = prev_weekday(a, weekday::thursday); // c = 2015-08-06
+//
+// civil_day d = ...
+// // Gets the following Thursday if d is not already Thursday
+// civil_day thurs1 = next_weekday(d - 1, weekday::thursday);
+// // Gets the previous Thursday if d is not already Thursday
+// civil_day thurs2 = prev_weekday(d + 1, weekday::thursday);
+//
+using detail::next_weekday;
+using detail::prev_weekday;
+
+// Returns the day-of-year for the given civil-time value.
+//
+// civil_day a(2015, 1, 1);
+// int yd_jan_1 = get_yearday(a); // yd_jan_1 = 1
+// civil_day b(2015, 12, 31);
+// int yd_dec_31 = get_yearday(b); // yd_dec_31 = 365
+//
+using detail::get_yearday;
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h
new file mode 100644
index 0000000000..4cde96f1aa
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h
@@ -0,0 +1,622 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
+#define ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
+
+#include <cstdint>
+#include <limits>
+#include <ostream>
+#include <type_traits>
+
+#include "absl/base/config.h"
+
+// Disable constexpr support unless we are in C++14 mode.
+#if __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+#define CONSTEXPR_D constexpr // data
+#define CONSTEXPR_F constexpr // function
+#define CONSTEXPR_M constexpr // member
+#else
+#define CONSTEXPR_D const
+#define CONSTEXPR_F inline
+#define CONSTEXPR_M
+#endif
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Support years that at least span the range of 64-bit time_t values.
+using year_t = std::int_fast64_t;
+
+// Type alias that indicates an argument is not normalized (e.g., the
+// constructor parameters and operands/results of addition/subtraction).
+using diff_t = std::int_fast64_t;
+
+namespace detail {
+
+// Type aliases that indicate normalized argument values.
+using month_t = std::int_fast8_t; // [1:12]
+using day_t = std::int_fast8_t; // [1:31]
+using hour_t = std::int_fast8_t; // [0:23]
+using minute_t = std::int_fast8_t; // [0:59]
+using second_t = std::int_fast8_t; // [0:59]
+
+// Normalized civil-time fields: Y-M-D HH:MM:SS.
+struct fields {
+ CONSTEXPR_M fields(year_t year, month_t month, day_t day, hour_t hour,
+ minute_t minute, second_t second)
+ : y(year), m(month), d(day), hh(hour), mm(minute), ss(second) {}
+ std::int_least64_t y;
+ std::int_least8_t m;
+ std::int_least8_t d;
+ std::int_least8_t hh;
+ std::int_least8_t mm;
+ std::int_least8_t ss;
+};
+
+struct second_tag {};
+struct minute_tag : second_tag {};
+struct hour_tag : minute_tag {};
+struct day_tag : hour_tag {};
+struct month_tag : day_tag {};
+struct year_tag : month_tag {};
+
+////////////////////////////////////////////////////////////////////////
+
+// Field normalization (without avoidable overflow).
+
+namespace impl {
+
+CONSTEXPR_F bool is_leap_year(year_t y) noexcept {
+ return y % 4 == 0 && (y % 100 != 0 || y % 400 == 0);
+}
+CONSTEXPR_F int year_index(year_t y, month_t m) noexcept {
+ return (static_cast<int>((y + (m > 2)) % 400) + 400) % 400;
+}
+CONSTEXPR_F int days_per_century(year_t y, month_t m) noexcept {
+ const int yi = year_index(y, m);
+ return 36524 + (yi == 0 || yi > 300);
+}
+CONSTEXPR_F int days_per_4years(year_t y, month_t m) noexcept {
+ const int yi = year_index(y, m);
+ return 1460 + (yi == 0 || yi > 300 || (yi - 1) % 100 < 96);
+}
+CONSTEXPR_F int days_per_year(year_t y, month_t m) noexcept {
+ return is_leap_year(y + (m > 2)) ? 366 : 365;
+}
+CONSTEXPR_F int days_per_month(year_t y, month_t m) noexcept {
+ CONSTEXPR_D int k_days_per_month[1 + 12] = {
+ -1, 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 // non leap year
+ };
+ return k_days_per_month[m] + (m == 2 && is_leap_year(y));
+}
+
+CONSTEXPR_F fields n_day(year_t y, month_t m, diff_t d, diff_t cd, hour_t hh,
+ minute_t mm, second_t ss) noexcept {
+ y += (cd / 146097) * 400;
+ cd %= 146097;
+ if (cd < 0) {
+ y -= 400;
+ cd += 146097;
+ }
+ y += (d / 146097) * 400;
+ d = d % 146097 + cd;
+ if (d > 0) {
+ if (d > 146097) {
+ y += 400;
+ d -= 146097;
+ }
+ } else {
+ if (d > -365) {
+ // We often hit the previous year when stepping a civil time backwards,
+ // so special case it to avoid counting up by 100/4/1-year chunks.
+ y -= 1;
+ d += days_per_year(y, m);
+ } else {
+ y -= 400;
+ d += 146097;
+ }
+ }
+ if (d > 365) {
+ for (int n = days_per_century(y, m); d > n; n = days_per_century(y, m)) {
+ d -= n;
+ y += 100;
+ }
+ for (int n = days_per_4years(y, m); d > n; n = days_per_4years(y, m)) {
+ d -= n;
+ y += 4;
+ }
+ for (int n = days_per_year(y, m); d > n; n = days_per_year(y, m)) {
+ d -= n;
+ ++y;
+ }
+ }
+ if (d > 28) {
+ for (int n = days_per_month(y, m); d > n; n = days_per_month(y, m)) {
+ d -= n;
+ if (++m > 12) {
+ ++y;
+ m = 1;
+ }
+ }
+ }
+ return fields(y, m, static_cast<day_t>(d), hh, mm, ss);
+}
+CONSTEXPR_F fields n_mon(year_t y, diff_t m, diff_t d, diff_t cd, hour_t hh,
+ minute_t mm, second_t ss) noexcept {
+ if (m != 12) {
+ y += m / 12;
+ m %= 12;
+ if (m <= 0) {
+ y -= 1;
+ m += 12;
+ }
+ }
+ return n_day(y, static_cast<month_t>(m), d, cd, hh, mm, ss);
+}
+CONSTEXPR_F fields n_hour(year_t y, diff_t m, diff_t d, diff_t cd, diff_t hh,
+ minute_t mm, second_t ss) noexcept {
+ cd += hh / 24;
+ hh %= 24;
+ if (hh < 0) {
+ cd -= 1;
+ hh += 24;
+ }
+ return n_mon(y, m, d, cd, static_cast<hour_t>(hh), mm, ss);
+}
+CONSTEXPR_F fields n_min(year_t y, diff_t m, diff_t d, diff_t hh, diff_t ch,
+ diff_t mm, second_t ss) noexcept {
+ ch += mm / 60;
+ mm %= 60;
+ if (mm < 0) {
+ ch -= 1;
+ mm += 60;
+ }
+ return n_hour(y, m, d, hh / 24 + ch / 24, hh % 24 + ch % 24,
+ static_cast<minute_t>(mm), ss);
+}
+CONSTEXPR_F fields n_sec(year_t y, diff_t m, diff_t d, diff_t hh, diff_t mm,
+ diff_t ss) noexcept {
+ // Optimization for when (non-constexpr) fields are already normalized.
+ if (0 <= ss && ss < 60) {
+ const second_t nss = static_cast<second_t>(ss);
+ if (0 <= mm && mm < 60) {
+ const minute_t nmm = static_cast<minute_t>(mm);
+ if (0 <= hh && hh < 24) {
+ const hour_t nhh = static_cast<hour_t>(hh);
+ if (1 <= d && d <= 28 && 1 <= m && m <= 12) {
+ const day_t nd = static_cast<day_t>(d);
+ const month_t nm = static_cast<month_t>(m);
+ return fields(y, nm, nd, nhh, nmm, nss);
+ }
+ return n_mon(y, m, d, 0, nhh, nmm, nss);
+ }
+ return n_hour(y, m, d, hh / 24, hh % 24, nmm, nss);
+ }
+ return n_min(y, m, d, hh, mm / 60, mm % 60, nss);
+ }
+ diff_t cm = ss / 60;
+ ss %= 60;
+ if (ss < 0) {
+ cm -= 1;
+ ss += 60;
+ }
+ return n_min(y, m, d, hh, mm / 60 + cm / 60, mm % 60 + cm % 60,
+ static_cast<second_t>(ss));
+}
+
+} // namespace impl
+
+////////////////////////////////////////////////////////////////////////
+
+// Increments the indicated (normalized) field by "n".
+CONSTEXPR_F fields step(second_tag, fields f, diff_t n) noexcept {
+ return impl::n_sec(f.y, f.m, f.d, f.hh, f.mm + n / 60, f.ss + n % 60);
+}
+CONSTEXPR_F fields step(minute_tag, fields f, diff_t n) noexcept {
+ return impl::n_min(f.y, f.m, f.d, f.hh + n / 60, 0, f.mm + n % 60, f.ss);
+}
+CONSTEXPR_F fields step(hour_tag, fields f, diff_t n) noexcept {
+ return impl::n_hour(f.y, f.m, f.d + n / 24, 0, f.hh + n % 24, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(day_tag, fields f, diff_t n) noexcept {
+ return impl::n_day(f.y, f.m, f.d, n, f.hh, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(month_tag, fields f, diff_t n) noexcept {
+ return impl::n_mon(f.y + n / 12, f.m + n % 12, f.d, 0, f.hh, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(year_tag, fields f, diff_t n) noexcept {
+ return fields(f.y + n, f.m, f.d, f.hh, f.mm, f.ss);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+namespace impl {
+
+// Returns (v * f + a) but avoiding intermediate overflow when possible.
+CONSTEXPR_F diff_t scale_add(diff_t v, diff_t f, diff_t a) noexcept {
+ return (v < 0) ? ((v + 1) * f + a) - f : ((v - 1) * f + a) + f;
+}
+
+// Map a (normalized) Y/M/D to the number of days before/after 1970-01-01.
+// Probably overflows for years outside [-292277022656:292277026595].
+CONSTEXPR_F diff_t ymd_ord(year_t y, month_t m, day_t d) noexcept {
+ const diff_t eyear = (m <= 2) ? y - 1 : y;
+ const diff_t era = (eyear >= 0 ? eyear : eyear - 399) / 400;
+ const diff_t yoe = eyear - era * 400;
+ const diff_t doy = (153 * (m + (m > 2 ? -3 : 9)) + 2) / 5 + d - 1;
+ const diff_t doe = yoe * 365 + yoe / 4 - yoe / 100 + doy;
+ return era * 146097 + doe - 719468;
+}
+
+// Returns the difference in days between two normalized Y-M-D tuples.
+// ymd_ord() will encounter integer overflow given extreme year values,
+// yet the difference between two such extreme values may actually be
+// small, so we take a little care to avoid overflow when possible by
+// exploiting the 146097-day cycle.
+CONSTEXPR_F diff_t day_difference(year_t y1, month_t m1, day_t d1, year_t y2,
+ month_t m2, day_t d2) noexcept {
+ const diff_t a_c4_off = y1 % 400;
+ const diff_t b_c4_off = y2 % 400;
+ diff_t c4_diff = (y1 - a_c4_off) - (y2 - b_c4_off);
+ diff_t delta = ymd_ord(a_c4_off, m1, d1) - ymd_ord(b_c4_off, m2, d2);
+ if (c4_diff > 0 && delta < 0) {
+ delta += 2 * 146097;
+ c4_diff -= 2 * 400;
+ } else if (c4_diff < 0 && delta > 0) {
+ delta -= 2 * 146097;
+ c4_diff += 2 * 400;
+ }
+ return (c4_diff / 400 * 146097) + delta;
+}
+
+} // namespace impl
+
+// Returns the difference between fields structs using the indicated unit.
+CONSTEXPR_F diff_t difference(year_tag, fields f1, fields f2) noexcept {
+ return f1.y - f2.y;
+}
+CONSTEXPR_F diff_t difference(month_tag, fields f1, fields f2) noexcept {
+ return impl::scale_add(difference(year_tag{}, f1, f2), 12, (f1.m - f2.m));
+}
+CONSTEXPR_F diff_t difference(day_tag, fields f1, fields f2) noexcept {
+ return impl::day_difference(f1.y, f1.m, f1.d, f2.y, f2.m, f2.d);
+}
+CONSTEXPR_F diff_t difference(hour_tag, fields f1, fields f2) noexcept {
+ return impl::scale_add(difference(day_tag{}, f1, f2), 24, (f1.hh - f2.hh));
+}
+CONSTEXPR_F diff_t difference(minute_tag, fields f1, fields f2) noexcept {
+ return impl::scale_add(difference(hour_tag{}, f1, f2), 60, (f1.mm - f2.mm));
+}
+CONSTEXPR_F diff_t difference(second_tag, fields f1, fields f2) noexcept {
+ return impl::scale_add(difference(minute_tag{}, f1, f2), 60, f1.ss - f2.ss);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+// Aligns the (normalized) fields struct to the indicated field.
+CONSTEXPR_F fields align(second_tag, fields f) noexcept { return f; }
+CONSTEXPR_F fields align(minute_tag, fields f) noexcept {
+ return fields{f.y, f.m, f.d, f.hh, f.mm, 0};
+}
+CONSTEXPR_F fields align(hour_tag, fields f) noexcept {
+ return fields{f.y, f.m, f.d, f.hh, 0, 0};
+}
+CONSTEXPR_F fields align(day_tag, fields f) noexcept {
+ return fields{f.y, f.m, f.d, 0, 0, 0};
+}
+CONSTEXPR_F fields align(month_tag, fields f) noexcept {
+ return fields{f.y, f.m, 1, 0, 0, 0};
+}
+CONSTEXPR_F fields align(year_tag, fields f) noexcept {
+ return fields{f.y, 1, 1, 0, 0, 0};
+}
+
+////////////////////////////////////////////////////////////////////////
+
+namespace impl {
+
+template <typename H>
+H AbslHashValueImpl(second_tag, H h, fields f) {
+ return H::combine(std::move(h), f.y, f.m, f.d, f.hh, f.mm, f.ss);
+}
+template <typename H>
+H AbslHashValueImpl(minute_tag, H h, fields f) {
+ return H::combine(std::move(h), f.y, f.m, f.d, f.hh, f.mm);
+}
+template <typename H>
+H AbslHashValueImpl(hour_tag, H h, fields f) {
+ return H::combine(std::move(h), f.y, f.m, f.d, f.hh);
+}
+template <typename H>
+H AbslHashValueImpl(day_tag, H h, fields f) {
+ return H::combine(std::move(h), f.y, f.m, f.d);
+}
+template <typename H>
+H AbslHashValueImpl(month_tag, H h, fields f) {
+ return H::combine(std::move(h), f.y, f.m);
+}
+template <typename H>
+H AbslHashValueImpl(year_tag, H h, fields f) {
+ return H::combine(std::move(h), f.y);
+}
+
+} // namespace impl
+
+////////////////////////////////////////////////////////////////////////
+
+template <typename T>
+class civil_time {
+ public:
+ explicit CONSTEXPR_M civil_time(year_t y, diff_t m = 1, diff_t d = 1,
+ diff_t hh = 0, diff_t mm = 0,
+ diff_t ss = 0) noexcept
+ : civil_time(impl::n_sec(y, m, d, hh, mm, ss)) {}
+
+ CONSTEXPR_M civil_time() noexcept : f_{1970, 1, 1, 0, 0, 0} {}
+ civil_time(const civil_time&) = default;
+ civil_time& operator=(const civil_time&) = default;
+
+ // Conversion between civil times of different alignment. Conversion to
+ // a more precise alignment is allowed implicitly (e.g., day -> hour),
+ // but conversion where information is discarded must be explicit
+ // (e.g., second -> minute).
+ template <typename U, typename S>
+ using preserves_data =
+ typename std::enable_if<std::is_base_of<U, S>::value>::type;
+ template <typename U>
+ CONSTEXPR_M civil_time(const civil_time<U>& ct,
+ preserves_data<T, U>* = nullptr) noexcept
+ : civil_time(ct.f_) {}
+ template <typename U>
+ explicit CONSTEXPR_M civil_time(const civil_time<U>& ct,
+ preserves_data<U, T>* = nullptr) noexcept
+ : civil_time(ct.f_) {}
+
+ // Factories for the maximum/minimum representable civil_time.
+ static CONSTEXPR_F civil_time(max)() {
+ const auto max_year = (std::numeric_limits<std::int_least64_t>::max)();
+ return civil_time(max_year, 12, 31, 23, 59, 59);
+ }
+ static CONSTEXPR_F civil_time(min)() {
+ const auto min_year = (std::numeric_limits<std::int_least64_t>::min)();
+ return civil_time(min_year, 1, 1, 0, 0, 0);
+ }
+
+ // Field accessors. Note: All but year() return an int.
+ CONSTEXPR_M year_t year() const noexcept { return f_.y; }
+ CONSTEXPR_M int month() const noexcept { return f_.m; }
+ CONSTEXPR_M int day() const noexcept { return f_.d; }
+ CONSTEXPR_M int hour() const noexcept { return f_.hh; }
+ CONSTEXPR_M int minute() const noexcept { return f_.mm; }
+ CONSTEXPR_M int second() const noexcept { return f_.ss; }
+
+ // Assigning arithmetic.
+ CONSTEXPR_M civil_time& operator+=(diff_t n) noexcept {
+ f_ = step(T{}, f_, n);
+ return *this;
+ }
+ CONSTEXPR_M civil_time& operator-=(diff_t n) noexcept {
+ if (n != (std::numeric_limits<diff_t>::min)()) {
+ f_ = step(T{}, f_, -n);
+ } else {
+ f_ = step(T{}, step(T{}, f_, -(n + 1)), 1);
+ }
+ return *this;
+ }
+ CONSTEXPR_M civil_time& operator++() noexcept { return *this += 1; }
+ CONSTEXPR_M civil_time operator++(int) noexcept {
+ const civil_time a = *this;
+ ++*this;
+ return a;
+ }
+ CONSTEXPR_M civil_time& operator--() noexcept { return *this -= 1; }
+ CONSTEXPR_M civil_time operator--(int) noexcept {
+ const civil_time a = *this;
+ --*this;
+ return a;
+ }
+
+ // Binary arithmetic operators.
+ friend CONSTEXPR_F civil_time operator+(civil_time a, diff_t n) noexcept {
+ return a += n;
+ }
+ friend CONSTEXPR_F civil_time operator+(diff_t n, civil_time a) noexcept {
+ return a += n;
+ }
+ friend CONSTEXPR_F civil_time operator-(civil_time a, diff_t n) noexcept {
+ return a -= n;
+ }
+ friend CONSTEXPR_F diff_t operator-(civil_time lhs, civil_time rhs) noexcept {
+ return difference(T{}, lhs.f_, rhs.f_);
+ }
+
+ template <typename H>
+ friend H AbslHashValue(H h, civil_time a) {
+ return impl::AbslHashValueImpl(T{}, std::move(h), a.f_);
+ }
+
+ private:
+ // All instantiations of this template are allowed to call the following
+ // private constructor and access the private fields member.
+ template <typename U>
+ friend class civil_time;
+
+ // The designated constructor that all others eventually call.
+ explicit CONSTEXPR_M civil_time(fields f) noexcept : f_(align(T{}, f)) {}
+
+ fields f_;
+};
+
+// Disallows difference between differently aligned types.
+// auto n = civil_day(...) - civil_hour(...); // would be confusing.
+template <typename T, typename U>
+CONSTEXPR_F diff_t operator-(civil_time<T>, civil_time<U>) = delete;
+
+using civil_year = civil_time<year_tag>;
+using civil_month = civil_time<month_tag>;
+using civil_day = civil_time<day_tag>;
+using civil_hour = civil_time<hour_tag>;
+using civil_minute = civil_time<minute_tag>;
+using civil_second = civil_time<second_tag>;
+
+////////////////////////////////////////////////////////////////////////
+
+// Relational operators that work with differently aligned objects.
+// Always compares all six fields.
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator<(const civil_time<T1>& lhs,
+ const civil_time<T2>& rhs) noexcept {
+ return (
+ lhs.year() < rhs.year() ||
+ (lhs.year() == rhs.year() &&
+ (lhs.month() < rhs.month() ||
+ (lhs.month() == rhs.month() &&
+ (lhs.day() < rhs.day() || (lhs.day() == rhs.day() &&
+ (lhs.hour() < rhs.hour() ||
+ (lhs.hour() == rhs.hour() &&
+ (lhs.minute() < rhs.minute() ||
+ (lhs.minute() == rhs.minute() &&
+ (lhs.second() < rhs.second())))))))))));
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator<=(const civil_time<T1>& lhs,
+ const civil_time<T2>& rhs) noexcept {
+ return !(rhs < lhs);
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator>=(const civil_time<T1>& lhs,
+ const civil_time<T2>& rhs) noexcept {
+ return !(lhs < rhs);
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator>(const civil_time<T1>& lhs,
+ const civil_time<T2>& rhs) noexcept {
+ return rhs < lhs;
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator==(const civil_time<T1>& lhs,
+ const civil_time<T2>& rhs) noexcept {
+ return lhs.year() == rhs.year() && lhs.month() == rhs.month() &&
+ lhs.day() == rhs.day() && lhs.hour() == rhs.hour() &&
+ lhs.minute() == rhs.minute() && lhs.second() == rhs.second();
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator!=(const civil_time<T1>& lhs,
+ const civil_time<T2>& rhs) noexcept {
+ return !(lhs == rhs);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+enum class weekday {
+ monday,
+ tuesday,
+ wednesday,
+ thursday,
+ friday,
+ saturday,
+ sunday,
+};
+
+CONSTEXPR_F weekday get_weekday(const civil_second& cs) noexcept {
+ CONSTEXPR_D weekday k_weekday_by_mon_off[13] = {
+ weekday::monday, weekday::tuesday, weekday::wednesday,
+ weekday::thursday, weekday::friday, weekday::saturday,
+ weekday::sunday, weekday::monday, weekday::tuesday,
+ weekday::wednesday, weekday::thursday, weekday::friday,
+ weekday::saturday,
+ };
+ CONSTEXPR_D int k_weekday_offsets[1 + 12] = {
+ -1, 0, 3, 2, 5, 0, 3, 5, 1, 4, 6, 2, 4,
+ };
+ year_t wd = 2400 + (cs.year() % 400) - (cs.month() < 3);
+ wd += wd / 4 - wd / 100 + wd / 400;
+ wd += k_weekday_offsets[cs.month()] + cs.day();
+ return k_weekday_by_mon_off[wd % 7 + 6];
+}
+
+////////////////////////////////////////////////////////////////////////
+
+CONSTEXPR_F civil_day next_weekday(civil_day cd, weekday wd) noexcept {
+ CONSTEXPR_D weekday k_weekdays_forw[14] = {
+ weekday::monday, weekday::tuesday, weekday::wednesday,
+ weekday::thursday, weekday::friday, weekday::saturday,
+ weekday::sunday, weekday::monday, weekday::tuesday,
+ weekday::wednesday, weekday::thursday, weekday::friday,
+ weekday::saturday, weekday::sunday,
+ };
+ weekday base = get_weekday(cd);
+ for (int i = 0;; ++i) {
+ if (base == k_weekdays_forw[i]) {
+ for (int j = i + 1;; ++j) {
+ if (wd == k_weekdays_forw[j]) {
+ return cd + (j - i);
+ }
+ }
+ }
+ }
+}
+
+CONSTEXPR_F civil_day prev_weekday(civil_day cd, weekday wd) noexcept {
+ CONSTEXPR_D weekday k_weekdays_back[14] = {
+ weekday::sunday, weekday::saturday, weekday::friday,
+ weekday::thursday, weekday::wednesday, weekday::tuesday,
+ weekday::monday, weekday::sunday, weekday::saturday,
+ weekday::friday, weekday::thursday, weekday::wednesday,
+ weekday::tuesday, weekday::monday,
+ };
+ weekday base = get_weekday(cd);
+ for (int i = 0;; ++i) {
+ if (base == k_weekdays_back[i]) {
+ for (int j = i + 1;; ++j) {
+ if (wd == k_weekdays_back[j]) {
+ return cd - (j - i);
+ }
+ }
+ }
+ }
+}
+
+CONSTEXPR_F int get_yearday(const civil_second& cs) noexcept {
+ CONSTEXPR_D int k_month_offsets[1 + 12] = {
+ -1, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334,
+ };
+ const int feb29 = (cs.month() > 2 && impl::is_leap_year(cs.year()));
+ return k_month_offsets[cs.month()] + feb29 + cs.day();
+}
+
+////////////////////////////////////////////////////////////////////////
+
+std::ostream& operator<<(std::ostream& os, const civil_year& y);
+std::ostream& operator<<(std::ostream& os, const civil_month& m);
+std::ostream& operator<<(std::ostream& os, const civil_day& d);
+std::ostream& operator<<(std::ostream& os, const civil_hour& h);
+std::ostream& operator<<(std::ostream& os, const civil_minute& m);
+std::ostream& operator<<(std::ostream& os, const civil_second& s);
+std::ostream& operator<<(std::ostream& os, weekday wd);
+
+} // namespace detail
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#undef CONSTEXPR_M
+#undef CONSTEXPR_F
+#undef CONSTEXPR_D
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/time_zone.h b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/time_zone.h
new file mode 100644
index 0000000000..d05147a17c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/time_zone.h
@@ -0,0 +1,384 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// A library for translating between absolute times (represented by
+// std::chrono::time_points of the std::chrono::system_clock) and civil
+// times (represented by cctz::civil_second) using the rules defined by
+// a time zone (cctz::time_zone).
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
+
+#include <chrono>
+#include <cstdint>
+#include <string>
+#include <utility>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Convenience aliases. Not intended as public API points.
+template <typename D>
+using time_point = std::chrono::time_point<std::chrono::system_clock, D>;
+using seconds = std::chrono::duration<std::int_fast64_t>;
+using sys_seconds = seconds; // Deprecated. Use cctz::seconds instead.
+
+namespace detail {
+template <typename D>
+inline std::pair<time_point<seconds>, D> split_seconds(
+ const time_point<D>& tp) {
+ auto sec = std::chrono::time_point_cast<seconds>(tp);
+ auto sub = tp - sec;
+ if (sub.count() < 0) {
+ sec -= seconds(1);
+ sub += seconds(1);
+ }
+ return {sec, std::chrono::duration_cast<D>(sub)};
+}
+inline std::pair<time_point<seconds>, seconds> split_seconds(
+ const time_point<seconds>& tp) {
+ return {tp, seconds::zero()};
+}
+} // namespace detail
+
+// cctz::time_zone is an opaque, small, value-type class representing a
+// geo-political region within which particular rules are used for mapping
+// between absolute and civil times. Time zones are named using the TZ
+// identifiers from the IANA Time Zone Database, such as "America/Los_Angeles"
+// or "Australia/Sydney". Time zones are created from factory functions such
+// as load_time_zone(). Note: strings like "PST" and "EDT" are not valid TZ
+// identifiers.
+//
+// Example:
+// cctz::time_zone utc = cctz::utc_time_zone();
+// cctz::time_zone pst = cctz::fixed_time_zone(std::chrono::hours(-8));
+// cctz::time_zone loc = cctz::local_time_zone();
+// cctz::time_zone lax;
+// if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+//
+// See also:
+// - http://www.iana.org/time-zones
+// - https://en.wikipedia.org/wiki/Zoneinfo
+class time_zone {
+ public:
+ time_zone() : time_zone(nullptr) {} // Equivalent to UTC
+ time_zone(const time_zone&) = default;
+ time_zone& operator=(const time_zone&) = default;
+
+ std::string name() const;
+
+ // An absolute_lookup represents the civil time (cctz::civil_second) within
+ // this time_zone at the given absolute time (time_point). There are
+ // additionally a few other fields that may be useful when working with
+ // older APIs, such as std::tm.
+ //
+ // Example:
+ // const cctz::time_zone tz = ...
+ // const auto tp = std::chrono::system_clock::now();
+ // const cctz::time_zone::absolute_lookup al = tz.lookup(tp);
+ struct absolute_lookup {
+ civil_second cs;
+ // Note: The following fields exist for backward compatibility with older
+ // APIs. Accessing these fields directly is a sign of imprudent logic in
+ // the calling code. Modern time-related code should only access this data
+ // indirectly by way of cctz::format().
+ int offset; // civil seconds east of UTC
+ bool is_dst; // is offset non-standard?
+ const char* abbr; // time-zone abbreviation (e.g., "PST")
+ };
+ absolute_lookup lookup(const time_point<seconds>& tp) const;
+ template <typename D>
+ absolute_lookup lookup(const time_point<D>& tp) const {
+ return lookup(detail::split_seconds(tp).first);
+ }
+
+ // A civil_lookup represents the absolute time(s) (time_point) that
+ // correspond to the given civil time (cctz::civil_second) within this
+ // time_zone. Usually the given civil time represents a unique instant
+ // in time, in which case the conversion is unambiguous. However,
+ // within this time zone, the given civil time may be skipped (e.g.,
+ // during a positive UTC offset shift), or repeated (e.g., during a
+ // negative UTC offset shift). To account for these possibilities,
+ // civil_lookup is richer than just a single time_point.
+ //
+ // In all cases the civil_lookup::kind enum will indicate the nature
+ // of the given civil-time argument, and the pre, trans, and post
+ // members will give the absolute time answers using the pre-transition
+ // offset, the transition point itself, and the post-transition offset,
+ // respectively (all three times are equal if kind == UNIQUE). If any
+ // of these three absolute times is outside the representable range of a
+ // time_point<seconds> the field is set to its maximum/minimum value.
+ //
+ // Example:
+ // cctz::time_zone lax;
+ // if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+ //
+ // // A unique civil time.
+ // auto jan01 = lax.lookup(cctz::civil_second(2011, 1, 1, 0, 0, 0));
+ // // jan01.kind == cctz::time_zone::civil_lookup::UNIQUE
+ // // jan01.pre is 2011/01/01 00:00:00 -0800
+ // // jan01.trans is 2011/01/01 00:00:00 -0800
+ // // jan01.post is 2011/01/01 00:00:00 -0800
+ //
+ // // A Spring DST transition, when there is a gap in civil time.
+ // auto mar13 = lax.lookup(cctz::civil_second(2011, 3, 13, 2, 15, 0));
+ // // mar13.kind == cctz::time_zone::civil_lookup::SKIPPED
+ // // mar13.pre is 2011/03/13 03:15:00 -0700
+ // // mar13.trans is 2011/03/13 03:00:00 -0700
+ // // mar13.post is 2011/03/13 01:15:00 -0800
+ //
+ // // A Fall DST transition, when civil times are repeated.
+ // auto nov06 = lax.lookup(cctz::civil_second(2011, 11, 6, 1, 15, 0));
+ // // nov06.kind == cctz::time_zone::civil_lookup::REPEATED
+ // // nov06.pre is 2011/11/06 01:15:00 -0700
+ // // nov06.trans is 2011/11/06 01:00:00 -0800
+ // // nov06.post is 2011/11/06 01:15:00 -0800
+ struct civil_lookup {
+ enum civil_kind {
+ UNIQUE, // the civil time was singular (pre == trans == post)
+ SKIPPED, // the civil time did not exist (pre >= trans > post)
+ REPEATED, // the civil time was ambiguous (pre < trans <= post)
+ } kind;
+ time_point<seconds> pre; // uses the pre-transition offset
+ time_point<seconds> trans; // instant of civil-offset change
+ time_point<seconds> post; // uses the post-transition offset
+ };
+ civil_lookup lookup(const civil_second& cs) const;
+
+ // Finds the time of the next/previous offset change in this time zone.
+ //
+ // By definition, next_transition(tp, &trans) returns false when tp has
+ // its maximum value, and prev_transition(tp, &trans) returns false
+ // when tp has its minimum value. If the zone has no transitions, the
+ // result will also be false no matter what the argument.
+ //
+ // Otherwise, when tp has its minimum value, next_transition(tp, &trans)
+ // returns true and sets trans to the first recorded transition. Chains
+ // of calls to next_transition()/prev_transition() will eventually return
+ // false, but it is unspecified exactly when next_transition(tp, &trans)
+ // jumps to false, or what time is set by prev_transition(tp, &trans) for
+ // a very distant tp.
+ //
+ // Note: Enumeration of time-zone transitions is for informational purposes
+ // only. Modern time-related code should not care about when offset changes
+ // occur.
+ //
+ // Example:
+ // cctz::time_zone nyc;
+ // if (!cctz::load_time_zone("America/New_York", &nyc)) { ... }
+ // const auto now = std::chrono::system_clock::now();
+ // auto tp = cctz::time_point<cctz::seconds>::min();
+ // cctz::time_zone::civil_transition trans;
+ // while (tp <= now && nyc.next_transition(tp, &trans)) {
+ // // transition: trans.from -> trans.to
+ // tp = nyc.lookup(trans.to).trans;
+ // }
+ struct civil_transition {
+ civil_second from; // the civil time we jump from
+ civil_second to; // the civil time we jump to
+ };
+ bool next_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const;
+ template <typename D>
+ bool next_transition(const time_point<D>& tp, civil_transition* trans) const {
+ return next_transition(detail::split_seconds(tp).first, trans);
+ }
+ bool prev_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const;
+ template <typename D>
+ bool prev_transition(const time_point<D>& tp, civil_transition* trans) const {
+ return prev_transition(detail::split_seconds(tp).first, trans);
+ }
+
+ // version() and description() provide additional information about the
+ // time zone. The content of each of the returned strings is unspecified,
+ // however, when the IANA Time Zone Database is the underlying data source
+ // the version() std::string will be in the familar form (e.g, "2018e") or
+ // empty when unavailable.
+ //
+ // Note: These functions are for informational or testing purposes only.
+ std::string version() const; // empty when unknown
+ std::string description() const;
+
+ // Relational operators.
+ friend bool operator==(time_zone lhs, time_zone rhs) {
+ return &lhs.effective_impl() == &rhs.effective_impl();
+ }
+ friend bool operator!=(time_zone lhs, time_zone rhs) { return !(lhs == rhs); }
+
+ template <typename H>
+ friend H AbslHashValue(H h, time_zone tz) {
+ return H::combine(std::move(h), &tz.effective_impl());
+ }
+
+ class Impl;
+
+ private:
+ explicit time_zone(const Impl* impl) : impl_(impl) {}
+ const Impl& effective_impl() const; // handles implicit UTC
+ const Impl* impl_;
+};
+
+// Loads the named time zone. May perform I/O on the initial load.
+// If the name is invalid, or some other kind of error occurs, returns
+// false and "*tz" is set to the UTC time zone.
+bool load_time_zone(const std::string& name, time_zone* tz);
+
+// Returns a time_zone representing UTC. Cannot fail.
+time_zone utc_time_zone();
+
+// Returns a time zone that is a fixed offset (seconds east) from UTC.
+// Note: If the absolute value of the offset is greater than 24 hours
+// you'll get UTC (i.e., zero offset) instead.
+time_zone fixed_time_zone(const seconds& offset);
+
+// Returns a time zone representing the local time zone. Falls back to UTC.
+// Note: local_time_zone.name() may only be something like "localtime".
+time_zone local_time_zone();
+
+// Returns the civil time (cctz::civil_second) within the given time zone at
+// the given absolute time (time_point). Since the additional fields provided
+// by the time_zone::absolute_lookup struct should rarely be needed in modern
+// code, this convert() function is simpler and should be preferred.
+template <typename D>
+inline civil_second convert(const time_point<D>& tp, const time_zone& tz) {
+ return tz.lookup(tp).cs;
+}
+
+// Returns the absolute time (time_point) that corresponds to the given civil
+// time within the given time zone. If the civil time is not unique (i.e., if
+// it was either repeated or non-existent), then the returned time_point is
+// the best estimate that preserves relative order. That is, this function
+// guarantees that if cs1 < cs2, then convert(cs1, tz) <= convert(cs2, tz).
+inline time_point<seconds> convert(const civil_second& cs,
+ const time_zone& tz) {
+ const time_zone::civil_lookup cl = tz.lookup(cs);
+ if (cl.kind == time_zone::civil_lookup::SKIPPED) return cl.trans;
+ return cl.pre;
+}
+
+namespace detail {
+using femtoseconds = std::chrono::duration<std::int_fast64_t, std::femto>;
+std::string format(const std::string&, const time_point<seconds>&,
+ const femtoseconds&, const time_zone&);
+bool parse(const std::string&, const std::string&, const time_zone&,
+ time_point<seconds>*, femtoseconds*, std::string* err = nullptr);
+} // namespace detail
+
+// Formats the given time_point in the given cctz::time_zone according to
+// the provided format string. Uses strftime()-like formatting options,
+// with the following extensions:
+//
+// - %Ez - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+// - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+// - %E#S - Seconds with # digits of fractional precision
+// - %E*S - Seconds with full fractional precision (a literal '*')
+// - %E#f - Fractional seconds with # digits of precision
+// - %E*f - Fractional seconds with full precision (a literal '*')
+// - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// Note that %E0S behaves like %S, and %E0f produces no characters. In
+// contrast %E*f always produces at least one digit, which may be '0'.
+//
+// Note that %Y produces as many characters as it takes to fully render the
+// year. A year outside of [-999:9999] when formatted with %E4Y will produce
+// more than four characters, just like %Y.
+//
+// Tip: Format strings should include the UTC offset (e.g., %z, %Ez, or %E*z)
+// so that the resulting string uniquely identifies an absolute time.
+//
+// Example:
+// cctz::time_zone lax;
+// if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+// auto tp = cctz::convert(cctz::civil_second(2013, 1, 2, 3, 4, 5), lax);
+// std::string f = cctz::format("%H:%M:%S", tp, lax); // "03:04:05"
+// f = cctz::format("%H:%M:%E3S", tp, lax); // "03:04:05.000"
+template <typename D>
+inline std::string format(const std::string& fmt, const time_point<D>& tp,
+ const time_zone& tz) {
+ const auto p = detail::split_seconds(tp);
+ const auto n = std::chrono::duration_cast<detail::femtoseconds>(p.second);
+ return detail::format(fmt, p.first, n, tz);
+}
+
+// Parses an input string according to the provided format string and
+// returns the corresponding time_point. Uses strftime()-like formatting
+// options, with the same extensions as cctz::format(), but with the
+// exceptions that %E#S is interpreted as %E*S, and %E#f as %E*f. %Ez
+// and %E*z also accept the same inputs.
+//
+// %Y consumes as many numeric characters as it can, so the matching data
+// should always be terminated with a non-numeric. %E4Y always consumes
+// exactly four characters, including any sign.
+//
+// Unspecified fields are taken from the default date and time of ...
+//
+// "1970-01-01 00:00:00.0 +0000"
+//
+// For example, parsing a string of "15:45" (%H:%M) will return a time_point
+// that represents "1970-01-01 15:45:00.0 +0000".
+//
+// Note that parse() returns time instants, so it makes most sense to parse
+// fully-specified date/time strings that include a UTC offset (%z, %Ez, or
+// %E*z).
+//
+// Note also that parse() only heeds the fields year, month, day, hour,
+// minute, (fractional) second, and UTC offset. Other fields, like weekday (%a
+// or %A), while parsed for syntactic validity, are ignored in the conversion.
+//
+// Date and time fields that are out-of-range will be treated as errors rather
+// than normalizing them like cctz::civil_second() would do. For example, it
+// is an error to parse the date "Oct 32, 2013" because 32 is out of range.
+//
+// A second of ":60" is normalized to ":00" of the following minute with
+// fractional seconds discarded. The following table shows how the given
+// seconds and subseconds will be parsed:
+//
+// "59.x" -> 59.x // exact
+// "60.x" -> 00.0 // normalized
+// "00.x" -> 00.x // exact
+//
+// Errors are indicated by returning false.
+//
+// Example:
+// const cctz::time_zone tz = ...
+// std::chrono::system_clock::time_point tp;
+// if (cctz::parse("%Y-%m-%d", "2015-10-09", tz, &tp)) {
+// ...
+// }
+template <typename D>
+inline bool parse(const std::string& fmt, const std::string& input,
+ const time_zone& tz, time_point<D>* tpp) {
+ time_point<seconds> sec;
+ detail::femtoseconds fs;
+ const bool b = detail::parse(fmt, input, tz, &sec, &fs);
+ if (b) {
+ // TODO: Return false if unrepresentable as a time_point<D>.
+ *tpp = std::chrono::time_point_cast<D>(sec);
+ *tpp += std::chrono::duration_cast<D>(fs);
+ }
+ return b;
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h
new file mode 100644
index 0000000000..912b44ba8f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h
@@ -0,0 +1,102 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
+#define ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
+
+#include <cstddef>
+#include <functional>
+#include <memory>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A stdio-like interface for providing zoneinfo data for a particular zone.
+class ZoneInfoSource {
+ public:
+ virtual ~ZoneInfoSource();
+
+ virtual std::size_t Read(void* ptr, std::size_t size) = 0; // like fread()
+ virtual int Skip(std::size_t offset) = 0; // like fseek()
+
+ // Until the zoneinfo data supports versioning information, we provide
+ // a way for a ZoneInfoSource to indicate it out-of-band. The default
+ // implementation returns an empty std::string.
+ virtual std::string Version() const;
+};
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz_extension {
+
+// A function-pointer type for a factory that returns a ZoneInfoSource
+// given the name of a time zone and a fallback factory. Returns null
+// when the data for the named zone cannot be found.
+using ZoneInfoSourceFactory =
+ std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource> (*)(
+ const std::string&,
+ const std::function<std::unique_ptr<
+ absl::time_internal::cctz::ZoneInfoSource>(const std::string&)>&);
+
+// The user can control the mapping of zone names to zoneinfo data by
+// providing a definition for cctz_extension::zone_info_source_factory.
+// For example, given functions my_factory() and my_other_factory() that
+// can return a ZoneInfoSource for a named zone, we could inject them into
+// cctz::load_time_zone() with:
+//
+// namespace cctz_extension {
+// namespace {
+// std::unique_ptr<cctz::ZoneInfoSource> CustomFactory(
+// const std::string& name,
+// const std::function<std::unique_ptr<cctz::ZoneInfoSource>(
+// const std::string& name)>& fallback_factory) {
+// if (auto zip = my_factory(name)) return zip;
+// if (auto zip = fallback_factory(name)) return zip;
+// if (auto zip = my_other_factory(name)) return zip;
+// return nullptr;
+// }
+// } // namespace
+// ZoneInfoSourceFactory zone_info_source_factory = CustomFactory;
+// } // namespace cctz_extension
+//
+// This might be used, say, to use zoneinfo data embedded in the program,
+// or read from a (possibly compressed) file archive, or both.
+//
+// cctz_extension::zone_info_source_factory() will be called:
+// (1) from the same thread as the cctz::load_time_zone() call,
+// (2) only once for any zone name, and
+// (3) serially (i.e., no concurrent execution).
+//
+// The fallback factory obtains zoneinfo data by reading files in ${TZDIR},
+// and it is used automatically when no zone_info_source_factory definition
+// is linked into the program.
+extern ZoneInfoSourceFactory zone_info_source_factory;
+
+} // namespace cctz_extension
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/cctz_benchmark.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/cctz_benchmark.cc
new file mode 100644
index 0000000000..d30a644e09
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/cctz_benchmark.cc
@@ -0,0 +1,1029 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <ctime>
+#include <random>
+#include <string>
+#include <vector>
+
+#include "benchmark/benchmark.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "time_zone_impl.h"
+
+namespace {
+
+namespace cctz = absl::time_internal::cctz;
+
+void BM_Difference_Days(benchmark::State& state) {
+ const cctz::civil_day c(2014, 8, 22);
+ const cctz::civil_day epoch(1970, 1, 1);
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(c - epoch);
+ }
+}
+BENCHMARK(BM_Difference_Days);
+
+void BM_Step_Days(benchmark::State& state) {
+ const cctz::civil_day kStart(2014, 8, 22);
+ cctz::civil_day c = kStart;
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(++c);
+ }
+}
+BENCHMARK(BM_Step_Days);
+
+void BM_GetWeekday(benchmark::State& state) {
+ const cctz::civil_day c(2014, 8, 22);
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::get_weekday(c));
+ }
+}
+BENCHMARK(BM_GetWeekday);
+
+void BM_NextWeekday(benchmark::State& state) {
+ const cctz::civil_day kStart(2014, 8, 22);
+ const cctz::civil_day kDays[7] = {
+ kStart + 0, kStart + 1, kStart + 2, kStart + 3,
+ kStart + 4, kStart + 5, kStart + 6,
+ };
+ const cctz::weekday kWeekdays[7] = {
+ cctz::weekday::monday, cctz::weekday::tuesday, cctz::weekday::wednesday,
+ cctz::weekday::thursday, cctz::weekday::friday, cctz::weekday::saturday,
+ cctz::weekday::sunday,
+ };
+ while (state.KeepRunningBatch(7 * 7)) {
+ for (const auto from : kDays) {
+ for (const auto to : kWeekdays) {
+ benchmark::DoNotOptimize(cctz::next_weekday(from, to));
+ }
+ }
+ }
+}
+BENCHMARK(BM_NextWeekday);
+
+void BM_PrevWeekday(benchmark::State& state) {
+ const cctz::civil_day kStart(2014, 8, 22);
+ const cctz::civil_day kDays[7] = {
+ kStart + 0, kStart + 1, kStart + 2, kStart + 3,
+ kStart + 4, kStart + 5, kStart + 6,
+ };
+ const cctz::weekday kWeekdays[7] = {
+ cctz::weekday::monday, cctz::weekday::tuesday, cctz::weekday::wednesday,
+ cctz::weekday::thursday, cctz::weekday::friday, cctz::weekday::saturday,
+ cctz::weekday::sunday,
+ };
+ while (state.KeepRunningBatch(7 * 7)) {
+ for (const auto from : kDays) {
+ for (const auto to : kWeekdays) {
+ benchmark::DoNotOptimize(cctz::prev_weekday(from, to));
+ }
+ }
+ }
+}
+BENCHMARK(BM_PrevWeekday);
+
+const char RFC3339_full[] = "%Y-%m-%dT%H:%M:%E*S%Ez";
+const char RFC3339_sec[] = "%Y-%m-%dT%H:%M:%S%Ez";
+
+const char RFC1123_full[] = "%a, %d %b %Y %H:%M:%S %z";
+const char RFC1123_no_wday[] = "%d %b %Y %H:%M:%S %z";
+
+// A list of known time-zone names.
+// TODO: Refactor with src/time_zone_lookup_test.cc.
+const char* const kTimeZoneNames[] = {"Africa/Abidjan",
+ "Africa/Accra",
+ "Africa/Addis_Ababa",
+ "Africa/Algiers",
+ "Africa/Asmara",
+ "Africa/Asmera",
+ "Africa/Bamako",
+ "Africa/Bangui",
+ "Africa/Banjul",
+ "Africa/Bissau",
+ "Africa/Blantyre",
+ "Africa/Brazzaville",
+ "Africa/Bujumbura",
+ "Africa/Cairo",
+ "Africa/Casablanca",
+ "Africa/Ceuta",
+ "Africa/Conakry",
+ "Africa/Dakar",
+ "Africa/Dar_es_Salaam",
+ "Africa/Djibouti",
+ "Africa/Douala",
+ "Africa/El_Aaiun",
+ "Africa/Freetown",
+ "Africa/Gaborone",
+ "Africa/Harare",
+ "Africa/Johannesburg",
+ "Africa/Juba",
+ "Africa/Kampala",
+ "Africa/Khartoum",
+ "Africa/Kigali",
+ "Africa/Kinshasa",
+ "Africa/Lagos",
+ "Africa/Libreville",
+ "Africa/Lome",
+ "Africa/Luanda",
+ "Africa/Lubumbashi",
+ "Africa/Lusaka",
+ "Africa/Malabo",
+ "Africa/Maputo",
+ "Africa/Maseru",
+ "Africa/Mbabane",
+ "Africa/Mogadishu",
+ "Africa/Monrovia",
+ "Africa/Nairobi",
+ "Africa/Ndjamena",
+ "Africa/Niamey",
+ "Africa/Nouakchott",
+ "Africa/Ouagadougou",
+ "Africa/Porto-Novo",
+ "Africa/Sao_Tome",
+ "Africa/Timbuktu",
+ "Africa/Tripoli",
+ "Africa/Tunis",
+ "Africa/Windhoek",
+ "America/Adak",
+ "America/Anchorage",
+ "America/Anguilla",
+ "America/Antigua",
+ "America/Araguaina",
+ "America/Argentina/Buenos_Aires",
+ "America/Argentina/Catamarca",
+ "America/Argentina/ComodRivadavia",
+ "America/Argentina/Cordoba",
+ "America/Argentina/Jujuy",
+ "America/Argentina/La_Rioja",
+ "America/Argentina/Mendoza",
+ "America/Argentina/Rio_Gallegos",
+ "America/Argentina/Salta",
+ "America/Argentina/San_Juan",
+ "America/Argentina/San_Luis",
+ "America/Argentina/Tucuman",
+ "America/Argentina/Ushuaia",
+ "America/Aruba",
+ "America/Asuncion",
+ "America/Atikokan",
+ "America/Atka",
+ "America/Bahia",
+ "America/Bahia_Banderas",
+ "America/Barbados",
+ "America/Belem",
+ "America/Belize",
+ "America/Blanc-Sablon",
+ "America/Boa_Vista",
+ "America/Bogota",
+ "America/Boise",
+ "America/Buenos_Aires",
+ "America/Cambridge_Bay",
+ "America/Campo_Grande",
+ "America/Cancun",
+ "America/Caracas",
+ "America/Catamarca",
+ "America/Cayenne",
+ "America/Cayman",
+ "America/Chicago",
+ "America/Chihuahua",
+ "America/Coral_Harbour",
+ "America/Cordoba",
+ "America/Costa_Rica",
+ "America/Creston",
+ "America/Cuiaba",
+ "America/Curacao",
+ "America/Danmarkshavn",
+ "America/Dawson",
+ "America/Dawson_Creek",
+ "America/Denver",
+ "America/Detroit",
+ "America/Dominica",
+ "America/Edmonton",
+ "America/Eirunepe",
+ "America/El_Salvador",
+ "America/Ensenada",
+ "America/Fort_Nelson",
+ "America/Fort_Wayne",
+ "America/Fortaleza",
+ "America/Glace_Bay",
+ "America/Godthab",
+ "America/Goose_Bay",
+ "America/Grand_Turk",
+ "America/Grenada",
+ "America/Guadeloupe",
+ "America/Guatemala",
+ "America/Guayaquil",
+ "America/Guyana",
+ "America/Halifax",
+ "America/Havana",
+ "America/Hermosillo",
+ "America/Indiana/Indianapolis",
+ "America/Indiana/Knox",
+ "America/Indiana/Marengo",
+ "America/Indiana/Petersburg",
+ "America/Indiana/Tell_City",
+ "America/Indiana/Vevay",
+ "America/Indiana/Vincennes",
+ "America/Indiana/Winamac",
+ "America/Indianapolis",
+ "America/Inuvik",
+ "America/Iqaluit",
+ "America/Jamaica",
+ "America/Jujuy",
+ "America/Juneau",
+ "America/Kentucky/Louisville",
+ "America/Kentucky/Monticello",
+ "America/Knox_IN",
+ "America/Kralendijk",
+ "America/La_Paz",
+ "America/Lima",
+ "America/Los_Angeles",
+ "America/Louisville",
+ "America/Lower_Princes",
+ "America/Maceio",
+ "America/Managua",
+ "America/Manaus",
+ "America/Marigot",
+ "America/Martinique",
+ "America/Matamoros",
+ "America/Mazatlan",
+ "America/Mendoza",
+ "America/Menominee",
+ "America/Merida",
+ "America/Metlakatla",
+ "America/Mexico_City",
+ "America/Miquelon",
+ "America/Moncton",
+ "America/Monterrey",
+ "America/Montevideo",
+ "America/Montreal",
+ "America/Montserrat",
+ "America/Nassau",
+ "America/New_York",
+ "America/Nipigon",
+ "America/Nome",
+ "America/Noronha",
+ "America/North_Dakota/Beulah",
+ "America/North_Dakota/Center",
+ "America/North_Dakota/New_Salem",
+ "America/Ojinaga",
+ "America/Panama",
+ "America/Pangnirtung",
+ "America/Paramaribo",
+ "America/Phoenix",
+ "America/Port-au-Prince",
+ "America/Port_of_Spain",
+ "America/Porto_Acre",
+ "America/Porto_Velho",
+ "America/Puerto_Rico",
+ "America/Punta_Arenas",
+ "America/Rainy_River",
+ "America/Rankin_Inlet",
+ "America/Recife",
+ "America/Regina",
+ "America/Resolute",
+ "America/Rio_Branco",
+ "America/Rosario",
+ "America/Santa_Isabel",
+ "America/Santarem",
+ "America/Santiago",
+ "America/Santo_Domingo",
+ "America/Sao_Paulo",
+ "America/Scoresbysund",
+ "America/Shiprock",
+ "America/Sitka",
+ "America/St_Barthelemy",
+ "America/St_Johns",
+ "America/St_Kitts",
+ "America/St_Lucia",
+ "America/St_Thomas",
+ "America/St_Vincent",
+ "America/Swift_Current",
+ "America/Tegucigalpa",
+ "America/Thule",
+ "America/Thunder_Bay",
+ "America/Tijuana",
+ "America/Toronto",
+ "America/Tortola",
+ "America/Vancouver",
+ "America/Virgin",
+ "America/Whitehorse",
+ "America/Winnipeg",
+ "America/Yakutat",
+ "America/Yellowknife",
+ "Antarctica/Casey",
+ "Antarctica/Davis",
+ "Antarctica/DumontDUrville",
+ "Antarctica/Macquarie",
+ "Antarctica/Mawson",
+ "Antarctica/McMurdo",
+ "Antarctica/Palmer",
+ "Antarctica/Rothera",
+ "Antarctica/South_Pole",
+ "Antarctica/Syowa",
+ "Antarctica/Troll",
+ "Antarctica/Vostok",
+ "Arctic/Longyearbyen",
+ "Asia/Aden",
+ "Asia/Almaty",
+ "Asia/Amman",
+ "Asia/Anadyr",
+ "Asia/Aqtau",
+ "Asia/Aqtobe",
+ "Asia/Ashgabat",
+ "Asia/Ashkhabad",
+ "Asia/Atyrau",
+ "Asia/Baghdad",
+ "Asia/Bahrain",
+ "Asia/Baku",
+ "Asia/Bangkok",
+ "Asia/Barnaul",
+ "Asia/Beirut",
+ "Asia/Bishkek",
+ "Asia/Brunei",
+ "Asia/Calcutta",
+ "Asia/Chita",
+ "Asia/Choibalsan",
+ "Asia/Chongqing",
+ "Asia/Chungking",
+ "Asia/Colombo",
+ "Asia/Dacca",
+ "Asia/Damascus",
+ "Asia/Dhaka",
+ "Asia/Dili",
+ "Asia/Dubai",
+ "Asia/Dushanbe",
+ "Asia/Famagusta",
+ "Asia/Gaza",
+ "Asia/Harbin",
+ "Asia/Hebron",
+ "Asia/Ho_Chi_Minh",
+ "Asia/Hong_Kong",
+ "Asia/Hovd",
+ "Asia/Irkutsk",
+ "Asia/Istanbul",
+ "Asia/Jakarta",
+ "Asia/Jayapura",
+ "Asia/Jerusalem",
+ "Asia/Kabul",
+ "Asia/Kamchatka",
+ "Asia/Karachi",
+ "Asia/Kashgar",
+ "Asia/Kathmandu",
+ "Asia/Katmandu",
+ "Asia/Khandyga",
+ "Asia/Kolkata",
+ "Asia/Krasnoyarsk",
+ "Asia/Kuala_Lumpur",
+ "Asia/Kuching",
+ "Asia/Kuwait",
+ "Asia/Macao",
+ "Asia/Macau",
+ "Asia/Magadan",
+ "Asia/Makassar",
+ "Asia/Manila",
+ "Asia/Muscat",
+ "Asia/Nicosia",
+ "Asia/Novokuznetsk",
+ "Asia/Novosibirsk",
+ "Asia/Omsk",
+ "Asia/Oral",
+ "Asia/Phnom_Penh",
+ "Asia/Pontianak",
+ "Asia/Pyongyang",
+ "Asia/Qatar",
+ "Asia/Qostanay",
+ "Asia/Qyzylorda",
+ "Asia/Rangoon",
+ "Asia/Riyadh",
+ "Asia/Saigon",
+ "Asia/Sakhalin",
+ "Asia/Samarkand",
+ "Asia/Seoul",
+ "Asia/Shanghai",
+ "Asia/Singapore",
+ "Asia/Srednekolymsk",
+ "Asia/Taipei",
+ "Asia/Tashkent",
+ "Asia/Tbilisi",
+ "Asia/Tehran",
+ "Asia/Tel_Aviv",
+ "Asia/Thimbu",
+ "Asia/Thimphu",
+ "Asia/Tokyo",
+ "Asia/Tomsk",
+ "Asia/Ujung_Pandang",
+ "Asia/Ulaanbaatar",
+ "Asia/Ulan_Bator",
+ "Asia/Urumqi",
+ "Asia/Ust-Nera",
+ "Asia/Vientiane",
+ "Asia/Vladivostok",
+ "Asia/Yakutsk",
+ "Asia/Yangon",
+ "Asia/Yekaterinburg",
+ "Asia/Yerevan",
+ "Atlantic/Azores",
+ "Atlantic/Bermuda",
+ "Atlantic/Canary",
+ "Atlantic/Cape_Verde",
+ "Atlantic/Faeroe",
+ "Atlantic/Faroe",
+ "Atlantic/Jan_Mayen",
+ "Atlantic/Madeira",
+ "Atlantic/Reykjavik",
+ "Atlantic/South_Georgia",
+ "Atlantic/St_Helena",
+ "Atlantic/Stanley",
+ "Australia/ACT",
+ "Australia/Adelaide",
+ "Australia/Brisbane",
+ "Australia/Broken_Hill",
+ "Australia/Canberra",
+ "Australia/Currie",
+ "Australia/Darwin",
+ "Australia/Eucla",
+ "Australia/Hobart",
+ "Australia/LHI",
+ "Australia/Lindeman",
+ "Australia/Lord_Howe",
+ "Australia/Melbourne",
+ "Australia/NSW",
+ "Australia/North",
+ "Australia/Perth",
+ "Australia/Queensland",
+ "Australia/South",
+ "Australia/Sydney",
+ "Australia/Tasmania",
+ "Australia/Victoria",
+ "Australia/West",
+ "Australia/Yancowinna",
+ "Brazil/Acre",
+ "Brazil/DeNoronha",
+ "Brazil/East",
+ "Brazil/West",
+ "CET",
+ "CST6CDT",
+ "Canada/Atlantic",
+ "Canada/Central",
+ "Canada/Eastern",
+ "Canada/Mountain",
+ "Canada/Newfoundland",
+ "Canada/Pacific",
+ "Canada/Saskatchewan",
+ "Canada/Yukon",
+ "Chile/Continental",
+ "Chile/EasterIsland",
+ "Cuba",
+ "EET",
+ "EST",
+ "EST5EDT",
+ "Egypt",
+ "Eire",
+ "Etc/GMT",
+ "Etc/GMT+0",
+ "Etc/GMT+1",
+ "Etc/GMT+10",
+ "Etc/GMT+11",
+ "Etc/GMT+12",
+ "Etc/GMT+2",
+ "Etc/GMT+3",
+ "Etc/GMT+4",
+ "Etc/GMT+5",
+ "Etc/GMT+6",
+ "Etc/GMT+7",
+ "Etc/GMT+8",
+ "Etc/GMT+9",
+ "Etc/GMT-0",
+ "Etc/GMT-1",
+ "Etc/GMT-10",
+ "Etc/GMT-11",
+ "Etc/GMT-12",
+ "Etc/GMT-13",
+ "Etc/GMT-14",
+ "Etc/GMT-2",
+ "Etc/GMT-3",
+ "Etc/GMT-4",
+ "Etc/GMT-5",
+ "Etc/GMT-6",
+ "Etc/GMT-7",
+ "Etc/GMT-8",
+ "Etc/GMT-9",
+ "Etc/GMT0",
+ "Etc/Greenwich",
+ "Etc/UCT",
+ "Etc/UTC",
+ "Etc/Universal",
+ "Etc/Zulu",
+ "Europe/Amsterdam",
+ "Europe/Andorra",
+ "Europe/Astrakhan",
+ "Europe/Athens",
+ "Europe/Belfast",
+ "Europe/Belgrade",
+ "Europe/Berlin",
+ "Europe/Bratislava",
+ "Europe/Brussels",
+ "Europe/Bucharest",
+ "Europe/Budapest",
+ "Europe/Busingen",
+ "Europe/Chisinau",
+ "Europe/Copenhagen",
+ "Europe/Dublin",
+ "Europe/Gibraltar",
+ "Europe/Guernsey",
+ "Europe/Helsinki",
+ "Europe/Isle_of_Man",
+ "Europe/Istanbul",
+ "Europe/Jersey",
+ "Europe/Kaliningrad",
+ "Europe/Kiev",
+ "Europe/Kirov",
+ "Europe/Lisbon",
+ "Europe/Ljubljana",
+ "Europe/London",
+ "Europe/Luxembourg",
+ "Europe/Madrid",
+ "Europe/Malta",
+ "Europe/Mariehamn",
+ "Europe/Minsk",
+ "Europe/Monaco",
+ "Europe/Moscow",
+ "Europe/Nicosia",
+ "Europe/Oslo",
+ "Europe/Paris",
+ "Europe/Podgorica",
+ "Europe/Prague",
+ "Europe/Riga",
+ "Europe/Rome",
+ "Europe/Samara",
+ "Europe/San_Marino",
+ "Europe/Sarajevo",
+ "Europe/Saratov",
+ "Europe/Simferopol",
+ "Europe/Skopje",
+ "Europe/Sofia",
+ "Europe/Stockholm",
+ "Europe/Tallinn",
+ "Europe/Tirane",
+ "Europe/Tiraspol",
+ "Europe/Ulyanovsk",
+ "Europe/Uzhgorod",
+ "Europe/Vaduz",
+ "Europe/Vatican",
+ "Europe/Vienna",
+ "Europe/Vilnius",
+ "Europe/Volgograd",
+ "Europe/Warsaw",
+ "Europe/Zagreb",
+ "Europe/Zaporozhye",
+ "Europe/Zurich",
+ "GB",
+ "GB-Eire",
+ "GMT",
+ "GMT+0",
+ "GMT-0",
+ "GMT0",
+ "Greenwich",
+ "HST",
+ "Hongkong",
+ "Iceland",
+ "Indian/Antananarivo",
+ "Indian/Chagos",
+ "Indian/Christmas",
+ "Indian/Cocos",
+ "Indian/Comoro",
+ "Indian/Kerguelen",
+ "Indian/Mahe",
+ "Indian/Maldives",
+ "Indian/Mauritius",
+ "Indian/Mayotte",
+ "Indian/Reunion",
+ "Iran",
+ "Israel",
+ "Jamaica",
+ "Japan",
+ "Kwajalein",
+ "Libya",
+ "MET",
+ "MST",
+ "MST7MDT",
+ "Mexico/BajaNorte",
+ "Mexico/BajaSur",
+ "Mexico/General",
+ "NZ",
+ "NZ-CHAT",
+ "Navajo",
+ "PRC",
+ "PST8PDT",
+ "Pacific/Apia",
+ "Pacific/Auckland",
+ "Pacific/Bougainville",
+ "Pacific/Chatham",
+ "Pacific/Chuuk",
+ "Pacific/Easter",
+ "Pacific/Efate",
+ "Pacific/Enderbury",
+ "Pacific/Fakaofo",
+ "Pacific/Fiji",
+ "Pacific/Funafuti",
+ "Pacific/Galapagos",
+ "Pacific/Gambier",
+ "Pacific/Guadalcanal",
+ "Pacific/Guam",
+ "Pacific/Honolulu",
+ "Pacific/Johnston",
+ "Pacific/Kiritimati",
+ "Pacific/Kosrae",
+ "Pacific/Kwajalein",
+ "Pacific/Majuro",
+ "Pacific/Marquesas",
+ "Pacific/Midway",
+ "Pacific/Nauru",
+ "Pacific/Niue",
+ "Pacific/Norfolk",
+ "Pacific/Noumea",
+ "Pacific/Pago_Pago",
+ "Pacific/Palau",
+ "Pacific/Pitcairn",
+ "Pacific/Pohnpei",
+ "Pacific/Ponape",
+ "Pacific/Port_Moresby",
+ "Pacific/Rarotonga",
+ "Pacific/Saipan",
+ "Pacific/Samoa",
+ "Pacific/Tahiti",
+ "Pacific/Tarawa",
+ "Pacific/Tongatapu",
+ "Pacific/Truk",
+ "Pacific/Wake",
+ "Pacific/Wallis",
+ "Pacific/Yap",
+ "Poland",
+ "Portugal",
+ "ROC",
+ "ROK",
+ "Singapore",
+ "Turkey",
+ "UCT",
+ "US/Alaska",
+ "US/Aleutian",
+ "US/Arizona",
+ "US/Central",
+ "US/East-Indiana",
+ "US/Eastern",
+ "US/Hawaii",
+ "US/Indiana-Starke",
+ "US/Michigan",
+ "US/Mountain",
+ "US/Pacific",
+ "US/Samoa",
+ "UTC",
+ "Universal",
+ "W-SU",
+ "WET",
+ "Zulu",
+ nullptr};
+
+std::vector<std::string> AllTimeZoneNames() {
+ std::vector<std::string> names;
+ for (const char* const* namep = kTimeZoneNames; *namep != nullptr; ++namep) {
+ names.push_back(std::string("file:") + *namep);
+ }
+ assert(!names.empty());
+
+ std::mt19937 urbg(42); // a UniformRandomBitGenerator with fixed seed
+ std::shuffle(names.begin(), names.end(), urbg);
+ return names;
+}
+
+cctz::time_zone TestTimeZone() {
+ cctz::time_zone tz;
+ cctz::load_time_zone("America/Los_Angeles", &tz);
+ return tz;
+}
+
+void BM_Zone_LoadUTCTimeZoneFirst(benchmark::State& state) {
+ cctz::time_zone tz;
+ cctz::load_time_zone("UTC", &tz); // in case we're first
+ cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::load_time_zone("UTC", &tz));
+ }
+}
+BENCHMARK(BM_Zone_LoadUTCTimeZoneFirst);
+
+void BM_Zone_LoadUTCTimeZoneLast(benchmark::State& state) {
+ cctz::time_zone tz;
+ for (const auto& name : AllTimeZoneNames()) {
+ cctz::load_time_zone(name, &tz); // prime cache
+ }
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::load_time_zone("UTC", &tz));
+ }
+}
+BENCHMARK(BM_Zone_LoadUTCTimeZoneLast);
+
+void BM_Zone_LoadTimeZoneFirst(benchmark::State& state) {
+ cctz::time_zone tz = cctz::utc_time_zone(); // in case we're first
+ const std::string name = "file:America/Los_Angeles";
+ while (state.KeepRunning()) {
+ state.PauseTiming();
+ cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+ state.ResumeTiming();
+ benchmark::DoNotOptimize(cctz::load_time_zone(name, &tz));
+ }
+}
+BENCHMARK(BM_Zone_LoadTimeZoneFirst);
+
+void BM_Zone_LoadTimeZoneCached(benchmark::State& state) {
+ cctz::time_zone tz = cctz::utc_time_zone(); // in case we're first
+ cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+ const std::string name = "file:America/Los_Angeles";
+ cctz::load_time_zone(name, &tz); // prime cache
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::load_time_zone(name, &tz));
+ }
+}
+BENCHMARK(BM_Zone_LoadTimeZoneCached);
+
+void BM_Zone_LoadLocalTimeZoneCached(benchmark::State& state) {
+ cctz::utc_time_zone(); // in case we're first
+ cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+ cctz::local_time_zone(); // prime cache
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::local_time_zone());
+ }
+}
+BENCHMARK(BM_Zone_LoadLocalTimeZoneCached);
+
+void BM_Zone_LoadAllTimeZonesFirst(benchmark::State& state) {
+ cctz::time_zone tz;
+ const std::vector<std::string> names = AllTimeZoneNames();
+ for (auto index = names.size(); state.KeepRunning(); ++index) {
+ if (index == names.size()) {
+ index = 0;
+ }
+ if (index == 0) {
+ state.PauseTiming();
+ cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+ state.ResumeTiming();
+ }
+ benchmark::DoNotOptimize(cctz::load_time_zone(names[index], &tz));
+ }
+}
+BENCHMARK(BM_Zone_LoadAllTimeZonesFirst);
+
+void BM_Zone_LoadAllTimeZonesCached(benchmark::State& state) {
+ cctz::time_zone tz;
+ const std::vector<std::string> names = AllTimeZoneNames();
+ for (const auto& name : names) {
+ cctz::load_time_zone(name, &tz); // prime cache
+ }
+ for (auto index = names.size(); state.KeepRunning(); ++index) {
+ if (index == names.size()) {
+ index = 0;
+ }
+ benchmark::DoNotOptimize(cctz::load_time_zone(names[index], &tz));
+ }
+}
+BENCHMARK(BM_Zone_LoadAllTimeZonesCached);
+
+void BM_Zone_TimeZoneEqualityImplicit(benchmark::State& state) {
+ cctz::time_zone tz; // implicit UTC
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(tz == tz);
+ }
+}
+BENCHMARK(BM_Zone_TimeZoneEqualityImplicit);
+
+void BM_Zone_TimeZoneEqualityExplicit(benchmark::State& state) {
+ cctz::time_zone tz = cctz::utc_time_zone(); // explicit UTC
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(tz == tz);
+ }
+}
+BENCHMARK(BM_Zone_TimeZoneEqualityExplicit);
+
+void BM_Zone_UTCTimeZone(benchmark::State& state) {
+ cctz::time_zone tz;
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::utc_time_zone());
+ }
+}
+BENCHMARK(BM_Zone_UTCTimeZone);
+
+// In each "ToCivil" benchmark we switch between two instants separated
+// by at least one transition in order to defeat any internal caching of
+// previous results (e.g., see local_time_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+
+void BM_Time_ToCivil_CCTZ(benchmark::State& state) {
+ const cctz::time_zone tz = TestTimeZone();
+ std::chrono::system_clock::time_point tp =
+ std::chrono::system_clock::from_time_t(1384569027);
+ std::chrono::system_clock::time_point tp2 =
+ std::chrono::system_clock::from_time_t(1418962578);
+ while (state.KeepRunning()) {
+ std::swap(tp, tp2);
+ tp += std::chrono::seconds(1);
+ benchmark::DoNotOptimize(cctz::convert(tp, tz));
+ }
+}
+BENCHMARK(BM_Time_ToCivil_CCTZ);
+
+void BM_Time_ToCivil_Libc(benchmark::State& state) {
+ // No timezone support, so just use localtime.
+ time_t t = 1384569027;
+ time_t t2 = 1418962578;
+ struct tm tm;
+ while (state.KeepRunning()) {
+ std::swap(t, t2);
+ t += 1;
+#if defined(_WIN32) || defined(_WIN64)
+ benchmark::DoNotOptimize(localtime_s(&tm, &t));
+#else
+ benchmark::DoNotOptimize(localtime_r(&t, &tm));
+#endif
+ }
+}
+BENCHMARK(BM_Time_ToCivil_Libc);
+
+void BM_Time_ToCivilUTC_CCTZ(benchmark::State& state) {
+ const cctz::time_zone tz = cctz::utc_time_zone();
+ std::chrono::system_clock::time_point tp =
+ std::chrono::system_clock::from_time_t(1384569027);
+ while (state.KeepRunning()) {
+ tp += std::chrono::seconds(1);
+ benchmark::DoNotOptimize(cctz::convert(tp, tz));
+ }
+}
+BENCHMARK(BM_Time_ToCivilUTC_CCTZ);
+
+void BM_Time_ToCivilUTC_Libc(benchmark::State& state) {
+ time_t t = 1384569027;
+ struct tm tm;
+ while (state.KeepRunning()) {
+ t += 1;
+#if defined(_WIN32) || defined(_WIN64)
+ benchmark::DoNotOptimize(gmtime_s(&tm, &t));
+#else
+ benchmark::DoNotOptimize(gmtime_r(&t, &tm));
+#endif
+ }
+}
+BENCHMARK(BM_Time_ToCivilUTC_Libc);
+
+// In each "FromCivil" benchmark we switch between two YMDhms values
+// separated by at least one transition in order to defeat any internal
+// caching of previous results (e.g., see time_local_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+// The "Day0" variants require normalization of the day of month.
+
+void BM_Time_FromCivil_CCTZ(benchmark::State& state) {
+ const cctz::time_zone tz = TestTimeZone();
+ int i = 0;
+ while (state.KeepRunning()) {
+ if ((i++ & 1) == 0) {
+ benchmark::DoNotOptimize(
+ cctz::convert(cctz::civil_second(2014, 12, 18, 20, 16, 18), tz));
+ } else {
+ benchmark::DoNotOptimize(
+ cctz::convert(cctz::civil_second(2013, 11, 15, 18, 30, 27), tz));
+ }
+ }
+}
+BENCHMARK(BM_Time_FromCivil_CCTZ);
+
+void BM_Time_FromCivil_Libc(benchmark::State& state) {
+ // No timezone support, so just use localtime.
+ int i = 0;
+ while (state.KeepRunning()) {
+ struct tm tm;
+ if ((i++ & 1) == 0) {
+ tm.tm_year = 2014 - 1900;
+ tm.tm_mon = 12 - 1;
+ tm.tm_mday = 18;
+ tm.tm_hour = 20;
+ tm.tm_min = 16;
+ tm.tm_sec = 18;
+ } else {
+ tm.tm_year = 2013 - 1900;
+ tm.tm_mon = 11 - 1;
+ tm.tm_mday = 15;
+ tm.tm_hour = 18;
+ tm.tm_min = 30;
+ tm.tm_sec = 27;
+ }
+ tm.tm_isdst = -1;
+ benchmark::DoNotOptimize(mktime(&tm));
+ }
+}
+BENCHMARK(BM_Time_FromCivil_Libc);
+
+void BM_Time_FromCivilUTC_CCTZ(benchmark::State& state) {
+ const cctz::time_zone tz = cctz::utc_time_zone();
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(
+ cctz::convert(cctz::civil_second(2014, 12, 18, 20, 16, 18), tz));
+ }
+}
+BENCHMARK(BM_Time_FromCivilUTC_CCTZ);
+
+// There is no BM_Time_FromCivilUTC_Libc.
+
+void BM_Time_FromCivilDay0_CCTZ(benchmark::State& state) {
+ const cctz::time_zone tz = TestTimeZone();
+ int i = 0;
+ while (state.KeepRunning()) {
+ if ((i++ & 1) == 0) {
+ benchmark::DoNotOptimize(
+ cctz::convert(cctz::civil_second(2014, 12, 0, 20, 16, 18), tz));
+ } else {
+ benchmark::DoNotOptimize(
+ cctz::convert(cctz::civil_second(2013, 11, 0, 18, 30, 27), tz));
+ }
+ }
+}
+BENCHMARK(BM_Time_FromCivilDay0_CCTZ);
+
+void BM_Time_FromCivilDay0_Libc(benchmark::State& state) {
+ // No timezone support, so just use localtime.
+ int i = 0;
+ while (state.KeepRunning()) {
+ struct tm tm;
+ if ((i++ & 1) == 0) {
+ tm.tm_year = 2014 - 1900;
+ tm.tm_mon = 12 - 1;
+ tm.tm_mday = 0;
+ tm.tm_hour = 20;
+ tm.tm_min = 16;
+ tm.tm_sec = 18;
+ } else {
+ tm.tm_year = 2013 - 1900;
+ tm.tm_mon = 11 - 1;
+ tm.tm_mday = 0;
+ tm.tm_hour = 18;
+ tm.tm_min = 30;
+ tm.tm_sec = 27;
+ }
+ tm.tm_isdst = -1;
+ benchmark::DoNotOptimize(mktime(&tm));
+ }
+}
+BENCHMARK(BM_Time_FromCivilDay0_Libc);
+
+const char* const kFormats[] = {
+ RFC1123_full, // 0
+ RFC1123_no_wday, // 1
+ RFC3339_full, // 2
+ RFC3339_sec, // 3
+ "%Y-%m-%dT%H:%M:%S", // 4
+ "%Y-%m-%d", // 5
+};
+const int kNumFormats = sizeof(kFormats) / sizeof(kFormats[0]);
+
+void BM_Format_FormatTime(benchmark::State& state) {
+ const std::string fmt = kFormats[state.range(0)];
+ state.SetLabel(fmt);
+ const cctz::time_zone tz = TestTimeZone();
+ const std::chrono::system_clock::time_point tp =
+ cctz::convert(cctz::civil_second(1977, 6, 28, 9, 8, 7), tz) +
+ std::chrono::microseconds(1);
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::format(fmt, tp, tz));
+ }
+}
+BENCHMARK(BM_Format_FormatTime)->DenseRange(0, kNumFormats - 1);
+
+void BM_Format_ParseTime(benchmark::State& state) {
+ const std::string fmt = kFormats[state.range(0)];
+ state.SetLabel(fmt);
+ const cctz::time_zone tz = TestTimeZone();
+ std::chrono::system_clock::time_point tp =
+ cctz::convert(cctz::civil_second(1977, 6, 28, 9, 8, 7), tz) +
+ std::chrono::microseconds(1);
+ const std::string when = cctz::format(fmt, tp, tz);
+ while (state.KeepRunning()) {
+ benchmark::DoNotOptimize(cctz::parse(fmt, when, tz, &tp));
+ }
+}
+BENCHMARK(BM_Format_ParseTime)->DenseRange(0, kNumFormats - 1);
+
+} // namespace
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_detail.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_detail.cc
new file mode 100644
index 0000000000..0b07e397e5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_detail.cc
@@ -0,0 +1,94 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/civil_time_detail.h"
+
+#include <iomanip>
+#include <ostream>
+#include <sstream>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+namespace detail {
+
+// Output stream operators output a format matching YYYY-MM-DDThh:mm:ss,
+// while omitting fields inferior to the type's alignment. For example,
+// civil_day is formatted only as YYYY-MM-DD.
+std::ostream& operator<<(std::ostream& os, const civil_year& y) {
+ std::stringstream ss;
+ ss << y.year(); // No padding.
+ return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_month& m) {
+ std::stringstream ss;
+ ss << civil_year(m) << '-';
+ ss << std::setfill('0') << std::setw(2) << m.month();
+ return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_day& d) {
+ std::stringstream ss;
+ ss << civil_month(d) << '-';
+ ss << std::setfill('0') << std::setw(2) << d.day();
+ return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_hour& h) {
+ std::stringstream ss;
+ ss << civil_day(h) << 'T';
+ ss << std::setfill('0') << std::setw(2) << h.hour();
+ return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_minute& m) {
+ std::stringstream ss;
+ ss << civil_hour(m) << ':';
+ ss << std::setfill('0') << std::setw(2) << m.minute();
+ return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_second& s) {
+ std::stringstream ss;
+ ss << civil_minute(s) << ':';
+ ss << std::setfill('0') << std::setw(2) << s.second();
+ return os << ss.str();
+}
+
+////////////////////////////////////////////////////////////////////////
+
+std::ostream& operator<<(std::ostream& os, weekday wd) {
+ switch (wd) {
+ case weekday::monday:
+ return os << "Monday";
+ case weekday::tuesday:
+ return os << "Tuesday";
+ case weekday::wednesday:
+ return os << "Wednesday";
+ case weekday::thursday:
+ return os << "Thursday";
+ case weekday::friday:
+ return os << "Friday";
+ case weekday::saturday:
+ return os << "Saturday";
+ case weekday::sunday:
+ return os << "Sunday";
+ }
+ return os; // Should never get here, but -Wreturn-type may warn without this.
+}
+
+} // namespace detail
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_test.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_test.cc
new file mode 100644
index 0000000000..be894d7072
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/civil_time_test.cc
@@ -0,0 +1,1056 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+#include <iomanip>
+#include <limits>
+#include <sstream>
+#include <string>
+#include <type_traits>
+
+#include "gtest/gtest.h"
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+template <typename T>
+std::string Format(const T& t) {
+ std::stringstream ss;
+ ss << t;
+ return ss.str();
+}
+
+} // namespace
+
+#if __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+// Construction constexpr tests
+
+TEST(CivilTime, Normal) {
+ constexpr civil_second css(2016, 1, 28, 17, 14, 12);
+ static_assert(css.second() == 12, "Normal.second");
+ constexpr civil_minute cmm(2016, 1, 28, 17, 14);
+ static_assert(cmm.minute() == 14, "Normal.minute");
+ constexpr civil_hour chh(2016, 1, 28, 17);
+ static_assert(chh.hour() == 17, "Normal.hour");
+ constexpr civil_day cd(2016, 1, 28);
+ static_assert(cd.day() == 28, "Normal.day");
+ constexpr civil_month cm(2016, 1);
+ static_assert(cm.month() == 1, "Normal.month");
+ constexpr civil_year cy(2016);
+ static_assert(cy.year() == 2016, "Normal.year");
+}
+
+TEST(CivilTime, Conversion) {
+ constexpr civil_year cy(2016);
+ static_assert(cy.year() == 2016, "Conversion.year");
+ constexpr civil_month cm(cy);
+ static_assert(cm.month() == 1, "Conversion.month");
+ constexpr civil_day cd(cm);
+ static_assert(cd.day() == 1, "Conversion.day");
+ constexpr civil_hour chh(cd);
+ static_assert(chh.hour() == 0, "Conversion.hour");
+ constexpr civil_minute cmm(chh);
+ static_assert(cmm.minute() == 0, "Conversion.minute");
+ constexpr civil_second css(cmm);
+ static_assert(css.second() == 0, "Conversion.second");
+}
+
+// Normalization constexpr tests
+
+TEST(CivilTime, Normalized) {
+ constexpr civil_second cs(2016, 1, 28, 17, 14, 12);
+ static_assert(cs.year() == 2016, "Normalized.year");
+ static_assert(cs.month() == 1, "Normalized.month");
+ static_assert(cs.day() == 28, "Normalized.day");
+ static_assert(cs.hour() == 17, "Normalized.hour");
+ static_assert(cs.minute() == 14, "Normalized.minute");
+ static_assert(cs.second() == 12, "Normalized.second");
+}
+
+TEST(CivilTime, SecondOverflow) {
+ constexpr civil_second cs(2016, 1, 28, 17, 14, 121);
+ static_assert(cs.year() == 2016, "SecondOverflow.year");
+ static_assert(cs.month() == 1, "SecondOverflow.month");
+ static_assert(cs.day() == 28, "SecondOverflow.day");
+ static_assert(cs.hour() == 17, "SecondOverflow.hour");
+ static_assert(cs.minute() == 16, "SecondOverflow.minute");
+ static_assert(cs.second() == 1, "SecondOverflow.second");
+}
+
+TEST(CivilTime, SecondUnderflow) {
+ constexpr civil_second cs(2016, 1, 28, 17, 14, -121);
+ static_assert(cs.year() == 2016, "SecondUnderflow.year");
+ static_assert(cs.month() == 1, "SecondUnderflow.month");
+ static_assert(cs.day() == 28, "SecondUnderflow.day");
+ static_assert(cs.hour() == 17, "SecondUnderflow.hour");
+ static_assert(cs.minute() == 11, "SecondUnderflow.minute");
+ static_assert(cs.second() == 59, "SecondUnderflow.second");
+}
+
+TEST(CivilTime, MinuteOverflow) {
+ constexpr civil_second cs(2016, 1, 28, 17, 121, 12);
+ static_assert(cs.year() == 2016, "MinuteOverflow.year");
+ static_assert(cs.month() == 1, "MinuteOverflow.month");
+ static_assert(cs.day() == 28, "MinuteOverflow.day");
+ static_assert(cs.hour() == 19, "MinuteOverflow.hour");
+ static_assert(cs.minute() == 1, "MinuteOverflow.minute");
+ static_assert(cs.second() == 12, "MinuteOverflow.second");
+}
+
+TEST(CivilTime, MinuteUnderflow) {
+ constexpr civil_second cs(2016, 1, 28, 17, -121, 12);
+ static_assert(cs.year() == 2016, "MinuteUnderflow.year");
+ static_assert(cs.month() == 1, "MinuteUnderflow.month");
+ static_assert(cs.day() == 28, "MinuteUnderflow.day");
+ static_assert(cs.hour() == 14, "MinuteUnderflow.hour");
+ static_assert(cs.minute() == 59, "MinuteUnderflow.minute");
+ static_assert(cs.second() == 12, "MinuteUnderflow.second");
+}
+
+TEST(CivilTime, HourOverflow) {
+ constexpr civil_second cs(2016, 1, 28, 49, 14, 12);
+ static_assert(cs.year() == 2016, "HourOverflow.year");
+ static_assert(cs.month() == 1, "HourOverflow.month");
+ static_assert(cs.day() == 30, "HourOverflow.day");
+ static_assert(cs.hour() == 1, "HourOverflow.hour");
+ static_assert(cs.minute() == 14, "HourOverflow.minute");
+ static_assert(cs.second() == 12, "HourOverflow.second");
+}
+
+TEST(CivilTime, HourUnderflow) {
+ constexpr civil_second cs(2016, 1, 28, -49, 14, 12);
+ static_assert(cs.year() == 2016, "HourUnderflow.year");
+ static_assert(cs.month() == 1, "HourUnderflow.month");
+ static_assert(cs.day() == 25, "HourUnderflow.day");
+ static_assert(cs.hour() == 23, "HourUnderflow.hour");
+ static_assert(cs.minute() == 14, "HourUnderflow.minute");
+ static_assert(cs.second() == 12, "HourUnderflow.second");
+}
+
+TEST(CivilTime, MonthOverflow) {
+ constexpr civil_second cs(2016, 25, 28, 17, 14, 12);
+ static_assert(cs.year() == 2018, "MonthOverflow.year");
+ static_assert(cs.month() == 1, "MonthOverflow.month");
+ static_assert(cs.day() == 28, "MonthOverflow.day");
+ static_assert(cs.hour() == 17, "MonthOverflow.hour");
+ static_assert(cs.minute() == 14, "MonthOverflow.minute");
+ static_assert(cs.second() == 12, "MonthOverflow.second");
+}
+
+TEST(CivilTime, MonthUnderflow) {
+ constexpr civil_second cs(2016, -25, 28, 17, 14, 12);
+ static_assert(cs.year() == 2013, "MonthUnderflow.year");
+ static_assert(cs.month() == 11, "MonthUnderflow.month");
+ static_assert(cs.day() == 28, "MonthUnderflow.day");
+ static_assert(cs.hour() == 17, "MonthUnderflow.hour");
+ static_assert(cs.minute() == 14, "MonthUnderflow.minute");
+ static_assert(cs.second() == 12, "MonthUnderflow.second");
+}
+
+TEST(CivilTime, C4Overflow) {
+ constexpr civil_second cs(2016, 1, 292195, 17, 14, 12);
+ static_assert(cs.year() == 2816, "C4Overflow.year");
+ static_assert(cs.month() == 1, "C4Overflow.month");
+ static_assert(cs.day() == 1, "C4Overflow.day");
+ static_assert(cs.hour() == 17, "C4Overflow.hour");
+ static_assert(cs.minute() == 14, "C4Overflow.minute");
+ static_assert(cs.second() == 12, "C4Overflow.second");
+}
+
+TEST(CivilTime, C4Underflow) {
+ constexpr civil_second cs(2016, 1, -292195, 17, 14, 12);
+ static_assert(cs.year() == 1215, "C4Underflow.year");
+ static_assert(cs.month() == 12, "C4Underflow.month");
+ static_assert(cs.day() == 30, "C4Underflow.day");
+ static_assert(cs.hour() == 17, "C4Underflow.hour");
+ static_assert(cs.minute() == 14, "C4Underflow.minute");
+ static_assert(cs.second() == 12, "C4Underflow.second");
+}
+
+TEST(CivilTime, MixedNormalization) {
+ constexpr civil_second cs(2016, -42, 122, 99, -147, 4949);
+ static_assert(cs.year() == 2012, "MixedNormalization.year");
+ static_assert(cs.month() == 10, "MixedNormalization.month");
+ static_assert(cs.day() == 4, "MixedNormalization.day");
+ static_assert(cs.hour() == 1, "MixedNormalization.hour");
+ static_assert(cs.minute() == 55, "MixedNormalization.minute");
+ static_assert(cs.second() == 29, "MixedNormalization.second");
+}
+
+// Relational constexpr tests
+
+TEST(CivilTime, Less) {
+ constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+ constexpr civil_second cs2(2016, 1, 28, 17, 14, 13);
+ constexpr bool less = cs1 < cs2;
+ static_assert(less, "Less");
+}
+
+// Arithmetic constexpr tests
+
+TEST(CivilTime, Addition) {
+ constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+ constexpr civil_second cs2 = cs1 + 50;
+ static_assert(cs2.year() == 2016, "Addition.year");
+ static_assert(cs2.month() == 1, "Addition.month");
+ static_assert(cs2.day() == 28, "Addition.day");
+ static_assert(cs2.hour() == 17, "Addition.hour");
+ static_assert(cs2.minute() == 15, "Addition.minute");
+ static_assert(cs2.second() == 2, "Addition.second");
+}
+
+TEST(CivilTime, Subtraction) {
+ constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+ constexpr civil_second cs2 = cs1 - 50;
+ static_assert(cs2.year() == 2016, "Subtraction.year");
+ static_assert(cs2.month() == 1, "Subtraction.month");
+ static_assert(cs2.day() == 28, "Subtraction.day");
+ static_assert(cs2.hour() == 17, "Subtraction.hour");
+ static_assert(cs2.minute() == 13, "Subtraction.minute");
+ static_assert(cs2.second() == 22, "Subtraction.second");
+}
+
+TEST(CivilTime, Difference) {
+ constexpr civil_day cd1(2016, 1, 28);
+ constexpr civil_day cd2(2015, 1, 28);
+ constexpr int diff = cd1 - cd2;
+ static_assert(diff == 365, "Difference");
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceWithHugeYear) {
+ {
+ constexpr civil_day d1(9223372036854775807, 1, 1);
+ constexpr civil_day d2(9223372036854775807, 12, 31);
+ static_assert(d2 - d1 == 364, "DifferenceWithHugeYear");
+ }
+ {
+ constexpr civil_day d1(-9223372036854775807 - 1, 1, 1);
+ constexpr civil_day d2(-9223372036854775807 - 1, 12, 31);
+ static_assert(d2 - d1 == 365, "DifferenceWithHugeYear");
+ }
+ {
+ // Check the limits of the return value at the end of the year range.
+ constexpr civil_day d1(9223372036854775807, 1, 1);
+ constexpr civil_day d2(9198119301927009252, 6, 6);
+ static_assert(d1 - d2 == 9223372036854775807, "DifferenceWithHugeYear");
+ static_assert((d2 - 1) - d1 == -9223372036854775807 - 1,
+ "DifferenceWithHugeYear");
+ }
+ {
+ // Check the limits of the return value at the start of the year range.
+ constexpr civil_day d1(-9223372036854775807 - 1, 1, 1);
+ constexpr civil_day d2(-9198119301927009254, 7, 28);
+ static_assert(d2 - d1 == 9223372036854775807, "DifferenceWithHugeYear");
+ static_assert(d1 - (d2 + 1) == -9223372036854775807 - 1,
+ "DifferenceWithHugeYear");
+ }
+ {
+ // Check the limits of the return value from either side of year 0.
+ constexpr civil_day d1(-12626367463883278, 9, 3);
+ constexpr civil_day d2(12626367463883277, 3, 28);
+ static_assert(d2 - d1 == 9223372036854775807, "DifferenceWithHugeYear");
+ static_assert(d1 - (d2 + 1) == -9223372036854775807 - 1,
+ "DifferenceWithHugeYear");
+ }
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceNoIntermediateOverflow) {
+ {
+ // The difference up to the minute field would be below the minimum
+ // diff_t, but the 52 extra seconds brings us back to the minimum.
+ constexpr civil_second s1(-292277022657, 1, 27, 8, 29 - 1, 52);
+ constexpr civil_second s2(1970, 1, 1, 0, 0 - 1, 0);
+ static_assert(s1 - s2 == -9223372036854775807 - 1,
+ "DifferenceNoIntermediateOverflow");
+ }
+ {
+ // The difference up to the minute field would be above the maximum
+ // diff_t, but the -53 extra seconds brings us back to the maximum.
+ constexpr civil_second s1(292277026596, 12, 4, 15, 30, 7 - 7);
+ constexpr civil_second s2(1970, 1, 1, 0, 0, 0 - 7);
+ static_assert(s1 - s2 == 9223372036854775807,
+ "DifferenceNoIntermediateOverflow");
+ }
+}
+
+// Helper constexpr tests
+
+TEST(CivilTime, WeekDay) {
+ constexpr civil_day cd(2016, 1, 28);
+ constexpr weekday wd = get_weekday(cd);
+ static_assert(wd == weekday::thursday, "Weekday");
+}
+
+TEST(CivilTime, NextWeekDay) {
+ constexpr civil_day cd(2016, 1, 28);
+ constexpr civil_day next = next_weekday(cd, weekday::thursday);
+ static_assert(next.year() == 2016, "NextWeekDay.year");
+ static_assert(next.month() == 2, "NextWeekDay.month");
+ static_assert(next.day() == 4, "NextWeekDay.day");
+}
+
+TEST(CivilTime, PrevWeekDay) {
+ constexpr civil_day cd(2016, 1, 28);
+ constexpr civil_day prev = prev_weekday(cd, weekday::thursday);
+ static_assert(prev.year() == 2016, "PrevWeekDay.year");
+ static_assert(prev.month() == 1, "PrevWeekDay.month");
+ static_assert(prev.day() == 21, "PrevWeekDay.day");
+}
+
+TEST(CivilTime, YearDay) {
+ constexpr civil_day cd(2016, 1, 28);
+ constexpr int yd = get_yearday(cd);
+ static_assert(yd == 28, "YearDay");
+}
+#endif // __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+
+// The remaining tests do not use constexpr.
+
+TEST(CivilTime, DefaultConstruction) {
+ civil_second ss;
+ EXPECT_EQ("1970-01-01T00:00:00", Format(ss));
+
+ civil_minute mm;
+ EXPECT_EQ("1970-01-01T00:00", Format(mm));
+
+ civil_hour hh;
+ EXPECT_EQ("1970-01-01T00", Format(hh));
+
+ civil_day d;
+ EXPECT_EQ("1970-01-01", Format(d));
+
+ civil_month m;
+ EXPECT_EQ("1970-01", Format(m));
+
+ civil_year y;
+ EXPECT_EQ("1970", Format(y));
+}
+
+TEST(CivilTime, StructMember) {
+ struct S {
+ civil_day day;
+ };
+ S s = {};
+ EXPECT_EQ(civil_day{}, s.day);
+}
+
+TEST(CivilTime, FieldsConstruction) {
+ EXPECT_EQ("2015-01-02T03:04:05", Format(civil_second(2015, 1, 2, 3, 4, 5)));
+ EXPECT_EQ("2015-01-02T03:04:00", Format(civil_second(2015, 1, 2, 3, 4)));
+ EXPECT_EQ("2015-01-02T03:00:00", Format(civil_second(2015, 1, 2, 3)));
+ EXPECT_EQ("2015-01-02T00:00:00", Format(civil_second(2015, 1, 2)));
+ EXPECT_EQ("2015-01-01T00:00:00", Format(civil_second(2015, 1)));
+ EXPECT_EQ("2015-01-01T00:00:00", Format(civil_second(2015)));
+
+ EXPECT_EQ("2015-01-02T03:04", Format(civil_minute(2015, 1, 2, 3, 4, 5)));
+ EXPECT_EQ("2015-01-02T03:04", Format(civil_minute(2015, 1, 2, 3, 4)));
+ EXPECT_EQ("2015-01-02T03:00", Format(civil_minute(2015, 1, 2, 3)));
+ EXPECT_EQ("2015-01-02T00:00", Format(civil_minute(2015, 1, 2)));
+ EXPECT_EQ("2015-01-01T00:00", Format(civil_minute(2015, 1)));
+ EXPECT_EQ("2015-01-01T00:00", Format(civil_minute(2015)));
+
+ EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3, 4, 5)));
+ EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3, 4)));
+ EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3)));
+ EXPECT_EQ("2015-01-02T00", Format(civil_hour(2015, 1, 2)));
+ EXPECT_EQ("2015-01-01T00", Format(civil_hour(2015, 1)));
+ EXPECT_EQ("2015-01-01T00", Format(civil_hour(2015)));
+
+ EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3, 4, 5)));
+ EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3, 4)));
+ EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3)));
+ EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2)));
+ EXPECT_EQ("2015-01-01", Format(civil_day(2015, 1)));
+ EXPECT_EQ("2015-01-01", Format(civil_day(2015)));
+
+ EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3, 4, 5)));
+ EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3, 4)));
+ EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3)));
+ EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2)));
+ EXPECT_EQ("2015-01", Format(civil_month(2015, 1)));
+ EXPECT_EQ("2015-01", Format(civil_month(2015)));
+
+ EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3, 4, 5)));
+ EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3, 4)));
+ EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3)));
+ EXPECT_EQ("2015", Format(civil_year(2015, 1, 2)));
+ EXPECT_EQ("2015", Format(civil_year(2015, 1)));
+ EXPECT_EQ("2015", Format(civil_year(2015)));
+}
+
+TEST(CivilTime, FieldsConstructionLimits) {
+ const int kIntMax = std::numeric_limits<int>::max();
+ EXPECT_EQ("2038-01-19T03:14:07",
+ Format(civil_second(1970, 1, 1, 0, 0, kIntMax)));
+ EXPECT_EQ("6121-02-11T05:21:07",
+ Format(civil_second(1970, 1, 1, 0, kIntMax, kIntMax)));
+ EXPECT_EQ("251104-11-20T12:21:07",
+ Format(civil_second(1970, 1, 1, kIntMax, kIntMax, kIntMax)));
+ EXPECT_EQ("6130715-05-30T12:21:07",
+ Format(civil_second(1970, 1, kIntMax, kIntMax, kIntMax, kIntMax)));
+ EXPECT_EQ(
+ "185087685-11-26T12:21:07",
+ Format(civil_second(1970, kIntMax, kIntMax, kIntMax, kIntMax, kIntMax)));
+
+ const int kIntMin = std::numeric_limits<int>::min();
+ EXPECT_EQ("1901-12-13T20:45:52",
+ Format(civil_second(1970, 1, 1, 0, 0, kIntMin)));
+ EXPECT_EQ("-2182-11-20T18:37:52",
+ Format(civil_second(1970, 1, 1, 0, kIntMin, kIntMin)));
+ EXPECT_EQ("-247165-02-11T10:37:52",
+ Format(civil_second(1970, 1, 1, kIntMin, kIntMin, kIntMin)));
+ EXPECT_EQ("-6126776-08-01T10:37:52",
+ Format(civil_second(1970, 1, kIntMin, kIntMin, kIntMin, kIntMin)));
+ EXPECT_EQ(
+ "-185083747-10-31T10:37:52",
+ Format(civil_second(1970, kIntMin, kIntMin, kIntMin, kIntMin, kIntMin)));
+}
+
+TEST(CivilTime, ImplicitCrossAlignment) {
+ civil_year year(2015);
+ civil_month month = year;
+ civil_day day = month;
+ civil_hour hour = day;
+ civil_minute minute = hour;
+ civil_second second = minute;
+
+ second = year;
+ EXPECT_EQ(second, year);
+ second = month;
+ EXPECT_EQ(second, month);
+ second = day;
+ EXPECT_EQ(second, day);
+ second = hour;
+ EXPECT_EQ(second, hour);
+ second = minute;
+ EXPECT_EQ(second, minute);
+
+ minute = year;
+ EXPECT_EQ(minute, year);
+ minute = month;
+ EXPECT_EQ(minute, month);
+ minute = day;
+ EXPECT_EQ(minute, day);
+ minute = hour;
+ EXPECT_EQ(minute, hour);
+
+ hour = year;
+ EXPECT_EQ(hour, year);
+ hour = month;
+ EXPECT_EQ(hour, month);
+ hour = day;
+ EXPECT_EQ(hour, day);
+
+ day = year;
+ EXPECT_EQ(day, year);
+ day = month;
+ EXPECT_EQ(day, month);
+
+ month = year;
+ EXPECT_EQ(month, year);
+
+ // Ensures unsafe conversions are not allowed.
+ EXPECT_FALSE((std::is_convertible<civil_second, civil_minute>::value));
+ EXPECT_FALSE((std::is_convertible<civil_second, civil_hour>::value));
+ EXPECT_FALSE((std::is_convertible<civil_second, civil_day>::value));
+ EXPECT_FALSE((std::is_convertible<civil_second, civil_month>::value));
+ EXPECT_FALSE((std::is_convertible<civil_second, civil_year>::value));
+
+ EXPECT_FALSE((std::is_convertible<civil_minute, civil_hour>::value));
+ EXPECT_FALSE((std::is_convertible<civil_minute, civil_day>::value));
+ EXPECT_FALSE((std::is_convertible<civil_minute, civil_month>::value));
+ EXPECT_FALSE((std::is_convertible<civil_minute, civil_year>::value));
+
+ EXPECT_FALSE((std::is_convertible<civil_hour, civil_day>::value));
+ EXPECT_FALSE((std::is_convertible<civil_hour, civil_month>::value));
+ EXPECT_FALSE((std::is_convertible<civil_hour, civil_year>::value));
+
+ EXPECT_FALSE((std::is_convertible<civil_day, civil_month>::value));
+ EXPECT_FALSE((std::is_convertible<civil_day, civil_year>::value));
+
+ EXPECT_FALSE((std::is_convertible<civil_month, civil_year>::value));
+}
+
+TEST(CivilTime, ExplicitCrossAlignment) {
+ //
+ // Assign from smaller units -> larger units
+ //
+
+ civil_second second(2015, 1, 2, 3, 4, 5);
+ EXPECT_EQ("2015-01-02T03:04:05", Format(second));
+
+ civil_minute minute(second);
+ EXPECT_EQ("2015-01-02T03:04", Format(minute));
+
+ civil_hour hour(minute);
+ EXPECT_EQ("2015-01-02T03", Format(hour));
+
+ civil_day day(hour);
+ EXPECT_EQ("2015-01-02", Format(day));
+
+ civil_month month(day);
+ EXPECT_EQ("2015-01", Format(month));
+
+ civil_year year(month);
+ EXPECT_EQ("2015", Format(year));
+
+ //
+ // Now assign from larger units -> smaller units
+ //
+
+ month = civil_month(year);
+ EXPECT_EQ("2015-01", Format(month));
+
+ day = civil_day(month);
+ EXPECT_EQ("2015-01-01", Format(day));
+
+ hour = civil_hour(day);
+ EXPECT_EQ("2015-01-01T00", Format(hour));
+
+ minute = civil_minute(hour);
+ EXPECT_EQ("2015-01-01T00:00", Format(minute));
+
+ second = civil_second(minute);
+ EXPECT_EQ("2015-01-01T00:00:00", Format(second));
+}
+
+// Metafunction to test whether difference is allowed between two types.
+template <typename T1, typename T2>
+struct HasDifference {
+ template <typename U1, typename U2>
+ static std::false_type test(...);
+ template <typename U1, typename U2>
+ static std::true_type test(decltype(std::declval<U1>() - std::declval<U2>()));
+ static constexpr bool value = decltype(test<T1, T2>(0))::value;
+};
+
+TEST(CivilTime, DisallowCrossAlignedDifference) {
+ // Difference is allowed between types with the same alignment.
+ static_assert(HasDifference<civil_second, civil_second>::value, "");
+ static_assert(HasDifference<civil_minute, civil_minute>::value, "");
+ static_assert(HasDifference<civil_hour, civil_hour>::value, "");
+ static_assert(HasDifference<civil_day, civil_day>::value, "");
+ static_assert(HasDifference<civil_month, civil_month>::value, "");
+ static_assert(HasDifference<civil_year, civil_year>::value, "");
+
+ // Difference is disallowed between types with different alignments.
+ static_assert(!HasDifference<civil_second, civil_minute>::value, "");
+ static_assert(!HasDifference<civil_second, civil_hour>::value, "");
+ static_assert(!HasDifference<civil_second, civil_day>::value, "");
+ static_assert(!HasDifference<civil_second, civil_month>::value, "");
+ static_assert(!HasDifference<civil_second, civil_year>::value, "");
+
+ static_assert(!HasDifference<civil_minute, civil_hour>::value, "");
+ static_assert(!HasDifference<civil_minute, civil_day>::value, "");
+ static_assert(!HasDifference<civil_minute, civil_month>::value, "");
+ static_assert(!HasDifference<civil_minute, civil_year>::value, "");
+
+ static_assert(!HasDifference<civil_hour, civil_day>::value, "");
+ static_assert(!HasDifference<civil_hour, civil_month>::value, "");
+ static_assert(!HasDifference<civil_hour, civil_year>::value, "");
+
+ static_assert(!HasDifference<civil_day, civil_month>::value, "");
+ static_assert(!HasDifference<civil_day, civil_year>::value, "");
+
+ static_assert(!HasDifference<civil_month, civil_year>::value, "");
+}
+
+TEST(CivilTime, ValueSemantics) {
+ const civil_hour a(2015, 1, 2, 3);
+ const civil_hour b = a;
+ const civil_hour c(b);
+ civil_hour d;
+ d = c;
+ EXPECT_EQ("2015-01-02T03", Format(d));
+}
+
+TEST(CivilTime, Relational) {
+ // Tests that the alignment unit is ignored in comparison.
+ const civil_year year(2014);
+ const civil_month month(year);
+ EXPECT_EQ(year, month);
+
+#define TEST_RELATIONAL(OLDER, YOUNGER) \
+ do { \
+ EXPECT_FALSE(OLDER < OLDER); \
+ EXPECT_FALSE(OLDER > OLDER); \
+ EXPECT_TRUE(OLDER >= OLDER); \
+ EXPECT_TRUE(OLDER <= OLDER); \
+ EXPECT_FALSE(YOUNGER < YOUNGER); \
+ EXPECT_FALSE(YOUNGER > YOUNGER); \
+ EXPECT_TRUE(YOUNGER >= YOUNGER); \
+ EXPECT_TRUE(YOUNGER <= YOUNGER); \
+ EXPECT_EQ(OLDER, OLDER); \
+ EXPECT_NE(OLDER, YOUNGER); \
+ EXPECT_LT(OLDER, YOUNGER); \
+ EXPECT_LE(OLDER, YOUNGER); \
+ EXPECT_GT(YOUNGER, OLDER); \
+ EXPECT_GE(YOUNGER, OLDER); \
+ } while (0)
+
+ // Alignment is ignored in comparison (verified above), so kSecond is used
+ // to test comparison in all field positions.
+ TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+ civil_second(2015, 1, 1, 0, 0, 0));
+ TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+ civil_second(2014, 2, 1, 0, 0, 0));
+ TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+ civil_second(2014, 1, 2, 0, 0, 0));
+ TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+ civil_second(2014, 1, 1, 1, 0, 0));
+ TEST_RELATIONAL(civil_second(2014, 1, 1, 1, 0, 0),
+ civil_second(2014, 1, 1, 1, 1, 0));
+ TEST_RELATIONAL(civil_second(2014, 1, 1, 1, 1, 0),
+ civil_second(2014, 1, 1, 1, 1, 1));
+
+ // Tests the relational operators of two different civil-time types.
+ TEST_RELATIONAL(civil_day(2014, 1, 1), civil_minute(2014, 1, 1, 1, 1));
+ TEST_RELATIONAL(civil_day(2014, 1, 1), civil_month(2014, 2));
+
+#undef TEST_RELATIONAL
+}
+
+TEST(CivilTime, Arithmetic) {
+ civil_second second(2015, 1, 2, 3, 4, 5);
+ EXPECT_EQ("2015-01-02T03:04:06", Format(second += 1));
+ EXPECT_EQ("2015-01-02T03:04:07", Format(second + 1));
+ EXPECT_EQ("2015-01-02T03:04:08", Format(2 + second));
+ EXPECT_EQ("2015-01-02T03:04:05", Format(second - 1));
+ EXPECT_EQ("2015-01-02T03:04:05", Format(second -= 1));
+ EXPECT_EQ("2015-01-02T03:04:05", Format(second++));
+ EXPECT_EQ("2015-01-02T03:04:07", Format(++second));
+ EXPECT_EQ("2015-01-02T03:04:07", Format(second--));
+ EXPECT_EQ("2015-01-02T03:04:05", Format(--second));
+
+ civil_minute minute(2015, 1, 2, 3, 4);
+ EXPECT_EQ("2015-01-02T03:05", Format(minute += 1));
+ EXPECT_EQ("2015-01-02T03:06", Format(minute + 1));
+ EXPECT_EQ("2015-01-02T03:07", Format(2 + minute));
+ EXPECT_EQ("2015-01-02T03:04", Format(minute - 1));
+ EXPECT_EQ("2015-01-02T03:04", Format(minute -= 1));
+ EXPECT_EQ("2015-01-02T03:04", Format(minute++));
+ EXPECT_EQ("2015-01-02T03:06", Format(++minute));
+ EXPECT_EQ("2015-01-02T03:06", Format(minute--));
+ EXPECT_EQ("2015-01-02T03:04", Format(--minute));
+
+ civil_hour hour(2015, 1, 2, 3);
+ EXPECT_EQ("2015-01-02T04", Format(hour += 1));
+ EXPECT_EQ("2015-01-02T05", Format(hour + 1));
+ EXPECT_EQ("2015-01-02T06", Format(2 + hour));
+ EXPECT_EQ("2015-01-02T03", Format(hour - 1));
+ EXPECT_EQ("2015-01-02T03", Format(hour -= 1));
+ EXPECT_EQ("2015-01-02T03", Format(hour++));
+ EXPECT_EQ("2015-01-02T05", Format(++hour));
+ EXPECT_EQ("2015-01-02T05", Format(hour--));
+ EXPECT_EQ("2015-01-02T03", Format(--hour));
+
+ civil_day day(2015, 1, 2);
+ EXPECT_EQ("2015-01-03", Format(day += 1));
+ EXPECT_EQ("2015-01-04", Format(day + 1));
+ EXPECT_EQ("2015-01-05", Format(2 + day));
+ EXPECT_EQ("2015-01-02", Format(day - 1));
+ EXPECT_EQ("2015-01-02", Format(day -= 1));
+ EXPECT_EQ("2015-01-02", Format(day++));
+ EXPECT_EQ("2015-01-04", Format(++day));
+ EXPECT_EQ("2015-01-04", Format(day--));
+ EXPECT_EQ("2015-01-02", Format(--day));
+
+ civil_month month(2015, 1);
+ EXPECT_EQ("2015-02", Format(month += 1));
+ EXPECT_EQ("2015-03", Format(month + 1));
+ EXPECT_EQ("2015-04", Format(2 + month));
+ EXPECT_EQ("2015-01", Format(month - 1));
+ EXPECT_EQ("2015-01", Format(month -= 1));
+ EXPECT_EQ("2015-01", Format(month++));
+ EXPECT_EQ("2015-03", Format(++month));
+ EXPECT_EQ("2015-03", Format(month--));
+ EXPECT_EQ("2015-01", Format(--month));
+
+ civil_year year(2015);
+ EXPECT_EQ("2016", Format(year += 1));
+ EXPECT_EQ("2017", Format(year + 1));
+ EXPECT_EQ("2018", Format(2 + year));
+ EXPECT_EQ("2015", Format(year - 1));
+ EXPECT_EQ("2015", Format(year -= 1));
+ EXPECT_EQ("2015", Format(year++));
+ EXPECT_EQ("2017", Format(++year));
+ EXPECT_EQ("2017", Format(year--));
+ EXPECT_EQ("2015", Format(--year));
+}
+
+TEST(CivilTime, ArithmeticLimits) {
+ const int kIntMax = std::numeric_limits<int>::max();
+ const int kIntMin = std::numeric_limits<int>::min();
+
+ civil_second second(1970, 1, 1, 0, 0, 0);
+ second += kIntMax;
+ EXPECT_EQ("2038-01-19T03:14:07", Format(second));
+ second -= kIntMax;
+ EXPECT_EQ("1970-01-01T00:00:00", Format(second));
+ second += kIntMin;
+ EXPECT_EQ("1901-12-13T20:45:52", Format(second));
+ second -= kIntMin;
+ EXPECT_EQ("1970-01-01T00:00:00", Format(second));
+
+ civil_minute minute(1970, 1, 1, 0, 0);
+ minute += kIntMax;
+ EXPECT_EQ("6053-01-23T02:07", Format(minute));
+ minute -= kIntMax;
+ EXPECT_EQ("1970-01-01T00:00", Format(minute));
+ minute += kIntMin;
+ EXPECT_EQ("-2114-12-08T21:52", Format(minute));
+ minute -= kIntMin;
+ EXPECT_EQ("1970-01-01T00:00", Format(minute));
+
+ civil_hour hour(1970, 1, 1, 0);
+ hour += kIntMax;
+ EXPECT_EQ("246953-10-09T07", Format(hour));
+ hour -= kIntMax;
+ EXPECT_EQ("1970-01-01T00", Format(hour));
+ hour += kIntMin;
+ EXPECT_EQ("-243014-03-24T16", Format(hour));
+ hour -= kIntMin;
+ EXPECT_EQ("1970-01-01T00", Format(hour));
+
+ civil_day day(1970, 1, 1);
+ day += kIntMax;
+ EXPECT_EQ("5881580-07-11", Format(day));
+ day -= kIntMax;
+ EXPECT_EQ("1970-01-01", Format(day));
+ day += kIntMin;
+ EXPECT_EQ("-5877641-06-23", Format(day));
+ day -= kIntMin;
+ EXPECT_EQ("1970-01-01", Format(day));
+
+ civil_month month(1970, 1);
+ month += kIntMax;
+ EXPECT_EQ("178958940-08", Format(month));
+ month -= kIntMax;
+ EXPECT_EQ("1970-01", Format(month));
+ month += kIntMin;
+ EXPECT_EQ("-178955001-05", Format(month));
+ month -= kIntMin;
+ EXPECT_EQ("1970-01", Format(month));
+
+ civil_year year(0);
+ year += kIntMax;
+ EXPECT_EQ("2147483647", Format(year));
+ year -= kIntMax;
+ EXPECT_EQ("0", Format(year));
+ year += kIntMin;
+ EXPECT_EQ("-2147483648", Format(year));
+ year -= kIntMin;
+ EXPECT_EQ("0", Format(year));
+}
+
+TEST(CivilTime, ArithmeticDifference) {
+ civil_second second(2015, 1, 2, 3, 4, 5);
+ EXPECT_EQ(0, second - second);
+ EXPECT_EQ(10, (second + 10) - second);
+ EXPECT_EQ(-10, (second - 10) - second);
+
+ civil_minute minute(2015, 1, 2, 3, 4);
+ EXPECT_EQ(0, minute - minute);
+ EXPECT_EQ(10, (minute + 10) - minute);
+ EXPECT_EQ(-10, (minute - 10) - minute);
+
+ civil_hour hour(2015, 1, 2, 3);
+ EXPECT_EQ(0, hour - hour);
+ EXPECT_EQ(10, (hour + 10) - hour);
+ EXPECT_EQ(-10, (hour - 10) - hour);
+
+ civil_day day(2015, 1, 2);
+ EXPECT_EQ(0, day - day);
+ EXPECT_EQ(10, (day + 10) - day);
+ EXPECT_EQ(-10, (day - 10) - day);
+
+ civil_month month(2015, 1);
+ EXPECT_EQ(0, month - month);
+ EXPECT_EQ(10, (month + 10) - month);
+ EXPECT_EQ(-10, (month - 10) - month);
+
+ civil_year year(2015);
+ EXPECT_EQ(0, year - year);
+ EXPECT_EQ(10, (year + 10) - year);
+ EXPECT_EQ(-10, (year - 10) - year);
+}
+
+TEST(CivilTime, DifferenceLimits) {
+ const int kIntMax = std::numeric_limits<int>::max();
+ const int kIntMin = std::numeric_limits<int>::min();
+
+ // Check day arithmetic at the end of the year range.
+ const civil_day max_day(kIntMax, 12, 31);
+ EXPECT_EQ(1, max_day - (max_day - 1));
+ EXPECT_EQ(-1, (max_day - 1) - max_day);
+
+ // Check day arithmetic at the end of the year range.
+ const civil_day min_day(kIntMin, 1, 1);
+ EXPECT_EQ(1, (min_day + 1) - min_day);
+ EXPECT_EQ(-1, min_day - (min_day + 1));
+
+ // Check the limits of the return value.
+ const civil_day d1(1970, 1, 1);
+ const civil_day d2(5881580, 7, 11);
+ EXPECT_EQ(kIntMax, d2 - d1);
+ EXPECT_EQ(kIntMin, d1 - (d2 + 1));
+}
+
+TEST(CivilTime, Properties) {
+ civil_second ss(2015, 2, 3, 4, 5, 6);
+ EXPECT_EQ(2015, ss.year());
+ EXPECT_EQ(2, ss.month());
+ EXPECT_EQ(3, ss.day());
+ EXPECT_EQ(4, ss.hour());
+ EXPECT_EQ(5, ss.minute());
+ EXPECT_EQ(6, ss.second());
+ EXPECT_EQ(weekday::tuesday, get_weekday(ss));
+ EXPECT_EQ(34, get_yearday(ss));
+
+ civil_minute mm(2015, 2, 3, 4, 5, 6);
+ EXPECT_EQ(2015, mm.year());
+ EXPECT_EQ(2, mm.month());
+ EXPECT_EQ(3, mm.day());
+ EXPECT_EQ(4, mm.hour());
+ EXPECT_EQ(5, mm.minute());
+ EXPECT_EQ(0, mm.second());
+ EXPECT_EQ(weekday::tuesday, get_weekday(mm));
+ EXPECT_EQ(34, get_yearday(mm));
+
+ civil_hour hh(2015, 2, 3, 4, 5, 6);
+ EXPECT_EQ(2015, hh.year());
+ EXPECT_EQ(2, hh.month());
+ EXPECT_EQ(3, hh.day());
+ EXPECT_EQ(4, hh.hour());
+ EXPECT_EQ(0, hh.minute());
+ EXPECT_EQ(0, hh.second());
+ EXPECT_EQ(weekday::tuesday, get_weekday(hh));
+ EXPECT_EQ(34, get_yearday(hh));
+
+ civil_day d(2015, 2, 3, 4, 5, 6);
+ EXPECT_EQ(2015, d.year());
+ EXPECT_EQ(2, d.month());
+ EXPECT_EQ(3, d.day());
+ EXPECT_EQ(0, d.hour());
+ EXPECT_EQ(0, d.minute());
+ EXPECT_EQ(0, d.second());
+ EXPECT_EQ(weekday::tuesday, get_weekday(d));
+ EXPECT_EQ(34, get_yearday(d));
+
+ civil_month m(2015, 2, 3, 4, 5, 6);
+ EXPECT_EQ(2015, m.year());
+ EXPECT_EQ(2, m.month());
+ EXPECT_EQ(1, m.day());
+ EXPECT_EQ(0, m.hour());
+ EXPECT_EQ(0, m.minute());
+ EXPECT_EQ(0, m.second());
+ EXPECT_EQ(weekday::sunday, get_weekday(m));
+ EXPECT_EQ(32, get_yearday(m));
+
+ civil_year y(2015, 2, 3, 4, 5, 6);
+ EXPECT_EQ(2015, y.year());
+ EXPECT_EQ(1, y.month());
+ EXPECT_EQ(1, y.day());
+ EXPECT_EQ(0, y.hour());
+ EXPECT_EQ(0, y.minute());
+ EXPECT_EQ(0, y.second());
+ EXPECT_EQ(weekday::thursday, get_weekday(y));
+ EXPECT_EQ(1, get_yearday(y));
+}
+
+TEST(CivilTime, OutputStream) {
+ // Tests formatting of civil_year, which does not pad.
+ EXPECT_EQ("2016", Format(civil_year(2016)));
+ EXPECT_EQ("123", Format(civil_year(123)));
+ EXPECT_EQ("0", Format(civil_year(0)));
+ EXPECT_EQ("-1", Format(civil_year(-1)));
+
+ // Tests formatting of sub-year types, which pad to 2 digits
+ EXPECT_EQ("2016-02", Format(civil_month(2016, 2)));
+ EXPECT_EQ("2016-02-03", Format(civil_day(2016, 2, 3)));
+ EXPECT_EQ("2016-02-03T04", Format(civil_hour(2016, 2, 3, 4)));
+ EXPECT_EQ("2016-02-03T04:05", Format(civil_minute(2016, 2, 3, 4, 5)));
+ EXPECT_EQ("2016-02-03T04:05:06", Format(civil_second(2016, 2, 3, 4, 5, 6)));
+
+ // Tests formatting of weekday.
+ EXPECT_EQ("Monday", Format(weekday::monday));
+ EXPECT_EQ("Tuesday", Format(weekday::tuesday));
+ EXPECT_EQ("Wednesday", Format(weekday::wednesday));
+ EXPECT_EQ("Thursday", Format(weekday::thursday));
+ EXPECT_EQ("Friday", Format(weekday::friday));
+ EXPECT_EQ("Saturday", Format(weekday::saturday));
+ EXPECT_EQ("Sunday", Format(weekday::sunday));
+}
+
+TEST(CivilTime, OutputStreamLeftFillWidth) {
+ civil_second cs(2016, 2, 3, 4, 5, 6);
+ {
+ std::stringstream ss;
+ ss << std::left << std::setfill('.');
+ ss << std::setw(3) << 'X';
+ ss << std::setw(21) << civil_year(cs);
+ ss << std::setw(3) << 'X';
+ EXPECT_EQ("X..2016.................X..", ss.str());
+ }
+ {
+ std::stringstream ss;
+ ss << std::left << std::setfill('.');
+ ss << std::setw(3) << 'X';
+ ss << std::setw(21) << civil_month(cs);
+ ss << std::setw(3) << 'X';
+ EXPECT_EQ("X..2016-02..............X..", ss.str());
+ }
+ {
+ std::stringstream ss;
+ ss << std::left << std::setfill('.');
+ ss << std::setw(3) << 'X';
+ ss << std::setw(21) << civil_day(cs);
+ ss << std::setw(3) << 'X';
+ EXPECT_EQ("X..2016-02-03...........X..", ss.str());
+ }
+ {
+ std::stringstream ss;
+ ss << std::left << std::setfill('.');
+ ss << std::setw(3) << 'X';
+ ss << std::setw(21) << civil_hour(cs);
+ ss << std::setw(3) << 'X';
+ EXPECT_EQ("X..2016-02-03T04........X..", ss.str());
+ }
+ {
+ std::stringstream ss;
+ ss << std::left << std::setfill('.');
+ ss << std::setw(3) << 'X';
+ ss << std::setw(21) << civil_minute(cs);
+ ss << std::setw(3) << 'X';
+ EXPECT_EQ("X..2016-02-03T04:05.....X..", ss.str());
+ }
+ {
+ std::stringstream ss;
+ ss << std::left << std::setfill('.');
+ ss << std::setw(3) << 'X';
+ ss << std::setw(21) << civil_second(cs);
+ ss << std::setw(3) << 'X';
+ EXPECT_EQ("X..2016-02-03T04:05:06..X..", ss.str());
+ }
+}
+
+TEST(CivilTime, NextPrevWeekday) {
+ // Jan 1, 1970 was a Thursday.
+ const civil_day thursday(1970, 1, 1);
+ EXPECT_EQ(weekday::thursday, get_weekday(thursday));
+
+ // Thursday -> Thursday
+ civil_day d = next_weekday(thursday, weekday::thursday);
+ EXPECT_EQ(7, d - thursday) << Format(d);
+ EXPECT_EQ(d - 14, prev_weekday(thursday, weekday::thursday));
+
+ // Thursday -> Friday
+ d = next_weekday(thursday, weekday::friday);
+ EXPECT_EQ(1, d - thursday) << Format(d);
+ EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::friday));
+
+ // Thursday -> Saturday
+ d = next_weekday(thursday, weekday::saturday);
+ EXPECT_EQ(2, d - thursday) << Format(d);
+ EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::saturday));
+
+ // Thursday -> Sunday
+ d = next_weekday(thursday, weekday::sunday);
+ EXPECT_EQ(3, d - thursday) << Format(d);
+ EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::sunday));
+
+ // Thursday -> Monday
+ d = next_weekday(thursday, weekday::monday);
+ EXPECT_EQ(4, d - thursday) << Format(d);
+ EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::monday));
+
+ // Thursday -> Tuesday
+ d = next_weekday(thursday, weekday::tuesday);
+ EXPECT_EQ(5, d - thursday) << Format(d);
+ EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::tuesday));
+
+ // Thursday -> Wednesday
+ d = next_weekday(thursday, weekday::wednesday);
+ EXPECT_EQ(6, d - thursday) << Format(d);
+ EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::wednesday));
+}
+
+TEST(CivilTime, NormalizeWithHugeYear) {
+ civil_month c(9223372036854775807, 1);
+ EXPECT_EQ("9223372036854775807-01", Format(c));
+ c = c - 1; // Causes normalization
+ EXPECT_EQ("9223372036854775806-12", Format(c));
+
+ c = civil_month(-9223372036854775807 - 1, 1);
+ EXPECT_EQ("-9223372036854775808-01", Format(c));
+ c = c + 12; // Causes normalization
+ EXPECT_EQ("-9223372036854775807-01", Format(c));
+}
+
+TEST(CivilTime, LeapYears) {
+ // Test data for leap years.
+ const struct {
+ int year;
+ int days;
+ struct {
+ int month;
+ int day;
+ } leap_day; // The date of the day after Feb 28.
+ } kLeapYearTable[]{
+ {1900, 365, {3, 1}}, {1999, 365, {3, 1}},
+ {2000, 366, {2, 29}}, // leap year
+ {2001, 365, {3, 1}}, {2002, 365, {3, 1}},
+ {2003, 365, {3, 1}}, {2004, 366, {2, 29}}, // leap year
+ {2005, 365, {3, 1}}, {2006, 365, {3, 1}},
+ {2007, 365, {3, 1}}, {2008, 366, {2, 29}}, // leap year
+ {2009, 365, {3, 1}}, {2100, 365, {3, 1}},
+ };
+
+ for (const auto& e : kLeapYearTable) {
+ // Tests incrementing through the leap day.
+ const civil_day feb28(e.year, 2, 28);
+ const civil_day next_day = feb28 + 1;
+ EXPECT_EQ(e.leap_day.month, next_day.month());
+ EXPECT_EQ(e.leap_day.day, next_day.day());
+
+ // Tests difference in days of leap years.
+ const civil_year year(feb28);
+ const civil_year next_year = year + 1;
+ EXPECT_EQ(e.days, civil_day(next_year) - civil_day(year));
+ }
+}
+
+TEST(CivilTime, FirstThursdayInMonth) {
+ const civil_day nov1(2014, 11, 1);
+ const civil_day thursday = next_weekday(nov1 - 1, weekday::thursday);
+ EXPECT_EQ("2014-11-06", Format(thursday));
+
+ // Bonus: Date of Thanksgiving in the United States
+ // Rule: Fourth Thursday of November
+ const civil_day thanksgiving = thursday + 7 * 3;
+ EXPECT_EQ("2014-11-27", Format(thanksgiving));
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.cc
new file mode 100644
index 0000000000..303c0244a8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.cc
@@ -0,0 +1,140 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "time_zone_fixed.h"
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <cstring>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// The prefix used for the internal names of fixed-offset zones.
+const char kFixedZonePrefix[] = "Fixed/UTC";
+
+const char kDigits[] = "0123456789";
+
+char* Format02d(char* p, int v) {
+ *p++ = kDigits[(v / 10) % 10];
+ *p++ = kDigits[v % 10];
+ return p;
+}
+
+int Parse02d(const char* p) {
+ if (const char* ap = std::strchr(kDigits, *p)) {
+ int v = static_cast<int>(ap - kDigits);
+ if (const char* bp = std::strchr(kDigits, *++p)) {
+ return (v * 10) + static_cast<int>(bp - kDigits);
+ }
+ }
+ return -1;
+}
+
+} // namespace
+
+bool FixedOffsetFromName(const std::string& name, seconds* offset) {
+ if (name.compare(0, std::string::npos, "UTC", 3) == 0) {
+ *offset = seconds::zero();
+ return true;
+ }
+
+ const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+ const char* const ep = kFixedZonePrefix + prefix_len;
+ if (name.size() != prefix_len + 9) // <prefix>+99:99:99
+ return false;
+ if (!std::equal(kFixedZonePrefix, ep, name.begin())) return false;
+ const char* np = name.data() + prefix_len;
+ if (np[0] != '+' && np[0] != '-') return false;
+ if (np[3] != ':' || np[6] != ':') // see note below about large offsets
+ return false;
+
+ int hours = Parse02d(np + 1);
+ if (hours == -1) return false;
+ int mins = Parse02d(np + 4);
+ if (mins == -1) return false;
+ int secs = Parse02d(np + 7);
+ if (secs == -1) return false;
+
+ secs += ((hours * 60) + mins) * 60;
+ if (secs > 24 * 60 * 60) return false; // outside supported offset range
+ *offset = seconds(secs * (np[0] == '-' ? -1 : 1)); // "-" means west
+ return true;
+}
+
+std::string FixedOffsetToName(const seconds& offset) {
+ if (offset == seconds::zero()) return "UTC";
+ if (offset < std::chrono::hours(-24) || offset > std::chrono::hours(24)) {
+ // We don't support fixed-offset zones more than 24 hours
+ // away from UTC to avoid complications in rendering such
+ // offsets and to (somewhat) limit the total number of zones.
+ return "UTC";
+ }
+ int offset_seconds = static_cast<int>(offset.count());
+ const char sign = (offset_seconds < 0 ? '-' : '+');
+ int offset_minutes = offset_seconds / 60;
+ offset_seconds %= 60;
+ if (sign == '-') {
+ if (offset_seconds > 0) {
+ offset_seconds -= 60;
+ offset_minutes += 1;
+ }
+ offset_seconds = -offset_seconds;
+ offset_minutes = -offset_minutes;
+ }
+ int offset_hours = offset_minutes / 60;
+ offset_minutes %= 60;
+ const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+ char buf[prefix_len + sizeof("-24:00:00")];
+ char* ep = std::copy(kFixedZonePrefix, kFixedZonePrefix + prefix_len, buf);
+ *ep++ = sign;
+ ep = Format02d(ep, offset_hours);
+ *ep++ = ':';
+ ep = Format02d(ep, offset_minutes);
+ *ep++ = ':';
+ ep = Format02d(ep, offset_seconds);
+ *ep++ = '\0';
+ assert(ep == buf + sizeof(buf));
+ return buf;
+}
+
+std::string FixedOffsetToAbbr(const seconds& offset) {
+ std::string abbr = FixedOffsetToName(offset);
+ const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+ if (abbr.size() == prefix_len + 9) { // <prefix>+99:99:99
+ abbr.erase(0, prefix_len); // +99:99:99
+ abbr.erase(6, 1); // +99:9999
+ abbr.erase(3, 1); // +999999
+ if (abbr[5] == '0' && abbr[6] == '0') { // +999900
+ abbr.erase(5, 2); // +9999
+ if (abbr[3] == '0' && abbr[4] == '0') { // +9900
+ abbr.erase(3, 2); // +99
+ }
+ }
+ }
+ return abbr;
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.h
new file mode 100644
index 0000000000..e74a0bbd9d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_fixed.h
@@ -0,0 +1,52 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
+
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Helper functions for dealing with the names and abbreviations
+// of time zones that are a fixed offset (seconds east) from UTC.
+// FixedOffsetFromName() extracts the offset from a valid fixed-offset
+// name, while FixedOffsetToName() and FixedOffsetToAbbr() generate
+// the canonical zone name and abbreviation respectively for the given
+// offset.
+//
+// A fixed-offset name looks like "Fixed/UTC<+-><hours>:<mins>:<secs>".
+// Its abbreviation is of the form "UTC(<+->H?H(MM(SS)?)?)?" where the
+// optional pieces are omitted when their values are zero. (Note that
+// the sign is the opposite of that used in a POSIX TZ specification.)
+//
+// Note: FixedOffsetFromName() fails on syntax errors or when the parsed
+// offset exceeds 24 hours. FixedOffsetToName() and FixedOffsetToAbbr()
+// both produce "UTC" when the argument offset exceeds 24 hours.
+bool FixedOffsetFromName(const std::string& name, seconds* offset);
+std::string FixedOffsetToName(const seconds& offset);
+std::string FixedOffsetToAbbr(const seconds& offset);
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format.cc
new file mode 100644
index 0000000000..950b23a1d2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format.cc
@@ -0,0 +1,922 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#if !defined(HAS_STRPTIME)
+#if !defined(_MSC_VER) && !defined(__MINGW32__)
+#define HAS_STRPTIME 1 // assume everyone has strptime() except windows
+#endif
+#endif
+
+#if defined(HAS_STRPTIME) && HAS_STRPTIME
+#if !defined(_XOPEN_SOURCE)
+#define _XOPEN_SOURCE // Definedness suffices for strptime.
+#endif
+#endif
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+// Include time.h directly since, by C++ standards, ctime doesn't have to
+// declare strptime.
+#include <time.h>
+
+#include <cctype>
+#include <chrono>
+#include <cstddef>
+#include <cstdint>
+#include <cstring>
+#include <ctime>
+#include <limits>
+#include <string>
+#include <vector>
+#if !HAS_STRPTIME
+#include <iomanip>
+#include <sstream>
+#endif
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "time_zone_if.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+namespace detail {
+
+namespace {
+
+#if !HAS_STRPTIME
+// Build a strptime() using C++11's std::get_time().
+char* strptime(const char* s, const char* fmt, std::tm* tm) {
+ std::istringstream input(s);
+ input >> std::get_time(tm, fmt);
+ if (input.fail()) return nullptr;
+ return const_cast<char*>(s) +
+ (input.eof() ? strlen(s) : static_cast<std::size_t>(input.tellg()));
+}
+#endif
+
+std::tm ToTM(const time_zone::absolute_lookup& al) {
+ std::tm tm{};
+ tm.tm_sec = al.cs.second();
+ tm.tm_min = al.cs.minute();
+ tm.tm_hour = al.cs.hour();
+ tm.tm_mday = al.cs.day();
+ tm.tm_mon = al.cs.month() - 1;
+
+ // Saturate tm.tm_year is cases of over/underflow.
+ if (al.cs.year() < std::numeric_limits<int>::min() + 1900) {
+ tm.tm_year = std::numeric_limits<int>::min();
+ } else if (al.cs.year() - 1900 > std::numeric_limits<int>::max()) {
+ tm.tm_year = std::numeric_limits<int>::max();
+ } else {
+ tm.tm_year = static_cast<int>(al.cs.year() - 1900);
+ }
+
+ switch (get_weekday(al.cs)) {
+ case weekday::sunday:
+ tm.tm_wday = 0;
+ break;
+ case weekday::monday:
+ tm.tm_wday = 1;
+ break;
+ case weekday::tuesday:
+ tm.tm_wday = 2;
+ break;
+ case weekday::wednesday:
+ tm.tm_wday = 3;
+ break;
+ case weekday::thursday:
+ tm.tm_wday = 4;
+ break;
+ case weekday::friday:
+ tm.tm_wday = 5;
+ break;
+ case weekday::saturday:
+ tm.tm_wday = 6;
+ break;
+ }
+ tm.tm_yday = get_yearday(al.cs) - 1;
+ tm.tm_isdst = al.is_dst ? 1 : 0;
+ return tm;
+}
+
+const char kDigits[] = "0123456789";
+
+// Formats a 64-bit integer in the given field width. Note that it is up
+// to the caller of Format64() [and Format02d()/FormatOffset()] to ensure
+// that there is sufficient space before ep to hold the conversion.
+char* Format64(char* ep, int width, std::int_fast64_t v) {
+ bool neg = false;
+ if (v < 0) {
+ --width;
+ neg = true;
+ if (v == std::numeric_limits<std::int_fast64_t>::min()) {
+ // Avoid negating minimum value.
+ std::int_fast64_t last_digit = -(v % 10);
+ v /= 10;
+ if (last_digit < 0) {
+ ++v;
+ last_digit += 10;
+ }
+ --width;
+ *--ep = kDigits[last_digit];
+ }
+ v = -v;
+ }
+ do {
+ --width;
+ *--ep = kDigits[v % 10];
+ } while (v /= 10);
+ while (--width >= 0) *--ep = '0'; // zero pad
+ if (neg) *--ep = '-';
+ return ep;
+}
+
+// Formats [0 .. 99] as %02d.
+char* Format02d(char* ep, int v) {
+ *--ep = kDigits[v % 10];
+ *--ep = kDigits[(v / 10) % 10];
+ return ep;
+}
+
+// Formats a UTC offset, like +00:00.
+char* FormatOffset(char* ep, int offset, const char* mode) {
+ // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+ // generate a "negative zero" when we're formatting a zero offset
+ // as the result of a failed load_time_zone().
+ char sign = '+';
+ if (offset < 0) {
+ offset = -offset; // bounded by 24h so no overflow
+ sign = '-';
+ }
+ const int seconds = offset % 60;
+ const int minutes = (offset /= 60) % 60;
+ const int hours = offset /= 60;
+ const char sep = mode[0];
+ const bool ext = (sep != '\0' && mode[1] == '*');
+ const bool ccc = (ext && mode[2] == ':');
+ if (ext && (!ccc || seconds != 0)) {
+ ep = Format02d(ep, seconds);
+ *--ep = sep;
+ } else {
+ // If we're not rendering seconds, sub-minute negative offsets
+ // should get a positive sign (e.g., offset=-10s => "+00:00").
+ if (hours == 0 && minutes == 0) sign = '+';
+ }
+ if (!ccc || minutes != 0 || seconds != 0) {
+ ep = Format02d(ep, minutes);
+ if (sep != '\0') *--ep = sep;
+ }
+ ep = Format02d(ep, hours);
+ *--ep = sign;
+ return ep;
+}
+
+// Formats a std::tm using strftime(3).
+void FormatTM(std::string* out, const std::string& fmt, const std::tm& tm) {
+ // strftime(3) returns the number of characters placed in the output
+ // array (which may be 0 characters). It also returns 0 to indicate
+ // an error, like the array wasn't large enough. To accommodate this,
+ // the following code grows the buffer size from 2x the format std::string
+ // length up to 32x.
+ for (std::size_t i = 2; i != 32; i *= 2) {
+ std::size_t buf_size = fmt.size() * i;
+ std::vector<char> buf(buf_size);
+ if (std::size_t len = strftime(&buf[0], buf_size, fmt.c_str(), &tm)) {
+ out->append(&buf[0], len);
+ return;
+ }
+ }
+}
+
+// Used for %E#S/%E#f specifiers and for data values in parse().
+template <typename T>
+const char* ParseInt(const char* dp, int width, T min, T max, T* vp) {
+ if (dp != nullptr) {
+ const T kmin = std::numeric_limits<T>::min();
+ bool erange = false;
+ bool neg = false;
+ T value = 0;
+ if (*dp == '-') {
+ neg = true;
+ if (width <= 0 || --width != 0) {
+ ++dp;
+ } else {
+ dp = nullptr; // width was 1
+ }
+ }
+ if (const char* const bp = dp) {
+ while (const char* cp = strchr(kDigits, *dp)) {
+ int d = static_cast<int>(cp - kDigits);
+ if (d >= 10) break;
+ if (value < kmin / 10) {
+ erange = true;
+ break;
+ }
+ value *= 10;
+ if (value < kmin + d) {
+ erange = true;
+ break;
+ }
+ value -= d;
+ dp += 1;
+ if (width > 0 && --width == 0) break;
+ }
+ if (dp != bp && !erange && (neg || value != kmin)) {
+ if (!neg || value != 0) {
+ if (!neg) value = -value; // make positive
+ if (min <= value && value <= max) {
+ *vp = value;
+ } else {
+ dp = nullptr;
+ }
+ } else {
+ dp = nullptr;
+ }
+ } else {
+ dp = nullptr;
+ }
+ }
+ }
+ return dp;
+}
+
+// The number of base-10 digits that can be represented by a signed 64-bit
+// integer. That is, 10^kDigits10_64 <= 2^63 - 1 < 10^(kDigits10_64 + 1).
+const int kDigits10_64 = 18;
+
+// 10^n for everything that can be represented by a signed 64-bit integer.
+const std::int_fast64_t kExp10[kDigits10_64 + 1] = {
+ 1,
+ 10,
+ 100,
+ 1000,
+ 10000,
+ 100000,
+ 1000000,
+ 10000000,
+ 100000000,
+ 1000000000,
+ 10000000000,
+ 100000000000,
+ 1000000000000,
+ 10000000000000,
+ 100000000000000,
+ 1000000000000000,
+ 10000000000000000,
+ 100000000000000000,
+ 1000000000000000000,
+};
+
+} // namespace
+
+// Uses strftime(3) to format the given Time. The following extended format
+// specifiers are also supported:
+//
+// - %Ez - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+// - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+// - %E#S - Seconds with # digits of fractional precision
+// - %E*S - Seconds with full fractional precision (a literal '*')
+// - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// The standard specifiers from RFC3339_* (%Y, %m, %d, %H, %M, and %S) are
+// handled internally for performance reasons. strftime(3) is slow due to
+// a POSIX requirement to respect changes to ${TZ}.
+//
+// The TZ/GNU %s extension is handled internally because strftime() has
+// to use mktime() to generate it, and that assumes the local time zone.
+//
+// We also handle the %z and %Z specifiers to accommodate platforms that do
+// not support the tm_gmtoff and tm_zone extensions to std::tm.
+//
+// Requires that zero() <= fs < seconds(1).
+std::string format(const std::string& format, const time_point<seconds>& tp,
+ const detail::femtoseconds& fs, const time_zone& tz) {
+ std::string result;
+ result.reserve(format.size()); // A reasonable guess for the result size.
+ const time_zone::absolute_lookup al = tz.lookup(tp);
+ const std::tm tm = ToTM(al);
+
+ // Scratch buffer for internal conversions.
+ char buf[3 + kDigits10_64]; // enough for longest conversion
+ char* const ep = buf + sizeof(buf);
+ char* bp; // works back from ep
+
+ // Maintain three, disjoint subsequences that span format.
+ // [format.begin() ... pending) : already formatted into result
+ // [pending ... cur) : formatting pending, but no special cases
+ // [cur ... format.end()) : unexamined
+ // Initially, everything is in the unexamined part.
+ const char* pending = format.c_str(); // NUL terminated
+ const char* cur = pending;
+ const char* end = pending + format.length();
+
+ while (cur != end) { // while something is unexamined
+ // Moves cur to the next percent sign.
+ const char* start = cur;
+ while (cur != end && *cur != '%') ++cur;
+
+ // If the new pending text is all ordinary, copy it out.
+ if (cur != start && pending == start) {
+ result.append(pending, static_cast<std::size_t>(cur - pending));
+ pending = start = cur;
+ }
+
+ // Span the sequential percent signs.
+ const char* percent = cur;
+ while (cur != end && *cur == '%') ++cur;
+
+ // If the new pending text is all percents, copy out one
+ // percent for every matched pair, then skip those pairs.
+ if (cur != start && pending == start) {
+ std::size_t escaped = static_cast<std::size_t>(cur - pending) / 2;
+ result.append(pending, escaped);
+ pending += escaped * 2;
+ // Also copy out a single trailing percent.
+ if (pending != cur && cur == end) {
+ result.push_back(*pending++);
+ }
+ }
+
+ // Loop unless we have an unescaped percent.
+ if (cur == end || (cur - percent) % 2 == 0) continue;
+
+ // Simple specifiers that we handle ourselves.
+ if (strchr("YmdeHMSzZs%", *cur)) {
+ if (cur - 1 != pending) {
+ FormatTM(&result, std::string(pending, cur - 1), tm);
+ }
+ switch (*cur) {
+ case 'Y':
+ // This avoids the tm.tm_year overflow problem for %Y, however
+ // tm.tm_year will still be used by other specifiers like %D.
+ bp = Format64(ep, 0, al.cs.year());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'm':
+ bp = Format02d(ep, al.cs.month());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'd':
+ case 'e':
+ bp = Format02d(ep, al.cs.day());
+ if (*cur == 'e' && *bp == '0') *bp = ' '; // for Windows
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'H':
+ bp = Format02d(ep, al.cs.hour());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'M':
+ bp = Format02d(ep, al.cs.minute());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'S':
+ bp = Format02d(ep, al.cs.second());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'z':
+ bp = FormatOffset(ep, al.offset, "");
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case 'Z':
+ result.append(al.abbr);
+ break;
+ case 's':
+ bp = Format64(ep, 0, ToUnixSeconds(tp));
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ break;
+ case '%':
+ result.push_back('%');
+ break;
+ }
+ pending = ++cur;
+ continue;
+ }
+
+ // More complex specifiers that we handle ourselves.
+ if (*cur == ':' && cur + 1 != end) {
+ if (*(cur + 1) == 'z') {
+ // Formats %:z.
+ if (cur - 1 != pending) {
+ FormatTM(&result, std::string(pending, cur - 1), tm);
+ }
+ bp = FormatOffset(ep, al.offset, ":");
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = cur += 2;
+ continue;
+ }
+ if (*(cur + 1) == ':' && cur + 2 != end) {
+ if (*(cur + 2) == 'z') {
+ // Formats %::z.
+ if (cur - 1 != pending) {
+ FormatTM(&result, std::string(pending, cur - 1), tm);
+ }
+ bp = FormatOffset(ep, al.offset, ":*");
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = cur += 3;
+ continue;
+ }
+ if (*(cur + 2) == ':' && cur + 3 != end) {
+ if (*(cur + 3) == 'z') {
+ // Formats %:::z.
+ if (cur - 1 != pending) {
+ FormatTM(&result, std::string(pending, cur - 1), tm);
+ }
+ bp = FormatOffset(ep, al.offset, ":*:");
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = cur += 4;
+ continue;
+ }
+ }
+ }
+ }
+
+ // Loop if there is no E modifier.
+ if (*cur != 'E' || ++cur == end) continue;
+
+ // Format our extensions.
+ if (*cur == 'z') {
+ // Formats %Ez.
+ if (cur - 2 != pending) {
+ FormatTM(&result, std::string(pending, cur - 2), tm);
+ }
+ bp = FormatOffset(ep, al.offset, ":");
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = ++cur;
+ } else if (*cur == '*' && cur + 1 != end && *(cur + 1) == 'z') {
+ // Formats %E*z.
+ if (cur - 2 != pending) {
+ FormatTM(&result, std::string(pending, cur - 2), tm);
+ }
+ bp = FormatOffset(ep, al.offset, ":*");
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = cur += 2;
+ } else if (*cur == '*' && cur + 1 != end &&
+ (*(cur + 1) == 'S' || *(cur + 1) == 'f')) {
+ // Formats %E*S or %E*F.
+ if (cur - 2 != pending) {
+ FormatTM(&result, std::string(pending, cur - 2), tm);
+ }
+ char* cp = ep;
+ bp = Format64(cp, 15, fs.count());
+ while (cp != bp && cp[-1] == '0') --cp;
+ switch (*(cur + 1)) {
+ case 'S':
+ if (cp != bp) *--bp = '.';
+ bp = Format02d(bp, al.cs.second());
+ break;
+ case 'f':
+ if (cp == bp) *--bp = '0';
+ break;
+ }
+ result.append(bp, static_cast<std::size_t>(cp - bp));
+ pending = cur += 2;
+ } else if (*cur == '4' && cur + 1 != end && *(cur + 1) == 'Y') {
+ // Formats %E4Y.
+ if (cur - 2 != pending) {
+ FormatTM(&result, std::string(pending, cur - 2), tm);
+ }
+ bp = Format64(ep, 4, al.cs.year());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = cur += 2;
+ } else if (std::isdigit(*cur)) {
+ // Possibly found %E#S or %E#f.
+ int n = 0;
+ if (const char* np = ParseInt(cur, 0, 0, 1024, &n)) {
+ if (*np == 'S' || *np == 'f') {
+ // Formats %E#S or %E#f.
+ if (cur - 2 != pending) {
+ FormatTM(&result, std::string(pending, cur - 2), tm);
+ }
+ bp = ep;
+ if (n > 0) {
+ if (n > kDigits10_64) n = kDigits10_64;
+ bp = Format64(bp, n,
+ (n > 15) ? fs.count() * kExp10[n - 15]
+ : fs.count() / kExp10[15 - n]);
+ if (*np == 'S') *--bp = '.';
+ }
+ if (*np == 'S') bp = Format02d(bp, al.cs.second());
+ result.append(bp, static_cast<std::size_t>(ep - bp));
+ pending = cur = ++np;
+ }
+ }
+ }
+ }
+
+ // Formats any remaining data.
+ if (end != pending) {
+ FormatTM(&result, std::string(pending, end), tm);
+ }
+
+ return result;
+}
+
+namespace {
+
+const char* ParseOffset(const char* dp, const char* mode, int* offset) {
+ if (dp != nullptr) {
+ const char first = *dp++;
+ if (first == '+' || first == '-') {
+ char sep = mode[0];
+ int hours = 0;
+ int minutes = 0;
+ int seconds = 0;
+ const char* ap = ParseInt(dp, 2, 0, 23, &hours);
+ if (ap != nullptr && ap - dp == 2) {
+ dp = ap;
+ if (sep != '\0' && *ap == sep) ++ap;
+ const char* bp = ParseInt(ap, 2, 0, 59, &minutes);
+ if (bp != nullptr && bp - ap == 2) {
+ dp = bp;
+ if (sep != '\0' && *bp == sep) ++bp;
+ const char* cp = ParseInt(bp, 2, 0, 59, &seconds);
+ if (cp != nullptr && cp - bp == 2) dp = cp;
+ }
+ *offset = ((hours * 60 + minutes) * 60) + seconds;
+ if (first == '-') *offset = -*offset;
+ } else {
+ dp = nullptr;
+ }
+ } else if (first == 'Z') { // Zulu
+ *offset = 0;
+ } else {
+ dp = nullptr;
+ }
+ }
+ return dp;
+}
+
+const char* ParseZone(const char* dp, std::string* zone) {
+ zone->clear();
+ if (dp != nullptr) {
+ while (*dp != '\0' && !std::isspace(*dp)) zone->push_back(*dp++);
+ if (zone->empty()) dp = nullptr;
+ }
+ return dp;
+}
+
+const char* ParseSubSeconds(const char* dp, detail::femtoseconds* subseconds) {
+ if (dp != nullptr) {
+ std::int_fast64_t v = 0;
+ std::int_fast64_t exp = 0;
+ const char* const bp = dp;
+ while (const char* cp = strchr(kDigits, *dp)) {
+ int d = static_cast<int>(cp - kDigits);
+ if (d >= 10) break;
+ if (exp < 15) {
+ exp += 1;
+ v *= 10;
+ v += d;
+ }
+ ++dp;
+ }
+ if (dp != bp) {
+ v *= kExp10[15 - exp];
+ *subseconds = detail::femtoseconds(v);
+ } else {
+ dp = nullptr;
+ }
+ }
+ return dp;
+}
+
+// Parses a string into a std::tm using strptime(3).
+const char* ParseTM(const char* dp, const char* fmt, std::tm* tm) {
+ if (dp != nullptr) {
+ dp = strptime(dp, fmt, tm);
+ }
+ return dp;
+}
+
+} // namespace
+
+// Uses strptime(3) to parse the given input. Supports the same extended
+// format specifiers as format(), although %E#S and %E*S are treated
+// identically (and similarly for %E#f and %E*f). %Ez and %E*z also accept
+// the same inputs.
+//
+// The standard specifiers from RFC3339_* (%Y, %m, %d, %H, %M, and %S) are
+// handled internally so that we can normally avoid strptime() altogether
+// (which is particularly helpful when the native implementation is broken).
+//
+// The TZ/GNU %s extension is handled internally because strptime() has to
+// use localtime_r() to generate it, and that assumes the local time zone.
+//
+// We also handle the %z specifier to accommodate platforms that do not
+// support the tm_gmtoff extension to std::tm. %Z is parsed but ignored.
+bool parse(const std::string& format, const std::string& input,
+ const time_zone& tz, time_point<seconds>* sec,
+ detail::femtoseconds* fs, std::string* err) {
+ // The unparsed input.
+ const char* data = input.c_str(); // NUL terminated
+
+ // Skips leading whitespace.
+ while (std::isspace(*data)) ++data;
+
+ const year_t kyearmax = std::numeric_limits<year_t>::max();
+ const year_t kyearmin = std::numeric_limits<year_t>::min();
+
+ // Sets default values for unspecified fields.
+ bool saw_year = false;
+ year_t year = 1970;
+ std::tm tm{};
+ tm.tm_year = 1970 - 1900;
+ tm.tm_mon = 1 - 1; // Jan
+ tm.tm_mday = 1;
+ tm.tm_hour = 0;
+ tm.tm_min = 0;
+ tm.tm_sec = 0;
+ tm.tm_wday = 4; // Thu
+ tm.tm_yday = 0;
+ tm.tm_isdst = 0;
+ auto subseconds = detail::femtoseconds::zero();
+ bool saw_offset = false;
+ int offset = 0; // No offset from passed tz.
+ std::string zone = "UTC";
+
+ const char* fmt = format.c_str(); // NUL terminated
+ bool twelve_hour = false;
+ bool afternoon = false;
+
+ bool saw_percent_s = false;
+ std::int_fast64_t percent_s = 0;
+
+ // Steps through format, one specifier at a time.
+ while (data != nullptr && *fmt != '\0') {
+ if (std::isspace(*fmt)) {
+ while (std::isspace(*data)) ++data;
+ while (std::isspace(*++fmt)) continue;
+ continue;
+ }
+
+ if (*fmt != '%') {
+ if (*data == *fmt) {
+ ++data;
+ ++fmt;
+ } else {
+ data = nullptr;
+ }
+ continue;
+ }
+
+ const char* percent = fmt;
+ if (*++fmt == '\0') {
+ data = nullptr;
+ continue;
+ }
+ switch (*fmt++) {
+ case 'Y':
+ // Symmetrically with FormatTime(), directly handing %Y avoids the
+ // tm.tm_year overflow problem. However, tm.tm_year will still be
+ // used by other specifiers like %D.
+ data = ParseInt(data, 0, kyearmin, kyearmax, &year);
+ if (data != nullptr) saw_year = true;
+ continue;
+ case 'm':
+ data = ParseInt(data, 2, 1, 12, &tm.tm_mon);
+ if (data != nullptr) tm.tm_mon -= 1;
+ continue;
+ case 'd':
+ case 'e':
+ data = ParseInt(data, 2, 1, 31, &tm.tm_mday);
+ continue;
+ case 'H':
+ data = ParseInt(data, 2, 0, 23, &tm.tm_hour);
+ twelve_hour = false;
+ continue;
+ case 'M':
+ data = ParseInt(data, 2, 0, 59, &tm.tm_min);
+ continue;
+ case 'S':
+ data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+ continue;
+ case 'I':
+ case 'l':
+ case 'r': // probably uses %I
+ twelve_hour = true;
+ break;
+ case 'R': // uses %H
+ case 'T': // uses %H
+ case 'c': // probably uses %H
+ case 'X': // probably uses %H
+ twelve_hour = false;
+ break;
+ case 'z':
+ data = ParseOffset(data, "", &offset);
+ if (data != nullptr) saw_offset = true;
+ continue;
+ case 'Z': // ignored; zone abbreviations are ambiguous
+ data = ParseZone(data, &zone);
+ continue;
+ case 's':
+ data =
+ ParseInt(data, 0, std::numeric_limits<std::int_fast64_t>::min(),
+ std::numeric_limits<std::int_fast64_t>::max(), &percent_s);
+ if (data != nullptr) saw_percent_s = true;
+ continue;
+ case ':':
+ if (fmt[0] == 'z' ||
+ (fmt[0] == ':' &&
+ (fmt[1] == 'z' || (fmt[1] == ':' && fmt[2] == 'z')))) {
+ data = ParseOffset(data, ":", &offset);
+ if (data != nullptr) saw_offset = true;
+ fmt += (fmt[0] == 'z') ? 1 : (fmt[1] == 'z') ? 2 : 3;
+ continue;
+ }
+ break;
+ case '%':
+ data = (*data == '%' ? data + 1 : nullptr);
+ continue;
+ case 'E':
+ if (fmt[0] == 'z' || (fmt[0] == '*' && fmt[1] == 'z')) {
+ data = ParseOffset(data, ":", &offset);
+ if (data != nullptr) saw_offset = true;
+ fmt += (fmt[0] == 'z') ? 1 : 2;
+ continue;
+ }
+ if (fmt[0] == '*' && fmt[1] == 'S') {
+ data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+ if (data != nullptr && *data == '.') {
+ data = ParseSubSeconds(data + 1, &subseconds);
+ }
+ fmt += 2;
+ continue;
+ }
+ if (fmt[0] == '*' && fmt[1] == 'f') {
+ if (data != nullptr && std::isdigit(*data)) {
+ data = ParseSubSeconds(data, &subseconds);
+ }
+ fmt += 2;
+ continue;
+ }
+ if (fmt[0] == '4' && fmt[1] == 'Y') {
+ const char* bp = data;
+ data = ParseInt(data, 4, year_t{-999}, year_t{9999}, &year);
+ if (data != nullptr) {
+ if (data - bp == 4) {
+ saw_year = true;
+ } else {
+ data = nullptr; // stopped too soon
+ }
+ }
+ fmt += 2;
+ continue;
+ }
+ if (std::isdigit(*fmt)) {
+ int n = 0; // value ignored
+ if (const char* np = ParseInt(fmt, 0, 0, 1024, &n)) {
+ if (*np == 'S') {
+ data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+ if (data != nullptr && *data == '.') {
+ data = ParseSubSeconds(data + 1, &subseconds);
+ }
+ fmt = ++np;
+ continue;
+ }
+ if (*np == 'f') {
+ if (data != nullptr && std::isdigit(*data)) {
+ data = ParseSubSeconds(data, &subseconds);
+ }
+ fmt = ++np;
+ continue;
+ }
+ }
+ }
+ if (*fmt == 'c') twelve_hour = false; // probably uses %H
+ if (*fmt == 'X') twelve_hour = false; // probably uses %H
+ if (*fmt != '\0') ++fmt;
+ break;
+ case 'O':
+ if (*fmt == 'H') twelve_hour = false;
+ if (*fmt == 'I') twelve_hour = true;
+ if (*fmt != '\0') ++fmt;
+ break;
+ }
+
+ // Parses the current specifier.
+ const char* orig_data = data;
+ std::string spec(percent, static_cast<std::size_t>(fmt - percent));
+ data = ParseTM(data, spec.c_str(), &tm);
+
+ // If we successfully parsed %p we need to remember whether the result
+ // was AM or PM so that we can adjust tm_hour before time_zone::lookup().
+ // So reparse the input with a known AM hour, and check if it is shifted
+ // to a PM hour.
+ if (spec == "%p" && data != nullptr) {
+ std::string test_input = "1";
+ test_input.append(orig_data, static_cast<std::size_t>(data - orig_data));
+ const char* test_data = test_input.c_str();
+ std::tm tmp{};
+ ParseTM(test_data, "%I%p", &tmp);
+ afternoon = (tmp.tm_hour == 13);
+ }
+ }
+
+ // Adjust a 12-hour tm_hour value if it should be in the afternoon.
+ if (twelve_hour && afternoon && tm.tm_hour < 12) {
+ tm.tm_hour += 12;
+ }
+
+ if (data == nullptr) {
+ if (err != nullptr) *err = "Failed to parse input";
+ return false;
+ }
+
+ // Skip any remaining whitespace.
+ while (std::isspace(*data)) ++data;
+
+ // parse() must consume the entire input std::string.
+ if (*data != '\0') {
+ if (err != nullptr) *err = "Illegal trailing data in input string";
+ return false;
+ }
+
+ // If we saw %s then we ignore anything else and return that time.
+ if (saw_percent_s) {
+ *sec = FromUnixSeconds(percent_s);
+ *fs = detail::femtoseconds::zero();
+ return true;
+ }
+
+ // If we saw %z, %Ez, or %E*z then we want to interpret the parsed fields
+ // in UTC and then shift by that offset. Otherwise we want to interpret
+ // the fields directly in the passed time_zone.
+ time_zone ptz = saw_offset ? utc_time_zone() : tz;
+
+ // Allows a leap second of 60 to normalize forward to the following ":00".
+ if (tm.tm_sec == 60) {
+ tm.tm_sec -= 1;
+ offset -= 1;
+ subseconds = detail::femtoseconds::zero();
+ }
+
+ if (!saw_year) {
+ year = year_t{tm.tm_year};
+ if (year > kyearmax - 1900) {
+ // Platform-dependent, maybe unreachable.
+ if (err != nullptr) *err = "Out-of-range year";
+ return false;
+ }
+ year += 1900;
+ }
+
+ const int month = tm.tm_mon + 1;
+ civil_second cs(year, month, tm.tm_mday, tm.tm_hour, tm.tm_min, tm.tm_sec);
+
+ // parse() should not allow normalization. Due to the restricted field
+ // ranges above (see ParseInt()), the only possibility is for days to roll
+ // into months. That is, parsing "Sep 31" should not produce "Oct 1".
+ if (cs.month() != month || cs.day() != tm.tm_mday) {
+ if (err != nullptr) *err = "Out-of-range field";
+ return false;
+ }
+
+ // Accounts for the offset adjustment before converting to absolute time.
+ if ((offset < 0 && cs > civil_second::max() + offset) ||
+ (offset > 0 && cs < civil_second::min() + offset)) {
+ if (err != nullptr) *err = "Out-of-range field";
+ return false;
+ }
+ cs -= offset;
+
+ const auto tp = ptz.lookup(cs).pre;
+ // Checks for overflow/underflow and returns an error as necessary.
+ if (tp == time_point<seconds>::max()) {
+ const auto al = ptz.lookup(time_point<seconds>::max());
+ if (cs > al.cs) {
+ if (err != nullptr) *err = "Out-of-range field";
+ return false;
+ }
+ }
+ if (tp == time_point<seconds>::min()) {
+ const auto al = ptz.lookup(time_point<seconds>::min());
+ if (cs < al.cs) {
+ if (err != nullptr) *err = "Out-of-range field";
+ return false;
+ }
+ }
+
+ *sec = tp;
+ *fs = subseconds;
+ return true;
+}
+
+} // namespace detail
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format_test.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format_test.cc
new file mode 100644
index 0000000000..caebcc4d95
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_format_test.cc
@@ -0,0 +1,1500 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <chrono>
+#include <iomanip>
+#include <sstream>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace chrono = std::chrono;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
+ do { \
+ time_zone::absolute_lookup al = tz.lookup(tp); \
+ EXPECT_EQ(y, al.cs.year()); \
+ EXPECT_EQ(m, al.cs.month()); \
+ EXPECT_EQ(d, al.cs.day()); \
+ EXPECT_EQ(hh, al.cs.hour()); \
+ EXPECT_EQ(mm, al.cs.minute()); \
+ EXPECT_EQ(ss, al.cs.second()); \
+ EXPECT_EQ(off, al.offset); \
+ EXPECT_TRUE(isdst == al.is_dst); \
+ EXPECT_STREQ(zone, al.abbr); \
+ } while (0)
+
+const char RFC3339_full[] = "%Y-%m-%dT%H:%M:%E*S%Ez";
+const char RFC3339_sec[] = "%Y-%m-%dT%H:%M:%S%Ez";
+
+const char RFC1123_full[] = "%a, %d %b %Y %H:%M:%S %z";
+const char RFC1123_no_wday[] = "%d %b %Y %H:%M:%S %z";
+
+// A helper that tests the given format specifier by itself, and with leading
+// and trailing characters. For example: TestFormatSpecifier(tp, "%a", "Thu").
+template <typename D>
+void TestFormatSpecifier(time_point<D> tp, time_zone tz, const std::string& fmt,
+ const std::string& ans) {
+ EXPECT_EQ(ans, format(fmt, tp, tz)) << fmt;
+ EXPECT_EQ("xxx " + ans, format("xxx " + fmt, tp, tz));
+ EXPECT_EQ(ans + " yyy", format(fmt + " yyy", tp, tz));
+ EXPECT_EQ("xxx " + ans + " yyy", format("xxx " + fmt + " yyy", tp, tz));
+}
+
+} // namespace
+
+//
+// Testing format()
+//
+
+TEST(Format, TimePointResolution) {
+ const char kFmt[] = "%H:%M:%E*S";
+ const time_zone utc = utc_time_zone();
+ const time_point<chrono::nanoseconds> t0 =
+ chrono::system_clock::from_time_t(1420167845) +
+ chrono::milliseconds(123) + chrono::microseconds(456) +
+ chrono::nanoseconds(789);
+ EXPECT_EQ(
+ "03:04:05.123456789",
+ format(kFmt, chrono::time_point_cast<chrono::nanoseconds>(t0), utc));
+ EXPECT_EQ(
+ "03:04:05.123456",
+ format(kFmt, chrono::time_point_cast<chrono::microseconds>(t0), utc));
+ EXPECT_EQ(
+ "03:04:05.123",
+ format(kFmt, chrono::time_point_cast<chrono::milliseconds>(t0), utc));
+ EXPECT_EQ("03:04:05",
+ format(kFmt, chrono::time_point_cast<chrono::seconds>(t0), utc));
+ EXPECT_EQ(
+ "03:04:05",
+ format(kFmt,
+ chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0),
+ utc));
+ EXPECT_EQ("03:04:00",
+ format(kFmt, chrono::time_point_cast<chrono::minutes>(t0), utc));
+ EXPECT_EQ("03:00:00",
+ format(kFmt, chrono::time_point_cast<chrono::hours>(t0), utc));
+}
+
+TEST(Format, TimePointExtendedResolution) {
+ const char kFmt[] = "%H:%M:%E*S";
+ const time_zone utc = utc_time_zone();
+ const time_point<absl::time_internal::cctz::seconds> tp =
+ chrono::time_point_cast<absl::time_internal::cctz::seconds>(
+ chrono::system_clock::from_time_t(0)) +
+ chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56);
+
+ EXPECT_EQ(
+ "12:34:56.123456789012345",
+ detail::format(kFmt, tp, detail::femtoseconds(123456789012345), utc));
+ EXPECT_EQ(
+ "12:34:56.012345678901234",
+ detail::format(kFmt, tp, detail::femtoseconds(12345678901234), utc));
+ EXPECT_EQ("12:34:56.001234567890123",
+ detail::format(kFmt, tp, detail::femtoseconds(1234567890123), utc));
+ EXPECT_EQ("12:34:56.000123456789012",
+ detail::format(kFmt, tp, detail::femtoseconds(123456789012), utc));
+
+ EXPECT_EQ("12:34:56.000000000000123",
+ detail::format(kFmt, tp, detail::femtoseconds(123), utc));
+ EXPECT_EQ("12:34:56.000000000000012",
+ detail::format(kFmt, tp, detail::femtoseconds(12), utc));
+ EXPECT_EQ("12:34:56.000000000000001",
+ detail::format(kFmt, tp, detail::femtoseconds(1), utc));
+}
+
+TEST(Format, Basics) {
+ time_zone tz = utc_time_zone();
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+
+ // Starts with a couple basic edge cases.
+ EXPECT_EQ("", format("", tp, tz));
+ EXPECT_EQ(" ", format(" ", tp, tz));
+ EXPECT_EQ(" ", format(" ", tp, tz));
+ EXPECT_EQ("xxx", format("xxx", tp, tz));
+ std::string big(128, 'x');
+ EXPECT_EQ(big, format(big, tp, tz));
+ // Cause the 1024-byte buffer to grow.
+ std::string bigger(100000, 'x');
+ EXPECT_EQ(bigger, format(bigger, tp, tz));
+
+ tp += chrono::hours(13) + chrono::minutes(4) + chrono::seconds(5);
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
+ EXPECT_EQ("1970-01-01", format("%Y-%m-%d", tp, tz));
+ EXPECT_EQ("13:04:05", format("%H:%M:%S", tp, tz));
+ EXPECT_EQ("13:04:05.006", format("%H:%M:%E3S", tp, tz));
+ EXPECT_EQ("13:04:05.006007", format("%H:%M:%E6S", tp, tz));
+ EXPECT_EQ("13:04:05.006007008", format("%H:%M:%E9S", tp, tz));
+}
+
+TEST(Format, PosixConversions) {
+ const time_zone tz = utc_time_zone();
+ auto tp = chrono::system_clock::from_time_t(0);
+
+ TestFormatSpecifier(tp, tz, "%d", "01");
+ TestFormatSpecifier(tp, tz, "%e", " 1"); // extension but internal support
+ TestFormatSpecifier(tp, tz, "%H", "00");
+ TestFormatSpecifier(tp, tz, "%I", "12");
+ TestFormatSpecifier(tp, tz, "%j", "001");
+ TestFormatSpecifier(tp, tz, "%m", "01");
+ TestFormatSpecifier(tp, tz, "%M", "00");
+ TestFormatSpecifier(tp, tz, "%S", "00");
+ TestFormatSpecifier(tp, tz, "%U", "00");
+#if !defined(__EMSCRIPTEN__)
+ TestFormatSpecifier(tp, tz, "%w", "4"); // 4=Thursday
+#endif
+ TestFormatSpecifier(tp, tz, "%W", "00");
+ TestFormatSpecifier(tp, tz, "%y", "70");
+ TestFormatSpecifier(tp, tz, "%Y", "1970");
+ TestFormatSpecifier(tp, tz, "%z", "+0000");
+ TestFormatSpecifier(tp, tz, "%Z", "UTC");
+ TestFormatSpecifier(tp, tz, "%%", "%");
+
+#if defined(__linux__)
+ // SU/C99/TZ extensions
+ TestFormatSpecifier(tp, tz, "%C", "19");
+ TestFormatSpecifier(tp, tz, "%D", "01/01/70");
+ TestFormatSpecifier(tp, tz, "%F", "1970-01-01");
+ TestFormatSpecifier(tp, tz, "%g", "70");
+ TestFormatSpecifier(tp, tz, "%G", "1970");
+ TestFormatSpecifier(tp, tz, "%k", " 0");
+ TestFormatSpecifier(tp, tz, "%l", "12");
+ TestFormatSpecifier(tp, tz, "%n", "\n");
+ TestFormatSpecifier(tp, tz, "%R", "00:00");
+ TestFormatSpecifier(tp, tz, "%t", "\t");
+ TestFormatSpecifier(tp, tz, "%T", "00:00:00");
+ TestFormatSpecifier(tp, tz, "%u", "4"); // 4=Thursday
+ TestFormatSpecifier(tp, tz, "%V", "01");
+ TestFormatSpecifier(tp, tz, "%s", "0");
+#endif
+}
+
+TEST(Format, LocaleSpecific) {
+ const time_zone tz = utc_time_zone();
+ auto tp = chrono::system_clock::from_time_t(0);
+
+ TestFormatSpecifier(tp, tz, "%a", "Thu");
+ TestFormatSpecifier(tp, tz, "%A", "Thursday");
+ TestFormatSpecifier(tp, tz, "%b", "Jan");
+ TestFormatSpecifier(tp, tz, "%B", "January");
+
+ // %c should at least produce the numeric year and time-of-day.
+ const std::string s = format("%c", tp, utc_time_zone());
+ EXPECT_THAT(s, testing::HasSubstr("1970"));
+ EXPECT_THAT(s, testing::HasSubstr("00:00:00"));
+
+ TestFormatSpecifier(tp, tz, "%p", "AM");
+ TestFormatSpecifier(tp, tz, "%x", "01/01/70");
+ TestFormatSpecifier(tp, tz, "%X", "00:00:00");
+
+#if defined(__linux__)
+ // SU/C99/TZ extensions
+ TestFormatSpecifier(tp, tz, "%h", "Jan"); // Same as %b
+ TestFormatSpecifier(tp, tz, "%P", "am");
+ TestFormatSpecifier(tp, tz, "%r", "12:00:00 AM");
+
+ // Modified conversion specifiers %E_
+ TestFormatSpecifier(tp, tz, "%Ec", "Thu Jan 1 00:00:00 1970");
+ TestFormatSpecifier(tp, tz, "%EC", "19");
+ TestFormatSpecifier(tp, tz, "%Ex", "01/01/70");
+ TestFormatSpecifier(tp, tz, "%EX", "00:00:00");
+ TestFormatSpecifier(tp, tz, "%Ey", "70");
+ TestFormatSpecifier(tp, tz, "%EY", "1970");
+
+ // Modified conversion specifiers %O_
+ TestFormatSpecifier(tp, tz, "%Od", "01");
+ TestFormatSpecifier(tp, tz, "%Oe", " 1");
+ TestFormatSpecifier(tp, tz, "%OH", "00");
+ TestFormatSpecifier(tp, tz, "%OI", "12");
+ TestFormatSpecifier(tp, tz, "%Om", "01");
+ TestFormatSpecifier(tp, tz, "%OM", "00");
+ TestFormatSpecifier(tp, tz, "%OS", "00");
+ TestFormatSpecifier(tp, tz, "%Ou", "4"); // 4=Thursday
+ TestFormatSpecifier(tp, tz, "%OU", "00");
+ TestFormatSpecifier(tp, tz, "%OV", "01");
+ TestFormatSpecifier(tp, tz, "%Ow", "4"); // 4=Thursday
+ TestFormatSpecifier(tp, tz, "%OW", "00");
+ TestFormatSpecifier(tp, tz, "%Oy", "70");
+#endif
+}
+
+TEST(Format, Escaping) {
+ const time_zone tz = utc_time_zone();
+ auto tp = chrono::system_clock::from_time_t(0);
+
+ TestFormatSpecifier(tp, tz, "%%", "%");
+ TestFormatSpecifier(tp, tz, "%%a", "%a");
+ TestFormatSpecifier(tp, tz, "%%b", "%b");
+ TestFormatSpecifier(tp, tz, "%%Ea", "%Ea");
+ TestFormatSpecifier(tp, tz, "%%Es", "%Es");
+ TestFormatSpecifier(tp, tz, "%%E3S", "%E3S");
+ TestFormatSpecifier(tp, tz, "%%OS", "%OS");
+ TestFormatSpecifier(tp, tz, "%%O3S", "%O3S");
+
+ // Multiple levels of escaping.
+ TestFormatSpecifier(tp, tz, "%%%Y", "%1970");
+ TestFormatSpecifier(tp, tz, "%%%E3S", "%00.000");
+ TestFormatSpecifier(tp, tz, "%%%%E3S", "%%E3S");
+}
+
+TEST(Format, ExtendedSeconds) {
+ const time_zone tz = utc_time_zone();
+
+ // No subseconds.
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+ tp += chrono::seconds(5);
+ EXPECT_EQ("05", format("%E*S", tp, tz));
+ EXPECT_EQ("05", format("%E0S", tp, tz));
+ EXPECT_EQ("05.0", format("%E1S", tp, tz));
+ EXPECT_EQ("05.00", format("%E2S", tp, tz));
+ EXPECT_EQ("05.000", format("%E3S", tp, tz));
+ EXPECT_EQ("05.0000", format("%E4S", tp, tz));
+ EXPECT_EQ("05.00000", format("%E5S", tp, tz));
+ EXPECT_EQ("05.000000", format("%E6S", tp, tz));
+ EXPECT_EQ("05.0000000", format("%E7S", tp, tz));
+ EXPECT_EQ("05.00000000", format("%E8S", tp, tz));
+ EXPECT_EQ("05.000000000", format("%E9S", tp, tz));
+ EXPECT_EQ("05.0000000000", format("%E10S", tp, tz));
+ EXPECT_EQ("05.00000000000", format("%E11S", tp, tz));
+ EXPECT_EQ("05.000000000000", format("%E12S", tp, tz));
+ EXPECT_EQ("05.0000000000000", format("%E13S", tp, tz));
+ EXPECT_EQ("05.00000000000000", format("%E14S", tp, tz));
+ EXPECT_EQ("05.000000000000000", format("%E15S", tp, tz));
+
+ // With subseconds.
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
+ EXPECT_EQ("05.006007008", format("%E*S", tp, tz));
+ EXPECT_EQ("05", format("%E0S", tp, tz));
+ EXPECT_EQ("05.0", format("%E1S", tp, tz));
+ EXPECT_EQ("05.00", format("%E2S", tp, tz));
+ EXPECT_EQ("05.006", format("%E3S", tp, tz));
+ EXPECT_EQ("05.0060", format("%E4S", tp, tz));
+ EXPECT_EQ("05.00600", format("%E5S", tp, tz));
+ EXPECT_EQ("05.006007", format("%E6S", tp, tz));
+ EXPECT_EQ("05.0060070", format("%E7S", tp, tz));
+ EXPECT_EQ("05.00600700", format("%E8S", tp, tz));
+ EXPECT_EQ("05.006007008", format("%E9S", tp, tz));
+ EXPECT_EQ("05.0060070080", format("%E10S", tp, tz));
+ EXPECT_EQ("05.00600700800", format("%E11S", tp, tz));
+ EXPECT_EQ("05.006007008000", format("%E12S", tp, tz));
+ EXPECT_EQ("05.0060070080000", format("%E13S", tp, tz));
+ EXPECT_EQ("05.00600700800000", format("%E14S", tp, tz));
+ EXPECT_EQ("05.006007008000000", format("%E15S", tp, tz));
+
+ // Times before the Unix epoch.
+ tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
+ EXPECT_EQ("1969-12-31 23:59:59.999999",
+ format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+
+ // Here is a "%E*S" case we got wrong for a while. While the first
+ // instant below is correctly rendered as "...:07.333304", the second
+ // one used to appear as "...:07.33330499999999999".
+ tp = chrono::system_clock::from_time_t(0) +
+ chrono::microseconds(1395024427333304);
+ EXPECT_EQ("2014-03-17 02:47:07.333304",
+ format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+ tp += chrono::microseconds(1);
+ EXPECT_EQ("2014-03-17 02:47:07.333305",
+ format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+}
+
+TEST(Format, ExtendedSubeconds) {
+ const time_zone tz = utc_time_zone();
+
+ // No subseconds.
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+ tp += chrono::seconds(5);
+ EXPECT_EQ("0", format("%E*f", tp, tz));
+ EXPECT_EQ("", format("%E0f", tp, tz));
+ EXPECT_EQ("0", format("%E1f", tp, tz));
+ EXPECT_EQ("00", format("%E2f", tp, tz));
+ EXPECT_EQ("000", format("%E3f", tp, tz));
+ EXPECT_EQ("0000", format("%E4f", tp, tz));
+ EXPECT_EQ("00000", format("%E5f", tp, tz));
+ EXPECT_EQ("000000", format("%E6f", tp, tz));
+ EXPECT_EQ("0000000", format("%E7f", tp, tz));
+ EXPECT_EQ("00000000", format("%E8f", tp, tz));
+ EXPECT_EQ("000000000", format("%E9f", tp, tz));
+ EXPECT_EQ("0000000000", format("%E10f", tp, tz));
+ EXPECT_EQ("00000000000", format("%E11f", tp, tz));
+ EXPECT_EQ("000000000000", format("%E12f", tp, tz));
+ EXPECT_EQ("0000000000000", format("%E13f", tp, tz));
+ EXPECT_EQ("00000000000000", format("%E14f", tp, tz));
+ EXPECT_EQ("000000000000000", format("%E15f", tp, tz));
+
+ // With subseconds.
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
+ EXPECT_EQ("006007008", format("%E*f", tp, tz));
+ EXPECT_EQ("", format("%E0f", tp, tz));
+ EXPECT_EQ("0", format("%E1f", tp, tz));
+ EXPECT_EQ("00", format("%E2f", tp, tz));
+ EXPECT_EQ("006", format("%E3f", tp, tz));
+ EXPECT_EQ("0060", format("%E4f", tp, tz));
+ EXPECT_EQ("00600", format("%E5f", tp, tz));
+ EXPECT_EQ("006007", format("%E6f", tp, tz));
+ EXPECT_EQ("0060070", format("%E7f", tp, tz));
+ EXPECT_EQ("00600700", format("%E8f", tp, tz));
+ EXPECT_EQ("006007008", format("%E9f", tp, tz));
+ EXPECT_EQ("0060070080", format("%E10f", tp, tz));
+ EXPECT_EQ("00600700800", format("%E11f", tp, tz));
+ EXPECT_EQ("006007008000", format("%E12f", tp, tz));
+ EXPECT_EQ("0060070080000", format("%E13f", tp, tz));
+ EXPECT_EQ("00600700800000", format("%E14f", tp, tz));
+ EXPECT_EQ("006007008000000", format("%E15f", tp, tz));
+
+ // Times before the Unix epoch.
+ tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
+ EXPECT_EQ("1969-12-31 23:59:59.999999",
+ format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+
+ // Here is a "%E*S" case we got wrong for a while. While the first
+ // instant below is correctly rendered as "...:07.333304", the second
+ // one used to appear as "...:07.33330499999999999".
+ tp = chrono::system_clock::from_time_t(0) +
+ chrono::microseconds(1395024427333304);
+ EXPECT_EQ("2014-03-17 02:47:07.333304",
+ format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+ tp += chrono::microseconds(1);
+ EXPECT_EQ("2014-03-17 02:47:07.333305",
+ format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+}
+
+TEST(Format, CompareExtendSecondsVsSubseconds) {
+ const time_zone tz = utc_time_zone();
+
+ // This test case illustrates the differences/similarities between:
+ // fmt_A: %E<prec>S
+ // fmt_B: %S.%E<prec>f
+ auto fmt_A = [](const std::string& prec) { return "%E" + prec + "S"; };
+ auto fmt_B = [](const std::string& prec) { return "%S.%E" + prec + "f"; };
+
+ // No subseconds:
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+ tp += chrono::seconds(5);
+ // ... %E*S and %S.%E*f are different.
+ EXPECT_EQ("05", format(fmt_A("*"), tp, tz));
+ EXPECT_EQ("05.0", format(fmt_B("*"), tp, tz));
+ // ... %E0S and %S.%E0f are different.
+ EXPECT_EQ("05", format(fmt_A("0"), tp, tz));
+ EXPECT_EQ("05.", format(fmt_B("0"), tp, tz));
+ // ... %E<prec>S and %S.%E<prec>f are the same for prec in [1:15].
+ for (int prec = 1; prec <= 15; ++prec) {
+ const std::string a = format(fmt_A(std::to_string(prec)), tp, tz);
+ const std::string b = format(fmt_B(std::to_string(prec)), tp, tz);
+ EXPECT_EQ(a, b) << "prec=" << prec;
+ }
+
+ // With subseconds:
+ // ... %E*S and %S.%E*f are the same.
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
+ EXPECT_EQ("05.006007008", format(fmt_A("*"), tp, tz));
+ EXPECT_EQ("05.006007008", format(fmt_B("*"), tp, tz));
+ // ... %E0S and %S.%E0f are different.
+ EXPECT_EQ("05", format(fmt_A("0"), tp, tz));
+ EXPECT_EQ("05.", format(fmt_B("0"), tp, tz));
+ // ... %E<prec>S and %S.%E<prec>f are the same for prec in [1:15].
+ for (int prec = 1; prec <= 15; ++prec) {
+ const std::string a = format(fmt_A(std::to_string(prec)), tp, tz);
+ const std::string b = format(fmt_B(std::to_string(prec)), tp, tz);
+ EXPECT_EQ(a, b) << "prec=" << prec;
+ }
+}
+
+TEST(Format, ExtendedOffset) {
+ const auto tp = chrono::system_clock::from_time_t(0);
+
+ auto tz = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+ TestFormatSpecifier(tp, tz, "%z", "+0000");
+ TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+ tz = fixed_time_zone(chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "+0000");
+ TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+ tz = fixed_time_zone(-chrono::seconds(56)); // NOTE: +00:00
+ TestFormatSpecifier(tp, tz, "%z", "+0000");
+ TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+ tz = fixed_time_zone(chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%z", "+0034");
+ TestFormatSpecifier(tp, tz, "%:z", "+00:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "+00:34");
+
+ tz = fixed_time_zone(-chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%z", "-0034");
+ TestFormatSpecifier(tp, tz, "%:z", "-00:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "-00:34");
+
+ tz = fixed_time_zone(chrono::minutes(34) + chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "+0034");
+ TestFormatSpecifier(tp, tz, "%:z", "+00:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "+00:34");
+
+ tz = fixed_time_zone(-chrono::minutes(34) - chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "-0034");
+ TestFormatSpecifier(tp, tz, "%:z", "-00:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "-00:34");
+
+ tz = fixed_time_zone(chrono::hours(12));
+ TestFormatSpecifier(tp, tz, "%z", "+1200");
+ TestFormatSpecifier(tp, tz, "%:z", "+12:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "+12:00");
+
+ tz = fixed_time_zone(-chrono::hours(12));
+ TestFormatSpecifier(tp, tz, "%z", "-1200");
+ TestFormatSpecifier(tp, tz, "%:z", "-12:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "-12:00");
+
+ tz = fixed_time_zone(chrono::hours(12) + chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "+1200");
+ TestFormatSpecifier(tp, tz, "%:z", "+12:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "+12:00");
+
+ tz = fixed_time_zone(-chrono::hours(12) - chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "-1200");
+ TestFormatSpecifier(tp, tz, "%:z", "-12:00");
+ TestFormatSpecifier(tp, tz, "%Ez", "-12:00");
+
+ tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%z", "+1234");
+ TestFormatSpecifier(tp, tz, "%:z", "+12:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "+12:34");
+
+ tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%z", "-1234");
+ TestFormatSpecifier(tp, tz, "%:z", "-12:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "-12:34");
+
+ tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34) +
+ chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "+1234");
+ TestFormatSpecifier(tp, tz, "%:z", "+12:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "+12:34");
+
+ tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34) -
+ chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%z", "-1234");
+ TestFormatSpecifier(tp, tz, "%:z", "-12:34");
+ TestFormatSpecifier(tp, tz, "%Ez", "-12:34");
+}
+
+TEST(Format, ExtendedSecondOffset) {
+ const auto tp = chrono::system_clock::from_time_t(0);
+
+ auto tz = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+ TestFormatSpecifier(tp, tz, "%E*z", "+00:00:00");
+ TestFormatSpecifier(tp, tz, "%::z", "+00:00:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "+00");
+
+ tz = fixed_time_zone(chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "+00:00:56");
+ TestFormatSpecifier(tp, tz, "%::z", "+00:00:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "+00:00:56");
+
+ tz = fixed_time_zone(-chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "-00:00:56");
+ TestFormatSpecifier(tp, tz, "%::z", "-00:00:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "-00:00:56");
+
+ tz = fixed_time_zone(chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%E*z", "+00:34:00");
+ TestFormatSpecifier(tp, tz, "%::z", "+00:34:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "+00:34");
+
+ tz = fixed_time_zone(-chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%E*z", "-00:34:00");
+ TestFormatSpecifier(tp, tz, "%::z", "-00:34:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "-00:34");
+
+ tz = fixed_time_zone(chrono::minutes(34) + chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "+00:34:56");
+ TestFormatSpecifier(tp, tz, "%::z", "+00:34:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "+00:34:56");
+
+ tz = fixed_time_zone(-chrono::minutes(34) - chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "-00:34:56");
+ TestFormatSpecifier(tp, tz, "%::z", "-00:34:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "-00:34:56");
+
+ tz = fixed_time_zone(chrono::hours(12));
+ TestFormatSpecifier(tp, tz, "%E*z", "+12:00:00");
+ TestFormatSpecifier(tp, tz, "%::z", "+12:00:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "+12");
+
+ tz = fixed_time_zone(-chrono::hours(12));
+ TestFormatSpecifier(tp, tz, "%E*z", "-12:00:00");
+ TestFormatSpecifier(tp, tz, "%::z", "-12:00:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "-12");
+
+ tz = fixed_time_zone(chrono::hours(12) + chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "+12:00:56");
+ TestFormatSpecifier(tp, tz, "%::z", "+12:00:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "+12:00:56");
+
+ tz = fixed_time_zone(-chrono::hours(12) - chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "-12:00:56");
+ TestFormatSpecifier(tp, tz, "%::z", "-12:00:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "-12:00:56");
+
+ tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%E*z", "+12:34:00");
+ TestFormatSpecifier(tp, tz, "%::z", "+12:34:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "+12:34");
+
+ tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34));
+ TestFormatSpecifier(tp, tz, "%E*z", "-12:34:00");
+ TestFormatSpecifier(tp, tz, "%::z", "-12:34:00");
+ TestFormatSpecifier(tp, tz, "%:::z", "-12:34");
+
+ tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34) +
+ chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "+12:34:56");
+ TestFormatSpecifier(tp, tz, "%::z", "+12:34:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "+12:34:56");
+
+ tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34) -
+ chrono::seconds(56));
+ TestFormatSpecifier(tp, tz, "%E*z", "-12:34:56");
+ TestFormatSpecifier(tp, tz, "%::z", "-12:34:56");
+ TestFormatSpecifier(tp, tz, "%:::z", "-12:34:56");
+}
+
+TEST(Format, ExtendedYears) {
+ const time_zone utc = utc_time_zone();
+ const char e4y_fmt[] = "%E4Y%m%d"; // no separators
+
+ // %E4Y zero-pads the year to produce at least 4 chars, including the sign.
+ auto tp = convert(civil_second(-999, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("-9991127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(-99, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("-0991127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(-9, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("-0091127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(-1, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("-0011127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(0, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("00001127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(1, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("00011127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(9, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("00091127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(99, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("00991127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(999, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("09991127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(9999, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("99991127", format(e4y_fmt, tp, utc));
+
+ // When the year is outside [-999:9999], more than 4 chars are produced.
+ tp = convert(civil_second(-1000, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("-10001127", format(e4y_fmt, tp, utc));
+ tp = convert(civil_second(10000, 11, 27, 0, 0, 0), utc);
+ EXPECT_EQ("100001127", format(e4y_fmt, tp, utc));
+}
+
+TEST(Format, RFC3339Format) {
+ time_zone tz;
+ EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+
+ time_point<chrono::nanoseconds> tp =
+ convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::milliseconds(100);
+ EXPECT_EQ("1977-06-28T09:08:07.1-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::milliseconds(20);
+ EXPECT_EQ("1977-06-28T09:08:07.12-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::milliseconds(3);
+ EXPECT_EQ("1977-06-28T09:08:07.123-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::microseconds(400);
+ EXPECT_EQ("1977-06-28T09:08:07.1234-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::microseconds(50);
+ EXPECT_EQ("1977-06-28T09:08:07.12345-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::microseconds(6);
+ EXPECT_EQ("1977-06-28T09:08:07.123456-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::nanoseconds(700);
+ EXPECT_EQ("1977-06-28T09:08:07.1234567-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::nanoseconds(80);
+ EXPECT_EQ("1977-06-28T09:08:07.12345678-07:00", format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+ tp += chrono::nanoseconds(9);
+ EXPECT_EQ("1977-06-28T09:08:07.123456789-07:00",
+ format(RFC3339_full, tp, tz));
+ EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+}
+
+TEST(Format, RFC1123Format) { // locale specific
+ time_zone tz;
+ EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+
+ auto tp = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+ EXPECT_EQ("Tue, 28 Jun 1977 09:08:07 -0700", format(RFC1123_full, tp, tz));
+ EXPECT_EQ("28 Jun 1977 09:08:07 -0700", format(RFC1123_no_wday, tp, tz));
+}
+
+//
+// Testing parse()
+//
+
+TEST(Parse, TimePointResolution) {
+ const char kFmt[] = "%H:%M:%E*S";
+ const time_zone utc = utc_time_zone();
+
+ time_point<chrono::nanoseconds> tp_ns;
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_ns));
+ EXPECT_EQ("03:04:05.123456789", format(kFmt, tp_ns, utc));
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ns));
+ EXPECT_EQ("03:04:05.123456", format(kFmt, tp_ns, utc));
+
+ time_point<chrono::microseconds> tp_us;
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_us));
+ EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_us));
+ EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_us));
+ EXPECT_EQ("03:04:05.123", format(kFmt, tp_us, utc));
+
+ time_point<chrono::milliseconds> tp_ms;
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ms));
+ EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_ms));
+ EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
+ EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_ms));
+ EXPECT_EQ("03:04:05", format(kFmt, tp_ms, utc));
+
+ time_point<chrono::seconds> tp_s;
+ EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_s));
+ EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
+ EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_s));
+ EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
+
+ time_point<chrono::minutes> tp_m;
+ EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_m));
+ EXPECT_EQ("03:04:00", format(kFmt, tp_m, utc));
+
+ time_point<chrono::hours> tp_h;
+ EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_h));
+ EXPECT_EQ("03:00:00", format(kFmt, tp_h, utc));
+}
+
+TEST(Parse, TimePointExtendedResolution) {
+ const char kFmt[] = "%H:%M:%E*S";
+ const time_zone utc = utc_time_zone();
+
+ time_point<absl::time_internal::cctz::seconds> tp;
+ detail::femtoseconds fs;
+ EXPECT_TRUE(detail::parse(kFmt, "12:34:56.123456789012345", utc, &tp, &fs));
+ EXPECT_EQ("12:34:56.123456789012345", detail::format(kFmt, tp, fs, utc));
+ EXPECT_TRUE(detail::parse(kFmt, "12:34:56.012345678901234", utc, &tp, &fs));
+ EXPECT_EQ("12:34:56.012345678901234", detail::format(kFmt, tp, fs, utc));
+ EXPECT_TRUE(detail::parse(kFmt, "12:34:56.001234567890123", utc, &tp, &fs));
+ EXPECT_EQ("12:34:56.001234567890123", detail::format(kFmt, tp, fs, utc));
+ EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000123", utc, &tp, &fs));
+ EXPECT_EQ("12:34:56.000000000000123", detail::format(kFmt, tp, fs, utc));
+ EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000012", utc, &tp, &fs));
+ EXPECT_EQ("12:34:56.000000000000012", detail::format(kFmt, tp, fs, utc));
+ EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000001", utc, &tp, &fs));
+ EXPECT_EQ("12:34:56.000000000000001", detail::format(kFmt, tp, fs, utc));
+}
+
+TEST(Parse, Basics) {
+ time_zone tz = utc_time_zone();
+ time_point<chrono::nanoseconds> tp =
+ chrono::system_clock::from_time_t(1234567890);
+
+ // Simple edge cases.
+ EXPECT_TRUE(parse("", "", tz, &tp));
+ EXPECT_EQ(chrono::system_clock::from_time_t(0), tp); // everything defaulted
+ EXPECT_TRUE(parse(" ", " ", tz, &tp));
+ EXPECT_TRUE(parse(" ", " ", tz, &tp));
+ EXPECT_TRUE(parse("x", "x", tz, &tp));
+ EXPECT_TRUE(parse("xxx", "xxx", tz, &tp));
+
+ EXPECT_TRUE(
+ parse("%Y-%m-%d %H:%M:%S %z", "2013-06-28 19:08:09 -0800", tz, &tp));
+ ExpectTime(tp, tz, 2013, 6, 29, 3, 8, 9, 0, false, "UTC");
+}
+
+TEST(Parse, WithTimeZone) {
+ time_zone tz;
+ EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+ time_point<chrono::nanoseconds> tp;
+
+ // We can parse a std::string without a UTC offset if we supply a timezone.
+ EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2013-06-28 19:08:09", tz, &tp));
+ ExpectTime(tp, tz, 2013, 6, 28, 19, 8, 9, -7 * 60 * 60, true, "PDT");
+
+ // But the timezone is ignored when a UTC offset is present.
+ EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S %z", "2013-06-28 19:08:09 +0800",
+ utc_time_zone(), &tp));
+ ExpectTime(tp, tz, 2013, 6, 28, 19 - 8 - 7, 8, 9, -7 * 60 * 60, true, "PDT");
+
+ // Check a skipped time (a Spring DST transition). parse() uses the
+ // pre-transition offset.
+ EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2011-03-13 02:15:00", tz, &tp));
+ ExpectTime(tp, tz, 2011, 3, 13, 3, 15, 0, -7 * 60 * 60, true, "PDT");
+
+ // Check a repeated time (a Fall DST transition). parse() uses the
+ // pre-transition offset.
+ EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2011-11-06 01:15:00", tz, &tp));
+ ExpectTime(tp, tz, 2011, 11, 6, 1, 15, 0, -7 * 60 * 60, true, "PDT");
+}
+
+TEST(Parse, LeapSecond) {
+ time_zone tz;
+ EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+ time_point<chrono::nanoseconds> tp;
+
+ // ":59" -> ":59"
+ EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59-08:00", tz, &tp));
+ ExpectTime(tp, tz, 2013, 6, 28, 8, 8, 59, -7 * 60 * 60, true, "PDT");
+
+ // ":59.5" -> ":59.5"
+ EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59.5-08:00", tz, &tp));
+ ExpectTime(tp, tz, 2013, 6, 28, 8, 8, 59, -7 * 60 * 60, true, "PDT");
+
+ // ":60" -> ":00"
+ EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:60-08:00", tz, &tp));
+ ExpectTime(tp, tz, 2013, 6, 28, 8, 9, 0, -7 * 60 * 60, true, "PDT");
+
+ // ":60.5" -> ":00.0"
+ EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:60.5-08:00", tz, &tp));
+ ExpectTime(tp, tz, 2013, 6, 28, 8, 9, 0, -7 * 60 * 60, true, "PDT");
+
+ // ":61" -> error
+ EXPECT_FALSE(parse(RFC3339_full, "2013-06-28T07:08:61-08:00", tz, &tp));
+}
+
+TEST(Parse, ErrorCases) {
+ const time_zone tz = utc_time_zone();
+ auto tp = chrono::system_clock::from_time_t(0);
+
+ // Illegal trailing data.
+ EXPECT_FALSE(parse("%S", "123", tz, &tp));
+
+ // Can't parse an illegal format specifier.
+ EXPECT_FALSE(parse("%Q", "x", tz, &tp));
+
+ // Fails because of trailing, unparsed data "blah".
+ EXPECT_FALSE(parse("%m-%d", "2-3 blah", tz, &tp));
+
+ // Trailing whitespace is allowed.
+ EXPECT_TRUE(parse("%m-%d", "2-3 ", tz, &tp));
+ EXPECT_EQ(2, convert(tp, utc_time_zone()).month());
+ EXPECT_EQ(3, convert(tp, utc_time_zone()).day());
+
+ // Feb 31 requires normalization.
+ EXPECT_FALSE(parse("%m-%d", "2-31", tz, &tp));
+
+ // Check that we cannot have spaces in UTC offsets.
+ EXPECT_TRUE(parse("%z", "-0203", tz, &tp));
+ EXPECT_FALSE(parse("%z", "- 2 3", tz, &tp));
+ EXPECT_TRUE(parse("%Ez", "-02:03", tz, &tp));
+ EXPECT_FALSE(parse("%Ez", "- 2: 3", tz, &tp));
+
+ // Check that we reject other malformed UTC offsets.
+ EXPECT_FALSE(parse("%Ez", "+-08:00", tz, &tp));
+ EXPECT_FALSE(parse("%Ez", "-+08:00", tz, &tp));
+
+ // Check that we do not accept "-0" in fields that allow zero.
+ EXPECT_FALSE(parse("%Y", "-0", tz, &tp));
+ EXPECT_FALSE(parse("%E4Y", "-0", tz, &tp));
+ EXPECT_FALSE(parse("%H", "-0", tz, &tp));
+ EXPECT_FALSE(parse("%M", "-0", tz, &tp));
+ EXPECT_FALSE(parse("%S", "-0", tz, &tp));
+ EXPECT_FALSE(parse("%z", "+-000", tz, &tp));
+ EXPECT_FALSE(parse("%Ez", "+-0:00", tz, &tp));
+ EXPECT_FALSE(parse("%z", "-00-0", tz, &tp));
+ EXPECT_FALSE(parse("%Ez", "-00:-0", tz, &tp));
+}
+
+TEST(Parse, PosixConversions) {
+ time_zone tz = utc_time_zone();
+ auto tp = chrono::system_clock::from_time_t(0);
+ const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+
+ tp = reset;
+ EXPECT_TRUE(parse("%d", "15", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).day());
+
+ // %e is an extension, but is supported internally.
+ tp = reset;
+ EXPECT_TRUE(parse("%e", "15", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).day()); // Equivalent to %d
+
+ tp = reset;
+ EXPECT_TRUE(parse("%H", "17", tz, &tp));
+ EXPECT_EQ(17, convert(tp, tz).hour());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%I", "5", tz, &tp));
+ EXPECT_EQ(5, convert(tp, tz).hour());
+
+ // %j is parsed but ignored.
+ EXPECT_TRUE(parse("%j", "32", tz, &tp));
+
+ tp = reset;
+ EXPECT_TRUE(parse("%m", "11", tz, &tp));
+ EXPECT_EQ(11, convert(tp, tz).month());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%M", "33", tz, &tp));
+ EXPECT_EQ(33, convert(tp, tz).minute());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%S", "55", tz, &tp));
+ EXPECT_EQ(55, convert(tp, tz).second());
+
+ // %U is parsed but ignored.
+ EXPECT_TRUE(parse("%U", "15", tz, &tp));
+
+ // %w is parsed but ignored.
+ EXPECT_TRUE(parse("%w", "2", tz, &tp));
+
+ // %W is parsed but ignored.
+ EXPECT_TRUE(parse("%W", "22", tz, &tp));
+
+ tp = reset;
+ EXPECT_TRUE(parse("%y", "04", tz, &tp));
+ EXPECT_EQ(2004, convert(tp, tz).year());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Y", "2004", tz, &tp));
+ EXPECT_EQ(2004, convert(tp, tz).year());
+
+ EXPECT_TRUE(parse("%%", "%", tz, &tp));
+
+#if defined(__linux__)
+ // SU/C99/TZ extensions
+
+ // Because we handle each (non-internal) specifier in a separate call
+ // to strptime(), there is no way to group %C and %y together. So we
+ // just skip the %C/%y case.
+#if 0
+ tp = reset;
+ EXPECT_TRUE(parse("%C %y", "20 04", tz, &tp));
+ EXPECT_EQ(2004, convert(tp, tz).year());
+#endif
+
+ tp = reset;
+ EXPECT_TRUE(parse("%D", "02/03/04", tz, &tp));
+ EXPECT_EQ(2, convert(tp, tz).month());
+ EXPECT_EQ(3, convert(tp, tz).day());
+ EXPECT_EQ(2004, convert(tp, tz).year());
+
+ EXPECT_TRUE(parse("%n", "\n", tz, &tp));
+
+ tp = reset;
+ EXPECT_TRUE(parse("%R", "03:44", tz, &tp));
+ EXPECT_EQ(3, convert(tp, tz).hour());
+ EXPECT_EQ(44, convert(tp, tz).minute());
+
+ EXPECT_TRUE(parse("%t", "\t\v\f\n\r ", tz, &tp));
+
+ tp = reset;
+ EXPECT_TRUE(parse("%T", "03:44:55", tz, &tp));
+ EXPECT_EQ(3, convert(tp, tz).hour());
+ EXPECT_EQ(44, convert(tp, tz).minute());
+ EXPECT_EQ(55, convert(tp, tz).second());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%s", "1234567890", tz, &tp));
+ EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+ // %s conversion, like %z/%Ez, pays no heed to the optional zone.
+ time_zone lax;
+ EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
+ tp = reset;
+ EXPECT_TRUE(parse("%s", "1234567890", lax, &tp));
+ EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+ // This is most important when the time has the same YMDhms
+ // breakdown in the zone as some other time. For example, ...
+ // 1414917000 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PDT)
+ // 1414920600 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PST)
+ tp = reset;
+ EXPECT_TRUE(parse("%s", "1414917000", lax, &tp));
+ EXPECT_EQ(chrono::system_clock::from_time_t(1414917000), tp);
+ tp = reset;
+ EXPECT_TRUE(parse("%s", "1414920600", lax, &tp));
+ EXPECT_EQ(chrono::system_clock::from_time_t(1414920600), tp);
+#endif
+}
+
+TEST(Parse, LocaleSpecific) {
+ time_zone tz = utc_time_zone();
+ auto tp = chrono::system_clock::from_time_t(0);
+ const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+
+ // %a is parsed but ignored.
+ EXPECT_TRUE(parse("%a", "Mon", tz, &tp));
+
+ // %A is parsed but ignored.
+ EXPECT_TRUE(parse("%A", "Monday", tz, &tp));
+
+ tp = reset;
+ EXPECT_TRUE(parse("%b", "Feb", tz, &tp));
+ EXPECT_EQ(2, convert(tp, tz).month());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%B", "February", tz, &tp));
+ EXPECT_EQ(2, convert(tp, tz).month());
+
+ // %p is parsed but ignored if it's alone. But it's used with %I.
+ EXPECT_TRUE(parse("%p", "AM", tz, &tp));
+ tp = reset;
+ EXPECT_TRUE(parse("%I %p", "5 PM", tz, &tp));
+ EXPECT_EQ(17, convert(tp, tz).hour());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%x", "02/03/04", tz, &tp));
+ if (convert(tp, tz).month() == 2) {
+ EXPECT_EQ(3, convert(tp, tz).day());
+ } else {
+ EXPECT_EQ(2, convert(tp, tz).day());
+ EXPECT_EQ(3, convert(tp, tz).month());
+ }
+ EXPECT_EQ(2004, convert(tp, tz).year());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%X", "15:44:55", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).hour());
+ EXPECT_EQ(44, convert(tp, tz).minute());
+ EXPECT_EQ(55, convert(tp, tz).second());
+
+#if defined(__linux__)
+ // SU/C99/TZ extensions
+
+ tp = reset;
+ EXPECT_TRUE(parse("%h", "Feb", tz, &tp));
+ EXPECT_EQ(2, convert(tp, tz).month()); // Equivalent to %b
+
+ tp = reset;
+ EXPECT_TRUE(parse("%l %p", "5 PM", tz, &tp));
+ EXPECT_EQ(17, convert(tp, tz).hour());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%r", "03:44:55 PM", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).hour());
+ EXPECT_EQ(44, convert(tp, tz).minute());
+ EXPECT_EQ(55, convert(tp, tz).second());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Ec", "Tue Nov 19 05:06:07 2013", tz, &tp));
+ EXPECT_EQ(convert(civil_second(2013, 11, 19, 5, 6, 7), tz), tp);
+
+ // Modified conversion specifiers %E_
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Ex", "02/03/04", tz, &tp));
+ EXPECT_EQ(2, convert(tp, tz).month());
+ EXPECT_EQ(3, convert(tp, tz).day());
+ EXPECT_EQ(2004, convert(tp, tz).year());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%EX", "15:44:55", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).hour());
+ EXPECT_EQ(44, convert(tp, tz).minute());
+ EXPECT_EQ(55, convert(tp, tz).second());
+
+ // %Ey, the year offset from %EC, doesn't really make sense alone as there
+ // is no way to represent it in tm_year (%EC is not simply the century).
+ // Yet, because we handle each (non-internal) specifier in a separate call
+ // to strptime(), there is no way to group %EC and %Ey either. So we just
+ // skip the %EC and %Ey cases.
+
+ tp = reset;
+ EXPECT_TRUE(parse("%EY", "2004", tz, &tp));
+ EXPECT_EQ(2004, convert(tp, tz).year());
+
+ // Modified conversion specifiers %O_
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Od", "15", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).day());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Oe", "15", tz, &tp));
+ EXPECT_EQ(15, convert(tp, tz).day()); // Equivalent to %d
+
+ tp = reset;
+ EXPECT_TRUE(parse("%OH", "17", tz, &tp));
+ EXPECT_EQ(17, convert(tp, tz).hour());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%OI", "5", tz, &tp));
+ EXPECT_EQ(5, convert(tp, tz).hour());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Om", "11", tz, &tp));
+ EXPECT_EQ(11, convert(tp, tz).month());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%OM", "33", tz, &tp));
+ EXPECT_EQ(33, convert(tp, tz).minute());
+
+ tp = reset;
+ EXPECT_TRUE(parse("%OS", "55", tz, &tp));
+ EXPECT_EQ(55, convert(tp, tz).second());
+
+ // %OU is parsed but ignored.
+ EXPECT_TRUE(parse("%OU", "15", tz, &tp));
+
+ // %Ow is parsed but ignored.
+ EXPECT_TRUE(parse("%Ow", "2", tz, &tp));
+
+ // %OW is parsed but ignored.
+ EXPECT_TRUE(parse("%OW", "22", tz, &tp));
+
+ tp = reset;
+ EXPECT_TRUE(parse("%Oy", "04", tz, &tp));
+ EXPECT_EQ(2004, convert(tp, tz).year());
+#endif
+}
+
+TEST(Parse, ExtendedSeconds) {
+ const time_zone tz = utc_time_zone();
+ const time_point<chrono::nanoseconds> unix_epoch =
+ chrono::system_clock::from_time_t(0);
+
+ // All %E<prec>S cases are treated the same as %E*S on input.
+ auto precisions = {"*", "0", "1", "2", "3", "4", "5", "6", "7",
+ "8", "9", "10", "11", "12", "13", "14", "15"};
+ for (const std::string& prec : precisions) {
+ const std::string fmt = "%E" + prec + "S";
+ SCOPED_TRACE(fmt);
+ time_point<chrono::nanoseconds> tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "5", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.0", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.00", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.6", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.60", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.600", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.67", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.670", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "05.678", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(678), tp);
+ }
+
+ // Here is a "%E*S" case we got wrong for a while. The fractional
+ // part of the first instant is less than 2^31 and was correctly
+ // parsed, while the second (and any subsecond field >=2^31) failed.
+ time_point<chrono::nanoseconds> tp = unix_epoch;
+ EXPECT_TRUE(parse("%E*S", "0.2147483647", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse("%E*S", "0.2147483648", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+
+ // We should also be able to specify long strings of digits far
+ // beyond the current resolution and have them convert the same way.
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(
+ "%E*S", "0.214748364801234567890123456789012345678901234567890123456789",
+ tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+}
+
+TEST(Parse, ExtendedSecondsScan) {
+ const time_zone tz = utc_time_zone();
+ time_point<chrono::nanoseconds> tp;
+ for (int ms = 0; ms < 1000; ms += 111) {
+ for (int us = 0; us < 1000; us += 27) {
+ const int micros = ms * 1000 + us;
+ for (int ns = 0; ns < 1000; ns += 9) {
+ const auto expected = chrono::system_clock::from_time_t(0) +
+ chrono::nanoseconds(micros * 1000 + ns);
+ std::ostringstream oss;
+ oss << "0." << std::setfill('0') << std::setw(3);
+ oss << ms << std::setw(3) << us << std::setw(3) << ns;
+ const std::string input = oss.str();
+ EXPECT_TRUE(parse("%E*S", input, tz, &tp));
+ EXPECT_EQ(expected, tp) << input;
+ }
+ }
+ }
+}
+
+TEST(Parse, ExtendedSubeconds) {
+ const time_zone tz = utc_time_zone();
+ const time_point<chrono::nanoseconds> unix_epoch =
+ chrono::system_clock::from_time_t(0);
+
+ // All %E<prec>f cases are treated the same as %E*f on input.
+ auto precisions = {"*", "0", "1", "2", "3", "4", "5", "6", "7",
+ "8", "9", "10", "11", "12", "13", "14", "15"};
+ for (const std::string& prec : precisions) {
+ const std::string fmt = "%E" + prec + "f";
+ SCOPED_TRACE(fmt);
+ time_point<chrono::nanoseconds> tp = unix_epoch - chrono::seconds(1);
+ EXPECT_TRUE(parse(fmt, "", tz, &tp));
+ EXPECT_EQ(unix_epoch, tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "6", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "60", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "600", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "67", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "670", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "678", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(678), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(fmt, "6789", tz, &tp));
+ EXPECT_EQ(
+ unix_epoch + chrono::milliseconds(678) + chrono::microseconds(900), tp);
+ }
+
+ // Here is a "%E*f" case we got wrong for a while. The fractional
+ // part of the first instant is less than 2^31 and was correctly
+ // parsed, while the second (and any subsecond field >=2^31) failed.
+ time_point<chrono::nanoseconds> tp = unix_epoch;
+ EXPECT_TRUE(parse("%E*f", "2147483647", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+ tp = unix_epoch;
+ EXPECT_TRUE(parse("%E*f", "2147483648", tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+
+ // We should also be able to specify long strings of digits far
+ // beyond the current resolution and have them convert the same way.
+ tp = unix_epoch;
+ EXPECT_TRUE(parse(
+ "%E*f", "214748364801234567890123456789012345678901234567890123456789",
+ tz, &tp));
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+}
+
+TEST(Parse, ExtendedSubecondsScan) {
+ time_point<chrono::nanoseconds> tp;
+ const time_zone tz = utc_time_zone();
+ for (int ms = 0; ms < 1000; ms += 111) {
+ for (int us = 0; us < 1000; us += 27) {
+ const int micros = ms * 1000 + us;
+ for (int ns = 0; ns < 1000; ns += 9) {
+ std::ostringstream oss;
+ oss << std::setfill('0') << std::setw(3) << ms;
+ oss << std::setw(3) << us << std::setw(3) << ns;
+ const std::string nanos = oss.str();
+ const auto expected = chrono::system_clock::from_time_t(0) +
+ chrono::nanoseconds(micros * 1000 + ns);
+ for (int ps = 0; ps < 1000; ps += 250) {
+ std::ostringstream ps_oss;
+ oss << std::setfill('0') << std::setw(3) << ps;
+ const std::string input = nanos + ps_oss.str() + "999";
+ EXPECT_TRUE(parse("%E*f", input, tz, &tp));
+ EXPECT_EQ(expected + chrono::nanoseconds(ps) / 1000, tp) << input;
+ }
+ }
+ }
+ }
+}
+
+TEST(Parse, ExtendedOffset) {
+ const time_zone utc = utc_time_zone();
+ time_point<absl::time_internal::cctz::seconds> tp;
+
+ EXPECT_TRUE(parse("%Ez", "+00:00", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse("%Ez", "-12:34", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+ EXPECT_TRUE(parse("%Ez", "+12:34", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+ EXPECT_FALSE(parse("%Ez", "-12:3", utc, &tp));
+
+ for (auto fmt : {"%Ez", "%z"}) {
+ EXPECT_TRUE(parse(fmt, "+0000", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-1234", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+1234", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-123", utc, &tp));
+
+ EXPECT_TRUE(parse(fmt, "+00", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-12", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+12", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 12, 0, 0), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-1", utc, &tp));
+ }
+}
+
+TEST(Parse, ExtendedSecondOffset) {
+ const time_zone utc = utc_time_zone();
+ time_point<absl::time_internal::cctz::seconds> tp;
+
+ for (auto fmt : {"%Ez", "%E*z", "%:z", "%::z", "%:::z"}) {
+ EXPECT_TRUE(parse(fmt, "+00:00:00", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-12:34:56", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 56), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+12:34:56", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 25, 4), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-12:34:5", utc, &tp));
+
+ EXPECT_TRUE(parse(fmt, "+000000", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-123456", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 56), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+123456", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 25, 4), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-12345", utc, &tp));
+
+ EXPECT_TRUE(parse(fmt, "+00:00", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-12:34", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+12:34", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-12:3", utc, &tp));
+
+ EXPECT_TRUE(parse(fmt, "+0000", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-1234", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+1234", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-123", utc, &tp));
+
+ EXPECT_TRUE(parse(fmt, "+00", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "-12", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(fmt, "+12", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1969, 12, 31, 12, 0, 0), utc), tp);
+ EXPECT_FALSE(parse(fmt, "-1", utc, &tp));
+ }
+}
+
+TEST(Parse, ExtendedYears) {
+ const time_zone utc = utc_time_zone();
+ const char e4y_fmt[] = "%E4Y%m%d"; // no separators
+ time_point<absl::time_internal::cctz::seconds> tp;
+
+ // %E4Y consumes exactly four chars, including any sign.
+ EXPECT_TRUE(parse(e4y_fmt, "-9991127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(-999, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "-0991127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(-99, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "-0091127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(-9, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "-0011127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(-1, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "00001127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(0, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "00011127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(1, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "00091127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(9, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "00991127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(99, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "09991127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(999, 11, 27, 0, 0, 0), utc), tp);
+ EXPECT_TRUE(parse(e4y_fmt, "99991127", utc, &tp));
+ EXPECT_EQ(convert(civil_second(9999, 11, 27, 0, 0, 0), utc), tp);
+
+ // When the year is outside [-999:9999], the parse fails.
+ EXPECT_FALSE(parse(e4y_fmt, "-10001127", utc, &tp));
+ EXPECT_FALSE(parse(e4y_fmt, "100001127", utc, &tp));
+}
+
+TEST(Parse, RFC3339Format) {
+ const time_zone tz = utc_time_zone();
+ time_point<chrono::nanoseconds> tp;
+ EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00+00:00", tz, &tp));
+ ExpectTime(tp, tz, 2014, 2, 12, 20, 21, 0, 0, false, "UTC");
+
+ // Check that %Ez also accepts "Z" as a synonym for "+00:00".
+ time_point<chrono::nanoseconds> tp2;
+ EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00Z", tz, &tp2));
+ EXPECT_EQ(tp, tp2);
+}
+
+TEST(Parse, MaxRange) {
+ const time_zone utc = utc_time_zone();
+ time_point<absl::time_internal::cctz::seconds> tp;
+
+ // tests the upper limit using +00:00 offset
+ EXPECT_TRUE(
+ parse(RFC3339_sec, "292277026596-12-04T15:30:07+00:00", utc, &tp));
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
+ EXPECT_FALSE(
+ parse(RFC3339_sec, "292277026596-12-04T15:30:08+00:00", utc, &tp));
+
+ // tests the upper limit using -01:00 offset
+ EXPECT_TRUE(
+ parse(RFC3339_sec, "292277026596-12-04T14:30:07-01:00", utc, &tp));
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
+ EXPECT_FALSE(
+ parse(RFC3339_sec, "292277026596-12-04T15:30:07-01:00", utc, &tp));
+
+ // tests the lower limit using +00:00 offset
+ EXPECT_TRUE(
+ parse(RFC3339_sec, "-292277022657-01-27T08:29:52+00:00", utc, &tp));
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
+ EXPECT_FALSE(
+ parse(RFC3339_sec, "-292277022657-01-27T08:29:51+00:00", utc, &tp));
+
+ // tests the lower limit using +01:00 offset
+ EXPECT_TRUE(
+ parse(RFC3339_sec, "-292277022657-01-27T09:29:52+01:00", utc, &tp));
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
+ EXPECT_FALSE(
+ parse(RFC3339_sec, "-292277022657-01-27T08:29:51+01:00", utc, &tp));
+
+ // tests max/min civil-second overflow
+ EXPECT_FALSE(
+ parse(RFC3339_sec, "9223372036854775807-12-31T23:59:59-00:01", utc, &tp));
+ EXPECT_FALSE(parse(RFC3339_sec, "-9223372036854775808-01-01T00:00:00+00:01",
+ utc, &tp));
+
+ // TODO: Add tests that parsing times with fractional seconds overflow
+ // appropriately. This can't be done until cctz::parse() properly detects
+ // overflow when combining the chrono seconds and femto.
+}
+
+//
+// Roundtrip test for format()/parse().
+//
+
+TEST(FormatParse, RoundTrip) {
+ time_zone lax;
+ EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
+ const auto in = convert(civil_second(1977, 6, 28, 9, 8, 7), lax);
+ const auto subseconds = chrono::nanoseconds(654321);
+
+ // RFC3339, which renders subseconds.
+ {
+ time_point<chrono::nanoseconds> out;
+ const std::string s = format(RFC3339_full, in + subseconds, lax);
+ EXPECT_TRUE(parse(RFC3339_full, s, lax, &out)) << s;
+ EXPECT_EQ(in + subseconds, out); // RFC3339_full includes %Ez
+ }
+
+ // RFC1123, which only does whole seconds.
+ {
+ time_point<chrono::nanoseconds> out;
+ const std::string s = format(RFC1123_full, in, lax);
+ EXPECT_TRUE(parse(RFC1123_full, s, lax, &out)) << s;
+ EXPECT_EQ(in, out); // RFC1123_full includes %z
+ }
+
+#if defined(_WIN32) || defined(_WIN64)
+ // Initial investigations indicate the %c does not roundtrip on Windows.
+ // TODO: Figure out what is going on here (perhaps a locale problem).
+#elif defined(__EMSCRIPTEN__)
+ // strftime() and strptime() use different defintions for "%c" under
+ // emscripten (see https://github.com/kripken/emscripten/pull/7491),
+ // causing its round-trip test to fail.
+#else
+ // Even though we don't know what %c will produce, it should roundtrip,
+ // but only in the 0-offset timezone.
+ {
+ time_point<chrono::nanoseconds> out;
+ time_zone utc = utc_time_zone();
+ const std::string s = format("%c", in, utc);
+ EXPECT_TRUE(parse("%c", s, utc, &out)) << s;
+ EXPECT_EQ(in, out);
+ }
+#endif
+}
+
+TEST(FormatParse, RoundTripDistantFuture) {
+ const time_zone utc = utc_time_zone();
+ const time_point<absl::time_internal::cctz::seconds> in =
+ time_point<absl::time_internal::cctz::seconds>::max();
+ const std::string s = format(RFC3339_full, in, utc);
+ time_point<absl::time_internal::cctz::seconds> out;
+ EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
+ EXPECT_EQ(in, out);
+}
+
+TEST(FormatParse, RoundTripDistantPast) {
+ const time_zone utc = utc_time_zone();
+ const time_point<absl::time_internal::cctz::seconds> in =
+ time_point<absl::time_internal::cctz::seconds>::min();
+ const std::string s = format(RFC3339_full, in, utc);
+ time_point<absl::time_internal::cctz::seconds> out;
+ EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
+ EXPECT_EQ(in, out);
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.cc
new file mode 100644
index 0000000000..0319b2f98e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.cc
@@ -0,0 +1,45 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "time_zone_if.h"
+
+#include "absl/base/config.h"
+#include "time_zone_info.h"
+#include "time_zone_libc.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+std::unique_ptr<TimeZoneIf> TimeZoneIf::Load(const std::string& name) {
+ // Support "libc:localtime" and "libc:*" to access the legacy
+ // localtime and UTC support respectively from the C library.
+ if (name.compare(0, 5, "libc:") == 0) {
+ return std::unique_ptr<TimeZoneIf>(new TimeZoneLibC(name.substr(5)));
+ }
+
+ // Otherwise use the "zoneinfo" implementation by default.
+ std::unique_ptr<TimeZoneInfo> tz(new TimeZoneInfo);
+ if (!tz->Load(name)) tz.reset();
+ return std::unique_ptr<TimeZoneIf>(tz.release());
+}
+
+// Defined out-of-line to avoid emitting a weak vtable in all TUs.
+TimeZoneIf::~TimeZoneIf() {}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.h
new file mode 100644
index 0000000000..32c0891c1e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_if.h
@@ -0,0 +1,76 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
+
+#include <chrono>
+#include <cstdint>
+#include <memory>
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A simple interface used to hide time-zone complexities from time_zone::Impl.
+// Subclasses implement the functions for civil-time conversions in the zone.
+class TimeZoneIf {
+ public:
+ // A factory function for TimeZoneIf implementations.
+ static std::unique_ptr<TimeZoneIf> Load(const std::string& name);
+
+ virtual ~TimeZoneIf();
+
+ virtual time_zone::absolute_lookup BreakTime(
+ const time_point<seconds>& tp) const = 0;
+ virtual time_zone::civil_lookup MakeTime(const civil_second& cs) const = 0;
+
+ virtual bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const = 0;
+ virtual bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const = 0;
+
+ virtual std::string Version() const = 0;
+ virtual std::string Description() const = 0;
+
+ protected:
+ TimeZoneIf() {}
+};
+
+// Convert between time_point<seconds> and a count of seconds since the
+// Unix epoch. We assume that the std::chrono::system_clock and the
+// Unix clock are second aligned, but not that they share an epoch.
+inline std::int_fast64_t ToUnixSeconds(const time_point<seconds>& tp) {
+ return (tp - std::chrono::time_point_cast<seconds>(
+ std::chrono::system_clock::from_time_t(0)))
+ .count();
+}
+inline time_point<seconds> FromUnixSeconds(std::int_fast64_t t) {
+ return std::chrono::time_point_cast<seconds>(
+ std::chrono::system_clock::from_time_t(0)) +
+ seconds(t);
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.cc
new file mode 100644
index 0000000000..030ae0e19e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.cc
@@ -0,0 +1,121 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "time_zone_impl.h"
+
+#include <deque>
+#include <mutex>
+#include <string>
+#include <unordered_map>
+#include <utility>
+
+#include "absl/base/config.h"
+#include "time_zone_fixed.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// time_zone::Impls are linked into a map to support fast lookup by name.
+using TimeZoneImplByName =
+ std::unordered_map<std::string, const time_zone::Impl*>;
+TimeZoneImplByName* time_zone_map = nullptr;
+
+// Mutual exclusion for time_zone_map.
+std::mutex& TimeZoneMutex() {
+ // This mutex is intentionally "leaked" to avoid the static deinitialization
+ // order fiasco (std::mutex's destructor is not trivial on many platforms).
+ static std::mutex* time_zone_mutex = new std::mutex;
+ return *time_zone_mutex;
+}
+
+} // namespace
+
+time_zone time_zone::Impl::UTC() { return time_zone(UTCImpl()); }
+
+bool time_zone::Impl::LoadTimeZone(const std::string& name, time_zone* tz) {
+ const time_zone::Impl* const utc_impl = UTCImpl();
+
+ // First check for UTC (which is never a key in time_zone_map).
+ auto offset = seconds::zero();
+ if (FixedOffsetFromName(name, &offset) && offset == seconds::zero()) {
+ *tz = time_zone(utc_impl);
+ return true;
+ }
+
+ // Then check, under a shared lock, whether the time zone has already
+ // been loaded. This is the common path. TODO: Move to shared_mutex.
+ {
+ std::lock_guard<std::mutex> lock(TimeZoneMutex());
+ if (time_zone_map != nullptr) {
+ TimeZoneImplByName::const_iterator itr = time_zone_map->find(name);
+ if (itr != time_zone_map->end()) {
+ *tz = time_zone(itr->second);
+ return itr->second != utc_impl;
+ }
+ }
+ }
+
+ // Now check again, under an exclusive lock.
+ std::lock_guard<std::mutex> lock(TimeZoneMutex());
+ if (time_zone_map == nullptr) time_zone_map = new TimeZoneImplByName;
+ const Impl*& impl = (*time_zone_map)[name];
+ if (impl == nullptr) {
+ // The first thread in loads the new time zone.
+ Impl* new_impl = new Impl(name);
+ new_impl->zone_ = TimeZoneIf::Load(new_impl->name_);
+ if (new_impl->zone_ == nullptr) {
+ delete new_impl; // free the nascent Impl
+ impl = utc_impl; // and fallback to UTC
+ } else {
+ impl = new_impl; // install new time zone
+ }
+ }
+ *tz = time_zone(impl);
+ return impl != utc_impl;
+}
+
+void time_zone::Impl::ClearTimeZoneMapTestOnly() {
+ std::lock_guard<std::mutex> lock(TimeZoneMutex());
+ if (time_zone_map != nullptr) {
+ // Existing time_zone::Impl* entries are in the wild, so we can't delete
+ // them. Instead, we move them to a private container, where they are
+ // logically unreachable but not "leaked". Future requests will result
+ // in reloading the data.
+ static auto* cleared = new std::deque<const time_zone::Impl*>;
+ for (const auto& element : *time_zone_map) {
+ cleared->push_back(element.second);
+ }
+ time_zone_map->clear();
+ }
+}
+
+time_zone::Impl::Impl(const std::string& name) : name_(name) {}
+
+const time_zone::Impl* time_zone::Impl::UTCImpl() {
+ static Impl* utc_impl = [] {
+ Impl* impl = new Impl("UTC");
+ impl->zone_ = TimeZoneIf::Load(impl->name_); // never fails
+ return impl;
+ }();
+ return utc_impl;
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.h
new file mode 100644
index 0000000000..69806c10d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_impl.h
@@ -0,0 +1,93 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
+
+#include <memory>
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "time_zone_if.h"
+#include "time_zone_info.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// time_zone::Impl is the internal object referenced by a cctz::time_zone.
+class time_zone::Impl {
+ public:
+ // The UTC time zone. Also used for other time zones that fail to load.
+ static time_zone UTC();
+
+ // Load a named time zone. Returns false if the name is invalid, or if
+ // some other kind of error occurs. Note that loading "UTC" never fails.
+ static bool LoadTimeZone(const std::string& name, time_zone* tz);
+
+ // Clears the map of cached time zones. Primarily for use in benchmarks
+ // that gauge the performance of loading/parsing the time-zone data.
+ static void ClearTimeZoneMapTestOnly();
+
+ // The primary key is the time-zone ID (e.g., "America/New_York").
+ const std::string& Name() const {
+ // TODO: It would nice if the zoneinfo data included the zone name.
+ return name_;
+ }
+
+ // Breaks a time_point down to civil-time components in this time zone.
+ time_zone::absolute_lookup BreakTime(const time_point<seconds>& tp) const {
+ return zone_->BreakTime(tp);
+ }
+
+ // Converts the civil-time components in this time zone into a time_point.
+ // That is, the opposite of BreakTime(). The requested civil time may be
+ // ambiguous or illegal due to a change of UTC offset.
+ time_zone::civil_lookup MakeTime(const civil_second& cs) const {
+ return zone_->MakeTime(cs);
+ }
+
+ // Finds the time of the next/previous offset change in this time zone.
+ bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ return zone_->NextTransition(tp, trans);
+ }
+ bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ return zone_->PrevTransition(tp, trans);
+ }
+
+ // Returns an implementation-defined version std::string for this time zone.
+ std::string Version() const { return zone_->Version(); }
+
+ // Returns an implementation-defined description of this time zone.
+ std::string Description() const { return zone_->Description(); }
+
+ private:
+ explicit Impl(const std::string& name);
+ static const Impl* UTCImpl();
+
+ const std::string name_;
+ std::unique_ptr<TimeZoneIf> zone_;
+};
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.cc
new file mode 100644
index 0000000000..f1697cdf04
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.cc
@@ -0,0 +1,958 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// This file implements the TimeZoneIf interface using the "zoneinfo"
+// data provided by the IANA Time Zone Database (i.e., the only real game
+// in town).
+//
+// TimeZoneInfo represents the history of UTC-offset changes within a time
+// zone. Most changes are due to daylight-saving rules, but occasionally
+// shifts are made to the time-zone's base offset. The database only attempts
+// to be definitive for times since 1970, so be wary of local-time conversions
+// before that. Also, rule and zone-boundary changes are made at the whim
+// of governments, so the conversion of future times needs to be taken with
+// a grain of salt.
+//
+// For more information see tzfile(5), http://www.iana.org/time-zones, or
+// https://en.wikipedia.org/wiki/Zoneinfo.
+//
+// Note that we assume the proleptic Gregorian calendar and 60-second
+// minutes throughout.
+
+#include "time_zone_info.h"
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <cstdint>
+#include <cstdio>
+#include <cstdlib>
+#include <cstring>
+#include <functional>
+#include <iostream>
+#include <memory>
+#include <sstream>
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "time_zone_fixed.h"
+#include "time_zone_posix.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+inline bool IsLeap(year_t year) {
+ return (year % 4) == 0 && ((year % 100) != 0 || (year % 400) == 0);
+}
+
+// The number of days in non-leap and leap years respectively.
+const std::int_least32_t kDaysPerYear[2] = {365, 366};
+
+// The day offsets of the beginning of each (1-based) month in non-leap and
+// leap years respectively (e.g., 335 days before December in a leap year).
+const std::int_least16_t kMonthOffsets[2][1 + 12 + 1] = {
+ {-1, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334, 365},
+ {-1, 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335, 366},
+};
+
+// We reject leap-second encoded zoneinfo and so assume 60-second minutes.
+const std::int_least32_t kSecsPerDay = 24 * 60 * 60;
+
+// 400-year chunks always have 146097 days (20871 weeks).
+const std::int_least64_t kSecsPer400Years = 146097LL * kSecsPerDay;
+
+// Like kDaysPerYear[] but scaled up by a factor of kSecsPerDay.
+const std::int_least32_t kSecsPerYear[2] = {
+ 365 * kSecsPerDay,
+ 366 * kSecsPerDay,
+};
+
+// Single-byte, unsigned numeric values are encoded directly.
+inline std::uint_fast8_t Decode8(const char* cp) {
+ return static_cast<std::uint_fast8_t>(*cp) & 0xff;
+}
+
+// Multi-byte, numeric values are encoded using a MSB first,
+// twos-complement representation. These helpers decode, from
+// the given address, 4-byte and 8-byte values respectively.
+// Note: If int_fastXX_t == intXX_t and this machine is not
+// twos complement, then there will be at least one input value
+// we cannot represent.
+std::int_fast32_t Decode32(const char* cp) {
+ std::uint_fast32_t v = 0;
+ for (int i = 0; i != (32 / 8); ++i) v = (v << 8) | Decode8(cp++);
+ const std::int_fast32_t s32max = 0x7fffffff;
+ const auto s32maxU = static_cast<std::uint_fast32_t>(s32max);
+ if (v <= s32maxU) return static_cast<std::int_fast32_t>(v);
+ return static_cast<std::int_fast32_t>(v - s32maxU - 1) - s32max - 1;
+}
+
+std::int_fast64_t Decode64(const char* cp) {
+ std::uint_fast64_t v = 0;
+ for (int i = 0; i != (64 / 8); ++i) v = (v << 8) | Decode8(cp++);
+ const std::int_fast64_t s64max = 0x7fffffffffffffff;
+ const auto s64maxU = static_cast<std::uint_fast64_t>(s64max);
+ if (v <= s64maxU) return static_cast<std::int_fast64_t>(v);
+ return static_cast<std::int_fast64_t>(v - s64maxU - 1) - s64max - 1;
+}
+
+// Generate a year-relative offset for a PosixTransition.
+std::int_fast64_t TransOffset(bool leap_year, int jan1_weekday,
+ const PosixTransition& pt) {
+ std::int_fast64_t days = 0;
+ switch (pt.date.fmt) {
+ case PosixTransition::J: {
+ days = pt.date.j.day;
+ if (!leap_year || days < kMonthOffsets[1][3]) days -= 1;
+ break;
+ }
+ case PosixTransition::N: {
+ days = pt.date.n.day;
+ break;
+ }
+ case PosixTransition::M: {
+ const bool last_week = (pt.date.m.week == 5);
+ days = kMonthOffsets[leap_year][pt.date.m.month + last_week];
+ const std::int_fast64_t weekday = (jan1_weekday + days) % 7;
+ if (last_week) {
+ days -= (weekday + 7 - 1 - pt.date.m.weekday) % 7 + 1;
+ } else {
+ days += (pt.date.m.weekday + 7 - weekday) % 7;
+ days += (pt.date.m.week - 1) * 7;
+ }
+ break;
+ }
+ }
+ return (days * kSecsPerDay) + pt.time.offset;
+}
+
+inline time_zone::civil_lookup MakeUnique(const time_point<seconds>& tp) {
+ time_zone::civil_lookup cl;
+ cl.kind = time_zone::civil_lookup::UNIQUE;
+ cl.pre = cl.trans = cl.post = tp;
+ return cl;
+}
+
+inline time_zone::civil_lookup MakeUnique(std::int_fast64_t unix_time) {
+ return MakeUnique(FromUnixSeconds(unix_time));
+}
+
+inline time_zone::civil_lookup MakeSkipped(const Transition& tr,
+ const civil_second& cs) {
+ time_zone::civil_lookup cl;
+ cl.kind = time_zone::civil_lookup::SKIPPED;
+ cl.pre = FromUnixSeconds(tr.unix_time - 1 + (cs - tr.prev_civil_sec));
+ cl.trans = FromUnixSeconds(tr.unix_time);
+ cl.post = FromUnixSeconds(tr.unix_time - (tr.civil_sec - cs));
+ return cl;
+}
+
+inline time_zone::civil_lookup MakeRepeated(const Transition& tr,
+ const civil_second& cs) {
+ time_zone::civil_lookup cl;
+ cl.kind = time_zone::civil_lookup::REPEATED;
+ cl.pre = FromUnixSeconds(tr.unix_time - 1 - (tr.prev_civil_sec - cs));
+ cl.trans = FromUnixSeconds(tr.unix_time);
+ cl.post = FromUnixSeconds(tr.unix_time + (cs - tr.civil_sec));
+ return cl;
+}
+
+inline civil_second YearShift(const civil_second& cs, year_t shift) {
+ return civil_second(cs.year() + shift, cs.month(), cs.day(), cs.hour(),
+ cs.minute(), cs.second());
+}
+
+} // namespace
+
+// What (no leap-seconds) UTC+seconds zoneinfo would look like.
+bool TimeZoneInfo::ResetToBuiltinUTC(const seconds& offset) {
+ transition_types_.resize(1);
+ TransitionType& tt(transition_types_.back());
+ tt.utc_offset = static_cast<std::int_least32_t>(offset.count());
+ tt.is_dst = false;
+ tt.abbr_index = 0;
+
+ // We temporarily add some redundant, contemporary (2013 through 2023)
+ // transitions for performance reasons. See TimeZoneInfo::LocalTime().
+ // TODO: Fix the performance issue and remove the extra transitions.
+ transitions_.clear();
+ transitions_.reserve(12);
+ for (const std::int_fast64_t unix_time : {
+ -(1LL << 59), // BIG_BANG
+ 1356998400LL, // 2013-01-01T00:00:00+00:00
+ 1388534400LL, // 2014-01-01T00:00:00+00:00
+ 1420070400LL, // 2015-01-01T00:00:00+00:00
+ 1451606400LL, // 2016-01-01T00:00:00+00:00
+ 1483228800LL, // 2017-01-01T00:00:00+00:00
+ 1514764800LL, // 2018-01-01T00:00:00+00:00
+ 1546300800LL, // 2019-01-01T00:00:00+00:00
+ 1577836800LL, // 2020-01-01T00:00:00+00:00
+ 1609459200LL, // 2021-01-01T00:00:00+00:00
+ 1640995200LL, // 2022-01-01T00:00:00+00:00
+ 1672531200LL, // 2023-01-01T00:00:00+00:00
+ 2147483647LL, // 2^31 - 1
+ }) {
+ Transition& tr(*transitions_.emplace(transitions_.end()));
+ tr.unix_time = unix_time;
+ tr.type_index = 0;
+ tr.civil_sec = LocalTime(tr.unix_time, tt).cs;
+ tr.prev_civil_sec = tr.civil_sec - 1;
+ }
+
+ default_transition_type_ = 0;
+ abbreviations_ = FixedOffsetToAbbr(offset);
+ abbreviations_.append(1, '\0'); // add NUL
+ future_spec_.clear(); // never needed for a fixed-offset zone
+ extended_ = false;
+
+ tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+ tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
+
+ transitions_.shrink_to_fit();
+ return true;
+}
+
+// Builds the in-memory header using the raw bytes from the file.
+bool TimeZoneInfo::Header::Build(const tzhead& tzh) {
+ std::int_fast32_t v;
+ if ((v = Decode32(tzh.tzh_timecnt)) < 0) return false;
+ timecnt = static_cast<std::size_t>(v);
+ if ((v = Decode32(tzh.tzh_typecnt)) < 0) return false;
+ typecnt = static_cast<std::size_t>(v);
+ if ((v = Decode32(tzh.tzh_charcnt)) < 0) return false;
+ charcnt = static_cast<std::size_t>(v);
+ if ((v = Decode32(tzh.tzh_leapcnt)) < 0) return false;
+ leapcnt = static_cast<std::size_t>(v);
+ if ((v = Decode32(tzh.tzh_ttisstdcnt)) < 0) return false;
+ ttisstdcnt = static_cast<std::size_t>(v);
+ if ((v = Decode32(tzh.tzh_ttisutcnt)) < 0) return false;
+ ttisutcnt = static_cast<std::size_t>(v);
+ return true;
+}
+
+// How many bytes of data are associated with this header. The result
+// depends upon whether this is a section with 4-byte or 8-byte times.
+std::size_t TimeZoneInfo::Header::DataLength(std::size_t time_len) const {
+ std::size_t len = 0;
+ len += (time_len + 1) * timecnt; // unix_time + type_index
+ len += (4 + 1 + 1) * typecnt; // utc_offset + is_dst + abbr_index
+ len += 1 * charcnt; // abbreviations
+ len += (time_len + 4) * leapcnt; // leap-time + TAI-UTC
+ len += 1 * ttisstdcnt; // UTC/local indicators
+ len += 1 * ttisutcnt; // standard/wall indicators
+ return len;
+}
+
+// Check that the TransitionType has the expected offset/is_dst/abbreviation.
+void TimeZoneInfo::CheckTransition(const std::string& name,
+ const TransitionType& tt,
+ std::int_fast32_t offset, bool is_dst,
+ const std::string& abbr) const {
+ if (tt.utc_offset != offset || tt.is_dst != is_dst ||
+ &abbreviations_[tt.abbr_index] != abbr) {
+ std::clog << name << ": Transition"
+ << " offset=" << tt.utc_offset << "/"
+ << (tt.is_dst ? "DST" : "STD")
+ << "/abbr=" << &abbreviations_[tt.abbr_index]
+ << " does not match POSIX spec '" << future_spec_ << "'\n";
+ }
+}
+
+// zic(8) can generate no-op transitions when a zone changes rules at an
+// instant when there is actually no discontinuity. So we check whether
+// two transitions have equivalent types (same offset/is_dst/abbr).
+bool TimeZoneInfo::EquivTransitions(std::uint_fast8_t tt1_index,
+ std::uint_fast8_t tt2_index) const {
+ if (tt1_index == tt2_index) return true;
+ const TransitionType& tt1(transition_types_[tt1_index]);
+ const TransitionType& tt2(transition_types_[tt2_index]);
+ if (tt1.is_dst != tt2.is_dst) return false;
+ if (tt1.utc_offset != tt2.utc_offset) return false;
+ if (tt1.abbr_index != tt2.abbr_index) return false;
+ return true;
+}
+
+// Use the POSIX-TZ-environment-variable-style string to handle times
+// in years after the last transition stored in the zoneinfo data.
+void TimeZoneInfo::ExtendTransitions(const std::string& name,
+ const Header& hdr) {
+ extended_ = false;
+ bool extending = !future_spec_.empty();
+
+ PosixTimeZone posix;
+ if (extending && !ParsePosixSpec(future_spec_, &posix)) {
+ std::clog << name << ": Failed to parse '" << future_spec_ << "'\n";
+ extending = false;
+ }
+
+ if (extending && posix.dst_abbr.empty()) { // std only
+ // The future specification should match the last/default transition,
+ // and that means that handling the future will fall out naturally.
+ std::uint_fast8_t index = default_transition_type_;
+ if (hdr.timecnt != 0) index = transitions_[hdr.timecnt - 1].type_index;
+ const TransitionType& tt(transition_types_[index]);
+ CheckTransition(name, tt, posix.std_offset, false, posix.std_abbr);
+ extending = false;
+ }
+
+ if (extending && hdr.timecnt < 2) {
+ std::clog << name << ": Too few transitions for POSIX spec\n";
+ extending = false;
+ }
+
+ if (!extending) {
+ // Ensure that there is always a transition in the second half of the
+ // time line (the BIG_BANG transition is in the first half) so that the
+ // signed difference between a civil_second and the civil_second of its
+ // previous transition is always representable, without overflow.
+ const Transition& last(transitions_.back());
+ if (last.unix_time < 0) {
+ const std::uint_fast8_t type_index = last.type_index;
+ Transition& tr(*transitions_.emplace(transitions_.end()));
+ tr.unix_time = 2147483647; // 2038-01-19T03:14:07+00:00
+ tr.type_index = type_index;
+ }
+ return; // last transition wins
+ }
+
+ // Extend the transitions for an additional 400 years using the
+ // future specification. Years beyond those can be handled by
+ // mapping back to a cycle-equivalent year within that range.
+ // zic(8) should probably do this so that we don't have to.
+ // TODO: Reduce the extension by the number of compatible
+ // transitions already in place.
+ transitions_.reserve(hdr.timecnt + 400 * 2 + 1);
+ transitions_.resize(hdr.timecnt + 400 * 2);
+ extended_ = true;
+
+ // The future specification should match the last two transitions,
+ // and those transitions should have different is_dst flags. Note
+ // that nothing says the UTC offset used by the is_dst transition
+ // must be greater than that used by the !is_dst transition. (See
+ // Europe/Dublin, for example.)
+ const Transition* tr0 = &transitions_[hdr.timecnt - 1];
+ const Transition* tr1 = &transitions_[hdr.timecnt - 2];
+ const TransitionType* tt0 = &transition_types_[tr0->type_index];
+ const TransitionType* tt1 = &transition_types_[tr1->type_index];
+ const TransitionType& dst(tt0->is_dst ? *tt0 : *tt1);
+ const TransitionType& std(tt0->is_dst ? *tt1 : *tt0);
+ CheckTransition(name, dst, posix.dst_offset, true, posix.dst_abbr);
+ CheckTransition(name, std, posix.std_offset, false, posix.std_abbr);
+
+ // Add the transitions to tr1 and back to tr0 for each extra year.
+ last_year_ = LocalTime(tr0->unix_time, *tt0).cs.year();
+ bool leap_year = IsLeap(last_year_);
+ const civil_day jan1(last_year_, 1, 1);
+ std::int_fast64_t jan1_time = civil_second(jan1) - civil_second();
+ int jan1_weekday = (static_cast<int>(get_weekday(jan1)) + 1) % 7;
+ Transition* tr = &transitions_[hdr.timecnt]; // next trans to fill
+ if (LocalTime(tr1->unix_time, *tt1).cs.year() != last_year_) {
+ // Add a single extra transition to align to a calendar year.
+ transitions_.resize(transitions_.size() + 1);
+ assert(tr == &transitions_[hdr.timecnt]); // no reallocation
+ const PosixTransition& pt1(tt0->is_dst ? posix.dst_end : posix.dst_start);
+ std::int_fast64_t tr1_offset = TransOffset(leap_year, jan1_weekday, pt1);
+ tr->unix_time = jan1_time + tr1_offset - tt0->utc_offset;
+ tr++->type_index = tr1->type_index;
+ tr0 = &transitions_[hdr.timecnt];
+ tr1 = &transitions_[hdr.timecnt - 1];
+ tt0 = &transition_types_[tr0->type_index];
+ tt1 = &transition_types_[tr1->type_index];
+ }
+ const PosixTransition& pt1(tt0->is_dst ? posix.dst_end : posix.dst_start);
+ const PosixTransition& pt0(tt0->is_dst ? posix.dst_start : posix.dst_end);
+ for (const year_t limit = last_year_ + 400; last_year_ < limit;) {
+ last_year_ += 1; // an additional year of generated transitions
+ jan1_time += kSecsPerYear[leap_year];
+ jan1_weekday = (jan1_weekday + kDaysPerYear[leap_year]) % 7;
+ leap_year = !leap_year && IsLeap(last_year_);
+ std::int_fast64_t tr1_offset = TransOffset(leap_year, jan1_weekday, pt1);
+ tr->unix_time = jan1_time + tr1_offset - tt0->utc_offset;
+ tr++->type_index = tr1->type_index;
+ std::int_fast64_t tr0_offset = TransOffset(leap_year, jan1_weekday, pt0);
+ tr->unix_time = jan1_time + tr0_offset - tt1->utc_offset;
+ tr++->type_index = tr0->type_index;
+ }
+ assert(tr == &transitions_[0] + transitions_.size());
+}
+
+bool TimeZoneInfo::Load(const std::string& name, ZoneInfoSource* zip) {
+ // Read and validate the header.
+ tzhead tzh;
+ if (zip->Read(&tzh, sizeof(tzh)) != sizeof(tzh)) return false;
+ if (strncmp(tzh.tzh_magic, TZ_MAGIC, sizeof(tzh.tzh_magic)) != 0)
+ return false;
+ Header hdr;
+ if (!hdr.Build(tzh)) return false;
+ std::size_t time_len = 4;
+ if (tzh.tzh_version[0] != '\0') {
+ // Skip the 4-byte data.
+ if (zip->Skip(hdr.DataLength(time_len)) != 0) return false;
+ // Read and validate the header for the 8-byte data.
+ if (zip->Read(&tzh, sizeof(tzh)) != sizeof(tzh)) return false;
+ if (strncmp(tzh.tzh_magic, TZ_MAGIC, sizeof(tzh.tzh_magic)) != 0)
+ return false;
+ if (tzh.tzh_version[0] == '\0') return false;
+ if (!hdr.Build(tzh)) return false;
+ time_len = 8;
+ }
+ if (hdr.typecnt == 0) return false;
+ if (hdr.leapcnt != 0) {
+ // This code assumes 60-second minutes so we do not want
+ // the leap-second encoded zoneinfo. We could reverse the
+ // compensation, but the "right" encoding is rarely used
+ // so currently we simply reject such data.
+ return false;
+ }
+ if (hdr.ttisstdcnt != 0 && hdr.ttisstdcnt != hdr.typecnt) return false;
+ if (hdr.ttisutcnt != 0 && hdr.ttisutcnt != hdr.typecnt) return false;
+
+ // Read the data into a local buffer.
+ std::size_t len = hdr.DataLength(time_len);
+ std::vector<char> tbuf(len);
+ if (zip->Read(tbuf.data(), len) != len) return false;
+ const char* bp = tbuf.data();
+
+ // Decode and validate the transitions.
+ transitions_.reserve(hdr.timecnt + 2); // We might add a couple.
+ transitions_.resize(hdr.timecnt);
+ for (std::size_t i = 0; i != hdr.timecnt; ++i) {
+ transitions_[i].unix_time = (time_len == 4) ? Decode32(bp) : Decode64(bp);
+ bp += time_len;
+ if (i != 0) {
+ // Check that the transitions are ordered by time (as zic guarantees).
+ if (!Transition::ByUnixTime()(transitions_[i - 1], transitions_[i]))
+ return false; // out of order
+ }
+ }
+ bool seen_type_0 = false;
+ for (std::size_t i = 0; i != hdr.timecnt; ++i) {
+ transitions_[i].type_index = Decode8(bp++);
+ if (transitions_[i].type_index >= hdr.typecnt) return false;
+ if (transitions_[i].type_index == 0) seen_type_0 = true;
+ }
+
+ // Decode and validate the transition types.
+ transition_types_.resize(hdr.typecnt);
+ for (std::size_t i = 0; i != hdr.typecnt; ++i) {
+ transition_types_[i].utc_offset =
+ static_cast<std::int_least32_t>(Decode32(bp));
+ if (transition_types_[i].utc_offset >= kSecsPerDay ||
+ transition_types_[i].utc_offset <= -kSecsPerDay)
+ return false;
+ bp += 4;
+ transition_types_[i].is_dst = (Decode8(bp++) != 0);
+ transition_types_[i].abbr_index = Decode8(bp++);
+ if (transition_types_[i].abbr_index >= hdr.charcnt) return false;
+ }
+
+ // Determine the before-first-transition type.
+ default_transition_type_ = 0;
+ if (seen_type_0 && hdr.timecnt != 0) {
+ std::uint_fast8_t index = 0;
+ if (transition_types_[0].is_dst) {
+ index = transitions_[0].type_index;
+ while (index != 0 && transition_types_[index].is_dst) --index;
+ }
+ while (index != hdr.typecnt && transition_types_[index].is_dst) ++index;
+ if (index != hdr.typecnt) default_transition_type_ = index;
+ }
+
+ // Copy all the abbreviations.
+ abbreviations_.assign(bp, hdr.charcnt);
+ bp += hdr.charcnt;
+
+ // Skip the unused portions. We've already dispensed with leap-second
+ // encoded zoneinfo. The ttisstd/ttisgmt indicators only apply when
+ // interpreting a POSIX spec that does not include start/end rules, and
+ // that isn't the case here (see "zic -p").
+ bp += (8 + 4) * hdr.leapcnt; // leap-time + TAI-UTC
+ bp += 1 * hdr.ttisstdcnt; // UTC/local indicators
+ bp += 1 * hdr.ttisutcnt; // standard/wall indicators
+ assert(bp == tbuf.data() + tbuf.size());
+
+ future_spec_.clear();
+ if (tzh.tzh_version[0] != '\0') {
+ // Snarf up the NL-enclosed future POSIX spec. Note
+ // that version '3' files utilize an extended format.
+ auto get_char = [](ZoneInfoSource* azip) -> int {
+ unsigned char ch; // all non-EOF results are positive
+ return (azip->Read(&ch, 1) == 1) ? ch : EOF;
+ };
+ if (get_char(zip) != '\n') return false;
+ for (int c = get_char(zip); c != '\n'; c = get_char(zip)) {
+ if (c == EOF) return false;
+ future_spec_.push_back(static_cast<char>(c));
+ }
+ }
+
+ // We don't check for EOF so that we're forwards compatible.
+
+ // If we did not find version information during the standard loading
+ // process (as of tzh_version '3' that is unsupported), then ask the
+ // ZoneInfoSource for any out-of-bound version std::string it may be privy to.
+ if (version_.empty()) {
+ version_ = zip->Version();
+ }
+
+ // Trim redundant transitions. zic may have added these to work around
+ // differences between the glibc and reference implementations (see
+ // zic.c:dontmerge) and the Qt library (see zic.c:WORK_AROUND_QTBUG_53071).
+ // For us, they just get in the way when we do future_spec_ extension.
+ while (hdr.timecnt > 1) {
+ if (!EquivTransitions(transitions_[hdr.timecnt - 1].type_index,
+ transitions_[hdr.timecnt - 2].type_index)) {
+ break;
+ }
+ hdr.timecnt -= 1;
+ }
+ transitions_.resize(hdr.timecnt);
+
+ // Ensure that there is always a transition in the first half of the
+ // time line (the second half is handled in ExtendTransitions()) so that
+ // the signed difference between a civil_second and the civil_second of
+ // its previous transition is always representable, without overflow.
+ // A contemporary zic will usually have already done this for us.
+ if (transitions_.empty() || transitions_.front().unix_time >= 0) {
+ Transition& tr(*transitions_.emplace(transitions_.begin()));
+ tr.unix_time = -(1LL << 59); // see tz/zic.c "BIG_BANG"
+ tr.type_index = default_transition_type_;
+ hdr.timecnt += 1;
+ }
+
+ // Extend the transitions using the future specification.
+ ExtendTransitions(name, hdr);
+
+ // Compute the local civil time for each transition and the preceding
+ // second. These will be used for reverse conversions in MakeTime().
+ const TransitionType* ttp = &transition_types_[default_transition_type_];
+ for (std::size_t i = 0; i != transitions_.size(); ++i) {
+ Transition& tr(transitions_[i]);
+ tr.prev_civil_sec = LocalTime(tr.unix_time, *ttp).cs - 1;
+ ttp = &transition_types_[tr.type_index];
+ tr.civil_sec = LocalTime(tr.unix_time, *ttp).cs;
+ if (i != 0) {
+ // Check that the transitions are ordered by civil time. Essentially
+ // this means that an offset change cannot cross another such change.
+ // No one does this in practice, and we depend on it in MakeTime().
+ if (!Transition::ByCivilTime()(transitions_[i - 1], tr))
+ return false; // out of order
+ }
+ }
+
+ // Compute the maximum/minimum civil times that can be converted to a
+ // time_point<seconds> for each of the zone's transition types.
+ for (auto& tt : transition_types_) {
+ tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+ tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
+ }
+
+ transitions_.shrink_to_fit();
+ return true;
+}
+
+namespace {
+
+// fopen(3) adaptor.
+inline FILE* FOpen(const char* path, const char* mode) {
+#if defined(_MSC_VER)
+ FILE* fp;
+ if (fopen_s(&fp, path, mode) != 0) fp = nullptr;
+ return fp;
+#else
+ return fopen(path, mode); // TODO: Enable the close-on-exec flag.
+#endif
+}
+
+// A stdio(3)-backed implementation of ZoneInfoSource.
+class FileZoneInfoSource : public ZoneInfoSource {
+ public:
+ static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+
+ std::size_t Read(void* ptr, std::size_t size) override {
+ size = std::min(size, len_);
+ std::size_t nread = fread(ptr, 1, size, fp_.get());
+ len_ -= nread;
+ return nread;
+ }
+ int Skip(std::size_t offset) override {
+ offset = std::min(offset, len_);
+ int rc = fseek(fp_.get(), static_cast<long>(offset), SEEK_CUR);
+ if (rc == 0) len_ -= offset;
+ return rc;
+ }
+ std::string Version() const override {
+ // TODO: It would nice if the zoneinfo data included the tzdb version.
+ return std::string();
+ }
+
+ protected:
+ explicit FileZoneInfoSource(
+ FILE* fp, std::size_t len = std::numeric_limits<std::size_t>::max())
+ : fp_(fp, fclose), len_(len) {}
+
+ private:
+ std::unique_ptr<FILE, int (*)(FILE*)> fp_;
+ std::size_t len_;
+};
+
+std::unique_ptr<ZoneInfoSource> FileZoneInfoSource::Open(
+ const std::string& name) {
+ // Use of the "file:" prefix is intended for testing purposes only.
+ const std::size_t pos = (name.compare(0, 5, "file:") == 0) ? 5 : 0;
+
+ // Map the time-zone name to a path name.
+ std::string path;
+ if (pos == name.size() || name[pos] != '/') {
+ const char* tzdir = "/usr/share/zoneinfo";
+ char* tzdir_env = nullptr;
+#if defined(_MSC_VER)
+ _dupenv_s(&tzdir_env, nullptr, "TZDIR");
+#else
+ tzdir_env = std::getenv("TZDIR");
+#endif
+ if (tzdir_env && *tzdir_env) tzdir = tzdir_env;
+ path += tzdir;
+ path += '/';
+#if defined(_MSC_VER)
+ free(tzdir_env);
+#endif
+ }
+ path.append(name, pos, std::string::npos);
+
+ // Open the zoneinfo file.
+ FILE* fp = FOpen(path.c_str(), "rb");
+ if (fp == nullptr) return nullptr;
+ std::size_t length = 0;
+ if (fseek(fp, 0, SEEK_END) == 0) {
+ long offset = ftell(fp);
+ if (offset >= 0) {
+ length = static_cast<std::size_t>(offset);
+ }
+ rewind(fp);
+ }
+ return std::unique_ptr<ZoneInfoSource>(new FileZoneInfoSource(fp, length));
+}
+
+class AndroidZoneInfoSource : public FileZoneInfoSource {
+ public:
+ static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+ std::string Version() const override { return version_; }
+
+ private:
+ explicit AndroidZoneInfoSource(FILE* fp, std::size_t len, const char* vers)
+ : FileZoneInfoSource(fp, len), version_(vers) {}
+ std::string version_;
+};
+
+std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
+ const std::string& name) {
+ // Use of the "file:" prefix is intended for testing purposes only.
+ const std::size_t pos = (name.compare(0, 5, "file:") == 0) ? 5 : 0;
+
+ // See Android's libc/tzcode/bionic.cpp for additional information.
+ for (const char* tzdata : {"/data/misc/zoneinfo/current/tzdata",
+ "/system/usr/share/zoneinfo/tzdata"}) {
+ std::unique_ptr<FILE, int (*)(FILE*)> fp(FOpen(tzdata, "rb"), fclose);
+ if (fp.get() == nullptr) continue;
+
+ char hbuf[24]; // covers header.zonetab_offset too
+ if (fread(hbuf, 1, sizeof(hbuf), fp.get()) != sizeof(hbuf)) continue;
+ if (strncmp(hbuf, "tzdata", 6) != 0) continue;
+ const char* vers = (hbuf[11] == '\0') ? hbuf + 6 : "";
+ const std::int_fast32_t index_offset = Decode32(hbuf + 12);
+ const std::int_fast32_t data_offset = Decode32(hbuf + 16);
+ if (index_offset < 0 || data_offset < index_offset) continue;
+ if (fseek(fp.get(), static_cast<long>(index_offset), SEEK_SET) != 0)
+ continue;
+
+ char ebuf[52]; // covers entry.unused too
+ const std::size_t index_size =
+ static_cast<std::size_t>(data_offset - index_offset);
+ const std::size_t zonecnt = index_size / sizeof(ebuf);
+ if (zonecnt * sizeof(ebuf) != index_size) continue;
+ for (std::size_t i = 0; i != zonecnt; ++i) {
+ if (fread(ebuf, 1, sizeof(ebuf), fp.get()) != sizeof(ebuf)) break;
+ const std::int_fast32_t start = data_offset + Decode32(ebuf + 40);
+ const std::int_fast32_t length = Decode32(ebuf + 44);
+ if (start < 0 || length < 0) break;
+ ebuf[40] = '\0'; // ensure zone name is NUL terminated
+ if (strcmp(name.c_str() + pos, ebuf) == 0) {
+ if (fseek(fp.get(), static_cast<long>(start), SEEK_SET) != 0) break;
+ return std::unique_ptr<ZoneInfoSource>(new AndroidZoneInfoSource(
+ fp.release(), static_cast<std::size_t>(length), vers));
+ }
+ }
+ }
+
+ return nullptr;
+}
+
+} // namespace
+
+bool TimeZoneInfo::Load(const std::string& name) {
+ // We can ensure that the loading of UTC or any other fixed-offset
+ // zone never fails because the simple, fixed-offset state can be
+ // internally generated. Note that this depends on our choice to not
+ // accept leap-second encoded ("right") zoneinfo.
+ auto offset = seconds::zero();
+ if (FixedOffsetFromName(name, &offset)) {
+ return ResetToBuiltinUTC(offset);
+ }
+
+ // Find and use a ZoneInfoSource to load the named zone.
+ auto zip = cctz_extension::zone_info_source_factory(
+ name, [](const std::string& name) -> std::unique_ptr<ZoneInfoSource> {
+ if (auto zip = FileZoneInfoSource::Open(name)) return zip;
+ if (auto zip = AndroidZoneInfoSource::Open(name)) return zip;
+ return nullptr;
+ });
+ return zip != nullptr && Load(name, zip.get());
+}
+
+// BreakTime() translation for a particular transition type.
+time_zone::absolute_lookup TimeZoneInfo::LocalTime(
+ std::int_fast64_t unix_time, const TransitionType& tt) const {
+ // A civil time in "+offset" looks like (time+offset) in UTC.
+ // Note: We perform two additions in the civil_second domain to
+ // sidestep the chance of overflow in (unix_time + tt.utc_offset).
+ return {(civil_second() + unix_time) + tt.utc_offset, tt.utc_offset,
+ tt.is_dst, &abbreviations_[tt.abbr_index]};
+}
+
+// BreakTime() translation for a particular transition.
+time_zone::absolute_lookup TimeZoneInfo::LocalTime(std::int_fast64_t unix_time,
+ const Transition& tr) const {
+ const TransitionType& tt = transition_types_[tr.type_index];
+ // Note: (unix_time - tr.unix_time) will never overflow as we
+ // have ensured that there is always a "nearby" transition.
+ return {tr.civil_sec + (unix_time - tr.unix_time), // TODO: Optimize.
+ tt.utc_offset, tt.is_dst, &abbreviations_[tt.abbr_index]};
+}
+
+// MakeTime() translation with a conversion-preserving +N * 400-year shift.
+time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs,
+ year_t c4_shift) const {
+ assert(last_year_ - 400 < cs.year() && cs.year() <= last_year_);
+ time_zone::civil_lookup cl = MakeTime(cs);
+ if (c4_shift > seconds::max().count() / kSecsPer400Years) {
+ cl.pre = cl.trans = cl.post = time_point<seconds>::max();
+ } else {
+ const auto offset = seconds(c4_shift * kSecsPer400Years);
+ const auto limit = time_point<seconds>::max() - offset;
+ for (auto* tp : {&cl.pre, &cl.trans, &cl.post}) {
+ if (*tp > limit) {
+ *tp = time_point<seconds>::max();
+ } else {
+ *tp += offset;
+ }
+ }
+ }
+ return cl;
+}
+
+time_zone::absolute_lookup TimeZoneInfo::BreakTime(
+ const time_point<seconds>& tp) const {
+ std::int_fast64_t unix_time = ToUnixSeconds(tp);
+ const std::size_t timecnt = transitions_.size();
+ assert(timecnt != 0); // We always add a transition.
+
+ if (unix_time < transitions_[0].unix_time) {
+ return LocalTime(unix_time, transition_types_[default_transition_type_]);
+ }
+ if (unix_time >= transitions_[timecnt - 1].unix_time) {
+ // After the last transition. If we extended the transitions using
+ // future_spec_, shift back to a supported year using the 400-year
+ // cycle of calendaric equivalence and then compensate accordingly.
+ if (extended_) {
+ const std::int_fast64_t diff =
+ unix_time - transitions_[timecnt - 1].unix_time;
+ const year_t shift = diff / kSecsPer400Years + 1;
+ const auto d = seconds(shift * kSecsPer400Years);
+ time_zone::absolute_lookup al = BreakTime(tp - d);
+ al.cs = YearShift(al.cs, shift * 400);
+ return al;
+ }
+ return LocalTime(unix_time, transitions_[timecnt - 1]);
+ }
+
+ const std::size_t hint = local_time_hint_.load(std::memory_order_relaxed);
+ if (0 < hint && hint < timecnt) {
+ if (transitions_[hint - 1].unix_time <= unix_time) {
+ if (unix_time < transitions_[hint].unix_time) {
+ return LocalTime(unix_time, transitions_[hint - 1]);
+ }
+ }
+ }
+
+ const Transition target = {unix_time, 0, civil_second(), civil_second()};
+ const Transition* begin = &transitions_[0];
+ const Transition* tr = std::upper_bound(begin, begin + timecnt, target,
+ Transition::ByUnixTime());
+ local_time_hint_.store(static_cast<std::size_t>(tr - begin),
+ std::memory_order_relaxed);
+ return LocalTime(unix_time, *--tr);
+}
+
+time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const {
+ const std::size_t timecnt = transitions_.size();
+ assert(timecnt != 0); // We always add a transition.
+
+ // Find the first transition after our target civil time.
+ const Transition* tr = nullptr;
+ const Transition* begin = &transitions_[0];
+ const Transition* end = begin + timecnt;
+ if (cs < begin->civil_sec) {
+ tr = begin;
+ } else if (cs >= transitions_[timecnt - 1].civil_sec) {
+ tr = end;
+ } else {
+ const std::size_t hint = time_local_hint_.load(std::memory_order_relaxed);
+ if (0 < hint && hint < timecnt) {
+ if (transitions_[hint - 1].civil_sec <= cs) {
+ if (cs < transitions_[hint].civil_sec) {
+ tr = begin + hint;
+ }
+ }
+ }
+ if (tr == nullptr) {
+ const Transition target = {0, 0, cs, civil_second()};
+ tr = std::upper_bound(begin, end, target, Transition::ByCivilTime());
+ time_local_hint_.store(static_cast<std::size_t>(tr - begin),
+ std::memory_order_relaxed);
+ }
+ }
+
+ if (tr == begin) {
+ if (tr->prev_civil_sec >= cs) {
+ // Before first transition, so use the default offset.
+ const TransitionType& tt(transition_types_[default_transition_type_]);
+ if (cs < tt.civil_min) return MakeUnique(time_point<seconds>::min());
+ return MakeUnique(cs - (civil_second() + tt.utc_offset));
+ }
+ // tr->prev_civil_sec < cs < tr->civil_sec
+ return MakeSkipped(*tr, cs);
+ }
+
+ if (tr == end) {
+ if (cs > (--tr)->prev_civil_sec) {
+ // After the last transition. If we extended the transitions using
+ // future_spec_, shift back to a supported year using the 400-year
+ // cycle of calendaric equivalence and then compensate accordingly.
+ if (extended_ && cs.year() > last_year_) {
+ const year_t shift = (cs.year() - last_year_ - 1) / 400 + 1;
+ return TimeLocal(YearShift(cs, shift * -400), shift);
+ }
+ const TransitionType& tt(transition_types_[tr->type_index]);
+ if (cs > tt.civil_max) return MakeUnique(time_point<seconds>::max());
+ return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
+ }
+ // tr->civil_sec <= cs <= tr->prev_civil_sec
+ return MakeRepeated(*tr, cs);
+ }
+
+ if (tr->prev_civil_sec < cs) {
+ // tr->prev_civil_sec < cs < tr->civil_sec
+ return MakeSkipped(*tr, cs);
+ }
+
+ if (cs <= (--tr)->prev_civil_sec) {
+ // tr->civil_sec <= cs <= tr->prev_civil_sec
+ return MakeRepeated(*tr, cs);
+ }
+
+ // In between transitions.
+ return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
+}
+
+std::string TimeZoneInfo::Version() const { return version_; }
+
+std::string TimeZoneInfo::Description() const {
+ std::ostringstream oss;
+ oss << "#trans=" << transitions_.size();
+ oss << " #types=" << transition_types_.size();
+ oss << " spec='" << future_spec_ << "'";
+ return oss.str();
+}
+
+bool TimeZoneInfo::NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ if (transitions_.empty()) return false;
+ const Transition* begin = &transitions_[0];
+ const Transition* end = begin + transitions_.size();
+ if (begin->unix_time <= -(1LL << 59)) {
+ // Do not report the BIG_BANG found in recent zoneinfo data as it is
+ // really a sentinel, not a transition. See tz/zic.c.
+ ++begin;
+ }
+ std::int_fast64_t unix_time = ToUnixSeconds(tp);
+ const Transition target = {unix_time, 0, civil_second(), civil_second()};
+ const Transition* tr =
+ std::upper_bound(begin, end, target, Transition::ByUnixTime());
+ for (; tr != end; ++tr) { // skip no-op transitions
+ std::uint_fast8_t prev_type_index =
+ (tr == begin) ? default_transition_type_ : tr[-1].type_index;
+ if (!EquivTransitions(prev_type_index, tr[0].type_index)) break;
+ }
+ // When tr == end we return false, ignoring future_spec_.
+ if (tr == end) return false;
+ trans->from = tr->prev_civil_sec + 1;
+ trans->to = tr->civil_sec;
+ return true;
+}
+
+bool TimeZoneInfo::PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ if (transitions_.empty()) return false;
+ const Transition* begin = &transitions_[0];
+ const Transition* end = begin + transitions_.size();
+ if (begin->unix_time <= -(1LL << 59)) {
+ // Do not report the BIG_BANG found in recent zoneinfo data as it is
+ // really a sentinel, not a transition. See tz/zic.c.
+ ++begin;
+ }
+ std::int_fast64_t unix_time = ToUnixSeconds(tp);
+ if (FromUnixSeconds(unix_time) != tp) {
+ if (unix_time == std::numeric_limits<std::int_fast64_t>::max()) {
+ if (end == begin) return false; // Ignore future_spec_.
+ trans->from = (--end)->prev_civil_sec + 1;
+ trans->to = end->civil_sec;
+ return true;
+ }
+ unix_time += 1; // ceils
+ }
+ const Transition target = {unix_time, 0, civil_second(), civil_second()};
+ const Transition* tr =
+ std::lower_bound(begin, end, target, Transition::ByUnixTime());
+ for (; tr != begin; --tr) { // skip no-op transitions
+ std::uint_fast8_t prev_type_index =
+ (tr - 1 == begin) ? default_transition_type_ : tr[-2].type_index;
+ if (!EquivTransitions(prev_type_index, tr[-1].type_index)) break;
+ }
+ // When tr == end we return the "last" transition, ignoring future_spec_.
+ if (tr == begin) return false;
+ trans->from = (--tr)->prev_civil_sec + 1;
+ trans->to = tr->civil_sec;
+ return true;
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.h
new file mode 100644
index 0000000000..2a10c06c77
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_info.h
@@ -0,0 +1,138 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
+
+#include <atomic>
+#include <cstddef>
+#include <cstdint>
+#include <string>
+#include <vector>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+#include "time_zone_if.h"
+#include "tzfile.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A transition to a new UTC offset.
+struct Transition {
+ std::int_least64_t unix_time; // the instant of this transition
+ std::uint_least8_t type_index; // index of the transition type
+ civil_second civil_sec; // local civil time of transition
+ civil_second prev_civil_sec; // local civil time one second earlier
+
+ struct ByUnixTime {
+ inline bool operator()(const Transition& lhs, const Transition& rhs) const {
+ return lhs.unix_time < rhs.unix_time;
+ }
+ };
+ struct ByCivilTime {
+ inline bool operator()(const Transition& lhs, const Transition& rhs) const {
+ return lhs.civil_sec < rhs.civil_sec;
+ }
+ };
+};
+
+// The characteristics of a particular transition.
+struct TransitionType {
+ std::int_least32_t utc_offset; // the new prevailing UTC offset
+ civil_second civil_max; // max convertible civil time for offset
+ civil_second civil_min; // min convertible civil time for offset
+ bool is_dst; // did we move into daylight-saving time
+ std::uint_least8_t abbr_index; // index of the new abbreviation
+};
+
+// A time zone backed by the IANA Time Zone Database (zoneinfo).
+class TimeZoneInfo : public TimeZoneIf {
+ public:
+ TimeZoneInfo() = default;
+ TimeZoneInfo(const TimeZoneInfo&) = delete;
+ TimeZoneInfo& operator=(const TimeZoneInfo&) = delete;
+
+ // Loads the zoneinfo for the given name, returning true if successful.
+ bool Load(const std::string& name);
+
+ // TimeZoneIf implementations.
+ time_zone::absolute_lookup BreakTime(
+ const time_point<seconds>& tp) const override;
+ time_zone::civil_lookup MakeTime(const civil_second& cs) const override;
+ bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ std::string Version() const override;
+ std::string Description() const override;
+
+ private:
+ struct Header { // counts of:
+ std::size_t timecnt; // transition times
+ std::size_t typecnt; // transition types
+ std::size_t charcnt; // zone abbreviation characters
+ std::size_t leapcnt; // leap seconds (we expect none)
+ std::size_t ttisstdcnt; // UTC/local indicators (unused)
+ std::size_t ttisutcnt; // standard/wall indicators (unused)
+
+ bool Build(const tzhead& tzh);
+ std::size_t DataLength(std::size_t time_len) const;
+ };
+
+ void CheckTransition(const std::string& name, const TransitionType& tt,
+ std::int_fast32_t offset, bool is_dst,
+ const std::string& abbr) const;
+ bool EquivTransitions(std::uint_fast8_t tt1_index,
+ std::uint_fast8_t tt2_index) const;
+ void ExtendTransitions(const std::string& name, const Header& hdr);
+
+ bool ResetToBuiltinUTC(const seconds& offset);
+ bool Load(const std::string& name, ZoneInfoSource* zip);
+
+ // Helpers for BreakTime() and MakeTime().
+ time_zone::absolute_lookup LocalTime(std::int_fast64_t unix_time,
+ const TransitionType& tt) const;
+ time_zone::absolute_lookup LocalTime(std::int_fast64_t unix_time,
+ const Transition& tr) const;
+ time_zone::civil_lookup TimeLocal(const civil_second& cs,
+ year_t c4_shift) const;
+
+ std::vector<Transition> transitions_; // ordered by unix_time and civil_sec
+ std::vector<TransitionType> transition_types_; // distinct transition types
+ std::uint_fast8_t default_transition_type_; // for before first transition
+ std::string abbreviations_; // all the NUL-terminated abbreviations
+
+ std::string version_; // the tzdata version if available
+ std::string future_spec_; // for after the last zic transition
+ bool extended_; // future_spec_ was used to generate transitions
+ year_t last_year_; // the final year of the generated transitions
+
+ // We remember the transitions found during the last BreakTime() and
+ // MakeTime() calls. If the next request is for the same transition we
+ // will avoid re-searching.
+ mutable std::atomic<std::size_t> local_time_hint_ = {}; // BreakTime() hint
+ mutable std::atomic<std::size_t> time_local_hint_ = {}; // MakeTime() hint
+};
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.cc
new file mode 100644
index 0000000000..47cf84c663
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.cc
@@ -0,0 +1,308 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#if defined(_WIN32) || defined(_WIN64)
+#define _CRT_SECURE_NO_WARNINGS 1
+#endif
+
+#include "time_zone_libc.h"
+
+#include <chrono>
+#include <ctime>
+#include <limits>
+#include <utility>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+#if defined(_WIN32) || defined(_WIN64)
+// Uses the globals: '_timezone', '_dstbias' and '_tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(_timezone + _dstbias) {
+ const bool is_dst = tm.tm_isdst > 0;
+ return _timezone + (is_dst ? _dstbias : 0);
+}
+auto tm_zone(const std::tm& tm) -> decltype(_tzname[0]) {
+ const bool is_dst = tm.tm_isdst > 0;
+ return _tzname[is_dst];
+}
+#elif defined(__sun)
+// Uses the globals: 'timezone', 'altzone' and 'tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(timezone) {
+ const bool is_dst = tm.tm_isdst > 0;
+ return is_dst ? altzone : timezone;
+}
+auto tm_zone(const std::tm& tm) -> decltype(tzname[0]) {
+ const bool is_dst = tm.tm_isdst > 0;
+ return tzname[is_dst];
+}
+#elif defined(__native_client__) || defined(__myriad2__) || \
+ defined(__EMSCRIPTEN__)
+// Uses the globals: 'timezone' and 'tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(_timezone + 0) {
+ const bool is_dst = tm.tm_isdst > 0;
+ return _timezone + (is_dst ? 60 * 60 : 0);
+}
+auto tm_zone(const std::tm& tm) -> decltype(tzname[0]) {
+ const bool is_dst = tm.tm_isdst > 0;
+ return tzname[is_dst];
+}
+#else
+// Adapt to different spellings of the struct std::tm extension fields.
+#if defined(tm_gmtoff)
+auto tm_gmtoff(const std::tm& tm) -> decltype(tm.tm_gmtoff) {
+ return tm.tm_gmtoff;
+}
+#elif defined(__tm_gmtoff)
+auto tm_gmtoff(const std::tm& tm) -> decltype(tm.__tm_gmtoff) {
+ return tm.__tm_gmtoff;
+}
+#else
+template <typename T>
+auto tm_gmtoff(const T& tm) -> decltype(tm.tm_gmtoff) {
+ return tm.tm_gmtoff;
+}
+template <typename T>
+auto tm_gmtoff(const T& tm) -> decltype(tm.__tm_gmtoff) {
+ return tm.__tm_gmtoff;
+}
+#endif // tm_gmtoff
+#if defined(tm_zone)
+auto tm_zone(const std::tm& tm) -> decltype(tm.tm_zone) { return tm.tm_zone; }
+#elif defined(__tm_zone)
+auto tm_zone(const std::tm& tm) -> decltype(tm.__tm_zone) {
+ return tm.__tm_zone;
+}
+#else
+template <typename T>
+auto tm_zone(const T& tm) -> decltype(tm.tm_zone) {
+ return tm.tm_zone;
+}
+template <typename T>
+auto tm_zone(const T& tm) -> decltype(tm.__tm_zone) {
+ return tm.__tm_zone;
+}
+#endif // tm_zone
+#endif
+
+inline std::tm* gm_time(const std::time_t* timep, std::tm* result) {
+#if defined(_WIN32) || defined(_WIN64)
+ return gmtime_s(result, timep) ? nullptr : result;
+#else
+ return gmtime_r(timep, result);
+#endif
+}
+
+inline std::tm* local_time(const std::time_t* timep, std::tm* result) {
+#if defined(_WIN32) || defined(_WIN64)
+ return localtime_s(result, timep) ? nullptr : result;
+#else
+ return localtime_r(timep, result);
+#endif
+}
+
+// Converts a civil second and "dst" flag into a time_t and UTC offset.
+// Returns false if time_t cannot represent the requested civil second.
+// Caller must have already checked that cs.year() will fit into a tm_year.
+bool make_time(const civil_second& cs, int is_dst, std::time_t* t, int* off) {
+ std::tm tm;
+ tm.tm_year = static_cast<int>(cs.year() - year_t{1900});
+ tm.tm_mon = cs.month() - 1;
+ tm.tm_mday = cs.day();
+ tm.tm_hour = cs.hour();
+ tm.tm_min = cs.minute();
+ tm.tm_sec = cs.second();
+ tm.tm_isdst = is_dst;
+ *t = std::mktime(&tm);
+ if (*t == std::time_t{-1}) {
+ std::tm tm2;
+ const std::tm* tmp = local_time(t, &tm2);
+ if (tmp == nullptr || tmp->tm_year != tm.tm_year ||
+ tmp->tm_mon != tm.tm_mon || tmp->tm_mday != tm.tm_mday ||
+ tmp->tm_hour != tm.tm_hour || tmp->tm_min != tm.tm_min ||
+ tmp->tm_sec != tm.tm_sec) {
+ // A true error (not just one second before the epoch).
+ return false;
+ }
+ }
+ *off = static_cast<int>(tm_gmtoff(tm));
+ return true;
+}
+
+// Find the least time_t in [lo:hi] where local time matches offset, given:
+// (1) lo doesn't match, (2) hi does, and (3) there is only one transition.
+std::time_t find_trans(std::time_t lo, std::time_t hi, int offset) {
+ std::tm tm;
+ while (lo + 1 != hi) {
+ const std::time_t mid = lo + (hi - lo) / 2;
+ if (std::tm* tmp = local_time(&mid, &tm)) {
+ if (tm_gmtoff(*tmp) == offset) {
+ hi = mid;
+ } else {
+ lo = mid;
+ }
+ } else {
+ // If std::tm cannot hold some result we resort to a linear search,
+ // ignoring all failed conversions. Slow, but never really happens.
+ while (++lo != hi) {
+ if (std::tm* tmp = local_time(&lo, &tm)) {
+ if (tm_gmtoff(*tmp) == offset) break;
+ }
+ }
+ return lo;
+ }
+ }
+ return hi;
+}
+
+} // namespace
+
+TimeZoneLibC::TimeZoneLibC(const std::string& name)
+ : local_(name == "localtime") {}
+
+time_zone::absolute_lookup TimeZoneLibC::BreakTime(
+ const time_point<seconds>& tp) const {
+ time_zone::absolute_lookup al;
+ al.offset = 0;
+ al.is_dst = false;
+ al.abbr = "-00";
+
+ const std::int_fast64_t s = ToUnixSeconds(tp);
+
+ // If std::time_t cannot hold the input we saturate the output.
+ if (s < std::numeric_limits<std::time_t>::min()) {
+ al.cs = civil_second::min();
+ return al;
+ }
+ if (s > std::numeric_limits<std::time_t>::max()) {
+ al.cs = civil_second::max();
+ return al;
+ }
+
+ const std::time_t t = static_cast<std::time_t>(s);
+ std::tm tm;
+ std::tm* tmp = local_ ? local_time(&t, &tm) : gm_time(&t, &tm);
+
+ // If std::tm cannot hold the result we saturate the output.
+ if (tmp == nullptr) {
+ al.cs = (s < 0) ? civil_second::min() : civil_second::max();
+ return al;
+ }
+
+ const year_t year = tmp->tm_year + year_t{1900};
+ al.cs = civil_second(year, tmp->tm_mon + 1, tmp->tm_mday, tmp->tm_hour,
+ tmp->tm_min, tmp->tm_sec);
+ al.offset = static_cast<int>(tm_gmtoff(*tmp));
+ al.abbr = local_ ? tm_zone(*tmp) : "UTC"; // as expected by cctz
+ al.is_dst = tmp->tm_isdst > 0;
+ return al;
+}
+
+time_zone::civil_lookup TimeZoneLibC::MakeTime(const civil_second& cs) const {
+ if (!local_) {
+ // If time_point<seconds> cannot hold the result we saturate.
+ static const civil_second min_tp_cs =
+ civil_second() + ToUnixSeconds(time_point<seconds>::min());
+ static const civil_second max_tp_cs =
+ civil_second() + ToUnixSeconds(time_point<seconds>::max());
+ const time_point<seconds> tp =
+ (cs < min_tp_cs)
+ ? time_point<seconds>::min()
+ : (cs > max_tp_cs) ? time_point<seconds>::max()
+ : FromUnixSeconds(cs - civil_second());
+ return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+ }
+
+ // If tm_year cannot hold the requested year we saturate the result.
+ if (cs.year() < 0) {
+ if (cs.year() < std::numeric_limits<int>::min() + year_t{1900}) {
+ const time_point<seconds> tp = time_point<seconds>::min();
+ return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+ }
+ } else {
+ if (cs.year() - year_t{1900} > std::numeric_limits<int>::max()) {
+ const time_point<seconds> tp = time_point<seconds>::max();
+ return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+ }
+ }
+
+ // We probe with "is_dst" values of 0 and 1 to try to distinguish unique
+ // civil seconds from skipped or repeated ones. This is not always possible
+ // however, as the "dst" flag does not change over some offset transitions.
+ // We are also subject to the vagaries of mktime() implementations.
+ std::time_t t0, t1;
+ int offset0, offset1;
+ if (make_time(cs, 0, &t0, &offset0) && make_time(cs, 1, &t1, &offset1)) {
+ if (t0 == t1) {
+ // The civil time was singular (pre == trans == post).
+ const time_point<seconds> tp = FromUnixSeconds(t0);
+ return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+ }
+
+ if (t0 > t1) {
+ std::swap(t0, t1);
+ std::swap(offset0, offset1);
+ }
+ const std::time_t tt = find_trans(t0, t1, offset1);
+ const time_point<seconds> trans = FromUnixSeconds(tt);
+
+ if (offset0 < offset1) {
+ // The civil time did not exist (pre >= trans > post).
+ const time_point<seconds> pre = FromUnixSeconds(t1);
+ const time_point<seconds> post = FromUnixSeconds(t0);
+ return {time_zone::civil_lookup::SKIPPED, pre, trans, post};
+ }
+
+ // The civil time was ambiguous (pre < trans <= post).
+ const time_point<seconds> pre = FromUnixSeconds(t0);
+ const time_point<seconds> post = FromUnixSeconds(t1);
+ return {time_zone::civil_lookup::REPEATED, pre, trans, post};
+ }
+
+ // make_time() failed somehow so we saturate the result.
+ const time_point<seconds> tp = (cs < civil_second())
+ ? time_point<seconds>::min()
+ : time_point<seconds>::max();
+ return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+}
+
+bool TimeZoneLibC::NextTransition(const time_point<seconds>&,
+ time_zone::civil_transition*) const {
+ return false;
+}
+
+bool TimeZoneLibC::PrevTransition(const time_point<seconds>&,
+ time_zone::civil_transition*) const {
+ return false;
+}
+
+std::string TimeZoneLibC::Version() const {
+ return std::string(); // unknown
+}
+
+std::string TimeZoneLibC::Description() const {
+ return local_ ? "localtime" : "UTC";
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.h
new file mode 100644
index 0000000000..1da9039a15
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_libc.h
@@ -0,0 +1,55 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
+
+#include <string>
+
+#include "absl/base/config.h"
+#include "time_zone_if.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A time zone backed by gmtime_r(3), localtime_r(3), and mktime(3),
+// and which therefore only supports UTC and the local time zone.
+// TODO: Add support for fixed offsets from UTC.
+class TimeZoneLibC : public TimeZoneIf {
+ public:
+ explicit TimeZoneLibC(const std::string& name);
+
+ // TimeZoneIf implementations.
+ time_zone::absolute_lookup BreakTime(
+ const time_point<seconds>& tp) const override;
+ time_zone::civil_lookup MakeTime(const civil_second& cs) const override;
+ bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ std::string Version() const override;
+ std::string Description() const override;
+
+ private:
+ const bool local_; // localtime or UTC
+};
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup.cc
new file mode 100644
index 0000000000..efdea64b4e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup.cc
@@ -0,0 +1,187 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+#if defined(__ANDROID__)
+#include <sys/system_properties.h>
+#if defined(__ANDROID_API__) && __ANDROID_API__ >= 21
+#include <dlfcn.h>
+#endif
+#endif
+
+#if defined(__APPLE__)
+#include <CoreFoundation/CFTimeZone.h>
+
+#include <vector>
+#endif
+
+#include <cstdlib>
+#include <cstring>
+#include <string>
+
+#include "time_zone_fixed.h"
+#include "time_zone_impl.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+#if defined(__ANDROID__) && defined(__ANDROID_API__) && __ANDROID_API__ >= 21
+namespace {
+// Android 'L' removes __system_property_get() from the NDK, however
+// it is still a hidden symbol in libc so we use dlsym() to access it.
+// See Chromium's base/sys_info_android.cc for a similar example.
+
+using property_get_func = int (*)(const char*, char*);
+
+property_get_func LoadSystemPropertyGet() {
+ int flag = RTLD_LAZY | RTLD_GLOBAL;
+#if defined(RTLD_NOLOAD)
+ flag |= RTLD_NOLOAD; // libc.so should already be resident
+#endif
+ if (void* handle = dlopen("libc.so", flag)) {
+ void* sym = dlsym(handle, "__system_property_get");
+ dlclose(handle);
+ return reinterpret_cast<property_get_func>(sym);
+ }
+ return nullptr;
+}
+
+int __system_property_get(const char* name, char* value) {
+ static property_get_func system_property_get = LoadSystemPropertyGet();
+ return system_property_get ? system_property_get(name, value) : -1;
+}
+
+} // namespace
+#endif
+
+std::string time_zone::name() const { return effective_impl().Name(); }
+
+time_zone::absolute_lookup time_zone::lookup(
+ const time_point<seconds>& tp) const {
+ return effective_impl().BreakTime(tp);
+}
+
+time_zone::civil_lookup time_zone::lookup(const civil_second& cs) const {
+ return effective_impl().MakeTime(cs);
+}
+
+bool time_zone::next_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const {
+ return effective_impl().NextTransition(tp, trans);
+}
+
+bool time_zone::prev_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const {
+ return effective_impl().PrevTransition(tp, trans);
+}
+
+std::string time_zone::version() const { return effective_impl().Version(); }
+
+std::string time_zone::description() const {
+ return effective_impl().Description();
+}
+
+const time_zone::Impl& time_zone::effective_impl() const {
+ if (impl_ == nullptr) {
+ // Dereferencing an implicit-UTC time_zone is expected to be
+ // rare, so we don't mind paying a small synchronization cost.
+ return *time_zone::Impl::UTC().impl_;
+ }
+ return *impl_;
+}
+
+bool load_time_zone(const std::string& name, time_zone* tz) {
+ return time_zone::Impl::LoadTimeZone(name, tz);
+}
+
+time_zone utc_time_zone() {
+ return time_zone::Impl::UTC(); // avoid name lookup
+}
+
+time_zone fixed_time_zone(const seconds& offset) {
+ time_zone tz;
+ load_time_zone(FixedOffsetToName(offset), &tz);
+ return tz;
+}
+
+time_zone local_time_zone() {
+ const char* zone = ":localtime";
+#if defined(__ANDROID__)
+ char sysprop[PROP_VALUE_MAX];
+ if (__system_property_get("persist.sys.timezone", sysprop) > 0) {
+ zone = sysprop;
+ }
+#endif
+#if defined(__APPLE__)
+ std::vector<char> buffer;
+ CFTimeZoneRef tz_default = CFTimeZoneCopyDefault();
+ if (CFStringRef tz_name = CFTimeZoneGetName(tz_default)) {
+ CFStringEncoding encoding = kCFStringEncodingUTF8;
+ CFIndex length = CFStringGetLength(tz_name);
+ buffer.resize(CFStringGetMaximumSizeForEncoding(length, encoding) + 1);
+ if (CFStringGetCString(tz_name, &buffer[0], buffer.size(), encoding)) {
+ zone = &buffer[0];
+ }
+ }
+ CFRelease(tz_default);
+#endif
+
+ // Allow ${TZ} to override to default zone.
+ char* tz_env = nullptr;
+#if defined(_MSC_VER)
+ _dupenv_s(&tz_env, nullptr, "TZ");
+#else
+ tz_env = std::getenv("TZ");
+#endif
+ if (tz_env) zone = tz_env;
+
+ // We only support the "[:]<zone-name>" form.
+ if (*zone == ':') ++zone;
+
+ // Map "localtime" to a system-specific name, but
+ // allow ${LOCALTIME} to override the default name.
+ char* localtime_env = nullptr;
+ if (strcmp(zone, "localtime") == 0) {
+#if defined(_MSC_VER)
+ // System-specific default is just "localtime".
+ _dupenv_s(&localtime_env, nullptr, "LOCALTIME");
+#else
+ zone = "/etc/localtime"; // System-specific default.
+ localtime_env = std::getenv("LOCALTIME");
+#endif
+ if (localtime_env) zone = localtime_env;
+ }
+
+ const std::string name = zone;
+#if defined(_MSC_VER)
+ free(localtime_env);
+ free(tz_env);
+#endif
+
+ time_zone tz;
+ load_time_zone(name, &tz); // Falls back to UTC.
+ // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+ // arrange for %z to generate "-0000" when we don't know the local
+ // offset because the load_time_zone() failed and we're using UTC.
+ return tz;
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc
new file mode 100644
index 0000000000..99137a082a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc
@@ -0,0 +1,1437 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <chrono>
+#include <cstddef>
+#include <cstdlib>
+#include <future>
+#include <limits>
+#include <string>
+#include <thread>
+#include <vector>
+
+#include "gtest/gtest.h"
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace chrono = std::chrono;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// A list of known time-zone names.
+const char* const kTimeZoneNames[] = {"Africa/Abidjan",
+ "Africa/Accra",
+ "Africa/Addis_Ababa",
+ "Africa/Algiers",
+ "Africa/Asmara",
+ "Africa/Asmera",
+ "Africa/Bamako",
+ "Africa/Bangui",
+ "Africa/Banjul",
+ "Africa/Bissau",
+ "Africa/Blantyre",
+ "Africa/Brazzaville",
+ "Africa/Bujumbura",
+ "Africa/Cairo",
+ "Africa/Casablanca",
+ "Africa/Ceuta",
+ "Africa/Conakry",
+ "Africa/Dakar",
+ "Africa/Dar_es_Salaam",
+ "Africa/Djibouti",
+ "Africa/Douala",
+ "Africa/El_Aaiun",
+ "Africa/Freetown",
+ "Africa/Gaborone",
+ "Africa/Harare",
+ "Africa/Johannesburg",
+ "Africa/Juba",
+ "Africa/Kampala",
+ "Africa/Khartoum",
+ "Africa/Kigali",
+ "Africa/Kinshasa",
+ "Africa/Lagos",
+ "Africa/Libreville",
+ "Africa/Lome",
+ "Africa/Luanda",
+ "Africa/Lubumbashi",
+ "Africa/Lusaka",
+ "Africa/Malabo",
+ "Africa/Maputo",
+ "Africa/Maseru",
+ "Africa/Mbabane",
+ "Africa/Mogadishu",
+ "Africa/Monrovia",
+ "Africa/Nairobi",
+ "Africa/Ndjamena",
+ "Africa/Niamey",
+ "Africa/Nouakchott",
+ "Africa/Ouagadougou",
+ "Africa/Porto-Novo",
+ "Africa/Sao_Tome",
+ "Africa/Timbuktu",
+ "Africa/Tripoli",
+ "Africa/Tunis",
+ "Africa/Windhoek",
+ "America/Adak",
+ "America/Anchorage",
+ "America/Anguilla",
+ "America/Antigua",
+ "America/Araguaina",
+ "America/Argentina/Buenos_Aires",
+ "America/Argentina/Catamarca",
+ "America/Argentina/ComodRivadavia",
+ "America/Argentina/Cordoba",
+ "America/Argentina/Jujuy",
+ "America/Argentina/La_Rioja",
+ "America/Argentina/Mendoza",
+ "America/Argentina/Rio_Gallegos",
+ "America/Argentina/Salta",
+ "America/Argentina/San_Juan",
+ "America/Argentina/San_Luis",
+ "America/Argentina/Tucuman",
+ "America/Argentina/Ushuaia",
+ "America/Aruba",
+ "America/Asuncion",
+ "America/Atikokan",
+ "America/Atka",
+ "America/Bahia",
+ "America/Bahia_Banderas",
+ "America/Barbados",
+ "America/Belem",
+ "America/Belize",
+ "America/Blanc-Sablon",
+ "America/Boa_Vista",
+ "America/Bogota",
+ "America/Boise",
+ "America/Buenos_Aires",
+ "America/Cambridge_Bay",
+ "America/Campo_Grande",
+ "America/Cancun",
+ "America/Caracas",
+ "America/Catamarca",
+ "America/Cayenne",
+ "America/Cayman",
+ "America/Chicago",
+ "America/Chihuahua",
+ "America/Coral_Harbour",
+ "America/Cordoba",
+ "America/Costa_Rica",
+ "America/Creston",
+ "America/Cuiaba",
+ "America/Curacao",
+ "America/Danmarkshavn",
+ "America/Dawson",
+ "America/Dawson_Creek",
+ "America/Denver",
+ "America/Detroit",
+ "America/Dominica",
+ "America/Edmonton",
+ "America/Eirunepe",
+ "America/El_Salvador",
+ "America/Ensenada",
+ "America/Fort_Nelson",
+ "America/Fort_Wayne",
+ "America/Fortaleza",
+ "America/Glace_Bay",
+ "America/Godthab",
+ "America/Goose_Bay",
+ "America/Grand_Turk",
+ "America/Grenada",
+ "America/Guadeloupe",
+ "America/Guatemala",
+ "America/Guayaquil",
+ "America/Guyana",
+ "America/Halifax",
+ "America/Havana",
+ "America/Hermosillo",
+ "America/Indiana/Indianapolis",
+ "America/Indiana/Knox",
+ "America/Indiana/Marengo",
+ "America/Indiana/Petersburg",
+ "America/Indiana/Tell_City",
+ "America/Indiana/Vevay",
+ "America/Indiana/Vincennes",
+ "America/Indiana/Winamac",
+ "America/Indianapolis",
+ "America/Inuvik",
+ "America/Iqaluit",
+ "America/Jamaica",
+ "America/Jujuy",
+ "America/Juneau",
+ "America/Kentucky/Louisville",
+ "America/Kentucky/Monticello",
+ "America/Knox_IN",
+ "America/Kralendijk",
+ "America/La_Paz",
+ "America/Lima",
+ "America/Los_Angeles",
+ "America/Louisville",
+ "America/Lower_Princes",
+ "America/Maceio",
+ "America/Managua",
+ "America/Manaus",
+ "America/Marigot",
+ "America/Martinique",
+ "America/Matamoros",
+ "America/Mazatlan",
+ "America/Mendoza",
+ "America/Menominee",
+ "America/Merida",
+ "America/Metlakatla",
+ "America/Mexico_City",
+ "America/Miquelon",
+ "America/Moncton",
+ "America/Monterrey",
+ "America/Montevideo",
+ "America/Montreal",
+ "America/Montserrat",
+ "America/Nassau",
+ "America/New_York",
+ "America/Nipigon",
+ "America/Nome",
+ "America/Noronha",
+ "America/North_Dakota/Beulah",
+ "America/North_Dakota/Center",
+ "America/North_Dakota/New_Salem",
+ "America/Ojinaga",
+ "America/Panama",
+ "America/Pangnirtung",
+ "America/Paramaribo",
+ "America/Phoenix",
+ "America/Port-au-Prince",
+ "America/Port_of_Spain",
+ "America/Porto_Acre",
+ "America/Porto_Velho",
+ "America/Puerto_Rico",
+ "America/Punta_Arenas",
+ "America/Rainy_River",
+ "America/Rankin_Inlet",
+ "America/Recife",
+ "America/Regina",
+ "America/Resolute",
+ "America/Rio_Branco",
+ "America/Rosario",
+ "America/Santa_Isabel",
+ "America/Santarem",
+ "America/Santiago",
+ "America/Santo_Domingo",
+ "America/Sao_Paulo",
+ "America/Scoresbysund",
+ "America/Shiprock",
+ "America/Sitka",
+ "America/St_Barthelemy",
+ "America/St_Johns",
+ "America/St_Kitts",
+ "America/St_Lucia",
+ "America/St_Thomas",
+ "America/St_Vincent",
+ "America/Swift_Current",
+ "America/Tegucigalpa",
+ "America/Thule",
+ "America/Thunder_Bay",
+ "America/Tijuana",
+ "America/Toronto",
+ "America/Tortola",
+ "America/Vancouver",
+ "America/Virgin",
+ "America/Whitehorse",
+ "America/Winnipeg",
+ "America/Yakutat",
+ "America/Yellowknife",
+ "Antarctica/Casey",
+ "Antarctica/Davis",
+ "Antarctica/DumontDUrville",
+ "Antarctica/Macquarie",
+ "Antarctica/Mawson",
+ "Antarctica/McMurdo",
+ "Antarctica/Palmer",
+ "Antarctica/Rothera",
+ "Antarctica/South_Pole",
+ "Antarctica/Syowa",
+ "Antarctica/Troll",
+ "Antarctica/Vostok",
+ "Arctic/Longyearbyen",
+ "Asia/Aden",
+ "Asia/Almaty",
+ "Asia/Amman",
+ "Asia/Anadyr",
+ "Asia/Aqtau",
+ "Asia/Aqtobe",
+ "Asia/Ashgabat",
+ "Asia/Ashkhabad",
+ "Asia/Atyrau",
+ "Asia/Baghdad",
+ "Asia/Bahrain",
+ "Asia/Baku",
+ "Asia/Bangkok",
+ "Asia/Barnaul",
+ "Asia/Beirut",
+ "Asia/Bishkek",
+ "Asia/Brunei",
+ "Asia/Calcutta",
+ "Asia/Chita",
+ "Asia/Choibalsan",
+ "Asia/Chongqing",
+ "Asia/Chungking",
+ "Asia/Colombo",
+ "Asia/Dacca",
+ "Asia/Damascus",
+ "Asia/Dhaka",
+ "Asia/Dili",
+ "Asia/Dubai",
+ "Asia/Dushanbe",
+ "Asia/Famagusta",
+ "Asia/Gaza",
+ "Asia/Harbin",
+ "Asia/Hebron",
+ "Asia/Ho_Chi_Minh",
+ "Asia/Hong_Kong",
+ "Asia/Hovd",
+ "Asia/Irkutsk",
+ "Asia/Istanbul",
+ "Asia/Jakarta",
+ "Asia/Jayapura",
+ "Asia/Jerusalem",
+ "Asia/Kabul",
+ "Asia/Kamchatka",
+ "Asia/Karachi",
+ "Asia/Kashgar",
+ "Asia/Kathmandu",
+ "Asia/Katmandu",
+ "Asia/Khandyga",
+ "Asia/Kolkata",
+ "Asia/Krasnoyarsk",
+ "Asia/Kuala_Lumpur",
+ "Asia/Kuching",
+ "Asia/Kuwait",
+ "Asia/Macao",
+ "Asia/Macau",
+ "Asia/Magadan",
+ "Asia/Makassar",
+ "Asia/Manila",
+ "Asia/Muscat",
+ "Asia/Nicosia",
+ "Asia/Novokuznetsk",
+ "Asia/Novosibirsk",
+ "Asia/Omsk",
+ "Asia/Oral",
+ "Asia/Phnom_Penh",
+ "Asia/Pontianak",
+ "Asia/Pyongyang",
+ "Asia/Qatar",
+ "Asia/Qostanay",
+ "Asia/Qyzylorda",
+ "Asia/Rangoon",
+ "Asia/Riyadh",
+ "Asia/Saigon",
+ "Asia/Sakhalin",
+ "Asia/Samarkand",
+ "Asia/Seoul",
+ "Asia/Shanghai",
+ "Asia/Singapore",
+ "Asia/Srednekolymsk",
+ "Asia/Taipei",
+ "Asia/Tashkent",
+ "Asia/Tbilisi",
+ "Asia/Tehran",
+ "Asia/Tel_Aviv",
+ "Asia/Thimbu",
+ "Asia/Thimphu",
+ "Asia/Tokyo",
+ "Asia/Tomsk",
+ "Asia/Ujung_Pandang",
+ "Asia/Ulaanbaatar",
+ "Asia/Ulan_Bator",
+ "Asia/Urumqi",
+ "Asia/Ust-Nera",
+ "Asia/Vientiane",
+ "Asia/Vladivostok",
+ "Asia/Yakutsk",
+ "Asia/Yangon",
+ "Asia/Yekaterinburg",
+ "Asia/Yerevan",
+ "Atlantic/Azores",
+ "Atlantic/Bermuda",
+ "Atlantic/Canary",
+ "Atlantic/Cape_Verde",
+ "Atlantic/Faeroe",
+ "Atlantic/Faroe",
+ "Atlantic/Jan_Mayen",
+ "Atlantic/Madeira",
+ "Atlantic/Reykjavik",
+ "Atlantic/South_Georgia",
+ "Atlantic/St_Helena",
+ "Atlantic/Stanley",
+ "Australia/ACT",
+ "Australia/Adelaide",
+ "Australia/Brisbane",
+ "Australia/Broken_Hill",
+ "Australia/Canberra",
+ "Australia/Currie",
+ "Australia/Darwin",
+ "Australia/Eucla",
+ "Australia/Hobart",
+ "Australia/LHI",
+ "Australia/Lindeman",
+ "Australia/Lord_Howe",
+ "Australia/Melbourne",
+ "Australia/NSW",
+ "Australia/North",
+ "Australia/Perth",
+ "Australia/Queensland",
+ "Australia/South",
+ "Australia/Sydney",
+ "Australia/Tasmania",
+ "Australia/Victoria",
+ "Australia/West",
+ "Australia/Yancowinna",
+ "Brazil/Acre",
+ "Brazil/DeNoronha",
+ "Brazil/East",
+ "Brazil/West",
+ "CET",
+ "CST6CDT",
+ "Canada/Atlantic",
+ "Canada/Central",
+ "Canada/Eastern",
+ "Canada/Mountain",
+ "Canada/Newfoundland",
+ "Canada/Pacific",
+ "Canada/Saskatchewan",
+ "Canada/Yukon",
+ "Chile/Continental",
+ "Chile/EasterIsland",
+ "Cuba",
+ "EET",
+ "EST",
+ "EST5EDT",
+ "Egypt",
+ "Eire",
+ "Etc/GMT",
+ "Etc/GMT+0",
+ "Etc/GMT+1",
+ "Etc/GMT+10",
+ "Etc/GMT+11",
+ "Etc/GMT+12",
+ "Etc/GMT+2",
+ "Etc/GMT+3",
+ "Etc/GMT+4",
+ "Etc/GMT+5",
+ "Etc/GMT+6",
+ "Etc/GMT+7",
+ "Etc/GMT+8",
+ "Etc/GMT+9",
+ "Etc/GMT-0",
+ "Etc/GMT-1",
+ "Etc/GMT-10",
+ "Etc/GMT-11",
+ "Etc/GMT-12",
+ "Etc/GMT-13",
+ "Etc/GMT-14",
+ "Etc/GMT-2",
+ "Etc/GMT-3",
+ "Etc/GMT-4",
+ "Etc/GMT-5",
+ "Etc/GMT-6",
+ "Etc/GMT-7",
+ "Etc/GMT-8",
+ "Etc/GMT-9",
+ "Etc/GMT0",
+ "Etc/Greenwich",
+ "Etc/UCT",
+ "Etc/UTC",
+ "Etc/Universal",
+ "Etc/Zulu",
+ "Europe/Amsterdam",
+ "Europe/Andorra",
+ "Europe/Astrakhan",
+ "Europe/Athens",
+ "Europe/Belfast",
+ "Europe/Belgrade",
+ "Europe/Berlin",
+ "Europe/Bratislava",
+ "Europe/Brussels",
+ "Europe/Bucharest",
+ "Europe/Budapest",
+ "Europe/Busingen",
+ "Europe/Chisinau",
+ "Europe/Copenhagen",
+ "Europe/Dublin",
+ "Europe/Gibraltar",
+ "Europe/Guernsey",
+ "Europe/Helsinki",
+ "Europe/Isle_of_Man",
+ "Europe/Istanbul",
+ "Europe/Jersey",
+ "Europe/Kaliningrad",
+ "Europe/Kiev",
+ "Europe/Kirov",
+ "Europe/Lisbon",
+ "Europe/Ljubljana",
+ "Europe/London",
+ "Europe/Luxembourg",
+ "Europe/Madrid",
+ "Europe/Malta",
+ "Europe/Mariehamn",
+ "Europe/Minsk",
+ "Europe/Monaco",
+ "Europe/Moscow",
+ "Europe/Nicosia",
+ "Europe/Oslo",
+ "Europe/Paris",
+ "Europe/Podgorica",
+ "Europe/Prague",
+ "Europe/Riga",
+ "Europe/Rome",
+ "Europe/Samara",
+ "Europe/San_Marino",
+ "Europe/Sarajevo",
+ "Europe/Saratov",
+ "Europe/Simferopol",
+ "Europe/Skopje",
+ "Europe/Sofia",
+ "Europe/Stockholm",
+ "Europe/Tallinn",
+ "Europe/Tirane",
+ "Europe/Tiraspol",
+ "Europe/Ulyanovsk",
+ "Europe/Uzhgorod",
+ "Europe/Vaduz",
+ "Europe/Vatican",
+ "Europe/Vienna",
+ "Europe/Vilnius",
+ "Europe/Volgograd",
+ "Europe/Warsaw",
+ "Europe/Zagreb",
+ "Europe/Zaporozhye",
+ "Europe/Zurich",
+ "GB",
+ "GB-Eire",
+ "GMT",
+ "GMT+0",
+ "GMT-0",
+ "GMT0",
+ "Greenwich",
+ "HST",
+ "Hongkong",
+ "Iceland",
+ "Indian/Antananarivo",
+ "Indian/Chagos",
+ "Indian/Christmas",
+ "Indian/Cocos",
+ "Indian/Comoro",
+ "Indian/Kerguelen",
+ "Indian/Mahe",
+ "Indian/Maldives",
+ "Indian/Mauritius",
+ "Indian/Mayotte",
+ "Indian/Reunion",
+ "Iran",
+ "Israel",
+ "Jamaica",
+ "Japan",
+ "Kwajalein",
+ "Libya",
+ "MET",
+ "MST",
+ "MST7MDT",
+ "Mexico/BajaNorte",
+ "Mexico/BajaSur",
+ "Mexico/General",
+ "NZ",
+ "NZ-CHAT",
+ "Navajo",
+ "PRC",
+ "PST8PDT",
+ "Pacific/Apia",
+ "Pacific/Auckland",
+ "Pacific/Bougainville",
+ "Pacific/Chatham",
+ "Pacific/Chuuk",
+ "Pacific/Easter",
+ "Pacific/Efate",
+ "Pacific/Enderbury",
+ "Pacific/Fakaofo",
+ "Pacific/Fiji",
+ "Pacific/Funafuti",
+ "Pacific/Galapagos",
+ "Pacific/Gambier",
+ "Pacific/Guadalcanal",
+ "Pacific/Guam",
+ "Pacific/Honolulu",
+ "Pacific/Johnston",
+ "Pacific/Kiritimati",
+ "Pacific/Kosrae",
+ "Pacific/Kwajalein",
+ "Pacific/Majuro",
+ "Pacific/Marquesas",
+ "Pacific/Midway",
+ "Pacific/Nauru",
+ "Pacific/Niue",
+ "Pacific/Norfolk",
+ "Pacific/Noumea",
+ "Pacific/Pago_Pago",
+ "Pacific/Palau",
+ "Pacific/Pitcairn",
+ "Pacific/Pohnpei",
+ "Pacific/Ponape",
+ "Pacific/Port_Moresby",
+ "Pacific/Rarotonga",
+ "Pacific/Saipan",
+ "Pacific/Samoa",
+ "Pacific/Tahiti",
+ "Pacific/Tarawa",
+ "Pacific/Tongatapu",
+ "Pacific/Truk",
+ "Pacific/Wake",
+ "Pacific/Wallis",
+ "Pacific/Yap",
+ "Poland",
+ "Portugal",
+ "ROC",
+ "ROK",
+ "Singapore",
+ "Turkey",
+ "UCT",
+ "US/Alaska",
+ "US/Aleutian",
+ "US/Arizona",
+ "US/Central",
+ "US/East-Indiana",
+ "US/Eastern",
+ "US/Hawaii",
+ "US/Indiana-Starke",
+ "US/Michigan",
+ "US/Mountain",
+ "US/Pacific",
+ "US/Samoa",
+ "UTC",
+ "Universal",
+ "W-SU",
+ "WET",
+ "Zulu",
+ nullptr};
+
+// Helper to return a loaded time zone by value (UTC on error).
+time_zone LoadZone(const std::string& name) {
+ time_zone tz;
+ load_time_zone(name, &tz);
+ return tz;
+}
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
+ do { \
+ time_zone::absolute_lookup al = tz.lookup(tp); \
+ EXPECT_EQ(y, al.cs.year()); \
+ EXPECT_EQ(m, al.cs.month()); \
+ EXPECT_EQ(d, al.cs.day()); \
+ EXPECT_EQ(hh, al.cs.hour()); \
+ EXPECT_EQ(mm, al.cs.minute()); \
+ EXPECT_EQ(ss, al.cs.second()); \
+ EXPECT_EQ(off, al.offset); \
+ EXPECT_TRUE(isdst == al.is_dst); \
+ /* EXPECT_STREQ(zone, al.abbr); */ \
+ } while (0)
+
+// These tests sometimes run on platforms that have zoneinfo data so old
+// that the transition we are attempting to check does not exist, most
+// notably Android emulators. Fortunately, AndroidZoneInfoSource supports
+// time_zone::version() so, in cases where we've learned that it matters,
+// we can make the check conditionally.
+int VersionCmp(time_zone tz, const std::string& target) {
+ std::string version = tz.version();
+ if (version.empty() && !target.empty()) return 1; // unknown > known
+ return version.compare(target);
+}
+
+} // namespace
+
+#if !defined(__EMSCRIPTEN__)
+TEST(TimeZones, LoadZonesConcurrently) {
+ std::promise<void> ready_promise;
+ std::shared_future<void> ready_future(ready_promise.get_future());
+ auto load_zones = [ready_future](std::promise<void>* started,
+ std::set<std::string>* failures) {
+ started->set_value();
+ ready_future.wait();
+ for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
+ std::string zone = *np;
+ time_zone tz;
+ if (load_time_zone(zone, &tz)) {
+ EXPECT_EQ(zone, tz.name());
+ } else {
+ failures->insert(zone);
+ }
+ }
+ };
+
+ const std::size_t n_threads = 128;
+ std::vector<std::thread> threads;
+ std::vector<std::set<std::string>> thread_failures(n_threads);
+ for (std::size_t i = 0; i != n_threads; ++i) {
+ std::promise<void> started;
+ threads.emplace_back(load_zones, &started, &thread_failures[i]);
+ started.get_future().wait();
+ }
+ ready_promise.set_value();
+ for (auto& thread : threads) {
+ thread.join();
+ }
+
+ // Allow a small number of failures to account for skew between
+ // the contents of kTimeZoneNames and the zoneinfo data source.
+#if defined(__ANDROID__)
+ // Cater to the possibility of using an even older zoneinfo data
+ // source when running on Android, where it is difficult to override
+ // the bionic tzdata provided by the test environment.
+ const std::size_t max_failures = 20;
+#else
+ const std::size_t max_failures = 3;
+#endif
+ std::set<std::string> failures;
+ for (const auto& thread_failure : thread_failures) {
+ failures.insert(thread_failure.begin(), thread_failure.end());
+ }
+ EXPECT_LE(failures.size(), max_failures) << testing::PrintToString(failures);
+}
+#endif
+
+TEST(TimeZone, NamedTimeZones) {
+ const time_zone utc = utc_time_zone();
+ EXPECT_EQ("UTC", utc.name());
+ const time_zone nyc = LoadZone("America/New_York");
+ EXPECT_EQ("America/New_York", nyc.name());
+ const time_zone syd = LoadZone("Australia/Sydney");
+ EXPECT_EQ("Australia/Sydney", syd.name());
+ const time_zone fixed0 =
+ fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+ EXPECT_EQ("UTC", fixed0.name());
+ const time_zone fixed_pos = fixed_time_zone(
+ chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
+ EXPECT_EQ("Fixed/UTC+03:25:45", fixed_pos.name());
+ const time_zone fixed_neg = fixed_time_zone(
+ -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
+ EXPECT_EQ("Fixed/UTC-12:34:56", fixed_neg.name());
+}
+
+TEST(TimeZone, Failures) {
+ time_zone tz;
+ EXPECT_FALSE(load_time_zone(":America/Los_Angeles", &tz));
+
+ tz = LoadZone("America/Los_Angeles");
+ EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
+ EXPECT_EQ(chrono::system_clock::from_time_t(0),
+ convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
+
+ // Ensures that the load still fails on a subsequent attempt.
+ tz = LoadZone("America/Los_Angeles");
+ EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
+ EXPECT_EQ(chrono::system_clock::from_time_t(0),
+ convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
+
+ // Loading an empty std::string timezone should fail.
+ tz = LoadZone("America/Los_Angeles");
+ EXPECT_FALSE(load_time_zone("", &tz));
+ EXPECT_EQ(chrono::system_clock::from_time_t(0),
+ convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
+}
+
+TEST(TimeZone, Equality) {
+ const time_zone a;
+ const time_zone b;
+ EXPECT_EQ(a, b);
+ EXPECT_EQ(a.name(), b.name());
+
+ const time_zone implicit_utc;
+ const time_zone explicit_utc = utc_time_zone();
+ EXPECT_EQ(implicit_utc, explicit_utc);
+ EXPECT_EQ(implicit_utc.name(), explicit_utc.name());
+
+ const time_zone fixed_zero =
+ fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+ EXPECT_EQ(fixed_zero, LoadZone(fixed_zero.name()));
+ EXPECT_EQ(fixed_zero, explicit_utc);
+
+ const time_zone fixed_utc = LoadZone("Fixed/UTC+00:00:00");
+ EXPECT_EQ(fixed_utc, LoadZone(fixed_utc.name()));
+ EXPECT_EQ(fixed_utc, explicit_utc);
+
+ const time_zone fixed_pos = fixed_time_zone(
+ chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
+ EXPECT_EQ(fixed_pos, LoadZone(fixed_pos.name()));
+ EXPECT_NE(fixed_pos, explicit_utc);
+ const time_zone fixed_neg = fixed_time_zone(
+ -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
+ EXPECT_EQ(fixed_neg, LoadZone(fixed_neg.name()));
+ EXPECT_NE(fixed_neg, explicit_utc);
+
+ const time_zone fixed_lim = fixed_time_zone(chrono::hours(24));
+ EXPECT_EQ(fixed_lim, LoadZone(fixed_lim.name()));
+ EXPECT_NE(fixed_lim, explicit_utc);
+ const time_zone fixed_ovfl =
+ fixed_time_zone(chrono::hours(24) + chrono::seconds(1));
+ EXPECT_EQ(fixed_ovfl, LoadZone(fixed_ovfl.name()));
+ EXPECT_EQ(fixed_ovfl, explicit_utc);
+
+ EXPECT_EQ(fixed_time_zone(chrono::seconds(1)),
+ fixed_time_zone(chrono::seconds(1)));
+
+ const time_zone local = local_time_zone();
+ EXPECT_EQ(local, LoadZone(local.name()));
+
+ time_zone la = LoadZone("America/Los_Angeles");
+ time_zone nyc = LoadZone("America/New_York");
+ EXPECT_NE(la, nyc);
+}
+
+TEST(StdChronoTimePoint, TimeTAlignment) {
+ // Ensures that the Unix epoch and the system clock epoch are an integral
+ // number of seconds apart. This simplifies conversions to/from time_t.
+ auto diff =
+ chrono::system_clock::time_point() - chrono::system_clock::from_time_t(0);
+ EXPECT_EQ(chrono::system_clock::time_point::duration::zero(),
+ diff % chrono::seconds(1));
+}
+
+TEST(BreakTime, TimePointResolution) {
+ const time_zone utc = utc_time_zone();
+ const auto t0 = chrono::system_clock::from_time_t(0);
+
+ ExpectTime(chrono::time_point_cast<chrono::nanoseconds>(t0), utc, 1970, 1, 1,
+ 0, 0, 0, 0, false, "UTC");
+ ExpectTime(chrono::time_point_cast<chrono::microseconds>(t0), utc, 1970, 1, 1,
+ 0, 0, 0, 0, false, "UTC");
+ ExpectTime(chrono::time_point_cast<chrono::milliseconds>(t0), utc, 1970, 1, 1,
+ 0, 0, 0, 0, false, "UTC");
+ ExpectTime(chrono::time_point_cast<chrono::seconds>(t0), utc, 1970, 1, 1, 0,
+ 0, 0, 0, false, "UTC");
+ ExpectTime(chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0),
+ utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+ ExpectTime(chrono::time_point_cast<chrono::minutes>(t0), utc, 1970, 1, 1, 0,
+ 0, 0, 0, false, "UTC");
+ ExpectTime(chrono::time_point_cast<chrono::hours>(t0), utc, 1970, 1, 1, 0, 0,
+ 0, 0, false, "UTC");
+}
+
+TEST(BreakTime, LocalTimeInUTC) {
+ const time_zone tz = utc_time_zone();
+ const auto tp = chrono::system_clock::from_time_t(0);
+ ExpectTime(tp, tz, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+ EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInUTCUnaligned) {
+ const time_zone tz = utc_time_zone();
+ const auto tp =
+ chrono::system_clock::from_time_t(0) - chrono::milliseconds(500);
+ ExpectTime(tp, tz, 1969, 12, 31, 23, 59, 59, 0, false, "UTC");
+ EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimePosix) {
+ // See IEEE Std 1003.1-1988 B.2.3 General Terms, Epoch.
+ const time_zone tz = utc_time_zone();
+ const auto tp = chrono::system_clock::from_time_t(536457599);
+ ExpectTime(tp, tz, 1986, 12, 31, 23, 59, 59, 0, false, "UTC");
+ EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(TimeZoneImpl, LocalTimeInFixed) {
+ const absl::time_internal::cctz::seconds offset =
+ -(chrono::hours(8) + chrono::minutes(33) + chrono::seconds(47));
+ const time_zone tz = fixed_time_zone(offset);
+ const auto tp = chrono::system_clock::from_time_t(0);
+ ExpectTime(tp, tz, 1969, 12, 31, 15, 26, 13, offset.count(), false,
+ "-083347");
+ EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInNewYork) {
+ const time_zone tz = LoadZone("America/New_York");
+ const auto tp = chrono::system_clock::from_time_t(45);
+ ExpectTime(tp, tz, 1969, 12, 31, 19, 0, 45, -5 * 60 * 60, false, "EST");
+ EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInMTV) {
+ const time_zone tz = LoadZone("America/Los_Angeles");
+ const auto tp = chrono::system_clock::from_time_t(1380855729);
+ ExpectTime(tp, tz, 2013, 10, 3, 20, 2, 9, -7 * 60 * 60, true, "PDT");
+ EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInSydney) {
+ const time_zone tz = LoadZone("Australia/Sydney");
+ const auto tp = chrono::system_clock::from_time_t(90);
+ ExpectTime(tp, tz, 1970, 1, 1, 10, 1, 30, 10 * 60 * 60, false, "AEST");
+ EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(MakeTime, TimePointResolution) {
+ const time_zone utc = utc_time_zone();
+ const time_point<chrono::nanoseconds> tp_ns =
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+ EXPECT_EQ("04:05", format("%M:%E*S", tp_ns, utc));
+ const time_point<chrono::microseconds> tp_us =
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+ EXPECT_EQ("04:05", format("%M:%E*S", tp_us, utc));
+ const time_point<chrono::milliseconds> tp_ms =
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+ EXPECT_EQ("04:05", format("%M:%E*S", tp_ms, utc));
+ const time_point<chrono::seconds> tp_s =
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+ EXPECT_EQ("04:05", format("%M:%E*S", tp_s, utc));
+ const time_point<absl::time_internal::cctz::seconds> tp_s64 =
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+ EXPECT_EQ("04:05", format("%M:%E*S", tp_s64, utc));
+
+ // These next two require chrono::time_point_cast because the conversion
+ // from a resolution of seconds (the return value of convert()) to a
+ // coarser resolution requires an explicit cast.
+ const time_point<chrono::minutes> tp_m =
+ chrono::time_point_cast<chrono::minutes>(
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
+ EXPECT_EQ("04:00", format("%M:%E*S", tp_m, utc));
+ const time_point<chrono::hours> tp_h = chrono::time_point_cast<chrono::hours>(
+ convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
+ EXPECT_EQ("00:00", format("%M:%E*S", tp_h, utc));
+}
+
+TEST(MakeTime, Normalization) {
+ const time_zone tz = LoadZone("America/New_York");
+ const auto tp = convert(civil_second(2009, 2, 13, 18, 31, 30), tz);
+ EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+ // Now requests for the same time_point but with out-of-range fields.
+ EXPECT_EQ(tp, convert(civil_second(2008, 14, 13, 18, 31, 30), tz)); // month
+ EXPECT_EQ(tp, convert(civil_second(2009, 1, 44, 18, 31, 30), tz)); // day
+ EXPECT_EQ(tp, convert(civil_second(2009, 2, 12, 42, 31, 30), tz)); // hour
+ EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 17, 91, 30), tz)); // minute
+ EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 18, 30, 90), tz)); // second
+}
+
+// NOTE: Run this with -ftrapv to detect overflow problems.
+TEST(MakeTime, SysSecondsLimits) {
+ const char RFC3339[] = "%Y-%m-%dT%H:%M:%S%Ez";
+ const time_zone utc = utc_time_zone();
+ const time_zone east = fixed_time_zone(chrono::hours(14));
+ const time_zone west = fixed_time_zone(-chrono::hours(14));
+ time_point<absl::time_internal::cctz::seconds> tp;
+
+ // Approach the maximal time_point<cctz::seconds> value from below.
+ tp = convert(civil_second(292277026596, 12, 4, 15, 30, 6), utc);
+ EXPECT_EQ("292277026596-12-04T15:30:06+00:00", format(RFC3339, tp, utc));
+ tp = convert(civil_second(292277026596, 12, 4, 15, 30, 7), utc);
+ EXPECT_EQ("292277026596-12-04T15:30:07+00:00", format(RFC3339, tp, utc));
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+ tp = convert(civil_second(292277026596, 12, 4, 15, 30, 8), utc);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+ tp = convert(civil_second::max(), utc);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+ // Checks that we can also get the maximal value for a far-east zone.
+ tp = convert(civil_second(292277026596, 12, 5, 5, 30, 7), east);
+ EXPECT_EQ("292277026596-12-05T05:30:07+14:00", format(RFC3339, tp, east));
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+ tp = convert(civil_second(292277026596, 12, 5, 5, 30, 8), east);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+ tp = convert(civil_second::max(), east);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+ // Checks that we can also get the maximal value for a far-west zone.
+ tp = convert(civil_second(292277026596, 12, 4, 1, 30, 7), west);
+ EXPECT_EQ("292277026596-12-04T01:30:07-14:00", format(RFC3339, tp, west));
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+ tp = convert(civil_second(292277026596, 12, 4, 7, 30, 8), west);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+ tp = convert(civil_second::max(), west);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+ // Approach the minimal time_point<cctz::seconds> value from above.
+ tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 53), utc);
+ EXPECT_EQ("-292277022657-01-27T08:29:53+00:00", format(RFC3339, tp, utc));
+ tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 52), utc);
+ EXPECT_EQ("-292277022657-01-27T08:29:52+00:00", format(RFC3339, tp, utc));
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+ tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 51), utc);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+ tp = convert(civil_second::min(), utc);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+ // Checks that we can also get the minimal value for a far-east zone.
+ tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 52), east);
+ EXPECT_EQ("-292277022657-01-27T22:29:52+14:00", format(RFC3339, tp, east));
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+ tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 51), east);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+ tp = convert(civil_second::min(), east);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+ // Checks that we can also get the minimal value for a far-west zone.
+ tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 52), west);
+ EXPECT_EQ("-292277022657-01-26T18:29:52-14:00", format(RFC3339, tp, west));
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+ tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 51), west);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+ tp = convert(civil_second::min(), west);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+ // Some similar checks for the "libc" time-zone implementation.
+ if (sizeof(std::time_t) >= 8) {
+ // Checks that "tm_year + 1900", as used by the "libc" implementation,
+ // can produce year values beyond the range on an int without overflow.
+#if defined(_WIN32) || defined(_WIN64)
+ // localtime_s() and gmtime_s() don't believe in years outside [1970:3000].
+#else
+ const time_zone utc = LoadZone("libc:UTC");
+ const year_t max_tm_year = year_t{std::numeric_limits<int>::max()} + 1900;
+ tp = convert(civil_second(max_tm_year, 12, 31, 23, 59, 59), utc);
+ EXPECT_EQ("2147485547-12-31T23:59:59+00:00", format(RFC3339, tp, utc));
+ const year_t min_tm_year = year_t{std::numeric_limits<int>::min()} + 1900;
+ tp = convert(civil_second(min_tm_year, 1, 1, 0, 0, 0), utc);
+ EXPECT_EQ("-2147481748-01-01T00:00:00+00:00", format(RFC3339, tp, utc));
+#endif
+ }
+}
+
+TEST(MakeTime, LocalTimeLibC) {
+ // Checks that cctz and libc agree on transition points in [1970:2037].
+ //
+ // We limit this test case to environments where:
+ // 1) we know how to change the time zone used by localtime()/mktime(),
+ // 2) cctz and localtime()/mktime() will use similar-enough tzdata, and
+ // 3) we have some idea about how mktime() behaves during transitions.
+#if defined(__linux__) && !defined(__ANDROID__)
+ const char* const ep = getenv("TZ");
+ std::string tz_name = (ep != nullptr) ? ep : "";
+ for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
+ ASSERT_EQ(0, setenv("TZ", *np, 1)); // change what "localtime" means
+ const auto zi = local_time_zone();
+ const auto lc = LoadZone("libc:localtime");
+ time_zone::civil_transition transition;
+ for (auto tp = zi.lookup(civil_second()).trans;
+ zi.next_transition(tp, &transition);
+ tp = zi.lookup(transition.to).trans) {
+ const auto fcl = zi.lookup(transition.from);
+ const auto tcl = zi.lookup(transition.to);
+ civil_second cs; // compare cs in zi and lc
+ if (fcl.kind == time_zone::civil_lookup::UNIQUE) {
+ if (tcl.kind == time_zone::civil_lookup::UNIQUE) {
+ // Both unique; must be an is_dst or abbr change.
+ ASSERT_EQ(transition.from, transition.to);
+ const auto trans = fcl.trans;
+ const auto tal = zi.lookup(trans);
+ const auto tprev = trans - absl::time_internal::cctz::seconds(1);
+ const auto pal = zi.lookup(tprev);
+ if (pal.is_dst == tal.is_dst) {
+ ASSERT_STRNE(pal.abbr, tal.abbr);
+ }
+ continue;
+ }
+ ASSERT_EQ(time_zone::civil_lookup::REPEATED, tcl.kind);
+ cs = transition.to;
+ } else {
+ ASSERT_EQ(time_zone::civil_lookup::UNIQUE, tcl.kind);
+ ASSERT_EQ(time_zone::civil_lookup::SKIPPED, fcl.kind);
+ cs = transition.from;
+ }
+ if (cs.year() > 2037) break; // limit test time (and to 32-bit time_t)
+ const auto cl_zi = zi.lookup(cs);
+ if (zi.lookup(cl_zi.pre).is_dst == zi.lookup(cl_zi.post).is_dst) {
+ // The "libc" implementation cannot correctly classify transitions
+ // that don't change the "tm_isdst" flag. In Europe/Volgograd, for
+ // example, there is a SKIPPED transition from +03 to +04 with dst=F
+ // on both sides ...
+ // 1540681199 = 2018-10-28 01:59:59 +03:00:00 [dst=F off=10800]
+ // 1540681200 = 2018-10-28 03:00:00 +04:00:00 [dst=F off=14400]
+ // but std::mktime(2018-10-28 02:00:00, tm_isdst=0) fails, unlike,
+ // say, the similar Europe/Chisinau transition from +02 to +03 ...
+ // 1521935999 = 2018-03-25 01:59:59 +02:00:00 [dst=F off=7200]
+ // 1521936000 = 2018-03-25 03:00:00 +03:00:00 [dst=T off=10800]
+ // where std::mktime(2018-03-25 02:00:00, tm_isdst=0) succeeds and
+ // returns 1521936000.
+ continue;
+ }
+ if (cs == civil_second(2037, 10, 4, 2, 0, 0)) {
+ const std::string tzname = *np;
+ if (tzname == "Africa/Casablanca" || tzname == "Africa/El_Aaiun") {
+ // The "libc" implementation gets this transition wrong (at least
+ // until 2018g when it was removed), returning an offset of 3600
+ // instead of 0. TODO: Revert this when 2018g is ubiquitous.
+ continue;
+ }
+ }
+ const auto cl_lc = lc.lookup(cs);
+ SCOPED_TRACE(testing::Message() << "For " << cs << " in " << *np);
+ EXPECT_EQ(cl_zi.kind, cl_lc.kind);
+ EXPECT_EQ(cl_zi.pre, cl_lc.pre);
+ EXPECT_EQ(cl_zi.trans, cl_lc.trans);
+ EXPECT_EQ(cl_zi.post, cl_lc.post);
+ }
+ }
+ if (ep == nullptr) {
+ ASSERT_EQ(0, unsetenv("TZ"));
+ } else {
+ ASSERT_EQ(0, setenv("TZ", tz_name.c_str(), 1));
+ }
+#endif
+}
+
+TEST(NextTransition, UTC) {
+ const auto tz = utc_time_zone();
+ time_zone::civil_transition trans;
+
+ auto tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_FALSE(tz.next_transition(tp, &trans));
+}
+
+TEST(PrevTransition, UTC) {
+ const auto tz = utc_time_zone();
+ time_zone::civil_transition trans;
+
+ auto tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_FALSE(tz.prev_transition(tp, &trans));
+}
+
+TEST(NextTransition, AmericaNewYork) {
+ const auto tz = LoadZone("America/New_York");
+ time_zone::civil_transition trans;
+
+ auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+ EXPECT_TRUE(tz.next_transition(tp, &trans));
+ EXPECT_EQ(civil_second(2018, 11, 4, 2, 0, 0), trans.from);
+ EXPECT_EQ(civil_second(2018, 11, 4, 1, 0, 0), trans.to);
+
+ tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_TRUE(tz.next_transition(tp, &trans));
+ if (trans.from == civil_second(1918, 3, 31, 2, 0, 0)) {
+ // It looks like the tzdata is only 32 bit (probably macOS),
+ // which bottoms out at 1901-12-13T20:45:52+00:00.
+ EXPECT_EQ(civil_second(1918, 3, 31, 3, 0, 0), trans.to);
+ } else {
+ EXPECT_EQ(civil_second(1883, 11, 18, 12, 3, 58), trans.from);
+ EXPECT_EQ(civil_second(1883, 11, 18, 12, 0, 0), trans.to);
+ }
+}
+
+TEST(PrevTransition, AmericaNewYork) {
+ const auto tz = LoadZone("America/New_York");
+ time_zone::civil_transition trans;
+
+ auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+ EXPECT_TRUE(tz.prev_transition(tp, &trans));
+ EXPECT_EQ(civil_second(2018, 3, 11, 2, 0, 0), trans.from);
+ EXPECT_EQ(civil_second(2018, 3, 11, 3, 0, 0), trans.to);
+
+ tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_TRUE(tz.prev_transition(tp, &trans));
+ // We have a transition but we don't know which one.
+}
+
+TEST(TimeZoneEdgeCase, AmericaNewYork) {
+ const time_zone tz = LoadZone("America/New_York");
+
+ // Spring 1:59:59 -> 3:00:00
+ auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -5 * 3600, false, "EST");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -4 * 3600, true, "EDT");
+
+ // Fall 1:59:59 -> 1:00:00
+ tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -4 * 3600, true, "EDT");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -5 * 3600, false, "EST");
+}
+
+TEST(TimeZoneEdgeCase, AmericaLosAngeles) {
+ const time_zone tz = LoadZone("America/Los_Angeles");
+
+ // Spring 1:59:59 -> 3:00:00
+ auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -8 * 3600, false, "PST");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -7 * 3600, true, "PDT");
+
+ // Fall 1:59:59 -> 1:00:00
+ tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, true, "PDT");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -8 * 3600, false, "PST");
+}
+
+TEST(TimeZoneEdgeCase, ArizonaNoTransition) {
+ const time_zone tz = LoadZone("America/Phoenix");
+
+ // No transition in Spring.
+ auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -7 * 3600, false, "MST");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 3, 10, 2, 0, 0, -7 * 3600, false, "MST");
+
+ // No transition in Fall.
+ tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, false, "MST");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 11, 3, 2, 0, 0, -7 * 3600, false, "MST");
+}
+
+TEST(TimeZoneEdgeCase, AsiaKathmandu) {
+ const time_zone tz = LoadZone("Asia/Kathmandu");
+
+ // A non-DST offset change from +0530 to +0545
+ //
+ // 504901799 == Tue, 31 Dec 1985 23:59:59 +0530 (+0530)
+ // 504901800 == Wed, 1 Jan 1986 00:15:00 +0545 (+0545)
+ auto tp = convert(civil_second(1985, 12, 31, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 1985, 12, 31, 23, 59, 59, 5.5 * 3600, false, "+0530");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1986, 1, 1, 0, 15, 0, 5.75 * 3600, false, "+0545");
+}
+
+TEST(TimeZoneEdgeCase, PacificChatham) {
+ const time_zone tz = LoadZone("Pacific/Chatham");
+
+ // One-hour DST offset changes, but at atypical values
+ //
+ // 1365256799 == Sun, 7 Apr 2013 03:44:59 +1345 (+1345)
+ // 1365256800 == Sun, 7 Apr 2013 02:45:00 +1245 (+1245)
+ auto tp = convert(civil_second(2013, 4, 7, 3, 44, 59), tz);
+ ExpectTime(tp, tz, 2013, 4, 7, 3, 44, 59, 13.75 * 3600, true, "+1345");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 4, 7, 2, 45, 0, 12.75 * 3600, false, "+1245");
+
+ // 1380376799 == Sun, 29 Sep 2013 02:44:59 +1245 (+1245)
+ // 1380376800 == Sun, 29 Sep 2013 03:45:00 +1345 (+1345)
+ tp = convert(civil_second(2013, 9, 29, 2, 44, 59), tz);
+ ExpectTime(tp, tz, 2013, 9, 29, 2, 44, 59, 12.75 * 3600, false, "+1245");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 9, 29, 3, 45, 0, 13.75 * 3600, true, "+1345");
+}
+
+TEST(TimeZoneEdgeCase, AustraliaLordHowe) {
+ const time_zone tz = LoadZone("Australia/Lord_Howe");
+
+ // Half-hour DST offset changes
+ //
+ // 1365260399 == Sun, 7 Apr 2013 01:59:59 +1100 (+11)
+ // 1365260400 == Sun, 7 Apr 2013 01:30:00 +1030 (+1030)
+ auto tp = convert(civil_second(2013, 4, 7, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 4, 7, 1, 59, 59, 11 * 3600, true, "+11");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 4, 7, 1, 30, 0, 10.5 * 3600, false, "+1030");
+
+ // 1380986999 == Sun, 6 Oct 2013 01:59:59 +1030 (+1030)
+ // 1380987000 == Sun, 6 Oct 2013 02:30:00 +1100 (+11)
+ tp = convert(civil_second(2013, 10, 6, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 2013, 10, 6, 1, 59, 59, 10.5 * 3600, false, "+1030");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2013, 10, 6, 2, 30, 0, 11 * 3600, true, "+11");
+}
+
+TEST(TimeZoneEdgeCase, PacificApia) {
+ const time_zone tz = LoadZone("Pacific/Apia");
+
+ // At the end of December 2011, Samoa jumped forward by one day,
+ // skipping 30 December from the local calendar, when the nation
+ // moved to the west of the International Date Line.
+ //
+ // A one-day, non-DST offset change
+ //
+ // 1325239199 == Thu, 29 Dec 2011 23:59:59 -1000 (-10)
+ // 1325239200 == Sat, 31 Dec 2011 00:00:00 +1400 (+14)
+ auto tp = convert(civil_second(2011, 12, 29, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 2011, 12, 29, 23, 59, 59, -10 * 3600, true, "-10");
+ EXPECT_EQ(363, get_yearday(convert(tp, tz)));
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2011, 12, 31, 0, 0, 0, 14 * 3600, true, "+14");
+ EXPECT_EQ(365, get_yearday(convert(tp, tz)));
+}
+
+TEST(TimeZoneEdgeCase, AfricaCairo) {
+ const time_zone tz = LoadZone("Africa/Cairo");
+
+ if (VersionCmp(tz, "2014c") >= 0) {
+ // An interesting case of midnight not existing.
+ //
+ // 1400191199 == Thu, 15 May 2014 23:59:59 +0200 (EET)
+ // 1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST)
+ auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST");
+ }
+}
+
+TEST(TimeZoneEdgeCase, AfricaMonrovia) {
+ const time_zone tz = LoadZone("Africa/Monrovia");
+
+ if (VersionCmp(tz, "2017b") >= 0) {
+ // Strange offset change -00:44:30 -> +00:00:00 (non-DST)
+ //
+ // 63593069 == Thu, 6 Jan 1972 23:59:59 -0044 (MMT)
+ // 63593070 == Fri, 7 Jan 1972 00:44:30 +0000 (GMT)
+ auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT");
+ }
+}
+
+TEST(TimeZoneEdgeCase, AmericaJamaica) {
+ // Jamaica discontinued DST transitions in 1983, and is now at a
+ // constant -0500. This makes it an interesting edge-case target.
+ // Note that the 32-bit times used in a (tzh_version == 0) zoneinfo
+ // file cannot represent the abbreviation-only transition of 1890,
+ // so we ignore the abbreviation by expecting what we received.
+ const time_zone tz = LoadZone("America/Jamaica");
+
+ // Before the first transition.
+ if (!tz.version().empty() && VersionCmp(tz, "2018d") >= 0) {
+ // We avoid the expectations on the -18430 offset below unless we are
+ // certain we have commit 907241e (Fix off-by-1 error for Jamaica and
+ // T&C before 1913) from 2018d. TODO: Remove the "version() not empty"
+ // part when 2018d is generally available from /usr/share/zoneinfo.
+ auto tp = convert(civil_second(1889, 12, 31, 0, 0, 0), tz);
+ ExpectTime(tp, tz, 1889, 12, 31, 0, 0, 0, -18430, false,
+ tz.lookup(tp).abbr);
+
+ // Over the first (abbreviation-change only) transition.
+ // -2524503170 == Tue, 31 Dec 1889 23:59:59 -0507 (LMT)
+ // -2524503169 == Wed, 1 Jan 1890 00:00:00 -0507 (KMT)
+ tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false,
+ tz.lookup(tp).abbr);
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT");
+ }
+
+ // Over the last (DST) transition.
+ // 436341599 == Sun, 30 Oct 1983 01:59:59 -0400 (EDT)
+ // 436341600 == Sun, 30 Oct 1983 01:00:00 -0500 (EST)
+ auto tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz);
+ ExpectTime(tp, tz, 1983, 10, 30, 1, 59, 59, -4 * 3600, true, "EDT");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1983, 10, 30, 1, 0, 0, -5 * 3600, false, "EST");
+
+ // After the last transition.
+ tp = convert(civil_second(1983, 12, 31, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 1983, 12, 31, 23, 59, 59, -5 * 3600, false, "EST");
+}
+
+TEST(TimeZoneEdgeCase, WET) {
+ // Cover some non-existent times within forward transitions.
+ const time_zone tz = LoadZone("WET");
+
+ // Before the first transition.
+ auto tp = convert(civil_second(1977, 1, 1, 0, 0, 0), tz);
+ ExpectTime(tp, tz, 1977, 1, 1, 0, 0, 0, 0, false, "WET");
+
+ // Over the first transition.
+ // 228877199 == Sun, 3 Apr 1977 00:59:59 +0000 (WET)
+ // 228877200 == Sun, 3 Apr 1977 02:00:00 +0100 (WEST)
+ tp = convert(civil_second(1977, 4, 3, 0, 59, 59), tz);
+ ExpectTime(tp, tz, 1977, 4, 3, 0, 59, 59, 0, false, "WET");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
+
+ // A non-existent time within the first transition.
+ time_zone::civil_lookup cl1 = tz.lookup(civil_second(1977, 4, 3, 1, 15, 0));
+ EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl1.kind);
+ ExpectTime(cl1.pre, tz, 1977, 4, 3, 2, 15, 0, 1 * 3600, true, "WEST");
+ ExpectTime(cl1.trans, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
+ ExpectTime(cl1.post, tz, 1977, 4, 3, 0, 15, 0, 0 * 3600, false, "WET");
+
+ // A non-existent time within the second forward transition.
+ time_zone::civil_lookup cl2 = tz.lookup(civil_second(1978, 4, 2, 1, 15, 0));
+ EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl2.kind);
+ ExpectTime(cl2.pre, tz, 1978, 4, 2, 2, 15, 0, 1 * 3600, true, "WEST");
+ ExpectTime(cl2.trans, tz, 1978, 4, 2, 2, 0, 0, 1 * 3600, true, "WEST");
+ ExpectTime(cl2.post, tz, 1978, 4, 2, 0, 15, 0, 0 * 3600, false, "WET");
+}
+
+TEST(TimeZoneEdgeCase, FixedOffsets) {
+ const time_zone gmtm5 = LoadZone("Etc/GMT+5"); // -0500
+ auto tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtm5);
+ ExpectTime(tp, gmtm5, 1970, 1, 1, 0, 0, 0, -5 * 3600, false, "-05");
+ EXPECT_EQ(chrono::system_clock::from_time_t(5 * 3600), tp);
+
+ const time_zone gmtp5 = LoadZone("Etc/GMT-5"); // +0500
+ tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtp5);
+ ExpectTime(tp, gmtp5, 1970, 1, 1, 0, 0, 0, 5 * 3600, false, "+05");
+ EXPECT_EQ(chrono::system_clock::from_time_t(-5 * 3600), tp);
+}
+
+TEST(TimeZoneEdgeCase, NegativeYear) {
+ // Tests transition from year 0 (aka 1BCE) to year -1.
+ const time_zone tz = utc_time_zone();
+ auto tp = convert(civil_second(0, 1, 1, 0, 0, 0), tz);
+ ExpectTime(tp, tz, 0, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
+ EXPECT_EQ(weekday::saturday, get_weekday(convert(tp, tz)));
+ tp -= absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, -1, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
+ EXPECT_EQ(weekday::friday, get_weekday(convert(tp, tz)));
+}
+
+TEST(TimeZoneEdgeCase, UTC32bitLimit) {
+ const time_zone tz = utc_time_zone();
+
+ // Limits of signed 32-bit time_t
+ //
+ // 2147483647 == Tue, 19 Jan 2038 03:14:07 +0000 (UTC)
+ // 2147483648 == Tue, 19 Jan 2038 03:14:08 +0000 (UTC)
+ auto tp = convert(civil_second(2038, 1, 19, 3, 14, 7), tz);
+ ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 7, 0 * 3600, false, "UTC");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 8, 0 * 3600, false, "UTC");
+}
+
+TEST(TimeZoneEdgeCase, UTC5DigitYear) {
+ const time_zone tz = utc_time_zone();
+
+ // Rollover to 5-digit year
+ //
+ // 253402300799 == Fri, 31 Dec 9999 23:59:59 +0000 (UTC)
+ // 253402300800 == Sat, 1 Jan 1000 00:00:00 +0000 (UTC)
+ auto tp = convert(civil_second(9999, 12, 31, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 9999, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 10000, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.cc
new file mode 100644
index 0000000000..5cdd09e89d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.cc
@@ -0,0 +1,159 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "time_zone_posix.h"
+
+#include <cstddef>
+#include <cstring>
+#include <limits>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+const char kDigits[] = "0123456789";
+
+const char* ParseInt(const char* p, int min, int max, int* vp) {
+ int value = 0;
+ const char* op = p;
+ const int kMaxInt = std::numeric_limits<int>::max();
+ for (; const char* dp = strchr(kDigits, *p); ++p) {
+ int d = static_cast<int>(dp - kDigits);
+ if (d >= 10) break; // '\0'
+ if (value > kMaxInt / 10) return nullptr;
+ value *= 10;
+ if (value > kMaxInt - d) return nullptr;
+ value += d;
+ }
+ if (p == op || value < min || value > max) return nullptr;
+ *vp = value;
+ return p;
+}
+
+// abbr = <.*?> | [^-+,\d]{3,}
+const char* ParseAbbr(const char* p, std::string* abbr) {
+ const char* op = p;
+ if (*p == '<') { // special zoneinfo <...> form
+ while (*++p != '>') {
+ if (*p == '\0') return nullptr;
+ }
+ abbr->assign(op + 1, static_cast<std::size_t>(p - op) - 1);
+ return ++p;
+ }
+ while (*p != '\0') {
+ if (strchr("-+,", *p)) break;
+ if (strchr(kDigits, *p)) break;
+ ++p;
+ }
+ if (p - op < 3) return nullptr;
+ abbr->assign(op, static_cast<std::size_t>(p - op));
+ return p;
+}
+
+// offset = [+|-]hh[:mm[:ss]] (aggregated into single seconds value)
+const char* ParseOffset(const char* p, int min_hour, int max_hour, int sign,
+ std::int_fast32_t* offset) {
+ if (p == nullptr) return nullptr;
+ if (*p == '+' || *p == '-') {
+ if (*p++ == '-') sign = -sign;
+ }
+ int hours = 0;
+ int minutes = 0;
+ int seconds = 0;
+
+ p = ParseInt(p, min_hour, max_hour, &hours);
+ if (p == nullptr) return nullptr;
+ if (*p == ':') {
+ p = ParseInt(p + 1, 0, 59, &minutes);
+ if (p == nullptr) return nullptr;
+ if (*p == ':') {
+ p = ParseInt(p + 1, 0, 59, &seconds);
+ if (p == nullptr) return nullptr;
+ }
+ }
+ *offset = sign * ((((hours * 60) + minutes) * 60) + seconds);
+ return p;
+}
+
+// datetime = ( Jn | n | Mm.w.d ) [ / offset ]
+const char* ParseDateTime(const char* p, PosixTransition* res) {
+ if (p != nullptr && *p == ',') {
+ if (*++p == 'M') {
+ int month = 0;
+ if ((p = ParseInt(p + 1, 1, 12, &month)) != nullptr && *p == '.') {
+ int week = 0;
+ if ((p = ParseInt(p + 1, 1, 5, &week)) != nullptr && *p == '.') {
+ int weekday = 0;
+ if ((p = ParseInt(p + 1, 0, 6, &weekday)) != nullptr) {
+ res->date.fmt = PosixTransition::M;
+ res->date.m.month = static_cast<std::int_fast8_t>(month);
+ res->date.m.week = static_cast<std::int_fast8_t>(week);
+ res->date.m.weekday = static_cast<std::int_fast8_t>(weekday);
+ }
+ }
+ }
+ } else if (*p == 'J') {
+ int day = 0;
+ if ((p = ParseInt(p + 1, 1, 365, &day)) != nullptr) {
+ res->date.fmt = PosixTransition::J;
+ res->date.j.day = static_cast<std::int_fast16_t>(day);
+ }
+ } else {
+ int day = 0;
+ if ((p = ParseInt(p, 0, 365, &day)) != nullptr) {
+ res->date.fmt = PosixTransition::N;
+ res->date.n.day = static_cast<std::int_fast16_t>(day);
+ }
+ }
+ }
+ if (p != nullptr) {
+ res->time.offset = 2 * 60 * 60; // default offset is 02:00:00
+ if (*p == '/') p = ParseOffset(p + 1, -167, 167, 1, &res->time.offset);
+ }
+ return p;
+}
+
+} // namespace
+
+// spec = std offset [ dst [ offset ] , datetime , datetime ]
+bool ParsePosixSpec(const std::string& spec, PosixTimeZone* res) {
+ const char* p = spec.c_str();
+ if (*p == ':') return false;
+
+ p = ParseAbbr(p, &res->std_abbr);
+ p = ParseOffset(p, 0, 24, -1, &res->std_offset);
+ if (p == nullptr) return false;
+ if (*p == '\0') return true;
+
+ p = ParseAbbr(p, &res->dst_abbr);
+ if (p == nullptr) return false;
+ res->dst_offset = res->std_offset + (60 * 60); // default
+ if (*p != ',') p = ParseOffset(p, 0, 24, -1, &res->dst_offset);
+
+ p = ParseDateTime(p, &res->dst_start);
+ p = ParseDateTime(p, &res->dst_end);
+
+ return p != nullptr && *p == '\0';
+}
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.h
new file mode 100644
index 0000000000..0cf29055f5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/time_zone_posix.h
@@ -0,0 +1,132 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// Parsing of a POSIX zone spec as described in the TZ part of section 8.3 in
+// http://pubs.opengroup.org/onlinepubs/009695399/basedefs/xbd_chap08.html.
+//
+// The current POSIX spec for America/Los_Angeles is "PST8PDT,M3.2.0,M11.1.0",
+// which would be broken down as ...
+//
+// PosixTimeZone {
+// std_abbr = "PST"
+// std_offset = -28800
+// dst_abbr = "PDT"
+// dst_offset = -25200
+// dst_start = PosixTransition {
+// date {
+// m {
+// month = 3
+// week = 2
+// weekday = 0
+// }
+// }
+// time {
+// offset = 7200
+// }
+// }
+// dst_end = PosixTransition {
+// date {
+// m {
+// month = 11
+// week = 1
+// weekday = 0
+// }
+// }
+// time {
+// offset = 7200
+// }
+// }
+// }
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
+
+#include <cstdint>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// The date/time of the transition. The date is specified as either:
+// (J) the Nth day of the year (1 <= N <= 365), excluding leap days, or
+// (N) the Nth day of the year (0 <= N <= 365), including leap days, or
+// (M) the Nth weekday of a month (e.g., the 2nd Sunday in March).
+// The time, specified as a day offset, identifies the particular moment
+// of the transition, and may be negative or >= 24h, and in which case
+// it would take us to another day, and perhaps week, or even month.
+struct PosixTransition {
+ enum DateFormat { J, N, M };
+
+ struct Date {
+ struct NonLeapDay {
+ std::int_fast16_t day; // day of non-leap year [1:365]
+ };
+ struct Day {
+ std::int_fast16_t day; // day of year [0:365]
+ };
+ struct MonthWeekWeekday {
+ std::int_fast8_t month; // month of year [1:12]
+ std::int_fast8_t week; // week of month [1:5] (5==last)
+ std::int_fast8_t weekday; // 0==Sun, ..., 6=Sat
+ };
+
+ DateFormat fmt;
+
+ union {
+ NonLeapDay j;
+ Day n;
+ MonthWeekWeekday m;
+ };
+ };
+
+ struct Time {
+ std::int_fast32_t offset; // seconds before/after 00:00:00
+ };
+
+ Date date;
+ Time time;
+};
+
+// The entirety of a POSIX-string specified time-zone rule. The standard
+// abbreviation and offset are always given. If the time zone includes
+// daylight saving, then the daylight abbrevation is non-empty and the
+// remaining fields are also valid. Note that the start/end transitions
+// are not ordered---in the southern hemisphere the transition to end
+// daylight time occurs first in any particular year.
+struct PosixTimeZone {
+ std::string std_abbr;
+ std::int_fast32_t std_offset;
+
+ std::string dst_abbr;
+ std::int_fast32_t dst_offset;
+ PosixTransition dst_start;
+ PosixTransition dst_end;
+};
+
+// Breaks down a POSIX time-zone specification into its constituent pieces,
+// filling in any missing values (DST offset, or start/end transition times)
+// with the standard-defined defaults. Returns false if the specification
+// could not be parsed (although some fields of *res may have been altered).
+bool ParsePosixSpec(const std::string& spec, PosixTimeZone* res);
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/tzfile.h b/third_party/abseil-cpp/absl/time/internal/cctz/src/tzfile.h
new file mode 100644
index 0000000000..1ed55e0f95
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/tzfile.h
@@ -0,0 +1,122 @@
+/* Layout and location of TZif files. */
+
+#ifndef TZFILE_H
+
+#define TZFILE_H
+
+/*
+** This file is in the public domain, so clarified as of
+** 1996-06-05 by Arthur David Olson.
+*/
+
+/*
+** This header is for use ONLY with the time conversion code.
+** There is no guarantee that it will remain unchanged,
+** or that it will remain at all.
+** Do NOT copy it to any system include directory.
+** Thank you!
+*/
+
+/*
+** Information about time zone files.
+*/
+
+#ifndef TZDIR
+#define TZDIR "/usr/share/zoneinfo" /* Time zone object file directory */
+#endif /* !defined TZDIR */
+
+#ifndef TZDEFAULT
+#define TZDEFAULT "/etc/localtime"
+#endif /* !defined TZDEFAULT */
+
+#ifndef TZDEFRULES
+#define TZDEFRULES "posixrules"
+#endif /* !defined TZDEFRULES */
+
+/* See Internet RFC 8536 for more details about the following format. */
+
+/*
+** Each file begins with. . .
+*/
+
+#define TZ_MAGIC "TZif"
+
+struct tzhead {
+ char tzh_magic[4]; /* TZ_MAGIC */
+ char tzh_version[1]; /* '\0' or '2' or '3' as of 2013 */
+ char tzh_reserved[15]; /* reserved; must be zero */
+ char tzh_ttisutcnt[4]; /* coded number of trans. time flags */
+ char tzh_ttisstdcnt[4]; /* coded number of trans. time flags */
+ char tzh_leapcnt[4]; /* coded number of leap seconds */
+ char tzh_timecnt[4]; /* coded number of transition times */
+ char tzh_typecnt[4]; /* coded number of local time types */
+ char tzh_charcnt[4]; /* coded number of abbr. chars */
+};
+
+/*
+** . . .followed by. . .
+**
+** tzh_timecnt (char [4])s coded transition times a la time(2)
+** tzh_timecnt (unsigned char)s types of local time starting at above
+** tzh_typecnt repetitions of
+** one (char [4]) coded UT offset in seconds
+** one (unsigned char) used to set tm_isdst
+** one (unsigned char) that's an abbreviation list index
+** tzh_charcnt (char)s '\0'-terminated zone abbreviations
+** tzh_leapcnt repetitions of
+** one (char [4]) coded leap second transition times
+** one (char [4]) total correction after above
+** tzh_ttisstdcnt (char)s indexed by type; if 1, transition
+** time is standard time, if 0,
+** transition time is local (wall clock)
+** time; if absent, transition times are
+** assumed to be local time
+** tzh_ttisutcnt (char)s indexed by type; if 1, transition
+** time is UT, if 0, transition time is
+** local time; if absent, transition
+** times are assumed to be local time.
+** When this is 1, the corresponding
+** std/wall indicator must also be 1.
+*/
+
+/*
+** If tzh_version is '2' or greater, the above is followed by a second instance
+** of tzhead and a second instance of the data in which each coded transition
+** time uses 8 rather than 4 chars,
+** then a POSIX-TZ-environment-variable-style std::string for use in handling
+** instants after the last transition time stored in the file
+** (with nothing between the newlines if there is no POSIX representation for
+** such instants).
+**
+** If tz_version is '3' or greater, the above is extended as follows.
+** First, the POSIX TZ std::string's hour offset may range from -167
+** through 167 as compared to the POSIX-required 0 through 24.
+** Second, its DST start time may be January 1 at 00:00 and its stop
+** time December 31 at 24:00 plus the difference between DST and
+** standard time, indicating DST all year.
+*/
+
+/*
+** In the current implementation, "tzset()" refuses to deal with files that
+** exceed any of the limits below.
+*/
+
+#ifndef TZ_MAX_TIMES
+#define TZ_MAX_TIMES 2000
+#endif /* !defined TZ_MAX_TIMES */
+
+#ifndef TZ_MAX_TYPES
+/* This must be at least 17 for Europe/Samara and Europe/Vilnius. */
+#define TZ_MAX_TYPES 256 /* Limited by what (unsigned char)'s can hold */
+#endif /* !defined TZ_MAX_TYPES */
+
+#ifndef TZ_MAX_CHARS
+#define TZ_MAX_CHARS 50 /* Maximum number of abbreviation characters */
+ /* (limited by what unsigned chars can hold) */
+#endif /* !defined TZ_MAX_CHARS */
+
+#ifndef TZ_MAX_LEAPS
+#define TZ_MAX_LEAPS 50 /* Maximum number of leap second corrections */
+#endif /* !defined TZ_MAX_LEAPS */
+
+#endif /* !defined TZFILE_H */
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/src/zone_info_source.cc b/third_party/abseil-cpp/absl/time/internal/cctz/src/zone_info_source.cc
new file mode 100644
index 0000000000..98ea161267
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/src/zone_info_source.cc
@@ -0,0 +1,115 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Defined out-of-line to avoid emitting a weak vtable in all TUs.
+ZoneInfoSource::~ZoneInfoSource() {}
+std::string ZoneInfoSource::Version() const { return std::string(); }
+
+} // namespace cctz
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz_extension {
+
+namespace {
+
+// A default for cctz_extension::zone_info_source_factory, which simply
+// defers to the fallback factory.
+std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource> DefaultFactory(
+ const std::string& name,
+ const std::function<
+ std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource>(
+ const std::string& name)>& fallback_factory) {
+ return fallback_factory(name);
+}
+
+} // namespace
+
+// A "weak" definition for cctz_extension::zone_info_source_factory.
+// The user may override this with their own "strong" definition (see
+// zone_info_source.h).
+#if !defined(__has_attribute)
+#define __has_attribute(x) 0
+#endif
+// MinGW is GCC on Windows, so while it asserts __has_attribute(weak), the
+// Windows linker cannot handle that. Nor does the MinGW compiler know how to
+// pass "#pragma comment(linker, ...)" to the Windows linker.
+#if (__has_attribute(weak) || defined(__GNUC__)) && !defined(__MINGW32__)
+ZoneInfoSourceFactory zone_info_source_factory __attribute__((weak)) =
+ DefaultFactory;
+#elif defined(_MSC_VER) && !defined(__MINGW32__) && !defined(_LIBCPP_VERSION)
+extern ZoneInfoSourceFactory zone_info_source_factory;
+extern ZoneInfoSourceFactory default_factory;
+ZoneInfoSourceFactory default_factory = DefaultFactory;
+#if defined(_M_IX86)
+#pragma comment( \
+ linker, \
+ "/alternatename:?zone_info_source_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@ABV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@@ZA=?default_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@ABV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@@ZA")
+#elif defined(_M_IA_64) || defined(_M_AMD64) || defined(_M_ARM64)
+#pragma comment( \
+ linker, \
+ "/alternatename:?zone_info_source_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@AEBV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@@ZEA=?default_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@AEBV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS \
+ "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+ "@@ZEA")
+#else
+#error Unsupported MSVC platform
+#endif // _M_<PLATFORM>
+#else
+// Make it a "strong" definition if we have no other choice.
+ZoneInfoSourceFactory zone_info_source_factory = DefaultFactory;
+#endif
+
+} // namespace cctz_extension
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/README.zoneinfo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/README.zoneinfo
new file mode 100644
index 0000000000..95fb4a91d1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/README.zoneinfo
@@ -0,0 +1,37 @@
+testdata/zoneinfo contains time-zone data files that may be used with CCTZ.
+Install them in a location referenced by the ${TZDIR} environment variable.
+Symbolic and hard links have been eliminated for portability.
+
+On Linux systems the distribution's versions of these files can probably
+already be found in the default ${TZDIR} location, /usr/share/zoneinfo.
+
+New versions can be generated using the following shell script.
+
+ #!/bin/sh -
+ set -e
+ DESTDIR=$(mktemp -d)
+ trap "rm -fr ${DESTDIR}" 0 2 15
+ (
+ cd ${DESTDIR}
+ git clone https://github.com/eggert/tz.git
+ make --directory=tz \
+ install DESTDIR=${DESTDIR} \
+ DATAFORM=vanguard \
+ TZDIR=/zoneinfo \
+ REDO=posix_only \
+ LOCALTIME=Factory \
+ TZDATA_TEXT= \
+ ZONETABLES=zone1970.tab
+ tar --create --dereference --hard-dereference --file tzfile.tar \
+ --directory=tz tzfile.h
+ tar --create --dereference --hard-dereference --file zoneinfo.tar \
+ --exclude=zoneinfo/posixrules zoneinfo \
+ --directory=tz version
+ )
+ tar --extract --directory src --file ${DESTDIR}/tzfile.tar
+ tar --extract --directory testdata --file ${DESTDIR}/zoneinfo.tar
+ exit 0
+
+To run the CCTZ tests using the testdata/zoneinfo files, execute:
+
+ bazel test --test_env=TZDIR=${PWD}/testdata/zoneinfo ...
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/version b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/version
new file mode 100644
index 0000000000..db18f8311d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/version
@@ -0,0 +1 @@
+2019c
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra
new file mode 100644
index 0000000000..697b9933eb
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers
new file mode 100644
index 0000000000..ae04342313
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau
new file mode 100644
index 0000000000..82ea5aaf0c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo
new file mode 100644
index 0000000000..d3f819623f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca
new file mode 100644
index 0000000000..245f4ebe18
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta
new file mode 100644
index 0000000000..850c8f06fa
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun
new file mode 100644
index 0000000000..a91f65f242
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg
new file mode 100644
index 0000000000..b1c425dace
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba
new file mode 100644
index 0000000000..625b1acccf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum
new file mode 100644
index 0000000000..8ee8cb92e7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru
new file mode 100644
index 0000000000..b1c425dace
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane
new file mode 100644
index 0000000000..b1c425dace
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia
new file mode 100644
index 0000000000..6d688502a1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena
new file mode 100644
index 0000000000..a968845e29
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome
new file mode 100644
index 0000000000..59f3759c40
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli
new file mode 100644
index 0000000000..07b393bb7d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis
new file mode 100644
index 0000000000..427fa56303
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek
new file mode 100644
index 0000000000..abecd137b1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adak b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adak
new file mode 100644
index 0000000000..43236498f6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adak
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage
new file mode 100644
index 0000000000..9bbb2fd3b3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina
new file mode 100644
index 0000000000..49381b4108
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires
new file mode 100644
index 0000000000..260f86a918
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca
new file mode 100644
index 0000000000..0ae222a2f8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia
new file mode 100644
index 0000000000..0ae222a2f8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba
new file mode 100644
index 0000000000..da4c23a545
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy
new file mode 100644
index 0000000000..604b856636
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja
new file mode 100644
index 0000000000..2218e36bfd
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza
new file mode 100644
index 0000000000..f9e677f171
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos
new file mode 100644
index 0000000000..c36587e1c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta
new file mode 100644
index 0000000000..0e797f2215
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan
new file mode 100644
index 0000000000..2698495bb3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis
new file mode 100644
index 0000000000..fe50f6211c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman
new file mode 100644
index 0000000000..c954000ba9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia
new file mode 100644
index 0000000000..3643628a24
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion
new file mode 100644
index 0000000000..2f3bbda6d3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan
new file mode 100644
index 0000000000..629ed42319
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atka b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atka
new file mode 100644
index 0000000000..43236498f6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atka
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia
new file mode 100644
index 0000000000..15808d30fb
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas
new file mode 100644
index 0000000000..896af3f56a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados
new file mode 100644
index 0000000000..9b90e306a6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belem b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belem
new file mode 100644
index 0000000000..60b5924dc1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belem
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belize b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belize
new file mode 100644
index 0000000000..851051ae94
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belize
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon
new file mode 100644
index 0000000000..f9f13a1679
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista
new file mode 100644
index 0000000000..978c33100f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota
new file mode 100644
index 0000000000..b2647d7a83
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boise b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boise
new file mode 100644
index 0000000000..f8d54e2747
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boise
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires
new file mode 100644
index 0000000000..260f86a918
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay
new file mode 100644
index 0000000000..f8db4b6ebf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande
new file mode 100644
index 0000000000..81206247d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun
new file mode 100644
index 0000000000..f907f0a5ba
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas
new file mode 100644
index 0000000000..eedf725e8d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca
new file mode 100644
index 0000000000..0ae222a2f8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne
new file mode 100644
index 0000000000..e5bc06fdbe
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman
new file mode 100644
index 0000000000..9964b9a334
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago
new file mode 100644
index 0000000000..a5b1617c7f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua
new file mode 100644
index 0000000000..8ed5f93b02
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour
new file mode 100644
index 0000000000..629ed42319
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba
new file mode 100644
index 0000000000..da4c23a545
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica
new file mode 100644
index 0000000000..37cb85e4db
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Creston b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Creston
new file mode 100644
index 0000000000..ca648573e4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Creston
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba
new file mode 100644
index 0000000000..9bea3d4079
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn
new file mode 100644
index 0000000000..9549adcb65
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson
new file mode 100644
index 0000000000..db9ceadd96
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek
new file mode 100644
index 0000000000..db9e339655
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denver b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denver
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denver
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit
new file mode 100644
index 0000000000..e104faa465
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton
new file mode 100644
index 0000000000..cd78a6f8be
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe
new file mode 100644
index 0000000000..39d6daeb9b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador
new file mode 100644
index 0000000000..e2f22304aa
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson
new file mode 100644
index 0000000000..5a0b7f1ca0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza
new file mode 100644
index 0000000000..be57dc20b4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay
new file mode 100644
index 0000000000..48412a4cbf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab
new file mode 100644
index 0000000000..0160308bf6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay
new file mode 100644
index 0000000000..a3f299079a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk
new file mode 100644
index 0000000000..b9bb063b62
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala
new file mode 100644
index 0000000000..407138caf9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil
new file mode 100644
index 0000000000..0559a7a4a4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana
new file mode 100644
index 0000000000..d5dab14969
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax
new file mode 100644
index 0000000000..756099abe6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havana b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havana
new file mode 100644
index 0000000000..b69ac45107
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havana
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo
new file mode 100644
index 0000000000..791a9fa2b3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox
new file mode 100644
index 0000000000..fcd408d74d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo
new file mode 100644
index 0000000000..1abf75e7e8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg
new file mode 100644
index 0000000000..0133548eca
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City
new file mode 100644
index 0000000000..7bbb653cd7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay
new file mode 100644
index 0000000000..d236b7c077
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes
new file mode 100644
index 0000000000..c818929d19
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac
new file mode 100644
index 0000000000..630935c1e1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik
new file mode 100644
index 0000000000..87bb355295
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit
new file mode 100644
index 0000000000..c8138bdbb3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica
new file mode 100644
index 0000000000..2a9b7fd52d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy
new file mode 100644
index 0000000000..604b856636
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau
new file mode 100644
index 0000000000..451f349009
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville
new file mode 100644
index 0000000000..177836e4fd
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello
new file mode 100644
index 0000000000..438e3eab4a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN
new file mode 100644
index 0000000000..fcd408d74d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz
new file mode 100644
index 0000000000..a101372435
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lima b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lima
new file mode 100644
index 0000000000..3c6529b756
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lima
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles
new file mode 100644
index 0000000000..9dad4f4c75
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville
new file mode 100644
index 0000000000..177836e4fd
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio
new file mode 100644
index 0000000000..bc8b951d2e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managua b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managua
new file mode 100644
index 0000000000..e0242bff6e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managua
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus
new file mode 100644
index 0000000000..63d58f80f5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique
new file mode 100644
index 0000000000..8df43dcf1c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros
new file mode 100644
index 0000000000..047968dfff
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan
new file mode 100644
index 0000000000..e4a785743d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza
new file mode 100644
index 0000000000..f9e677f171
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee
new file mode 100644
index 0000000000..314613866d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Merida b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Merida
new file mode 100644
index 0000000000..ea852da33a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Merida
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla
new file mode 100644
index 0000000000..1e94be3d55
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City
new file mode 100644
index 0000000000..e7fb6f2953
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon
new file mode 100644
index 0000000000..b924b71004
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton
new file mode 100644
index 0000000000..9df8d0f2ec
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey
new file mode 100644
index 0000000000..a8928c8dc9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo
new file mode 100644
index 0000000000..2f357bcf50
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal
new file mode 100644
index 0000000000..6752c5b052
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau
new file mode 100644
index 0000000000..33cc6c6265
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_York b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_York
new file mode 100644
index 0000000000..2f75480e06
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_York
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon
new file mode 100644
index 0000000000..f6a856e693
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nome b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nome
new file mode 100644
index 0000000000..10998df3bb
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nome
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha
new file mode 100644
index 0000000000..f140726f2a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah
new file mode 100644
index 0000000000..246345dde7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center
new file mode 100644
index 0000000000..1fa0703778
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem
new file mode 100644
index 0000000000..123f2aeecf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga
new file mode 100644
index 0000000000..fc4a03e369
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panama b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panama
new file mode 100644
index 0000000000..9964b9a334
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panama
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung
new file mode 100644
index 0000000000..3e4e0db6ae
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo
new file mode 100644
index 0000000000..bc8a6edf13
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix
new file mode 100644
index 0000000000..ac6bb0c782
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince
new file mode 100644
index 0000000000..287f143926
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre
new file mode 100644
index 0000000000..a374cb43d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho
new file mode 100644
index 0000000000..2e873a5aa8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico
new file mode 100644
index 0000000000..a662a57137
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas
new file mode 100644
index 0000000000..a5a8af52c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River
new file mode 100644
index 0000000000..ea66099155
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet
new file mode 100644
index 0000000000..3a70587472
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recife b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recife
new file mode 100644
index 0000000000..d7abb168a7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recife
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Regina b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Regina
new file mode 100644
index 0000000000..20c9c84df4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Regina
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute
new file mode 100644
index 0000000000..0a73b753ba
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco
new file mode 100644
index 0000000000..a374cb43d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario
new file mode 100644
index 0000000000..da4c23a545
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem
new file mode 100644
index 0000000000..c28f36063b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago
new file mode 100644
index 0000000000..816a042818
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo
new file mode 100644
index 0000000000..4fe36fd4c1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo
new file mode 100644
index 0000000000..13ff083869
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund
new file mode 100644
index 0000000000..e20e9e1c42
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka
new file mode 100644
index 0000000000..31f7061371
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns
new file mode 100644
index 0000000000..65a5b0c720
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current
new file mode 100644
index 0000000000..8e9ef255ee
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa
new file mode 100644
index 0000000000..2adacb2e50
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thule b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thule
new file mode 100644
index 0000000000..6f802f1c2a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thule
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay
new file mode 100644
index 0000000000..e504c9acf1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto
new file mode 100644
index 0000000000..6752c5b052
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver
new file mode 100644
index 0000000000..bb60cbced3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse
new file mode 100644
index 0000000000..fb3cd71a69
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg
new file mode 100644
index 0000000000..ac40299f6b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat
new file mode 100644
index 0000000000..da209f9f0a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife
new file mode 100644
index 0000000000..e6afa390e8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey
new file mode 100644
index 0000000000..f100f47461
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis
new file mode 100644
index 0000000000..916f2c2592
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville
new file mode 100644
index 0000000000..a71b39c004
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie
new file mode 100644
index 0000000000..616afd9c83
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson
new file mode 100644
index 0000000000..b32e7fd6c6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer
new file mode 100644
index 0000000000..3dd85f84ff
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera
new file mode 100644
index 0000000000..8b2430a20e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa
new file mode 100644
index 0000000000..254af7d12f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll
new file mode 100644
index 0000000000..5e565da2f6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok
new file mode 100644
index 0000000000..728305305d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen
new file mode 100644
index 0000000000..15a34c3ced
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden
new file mode 100644
index 0000000000..2aea25f8c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty
new file mode 100644
index 0000000000..a4b0077900
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman
new file mode 100644
index 0000000000..c9e8707912
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr
new file mode 100644
index 0000000000..6ed8b7cb07
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau
new file mode 100644
index 0000000000..e2d0f91954
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe
new file mode 100644
index 0000000000..06f0a13a66
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat
new file mode 100644
index 0000000000..73891af1ee
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad
new file mode 100644
index 0000000000..73891af1ee
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau
new file mode 100644
index 0000000000..8b5153e054
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad
new file mode 100644
index 0000000000..f7162edf93
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain
new file mode 100644
index 0000000000..63188b269d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku
new file mode 100644
index 0000000000..a0de74b958
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok
new file mode 100644
index 0000000000..c292ac5b5f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul
new file mode 100644
index 0000000000..759592a255
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut
new file mode 100644
index 0000000000..fb266ede22
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek
new file mode 100644
index 0000000000..f6e20dd3a8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei
new file mode 100644
index 0000000000..3dab0abf4e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta
new file mode 100644
index 0000000000..0014046d29
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita
new file mode 100644
index 0000000000..c4149c05ce
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan
new file mode 100644
index 0000000000..e48daa8243
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing
new file mode 100644
index 0000000000..3c0bef2061
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking
new file mode 100644
index 0000000000..3c0bef2061
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo
new file mode 100644
index 0000000000..62c64d85df
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca
new file mode 100644
index 0000000000..b11c928410
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus
new file mode 100644
index 0000000000..d9104a7ab8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka
new file mode 100644
index 0000000000..b11c928410
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili
new file mode 100644
index 0000000000..30943bbd0a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai
new file mode 100644
index 0000000000..fc0a589e2b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe
new file mode 100644
index 0000000000..82d85b8c1b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta
new file mode 100644
index 0000000000..653b146a60
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza
new file mode 100644
index 0000000000..592b632606
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin
new file mode 100644
index 0000000000..3c0bef2061
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron
new file mode 100644
index 0000000000..ae82f9b546
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh
new file mode 100644
index 0000000000..e2934e371b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong
new file mode 100644
index 0000000000..23d0375fba
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd
new file mode 100644
index 0000000000..4cb800a918
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk
new file mode 100644
index 0000000000..4dcbbb7ea2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul
new file mode 100644
index 0000000000..508446bb6a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta
new file mode 100644
index 0000000000..5baa3a8f2e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura
new file mode 100644
index 0000000000..3002c82022
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem
new file mode 100644
index 0000000000..440ef06b5d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul
new file mode 100644
index 0000000000..d19b9bd51d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka
new file mode 100644
index 0000000000..3e80b4e09f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi
new file mode 100644
index 0000000000..ba65c0e8d3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar
new file mode 100644
index 0000000000..faa14d92d5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu
new file mode 100644
index 0000000000..a5d510753f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu
new file mode 100644
index 0000000000..a5d510753f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga
new file mode 100644
index 0000000000..72bea64ba8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata
new file mode 100644
index 0000000000..0014046d29
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk
new file mode 100644
index 0000000000..30c6f16505
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur
new file mode 100644
index 0000000000..612b01e71c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching
new file mode 100644
index 0000000000..c86750cb7d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait
new file mode 100644
index 0000000000..2aea25f8c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao
new file mode 100644
index 0000000000..cac65063d0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau
new file mode 100644
index 0000000000..cac65063d0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan
new file mode 100644
index 0000000000..b4fcac18e3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar
new file mode 100644
index 0000000000..556ba86693
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila
new file mode 100644
index 0000000000..f4f4b04efa
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat
new file mode 100644
index 0000000000..fc0a589e2b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia
new file mode 100644
index 0000000000..f7f10ab766
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk
new file mode 100644
index 0000000000..d983276119
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk
new file mode 100644
index 0000000000..e0ee5fcea9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk
new file mode 100644
index 0000000000..b29b769311
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral
new file mode 100644
index 0000000000..ad1f9ca1ca
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh
new file mode 100644
index 0000000000..c292ac5b5f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak
new file mode 100644
index 0000000000..12ce24cbea
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang
new file mode 100644
index 0000000000..7ad7e0b2cf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar
new file mode 100644
index 0000000000..63188b269d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay
new file mode 100644
index 0000000000..73b9d963ef
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda
new file mode 100644
index 0000000000..c2fe4c144c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon
new file mode 100644
index 0000000000..dd77395b05
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh
new file mode 100644
index 0000000000..2aea25f8c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon
new file mode 100644
index 0000000000..e2934e371b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin
new file mode 100644
index 0000000000..485459ce03
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand
new file mode 100644
index 0000000000..030d47ce07
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul
new file mode 100644
index 0000000000..96199e73e7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai
new file mode 100644
index 0000000000..3c0bef2061
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore
new file mode 100644
index 0000000000..2364b2178b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk
new file mode 100644
index 0000000000..261a9832b3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei
new file mode 100644
index 0000000000..24c43444b6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent
new file mode 100644
index 0000000000..32a9d7d0c9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi
new file mode 100644
index 0000000000..b608d79748
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran
new file mode 100644
index 0000000000..8cec5ad7de
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv
new file mode 100644
index 0000000000..440ef06b5d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu
new file mode 100644
index 0000000000..fe409c7a2a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu
new file mode 100644
index 0000000000..fe409c7a2a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo
new file mode 100644
index 0000000000..26f4d34d67
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk
new file mode 100644
index 0000000000..670e2ad2ce
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang
new file mode 100644
index 0000000000..556ba86693
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar
new file mode 100644
index 0000000000..2e20cc3a43
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator
new file mode 100644
index 0000000000..2e20cc3a43
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi
new file mode 100644
index 0000000000..faa14d92d5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera
new file mode 100644
index 0000000000..9e4a78f6a5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane
new file mode 100644
index 0000000000..c292ac5b5f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok
new file mode 100644
index 0000000000..8ab253ce73
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk
new file mode 100644
index 0000000000..c815e99b1a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon
new file mode 100644
index 0000000000..dd77395b05
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg
new file mode 100644
index 0000000000..6958d7eddd
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan
new file mode 100644
index 0000000000..250bfe020a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores
new file mode 100644
index 0000000000..56593dbfff
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda
new file mode 100644
index 0000000000..419c660ba7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary
new file mode 100644
index 0000000000..f3192156ff
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde
new file mode 100644
index 0000000000..e2a49d248d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe
new file mode 100644
index 0000000000..4dab7ef085
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe
new file mode 100644
index 0000000000..4dab7ef085
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen
new file mode 100644
index 0000000000..15a34c3ced
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira
new file mode 100644
index 0000000000..5213761f89
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik
new file mode 100644
index 0000000000..10e0fc8190
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia
new file mode 100644
index 0000000000..4466608612
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley
new file mode 100644
index 0000000000..88077f1107
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide
new file mode 100644
index 0000000000..0b1252abb7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane
new file mode 100644
index 0000000000..3021bdb614
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill
new file mode 100644
index 0000000000..1ac3fc8f52
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie
new file mode 100644
index 0000000000..f65a990efe
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin
new file mode 100644
index 0000000000..1cf502984a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla
new file mode 100644
index 0000000000..98ae557064
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart
new file mode 100644
index 0000000000..02b07ca232
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI
new file mode 100644
index 0000000000..9e04a80ece
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman
new file mode 100644
index 0000000000..eab0fb998a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe
new file mode 100644
index 0000000000..9e04a80ece
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne
new file mode 100644
index 0000000000..ba457338ba
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/North b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/North
new file mode 100644
index 0000000000..1cf502984a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/North
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth
new file mode 100644
index 0000000000..a876b9e785
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland
new file mode 100644
index 0000000000..3021bdb614
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/South b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/South
new file mode 100644
index 0000000000..0b1252abb7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/South
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania
new file mode 100644
index 0000000000..02b07ca232
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria
new file mode 100644
index 0000000000..ba457338ba
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/West b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/West
new file mode 100644
index 0000000000..a876b9e785
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/West
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna
new file mode 100644
index 0000000000..1ac3fc8f52
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre
new file mode 100644
index 0000000000..a374cb43d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha
new file mode 100644
index 0000000000..f140726f2a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East
new file mode 100644
index 0000000000..13ff083869
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West
new file mode 100644
index 0000000000..63d58f80f5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CET b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CET
new file mode 100644
index 0000000000..122e934210
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CET
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT
new file mode 100644
index 0000000000..ca67929fbe
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic
new file mode 100644
index 0000000000..756099abe6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central
new file mode 100644
index 0000000000..ac40299f6b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern
new file mode 100644
index 0000000000..6752c5b052
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain
new file mode 100644
index 0000000000..cd78a6f8be
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland
new file mode 100644
index 0000000000..65a5b0c720
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific
new file mode 100644
index 0000000000..bb60cbced3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan
new file mode 100644
index 0000000000..20c9c84df4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon
new file mode 100644
index 0000000000..fb3cd71a69
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental
new file mode 100644
index 0000000000..816a042818
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland
new file mode 100644
index 0000000000..cae3744096
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Cuba b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Cuba
new file mode 100644
index 0000000000..b69ac45107
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Cuba
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EET b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EET
new file mode 100644
index 0000000000..cbdb71ddd3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EET
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST
new file mode 100644
index 0000000000..21ebc00b3f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT
new file mode 100644
index 0000000000..9bce5007d4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Egypt b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Egypt
new file mode 100644
index 0000000000..d3f819623f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Egypt
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Eire b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Eire
new file mode 100644
index 0000000000..1d994902db
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Eire
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1
new file mode 100644
index 0000000000..4dab6f9005
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10
new file mode 100644
index 0000000000..c749290af2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11
new file mode 100644
index 0000000000..d969982309
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12
new file mode 100644
index 0000000000..cdeec90973
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2
new file mode 100644
index 0000000000..fbd2a941fd
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3
new file mode 100644
index 0000000000..ee246ef56f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4
new file mode 100644
index 0000000000..5a25ff2a6a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5
new file mode 100644
index 0000000000..c0b745f1cc
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6
new file mode 100644
index 0000000000..06e777d57e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7
new file mode 100644
index 0000000000..4e0b53a082
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8
new file mode 100644
index 0000000000..714b0c5628
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9
new file mode 100644
index 0000000000..78b9daa373
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1
new file mode 100644
index 0000000000..a838bebf5e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10
new file mode 100644
index 0000000000..68ff77db0d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11
new file mode 100644
index 0000000000..66af5a42be
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12
new file mode 100644
index 0000000000..17ba505772
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13
new file mode 100644
index 0000000000..5f3706ce64
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14
new file mode 100644
index 0000000000..7e9f9c465c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2
new file mode 100644
index 0000000000..fcef6d9acb
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3
new file mode 100644
index 0000000000..27973bc857
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4
new file mode 100644
index 0000000000..1efd841261
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5
new file mode 100644
index 0000000000..1f761844fc
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6
new file mode 100644
index 0000000000..952681ed46
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7
new file mode 100644
index 0000000000..cefc9126c6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8
new file mode 100644
index 0000000000..afb093da00
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9
new file mode 100644
index 0000000000..9265fb7c20
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam
new file mode 100644
index 0000000000..c3ff07b436
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra
new file mode 100644
index 0000000000..5962550392
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan
new file mode 100644
index 0000000000..73a4d013fc
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens
new file mode 100644
index 0000000000..9f3a0678d7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin
new file mode 100644
index 0000000000..7f6d958f86
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava
new file mode 100644
index 0000000000..ce8f433ece
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels
new file mode 100644
index 0000000000..40d7124e53
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest
new file mode 100644
index 0000000000..4303b903e5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest
new file mode 100644
index 0000000000..6b94a4f312
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen
new file mode 100644
index 0000000000..ad6cf59281
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau
new file mode 100644
index 0000000000..5ee23fe0e5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen
new file mode 100644
index 0000000000..776be6e4a6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin
new file mode 100644
index 0000000000..1d994902db
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar
new file mode 100644
index 0000000000..117aadb836
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki
new file mode 100644
index 0000000000..b4f8f9cbb5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul
new file mode 100644
index 0000000000..508446bb6a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad
new file mode 100644
index 0000000000..cc99beabe4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev
new file mode 100644
index 0000000000..9337c9ea27
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov
new file mode 100644
index 0000000000..a3b5320a0b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon
new file mode 100644
index 0000000000..355817b52b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/London b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/London
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/London
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg
new file mode 100644
index 0000000000..c4ca733f53
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid
new file mode 100644
index 0000000000..16f6420ab7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta
new file mode 100644
index 0000000000..bf2452da40
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn
new file mode 100644
index 0000000000..b4f8f9cbb5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk
new file mode 100644
index 0000000000..453306c075
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco
new file mode 100644
index 0000000000..686ae88315
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow
new file mode 100644
index 0000000000..ddb3f4e99a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia
new file mode 100644
index 0000000000..f7f10ab766
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo
new file mode 100644
index 0000000000..15a34c3ced
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris
new file mode 100644
index 0000000000..ca85435168
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague
new file mode 100644
index 0000000000..ce8f433ece
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga
new file mode 100644
index 0000000000..8db477d017
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome
new file mode 100644
index 0000000000..ac4c16342b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara
new file mode 100644
index 0000000000..97d5dd9e6e
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino
new file mode 100644
index 0000000000..ac4c16342b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov
new file mode 100644
index 0000000000..8fd5f6d4b8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol
new file mode 100644
index 0000000000..432e8315bc
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia
new file mode 100644
index 0000000000..0e4d879332
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm
new file mode 100644
index 0000000000..f3e0c7f0f2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn
new file mode 100644
index 0000000000..b5acca3cf5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane
new file mode 100644
index 0000000000..0b86017d24
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol
new file mode 100644
index 0000000000..5ee23fe0e5
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk
new file mode 100644
index 0000000000..7b61bdc522
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod
new file mode 100644
index 0000000000..66ae8d69e3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz
new file mode 100644
index 0000000000..ad6cf59281
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican
new file mode 100644
index 0000000000..ac4c16342b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna
new file mode 100644
index 0000000000..3582bb15cd
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius
new file mode 100644
index 0000000000..7abd63fa60
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd
new file mode 100644
index 0000000000..d1cfac0e38
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw
new file mode 100644
index 0000000000..e33cf67171
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye
new file mode 100644
index 0000000000..e42edfc850
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich
new file mode 100644
index 0000000000..ad6cf59281
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Factory b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Factory
new file mode 100644
index 0000000000..60aa2a0d69
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Factory
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0 b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwich b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwich
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwich
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/HST b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/HST
new file mode 100644
index 0000000000..cccd45eb8c
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/HST
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkong b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkong
new file mode 100644
index 0000000000..23d0375fba
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkong
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iceland b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iceland
new file mode 100644
index 0000000000..10e0fc8190
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iceland
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos
new file mode 100644
index 0000000000..93d6dda50f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas
new file mode 100644
index 0000000000..d18c3810d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos
new file mode 100644
index 0000000000..f8116e7025
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen
new file mode 100644
index 0000000000..cde4cf7ea7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe
new file mode 100644
index 0000000000..cba7dfe735
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives
new file mode 100644
index 0000000000..7c839cfa9b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius
new file mode 100644
index 0000000000..17f2616990
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion
new file mode 100644
index 0000000000..dfe08313df
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iran b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iran
new file mode 100644
index 0000000000..8cec5ad7de
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Iran
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Israel b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Israel
new file mode 100644
index 0000000000..440ef06b5d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Israel
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaica b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaica
new file mode 100644
index 0000000000..2a9b7fd52d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaica
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Japan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Japan
new file mode 100644
index 0000000000..26f4d34d67
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Japan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein
new file mode 100644
index 0000000000..1a7975fad7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Libya b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Libya
new file mode 100644
index 0000000000..07b393bb7d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Libya
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MET b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MET
new file mode 100644
index 0000000000..4a826bb185
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MET
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST
new file mode 100644
index 0000000000..c93a58eee8
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT
new file mode 100644
index 0000000000..4506a6e150
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur
new file mode 100644
index 0000000000..e4a785743d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General
new file mode 100644
index 0000000000..e7fb6f2953
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT
new file mode 100644
index 0000000000..c004109882
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajo
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PRC b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PRC
new file mode 100644
index 0000000000..3c0bef2061
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PRC
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT
new file mode 100644
index 0000000000..99d246baa3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia
new file mode 100644
index 0000000000..dab1f3f602
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville
new file mode 100644
index 0000000000..2892d26809
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham
new file mode 100644
index 0000000000..c004109882
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk
new file mode 100644
index 0000000000..07c84b7110
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter
new file mode 100644
index 0000000000..cae3744096
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate
new file mode 100644
index 0000000000..60150175c0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury
new file mode 100644
index 0000000000..f0b8252362
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo
new file mode 100644
index 0000000000..e40307f6aa
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji
new file mode 100644
index 0000000000..d39bf53645
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti
new file mode 100644
index 0000000000..ea728637ac
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos
new file mode 100644
index 0000000000..31f0921ea0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier
new file mode 100644
index 0000000000..e1fc3daa55
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal
new file mode 100644
index 0000000000..7e9d10a100
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam
new file mode 100644
index 0000000000..66490d25df
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu
new file mode 100644
index 0000000000..c7cd060159
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston
new file mode 100644
index 0000000000..c7cd060159
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati
new file mode 100644
index 0000000000..7cae0cb756
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae
new file mode 100644
index 0000000000..a584aae5eb
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein
new file mode 100644
index 0000000000..1a7975fad7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro
new file mode 100644
index 0000000000..9ef8374de4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas
new file mode 100644
index 0000000000..74d6792bf6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru
new file mode 100644
index 0000000000..acec0429f1
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue
new file mode 100644
index 0000000000..684b010e8b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk
new file mode 100644
index 0000000000..53c1aad4e0
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea
new file mode 100644
index 0000000000..931a1a306f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau
new file mode 100644
index 0000000000..146b35152a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn
new file mode 100644
index 0000000000..ef91b061bb
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei
new file mode 100644
index 0000000000..c298ddd4de
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape
new file mode 100644
index 0000000000..c298ddd4de
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby
new file mode 100644
index 0000000000..920ad27e62
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga
new file mode 100644
index 0000000000..da6b0fadea
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan
new file mode 100644
index 0000000000..66490d25df
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti
new file mode 100644
index 0000000000..442b8eb5a4
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa
new file mode 100644
index 0000000000..3db6c75033
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu
new file mode 100644
index 0000000000..5553c6009a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk
new file mode 100644
index 0000000000..07c84b7110
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake
new file mode 100644
index 0000000000..c9e310670f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis
new file mode 100644
index 0000000000..b35344b312
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap
new file mode 100644
index 0000000000..07c84b7110
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Poland b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Poland
new file mode 100644
index 0000000000..e33cf67171
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Poland
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugal b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugal
new file mode 100644
index 0000000000..355817b52b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugal
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROC b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROC
new file mode 100644
index 0000000000..24c43444b6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROC
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROK b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROK
new file mode 100644
index 0000000000..96199e73e7
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/ROK
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Singapore b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Singapore
new file mode 100644
index 0000000000..2364b2178b
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Singapore
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkey b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkey
new file mode 100644
index 0000000000..508446bb6a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkey
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UCT b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UCT
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UCT
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska
new file mode 100644
index 0000000000..9bbb2fd3b3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian
new file mode 100644
index 0000000000..43236498f6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona
new file mode 100644
index 0000000000..ac6bb0c782
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Central b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Central
new file mode 100644
index 0000000000..a5b1617c7f
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Central
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern
new file mode 100644
index 0000000000..2f75480e06
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii
new file mode 100644
index 0000000000..c7cd060159
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke
new file mode 100644
index 0000000000..fcd408d74d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan
new file mode 100644
index 0000000000..e104faa465
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific
new file mode 100644
index 0000000000..9dad4f4c75
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UTC b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UTC
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/UTC
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Universal b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Universal
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Universal
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SU b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SU
new file mode 100644
index 0000000000..ddb3f4e99a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SU
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/WET b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/WET
new file mode 100644
index 0000000000..c27390b5b6
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/WET
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulu b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulu
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulu
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab
new file mode 100644
index 0000000000..a4ff61a4d3
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab
@@ -0,0 +1,274 @@
+# ISO 3166 alpha-2 country codes
+#
+# This file is in the public domain, so clarified as of
+# 2009-05-17 by Arthur David Olson.
+#
+# From Paul Eggert (2015-05-02):
+# This file contains a table of two-letter country codes. Columns are
+# separated by a single tab. Lines beginning with '#' are comments.
+# All text uses UTF-8 encoding. The columns of the table are as follows:
+#
+# 1. ISO 3166-1 alpha-2 country code, current as of
+# ISO 3166-1 N976 (2018-11-06). See: Updates on ISO 3166-1
+# https://isotc.iso.org/livelink/livelink/Open/16944257
+# 2. The usual English name for the coded region,
+# chosen so that alphabetic sorting of subsets produces helpful lists.
+# This is not the same as the English name in the ISO 3166 tables.
+#
+# The table is sorted by country code.
+#
+# This table is intended as an aid for users, to help them select time
+# zone data appropriate for their practical needs. It is not intended
+# to take or endorse any position on legal or territorial claims.
+#
+#country-
+#code name of country, territory, area, or subdivision
+AD Andorra
+AE United Arab Emirates
+AF Afghanistan
+AG Antigua & Barbuda
+AI Anguilla
+AL Albania
+AM Armenia
+AO Angola
+AQ Antarctica
+AR Argentina
+AS Samoa (American)
+AT Austria
+AU Australia
+AW Aruba
+AX Ã…land Islands
+AZ Azerbaijan
+BA Bosnia & Herzegovina
+BB Barbados
+BD Bangladesh
+BE Belgium
+BF Burkina Faso
+BG Bulgaria
+BH Bahrain
+BI Burundi
+BJ Benin
+BL St Barthelemy
+BM Bermuda
+BN Brunei
+BO Bolivia
+BQ Caribbean NL
+BR Brazil
+BS Bahamas
+BT Bhutan
+BV Bouvet Island
+BW Botswana
+BY Belarus
+BZ Belize
+CA Canada
+CC Cocos (Keeling) Islands
+CD Congo (Dem. Rep.)
+CF Central African Rep.
+CG Congo (Rep.)
+CH Switzerland
+CI Côte d'Ivoire
+CK Cook Islands
+CL Chile
+CM Cameroon
+CN China
+CO Colombia
+CR Costa Rica
+CU Cuba
+CV Cape Verde
+CW Curaçao
+CX Christmas Island
+CY Cyprus
+CZ Czech Republic
+DE Germany
+DJ Djibouti
+DK Denmark
+DM Dominica
+DO Dominican Republic
+DZ Algeria
+EC Ecuador
+EE Estonia
+EG Egypt
+EH Western Sahara
+ER Eritrea
+ES Spain
+ET Ethiopia
+FI Finland
+FJ Fiji
+FK Falkland Islands
+FM Micronesia
+FO Faroe Islands
+FR France
+GA Gabon
+GB Britain (UK)
+GD Grenada
+GE Georgia
+GF French Guiana
+GG Guernsey
+GH Ghana
+GI Gibraltar
+GL Greenland
+GM Gambia
+GN Guinea
+GP Guadeloupe
+GQ Equatorial Guinea
+GR Greece
+GS South Georgia & the South Sandwich Islands
+GT Guatemala
+GU Guam
+GW Guinea-Bissau
+GY Guyana
+HK Hong Kong
+HM Heard Island & McDonald Islands
+HN Honduras
+HR Croatia
+HT Haiti
+HU Hungary
+ID Indonesia
+IE Ireland
+IL Israel
+IM Isle of Man
+IN India
+IO British Indian Ocean Territory
+IQ Iraq
+IR Iran
+IS Iceland
+IT Italy
+JE Jersey
+JM Jamaica
+JO Jordan
+JP Japan
+KE Kenya
+KG Kyrgyzstan
+KH Cambodia
+KI Kiribati
+KM Comoros
+KN St Kitts & Nevis
+KP Korea (North)
+KR Korea (South)
+KW Kuwait
+KY Cayman Islands
+KZ Kazakhstan
+LA Laos
+LB Lebanon
+LC St Lucia
+LI Liechtenstein
+LK Sri Lanka
+LR Liberia
+LS Lesotho
+LT Lithuania
+LU Luxembourg
+LV Latvia
+LY Libya
+MA Morocco
+MC Monaco
+MD Moldova
+ME Montenegro
+MF St Martin (French)
+MG Madagascar
+MH Marshall Islands
+MK North Macedonia
+ML Mali
+MM Myanmar (Burma)
+MN Mongolia
+MO Macau
+MP Northern Mariana Islands
+MQ Martinique
+MR Mauritania
+MS Montserrat
+MT Malta
+MU Mauritius
+MV Maldives
+MW Malawi
+MX Mexico
+MY Malaysia
+MZ Mozambique
+NA Namibia
+NC New Caledonia
+NE Niger
+NF Norfolk Island
+NG Nigeria
+NI Nicaragua
+NL Netherlands
+NO Norway
+NP Nepal
+NR Nauru
+NU Niue
+NZ New Zealand
+OM Oman
+PA Panama
+PE Peru
+PF French Polynesia
+PG Papua New Guinea
+PH Philippines
+PK Pakistan
+PL Poland
+PM St Pierre & Miquelon
+PN Pitcairn
+PR Puerto Rico
+PS Palestine
+PT Portugal
+PW Palau
+PY Paraguay
+QA Qatar
+RE Réunion
+RO Romania
+RS Serbia
+RU Russia
+RW Rwanda
+SA Saudi Arabia
+SB Solomon Islands
+SC Seychelles
+SD Sudan
+SE Sweden
+SG Singapore
+SH St Helena
+SI Slovenia
+SJ Svalbard & Jan Mayen
+SK Slovakia
+SL Sierra Leone
+SM San Marino
+SN Senegal
+SO Somalia
+SR Suriname
+SS South Sudan
+ST Sao Tome & Principe
+SV El Salvador
+SX St Maarten (Dutch)
+SY Syria
+SZ Eswatini (Swaziland)
+TC Turks & Caicos Is
+TD Chad
+TF French Southern & Antarctic Lands
+TG Togo
+TH Thailand
+TJ Tajikistan
+TK Tokelau
+TL East Timor
+TM Turkmenistan
+TN Tunisia
+TO Tonga
+TR Turkey
+TT Trinidad & Tobago
+TV Tuvalu
+TW Taiwan
+TZ Tanzania
+UA Ukraine
+UG Uganda
+UM US minor outlying islands
+US United States
+UY Uruguay
+UZ Uzbekistan
+VA Vatican City
+VC St Vincent
+VE Venezuela
+VG Virgin Islands (UK)
+VI Virgin Islands (US)
+VN Vietnam
+VU Vanuatu
+WF Wallis & Futuna
+WS Samoa (western)
+YE Yemen
+YT Mayotte
+ZA South Africa
+ZM Zambia
+ZW Zimbabwe
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/localtime b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/localtime
new file mode 100644
index 0000000000..afeeb88d06
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/localtime
Binary files differ
diff --git a/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab
new file mode 100644
index 0000000000..822ffa1f1a
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab
@@ -0,0 +1,384 @@
+# tzdb timezone descriptions
+#
+# This file is in the public domain.
+#
+# From Paul Eggert (2018-06-27):
+# This file contains a table where each row stands for a timezone where
+# civil timestamps have agreed since 1970. Columns are separated by
+# a single tab. Lines beginning with '#' are comments. All text uses
+# UTF-8 encoding. The columns of the table are as follows:
+#
+# 1. The countries that overlap the timezone, as a comma-separated list
+# of ISO 3166 2-character country codes. See the file 'iso3166.tab'.
+# 2. Latitude and longitude of the timezone's principal location
+# in ISO 6709 sign-degrees-minutes-seconds format,
+# either ±DDMM±DDDMM or ±DDMMSS±DDDMMSS,
+# first latitude (+ is north), then longitude (+ is east).
+# 3. Timezone name used in value of TZ environment variable.
+# Please see the theory.html file for how these names are chosen.
+# If multiple timezones overlap a country, each has a row in the
+# table, with each column 1 containing the country code.
+# 4. Comments; present if and only if a country has multiple timezones.
+#
+# If a timezone covers multiple countries, the most-populous city is used,
+# and that country is listed first in column 1; any other countries
+# are listed alphabetically by country code. The table is sorted
+# first by country code, then (if possible) by an order within the
+# country that (1) makes some geographical sense, and (2) puts the
+# most populous timezones first, where that does not contradict (1).
+#
+# This table is intended as an aid for users, to help them select timezones
+# appropriate for their practical needs. It is not intended to take or
+# endorse any position on legal or territorial claims.
+#
+#country-
+#codes coordinates TZ comments
+AD +4230+00131 Europe/Andorra
+AE,OM +2518+05518 Asia/Dubai
+AF +3431+06912 Asia/Kabul
+AL +4120+01950 Europe/Tirane
+AM +4011+04430 Asia/Yerevan
+AQ -6617+11031 Antarctica/Casey Casey
+AQ -6835+07758 Antarctica/Davis Davis
+AQ -6640+14001 Antarctica/DumontDUrville Dumont-d'Urville
+AQ -6736+06253 Antarctica/Mawson Mawson
+AQ -6448-06406 Antarctica/Palmer Palmer
+AQ -6734-06808 Antarctica/Rothera Rothera
+AQ -690022+0393524 Antarctica/Syowa Syowa
+AQ -720041+0023206 Antarctica/Troll Troll
+AQ -7824+10654 Antarctica/Vostok Vostok
+AR -3436-05827 America/Argentina/Buenos_Aires Buenos Aires (BA, CF)
+AR -3124-06411 America/Argentina/Cordoba Argentina (most areas: CB, CC, CN, ER, FM, MN, SE, SF)
+AR -2447-06525 America/Argentina/Salta Salta (SA, LP, NQ, RN)
+AR -2411-06518 America/Argentina/Jujuy Jujuy (JY)
+AR -2649-06513 America/Argentina/Tucuman Tucumán (TM)
+AR -2828-06547 America/Argentina/Catamarca Catamarca (CT); Chubut (CH)
+AR -2926-06651 America/Argentina/La_Rioja La Rioja (LR)
+AR -3132-06831 America/Argentina/San_Juan San Juan (SJ)
+AR -3253-06849 America/Argentina/Mendoza Mendoza (MZ)
+AR -3319-06621 America/Argentina/San_Luis San Luis (SL)
+AR -5138-06913 America/Argentina/Rio_Gallegos Santa Cruz (SC)
+AR -5448-06818 America/Argentina/Ushuaia Tierra del Fuego (TF)
+AS,UM -1416-17042 Pacific/Pago_Pago Samoa, Midway
+AT +4813+01620 Europe/Vienna
+AU -3133+15905 Australia/Lord_Howe Lord Howe Island
+AU -5430+15857 Antarctica/Macquarie Macquarie Island
+AU -4253+14719 Australia/Hobart Tasmania (most areas)
+AU -3956+14352 Australia/Currie Tasmania (King Island)
+AU -3749+14458 Australia/Melbourne Victoria
+AU -3352+15113 Australia/Sydney New South Wales (most areas)
+AU -3157+14127 Australia/Broken_Hill New South Wales (Yancowinna)
+AU -2728+15302 Australia/Brisbane Queensland (most areas)
+AU -2016+14900 Australia/Lindeman Queensland (Whitsunday Islands)
+AU -3455+13835 Australia/Adelaide South Australia
+AU -1228+13050 Australia/Darwin Northern Territory
+AU -3157+11551 Australia/Perth Western Australia (most areas)
+AU -3143+12852 Australia/Eucla Western Australia (Eucla)
+AZ +4023+04951 Asia/Baku
+BB +1306-05937 America/Barbados
+BD +2343+09025 Asia/Dhaka
+BE +5050+00420 Europe/Brussels
+BG +4241+02319 Europe/Sofia
+BM +3217-06446 Atlantic/Bermuda
+BN +0456+11455 Asia/Brunei
+BO -1630-06809 America/La_Paz
+BR -0351-03225 America/Noronha Atlantic islands
+BR -0127-04829 America/Belem Pará (east); Amapá
+BR -0343-03830 America/Fortaleza Brazil (northeast: MA, PI, CE, RN, PB)
+BR -0803-03454 America/Recife Pernambuco
+BR -0712-04812 America/Araguaina Tocantins
+BR -0940-03543 America/Maceio Alagoas, Sergipe
+BR -1259-03831 America/Bahia Bahia
+BR -2332-04637 America/Sao_Paulo Brazil (southeast: GO, DF, MG, ES, RJ, SP, PR, SC, RS)
+BR -2027-05437 America/Campo_Grande Mato Grosso do Sul
+BR -1535-05605 America/Cuiaba Mato Grosso
+BR -0226-05452 America/Santarem Pará (west)
+BR -0846-06354 America/Porto_Velho Rondônia
+BR +0249-06040 America/Boa_Vista Roraima
+BR -0308-06001 America/Manaus Amazonas (east)
+BR -0640-06952 America/Eirunepe Amazonas (west)
+BR -0958-06748 America/Rio_Branco Acre
+BS +2505-07721 America/Nassau
+BT +2728+08939 Asia/Thimphu
+BY +5354+02734 Europe/Minsk
+BZ +1730-08812 America/Belize
+CA +4734-05243 America/St_Johns Newfoundland; Labrador (southeast)
+CA +4439-06336 America/Halifax Atlantic - NS (most areas); PE
+CA +4612-05957 America/Glace_Bay Atlantic - NS (Cape Breton)
+CA +4606-06447 America/Moncton Atlantic - New Brunswick
+CA +5320-06025 America/Goose_Bay Atlantic - Labrador (most areas)
+CA +5125-05707 America/Blanc-Sablon AST - QC (Lower North Shore)
+CA +4339-07923 America/Toronto Eastern - ON, QC (most areas)
+CA +4901-08816 America/Nipigon Eastern - ON, QC (no DST 1967-73)
+CA +4823-08915 America/Thunder_Bay Eastern - ON (Thunder Bay)
+CA +6344-06828 America/Iqaluit Eastern - NU (most east areas)
+CA +6608-06544 America/Pangnirtung Eastern - NU (Pangnirtung)
+CA +484531-0913718 America/Atikokan EST - ON (Atikokan); NU (Coral H)
+CA +4953-09709 America/Winnipeg Central - ON (west); Manitoba
+CA +4843-09434 America/Rainy_River Central - ON (Rainy R, Ft Frances)
+CA +744144-0944945 America/Resolute Central - NU (Resolute)
+CA +624900-0920459 America/Rankin_Inlet Central - NU (central)
+CA +5024-10439 America/Regina CST - SK (most areas)
+CA +5017-10750 America/Swift_Current CST - SK (midwest)
+CA +5333-11328 America/Edmonton Mountain - AB; BC (E); SK (W)
+CA +690650-1050310 America/Cambridge_Bay Mountain - NU (west)
+CA +6227-11421 America/Yellowknife Mountain - NT (central)
+CA +682059-1334300 America/Inuvik Mountain - NT (west)
+CA +4906-11631 America/Creston MST - BC (Creston)
+CA +5946-12014 America/Dawson_Creek MST - BC (Dawson Cr, Ft St John)
+CA +5848-12242 America/Fort_Nelson MST - BC (Ft Nelson)
+CA +4916-12307 America/Vancouver Pacific - BC (most areas)
+CA +6043-13503 America/Whitehorse Pacific - Yukon (south)
+CA +6404-13925 America/Dawson Pacific - Yukon (north)
+CC -1210+09655 Indian/Cocos
+CH,DE,LI +4723+00832 Europe/Zurich Swiss time
+CI,BF,GM,GN,ML,MR,SH,SL,SN,TG +0519-00402 Africa/Abidjan
+CK -2114-15946 Pacific/Rarotonga
+CL -3327-07040 America/Santiago Chile (most areas)
+CL -5309-07055 America/Punta_Arenas Region of Magallanes
+CL -2709-10926 Pacific/Easter Easter Island
+CN +3114+12128 Asia/Shanghai Beijing Time
+CN +4348+08735 Asia/Urumqi Xinjiang Time
+CO +0436-07405 America/Bogota
+CR +0956-08405 America/Costa_Rica
+CU +2308-08222 America/Havana
+CV +1455-02331 Atlantic/Cape_Verde
+CW,AW,BQ,SX +1211-06900 America/Curacao
+CX -1025+10543 Indian/Christmas
+CY +3510+03322 Asia/Nicosia Cyprus (most areas)
+CY +3507+03357 Asia/Famagusta Northern Cyprus
+CZ,SK +5005+01426 Europe/Prague
+DE +5230+01322 Europe/Berlin Germany (most areas)
+DK +5540+01235 Europe/Copenhagen
+DO +1828-06954 America/Santo_Domingo
+DZ +3647+00303 Africa/Algiers
+EC -0210-07950 America/Guayaquil Ecuador (mainland)
+EC -0054-08936 Pacific/Galapagos Galápagos Islands
+EE +5925+02445 Europe/Tallinn
+EG +3003+03115 Africa/Cairo
+EH +2709-01312 Africa/El_Aaiun
+ES +4024-00341 Europe/Madrid Spain (mainland)
+ES +3553-00519 Africa/Ceuta Ceuta, Melilla
+ES +2806-01524 Atlantic/Canary Canary Islands
+FI,AX +6010+02458 Europe/Helsinki
+FJ -1808+17825 Pacific/Fiji
+FK -5142-05751 Atlantic/Stanley
+FM +0725+15147 Pacific/Chuuk Chuuk/Truk, Yap
+FM +0658+15813 Pacific/Pohnpei Pohnpei/Ponape
+FM +0519+16259 Pacific/Kosrae Kosrae
+FO +6201-00646 Atlantic/Faroe
+FR +4852+00220 Europe/Paris
+GB,GG,IM,JE +513030-0000731 Europe/London
+GE +4143+04449 Asia/Tbilisi
+GF +0456-05220 America/Cayenne
+GH +0533-00013 Africa/Accra
+GI +3608-00521 Europe/Gibraltar
+GL +6411-05144 America/Godthab Greenland (most areas)
+GL +7646-01840 America/Danmarkshavn National Park (east coast)
+GL +7029-02158 America/Scoresbysund Scoresbysund/Ittoqqortoormiit
+GL +7634-06847 America/Thule Thule/Pituffik
+GR +3758+02343 Europe/Athens
+GS -5416-03632 Atlantic/South_Georgia
+GT +1438-09031 America/Guatemala
+GU,MP +1328+14445 Pacific/Guam
+GW +1151-01535 Africa/Bissau
+GY +0648-05810 America/Guyana
+HK +2217+11409 Asia/Hong_Kong
+HN +1406-08713 America/Tegucigalpa
+HT +1832-07220 America/Port-au-Prince
+HU +4730+01905 Europe/Budapest
+ID -0610+10648 Asia/Jakarta Java, Sumatra
+ID -0002+10920 Asia/Pontianak Borneo (west, central)
+ID -0507+11924 Asia/Makassar Borneo (east, south); Sulawesi/Celebes, Bali, Nusa Tengarra; Timor (west)
+ID -0232+14042 Asia/Jayapura New Guinea (West Papua / Irian Jaya); Malukus/Moluccas
+IE +5320-00615 Europe/Dublin
+IL +314650+0351326 Asia/Jerusalem
+IN +2232+08822 Asia/Kolkata
+IO -0720+07225 Indian/Chagos
+IQ +3321+04425 Asia/Baghdad
+IR +3540+05126 Asia/Tehran
+IS +6409-02151 Atlantic/Reykjavik
+IT,SM,VA +4154+01229 Europe/Rome
+JM +175805-0764736 America/Jamaica
+JO +3157+03556 Asia/Amman
+JP +353916+1394441 Asia/Tokyo
+KE,DJ,ER,ET,KM,MG,SO,TZ,UG,YT -0117+03649 Africa/Nairobi
+KG +4254+07436 Asia/Bishkek
+KI +0125+17300 Pacific/Tarawa Gilbert Islands
+KI -0308-17105 Pacific/Enderbury Phoenix Islands
+KI +0152-15720 Pacific/Kiritimati Line Islands
+KP +3901+12545 Asia/Pyongyang
+KR +3733+12658 Asia/Seoul
+KZ +4315+07657 Asia/Almaty Kazakhstan (most areas)
+KZ +4448+06528 Asia/Qyzylorda Qyzylorda/Kyzylorda/Kzyl-Orda
+KZ +5312+06337 Asia/Qostanay Qostanay/Kostanay/Kustanay
+KZ +5017+05710 Asia/Aqtobe Aqtöbe/Aktobe
+KZ +4431+05016 Asia/Aqtau Mangghystaū/Mankistau
+KZ +4707+05156 Asia/Atyrau Atyraū/Atirau/Gur'yev
+KZ +5113+05121 Asia/Oral West Kazakhstan
+LB +3353+03530 Asia/Beirut
+LK +0656+07951 Asia/Colombo
+LR +0618-01047 Africa/Monrovia
+LT +5441+02519 Europe/Vilnius
+LU +4936+00609 Europe/Luxembourg
+LV +5657+02406 Europe/Riga
+LY +3254+01311 Africa/Tripoli
+MA +3339-00735 Africa/Casablanca
+MC +4342+00723 Europe/Monaco
+MD +4700+02850 Europe/Chisinau
+MH +0709+17112 Pacific/Majuro Marshall Islands (most areas)
+MH +0905+16720 Pacific/Kwajalein Kwajalein
+MM +1647+09610 Asia/Yangon
+MN +4755+10653 Asia/Ulaanbaatar Mongolia (most areas)
+MN +4801+09139 Asia/Hovd Bayan-Ölgii, Govi-Altai, Hovd, Uvs, Zavkhan
+MN +4804+11430 Asia/Choibalsan Dornod, Sükhbaatar
+MO +221150+1133230 Asia/Macau
+MQ +1436-06105 America/Martinique
+MT +3554+01431 Europe/Malta
+MU -2010+05730 Indian/Mauritius
+MV +0410+07330 Indian/Maldives
+MX +1924-09909 America/Mexico_City Central Time
+MX +2105-08646 America/Cancun Eastern Standard Time - Quintana Roo
+MX +2058-08937 America/Merida Central Time - Campeche, Yucatán
+MX +2540-10019 America/Monterrey Central Time - Durango; Coahuila, Nuevo León, Tamaulipas (most areas)
+MX +2550-09730 America/Matamoros Central Time US - Coahuila, Nuevo León, Tamaulipas (US border)
+MX +2313-10625 America/Mazatlan Mountain Time - Baja California Sur, Nayarit, Sinaloa
+MX +2838-10605 America/Chihuahua Mountain Time - Chihuahua (most areas)
+MX +2934-10425 America/Ojinaga Mountain Time US - Chihuahua (US border)
+MX +2904-11058 America/Hermosillo Mountain Standard Time - Sonora
+MX +3232-11701 America/Tijuana Pacific Time US - Baja California
+MX +2048-10515 America/Bahia_Banderas Central Time - Bahía de Banderas
+MY +0310+10142 Asia/Kuala_Lumpur Malaysia (peninsula)
+MY +0133+11020 Asia/Kuching Sabah, Sarawak
+MZ,BI,BW,CD,MW,RW,ZM,ZW -2558+03235 Africa/Maputo Central Africa Time
+NA -2234+01706 Africa/Windhoek
+NC -2216+16627 Pacific/Noumea
+NF -2903+16758 Pacific/Norfolk
+NG,AO,BJ,CD,CF,CG,CM,GA,GQ,NE +0627+00324 Africa/Lagos West Africa Time
+NI +1209-08617 America/Managua
+NL +5222+00454 Europe/Amsterdam
+NO,SJ +5955+01045 Europe/Oslo
+NP +2743+08519 Asia/Kathmandu
+NR -0031+16655 Pacific/Nauru
+NU -1901-16955 Pacific/Niue
+NZ,AQ -3652+17446 Pacific/Auckland New Zealand time
+NZ -4357-17633 Pacific/Chatham Chatham Islands
+PA,KY +0858-07932 America/Panama
+PE -1203-07703 America/Lima
+PF -1732-14934 Pacific/Tahiti Society Islands
+PF -0900-13930 Pacific/Marquesas Marquesas Islands
+PF -2308-13457 Pacific/Gambier Gambier Islands
+PG -0930+14710 Pacific/Port_Moresby Papua New Guinea (most areas)
+PG -0613+15534 Pacific/Bougainville Bougainville
+PH +1435+12100 Asia/Manila
+PK +2452+06703 Asia/Karachi
+PL +5215+02100 Europe/Warsaw
+PM +4703-05620 America/Miquelon
+PN -2504-13005 Pacific/Pitcairn
+PR +182806-0660622 America/Puerto_Rico
+PS +3130+03428 Asia/Gaza Gaza Strip
+PS +313200+0350542 Asia/Hebron West Bank
+PT +3843-00908 Europe/Lisbon Portugal (mainland)
+PT +3238-01654 Atlantic/Madeira Madeira Islands
+PT +3744-02540 Atlantic/Azores Azores
+PW +0720+13429 Pacific/Palau
+PY -2516-05740 America/Asuncion
+QA,BH +2517+05132 Asia/Qatar
+RE,TF -2052+05528 Indian/Reunion Réunion, Crozet, Scattered Islands
+RO +4426+02606 Europe/Bucharest
+RS,BA,HR,ME,MK,SI +4450+02030 Europe/Belgrade
+RU +5443+02030 Europe/Kaliningrad MSK-01 - Kaliningrad
+RU +554521+0373704 Europe/Moscow MSK+00 - Moscow area
+# Mention RU and UA alphabetically. See "territorial claims" above.
+RU,UA +4457+03406 Europe/Simferopol MSK+00 - Crimea
+RU +5836+04939 Europe/Kirov MSK+00 - Kirov
+RU +4621+04803 Europe/Astrakhan MSK+01 - Astrakhan
+RU +4844+04425 Europe/Volgograd MSK+01 - Volgograd
+RU +5134+04602 Europe/Saratov MSK+01 - Saratov
+RU +5420+04824 Europe/Ulyanovsk MSK+01 - Ulyanovsk
+RU +5312+05009 Europe/Samara MSK+01 - Samara, Udmurtia
+RU +5651+06036 Asia/Yekaterinburg MSK+02 - Urals
+RU +5500+07324 Asia/Omsk MSK+03 - Omsk
+RU +5502+08255 Asia/Novosibirsk MSK+04 - Novosibirsk
+RU +5322+08345 Asia/Barnaul MSK+04 - Altai
+RU +5630+08458 Asia/Tomsk MSK+04 - Tomsk
+RU +5345+08707 Asia/Novokuznetsk MSK+04 - Kemerovo
+RU +5601+09250 Asia/Krasnoyarsk MSK+04 - Krasnoyarsk area
+RU +5216+10420 Asia/Irkutsk MSK+05 - Irkutsk, Buryatia
+RU +5203+11328 Asia/Chita MSK+06 - Zabaykalsky
+RU +6200+12940 Asia/Yakutsk MSK+06 - Lena River
+RU +623923+1353314 Asia/Khandyga MSK+06 - Tomponsky, Ust-Maysky
+RU +4310+13156 Asia/Vladivostok MSK+07 - Amur River
+RU +643337+1431336 Asia/Ust-Nera MSK+07 - Oymyakonsky
+RU +5934+15048 Asia/Magadan MSK+08 - Magadan
+RU +4658+14242 Asia/Sakhalin MSK+08 - Sakhalin Island
+RU +6728+15343 Asia/Srednekolymsk MSK+08 - Sakha (E); North Kuril Is
+RU +5301+15839 Asia/Kamchatka MSK+09 - Kamchatka
+RU +6445+17729 Asia/Anadyr MSK+09 - Bering Sea
+SA,KW,YE +2438+04643 Asia/Riyadh
+SB -0932+16012 Pacific/Guadalcanal
+SC -0440+05528 Indian/Mahe
+SD +1536+03232 Africa/Khartoum
+SE +5920+01803 Europe/Stockholm
+SG +0117+10351 Asia/Singapore
+SR +0550-05510 America/Paramaribo
+SS +0451+03137 Africa/Juba
+ST +0020+00644 Africa/Sao_Tome
+SV +1342-08912 America/El_Salvador
+SY +3330+03618 Asia/Damascus
+TC +2128-07108 America/Grand_Turk
+TD +1207+01503 Africa/Ndjamena
+TF -492110+0701303 Indian/Kerguelen Kerguelen, St Paul Island, Amsterdam Island
+TH,KH,LA,VN +1345+10031 Asia/Bangkok Indochina (most areas)
+TJ +3835+06848 Asia/Dushanbe
+TK -0922-17114 Pacific/Fakaofo
+TL -0833+12535 Asia/Dili
+TM +3757+05823 Asia/Ashgabat
+TN +3648+01011 Africa/Tunis
+TO -2110-17510 Pacific/Tongatapu
+TR +4101+02858 Europe/Istanbul
+TT,AG,AI,BL,DM,GD,GP,KN,LC,MF,MS,VC,VG,VI +1039-06131 America/Port_of_Spain
+TV -0831+17913 Pacific/Funafuti
+TW +2503+12130 Asia/Taipei
+UA +5026+03031 Europe/Kiev Ukraine (most areas)
+UA +4837+02218 Europe/Uzhgorod Ruthenia
+UA +4750+03510 Europe/Zaporozhye Zaporozh'ye/Zaporizhia; Lugansk/Luhansk (east)
+UM +1917+16637 Pacific/Wake Wake Island
+US +404251-0740023 America/New_York Eastern (most areas)
+US +421953-0830245 America/Detroit Eastern - MI (most areas)
+US +381515-0854534 America/Kentucky/Louisville Eastern - KY (Louisville area)
+US +364947-0845057 America/Kentucky/Monticello Eastern - KY (Wayne)
+US +394606-0860929 America/Indiana/Indianapolis Eastern - IN (most areas)
+US +384038-0873143 America/Indiana/Vincennes Eastern - IN (Da, Du, K, Mn)
+US +410305-0863611 America/Indiana/Winamac Eastern - IN (Pulaski)
+US +382232-0862041 America/Indiana/Marengo Eastern - IN (Crawford)
+US +382931-0871643 America/Indiana/Petersburg Eastern - IN (Pike)
+US +384452-0850402 America/Indiana/Vevay Eastern - IN (Switzerland)
+US +415100-0873900 America/Chicago Central (most areas)
+US +375711-0864541 America/Indiana/Tell_City Central - IN (Perry)
+US +411745-0863730 America/Indiana/Knox Central - IN (Starke)
+US +450628-0873651 America/Menominee Central - MI (Wisconsin border)
+US +470659-1011757 America/North_Dakota/Center Central - ND (Oliver)
+US +465042-1012439 America/North_Dakota/New_Salem Central - ND (Morton rural)
+US +471551-1014640 America/North_Dakota/Beulah Central - ND (Mercer)
+US +394421-1045903 America/Denver Mountain (most areas)
+US +433649-1161209 America/Boise Mountain - ID (south); OR (east)
+US +332654-1120424 America/Phoenix MST - Arizona (except Navajo)
+US +340308-1181434 America/Los_Angeles Pacific
+US +611305-1495401 America/Anchorage Alaska (most areas)
+US +581807-1342511 America/Juneau Alaska - Juneau area
+US +571035-1351807 America/Sitka Alaska - Sitka area
+US +550737-1313435 America/Metlakatla Alaska - Annette Island
+US +593249-1394338 America/Yakutat Alaska - Yakutat
+US +643004-1652423 America/Nome Alaska (west)
+US +515248-1763929 America/Adak Aleutian Islands
+US,UM +211825-1575130 Pacific/Honolulu Hawaii
+UY -345433-0561245 America/Montevideo
+UZ +3940+06648 Asia/Samarkand Uzbekistan (west)
+UZ +4120+06918 Asia/Tashkent Uzbekistan (east)
+VE +1030-06656 America/Caracas
+VN +1045+10640 Asia/Ho_Chi_Minh Vietnam (south)
+VU -1740+16825 Pacific/Efate
+WF -1318-17610 Pacific/Wallis
+WS -1350-17144 Pacific/Apia
+ZA,LS,SZ -2615+02800 Africa/Johannesburg
diff --git a/third_party/abseil-cpp/absl/time/internal/get_current_time_chrono.inc b/third_party/abseil-cpp/absl/time/internal/get_current_time_chrono.inc
new file mode 100644
index 0000000000..5eeb6406aa
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/get_current_time_chrono.inc
@@ -0,0 +1,31 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <chrono>
+#include <cstdint>
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+static int64_t GetCurrentTimeNanosFromSystem() {
+ return std::chrono::duration_cast<std::chrono::nanoseconds>(
+ std::chrono::system_clock::now() -
+ std::chrono::system_clock::from_time_t(0))
+ .count();
+}
+
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/get_current_time_posix.inc b/third_party/abseil-cpp/absl/time/internal/get_current_time_posix.inc
new file mode 100644
index 0000000000..42072000ae
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/get_current_time_posix.inc
@@ -0,0 +1,24 @@
+#include "absl/time/clock.h"
+
+#include <sys/time.h>
+#include <ctime>
+#include <cstdint>
+
+#include "absl/base/internal/raw_logging.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+static int64_t GetCurrentTimeNanosFromSystem() {
+ const int64_t kNanosPerSecond = 1000 * 1000 * 1000;
+ struct timespec ts;
+ ABSL_RAW_CHECK(clock_gettime(CLOCK_REALTIME, &ts) == 0,
+ "Failed to read real-time clock.");
+ return (int64_t{ts.tv_sec} * kNanosPerSecond +
+ int64_t{ts.tv_nsec});
+}
+
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/test_util.cc b/third_party/abseil-cpp/absl/time/internal/test_util.cc
new file mode 100644
index 0000000000..9bffe121da
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/test_util.cc
@@ -0,0 +1,130 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/test_util.h"
+
+#include <algorithm>
+#include <cstddef>
+#include <cstring>
+
+#include "absl/base/internal/raw_logging.h"
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+
+namespace cctz = absl::time_internal::cctz;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+TimeZone LoadTimeZone(const std::string& name) {
+ TimeZone tz;
+ ABSL_RAW_CHECK(LoadTimeZone(name, &tz), name.c_str());
+ return tz;
+}
+
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz_extension {
+namespace {
+
+// Embed the zoneinfo data for time zones used during tests and benchmarks.
+// The data was generated using "xxd -i zoneinfo-file". There is no need
+// to update the data as long as the tests do not depend on recent changes
+// (and the past rules remain the same).
+#include "absl/time/internal/zoneinfo.inc"
+
+const struct ZoneInfo {
+ const char* name;
+ const char* data;
+ std::size_t length;
+} kZoneInfo[] = {
+ // The three real time zones used by :time_test and :time_benchmark.
+ {"America/Los_Angeles", //
+ reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+ {"America/New_York", //
+ reinterpret_cast<char*>(America_New_York), America_New_York_len},
+ {"Australia/Sydney", //
+ reinterpret_cast<char*>(Australia_Sydney), Australia_Sydney_len},
+
+ // Other zones named in tests but which should fail to load.
+ {"Invalid/TimeZone", nullptr, 0},
+ {"", nullptr, 0},
+
+ // Also allow for loading the local time zone under TZ=US/Pacific.
+ {"US/Pacific", //
+ reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+
+ // Allows use of the local time zone from a system-specific location.
+#ifdef _MSC_VER
+ {"localtime", //
+ reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+#else
+ {"/etc/localtime", //
+ reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+#endif
+};
+
+class TestZoneInfoSource : public cctz::ZoneInfoSource {
+ public:
+ TestZoneInfoSource(const char* data, std::size_t size)
+ : data_(data), end_(data + size) {}
+
+ std::size_t Read(void* ptr, std::size_t size) override {
+ const std::size_t len = std::min<std::size_t>(size, end_ - data_);
+ memcpy(ptr, data_, len);
+ data_ += len;
+ return len;
+ }
+
+ int Skip(std::size_t offset) override {
+ data_ += std::min<std::size_t>(offset, end_ - data_);
+ return 0;
+ }
+
+ private:
+ const char* data_;
+ const char* const end_;
+};
+
+std::unique_ptr<cctz::ZoneInfoSource> TestFactory(
+ const std::string& name,
+ const std::function<std::unique_ptr<cctz::ZoneInfoSource>(
+ const std::string& name)>& /*fallback_factory*/) {
+ for (const ZoneInfo& zoneinfo : kZoneInfo) {
+ if (name == zoneinfo.name) {
+ if (zoneinfo.data == nullptr) return nullptr;
+ return std::unique_ptr<cctz::ZoneInfoSource>(
+ new TestZoneInfoSource(zoneinfo.data, zoneinfo.length));
+ }
+ }
+ ABSL_RAW_LOG(FATAL, "Unexpected time zone \"%s\" in test", name.c_str());
+ return nullptr;
+}
+
+} // namespace
+
+#if !defined(__MINGW32__)
+// MinGW does not support the weak symbol extension mechanism.
+ZoneInfoSourceFactory zone_info_source_factory = TestFactory;
+#endif
+
+} // namespace cctz_extension
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
diff --git a/third_party/abseil-cpp/absl/time/internal/test_util.h b/third_party/abseil-cpp/absl/time/internal/test_util.h
new file mode 100644
index 0000000000..5c4bf1f680
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/test_util.h
@@ -0,0 +1,33 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_TEST_UTIL_H_
+#define ABSL_TIME_INTERNAL_TEST_UTIL_H_
+
+#include <string>
+
+#include "absl/time/time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+// Loads the named timezone, but dies on any failure.
+absl::TimeZone LoadTimeZone(const std::string& name);
+
+} // namespace time_internal
+ABSL_NAMESPACE_END
+} // namespace absl
+
+#endif // ABSL_TIME_INTERNAL_TEST_UTIL_H_
diff --git a/third_party/abseil-cpp/absl/time/internal/zoneinfo.inc b/third_party/abseil-cpp/absl/time/internal/zoneinfo.inc
new file mode 100644
index 0000000000..bfed82990d
--- /dev/null
+++ b/third_party/abseil-cpp/absl/time/internal/zoneinfo.inc
@@ -0,0 +1,729 @@
+unsigned char America_Los_Angeles[] = {
+ 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0x80, 0x00, 0x00, 0x00,
+ 0x9e, 0xa6, 0x48, 0xa0, 0x9f, 0xbb, 0x15, 0x90, 0xa0, 0x86, 0x2a, 0xa0,
+ 0xa1, 0x9a, 0xf7, 0x90, 0xcb, 0x89, 0x1a, 0xa0, 0xd2, 0x23, 0xf4, 0x70,
+ 0xd2, 0x61, 0x26, 0x10, 0xd6, 0xfe, 0x74, 0x5c, 0xd8, 0x80, 0xad, 0x90,
+ 0xda, 0xfe, 0xc3, 0x90, 0xdb, 0xc0, 0x90, 0x10, 0xdc, 0xde, 0xa5, 0x90,
+ 0xdd, 0xa9, 0xac, 0x90, 0xde, 0xbe, 0x87, 0x90, 0xdf, 0x89, 0x8e, 0x90,
+ 0xe0, 0x9e, 0x69, 0x90, 0xe1, 0x69, 0x70, 0x90, 0xe2, 0x7e, 0x4b, 0x90,
+ 0xe3, 0x49, 0x52, 0x90, 0xe4, 0x5e, 0x2d, 0x90, 0xe5, 0x29, 0x34, 0x90,
+ 0xe6, 0x47, 0x4a, 0x10, 0xe7, 0x12, 0x51, 0x10, 0xe8, 0x27, 0x2c, 0x10,
+ 0xe8, 0xf2, 0x33, 0x10, 0xea, 0x07, 0x0e, 0x10, 0xea, 0xd2, 0x15, 0x10,
+ 0xeb, 0xe6, 0xf0, 0x10, 0xec, 0xb1, 0xf7, 0x10, 0xed, 0xc6, 0xd2, 0x10,
+ 0xee, 0x91, 0xd9, 0x10, 0xef, 0xaf, 0xee, 0x90, 0xf0, 0x71, 0xbb, 0x10,
+ 0xf1, 0x8f, 0xd0, 0x90, 0xf2, 0x7f, 0xc1, 0x90, 0xf3, 0x6f, 0xb2, 0x90,
+ 0xf4, 0x5f, 0xa3, 0x90, 0xf5, 0x4f, 0x94, 0x90, 0xf6, 0x3f, 0x85, 0x90,
+ 0xf7, 0x2f, 0x76, 0x90, 0xf8, 0x28, 0xa2, 0x10, 0xf9, 0x0f, 0x58, 0x90,
+ 0xfa, 0x08, 0x84, 0x10, 0xfa, 0xf8, 0x83, 0x20, 0xfb, 0xe8, 0x66, 0x10,
+ 0xfc, 0xd8, 0x65, 0x20, 0xfd, 0xc8, 0x48, 0x10, 0xfe, 0xb8, 0x47, 0x20,
+ 0xff, 0xa8, 0x2a, 0x10, 0x00, 0x98, 0x29, 0x20, 0x01, 0x88, 0x0c, 0x10,
+ 0x02, 0x78, 0x0b, 0x20, 0x03, 0x71, 0x28, 0x90, 0x04, 0x61, 0x27, 0xa0,
+ 0x05, 0x51, 0x0a, 0x90, 0x06, 0x41, 0x09, 0xa0, 0x07, 0x30, 0xec, 0x90,
+ 0x07, 0x8d, 0x43, 0xa0, 0x09, 0x10, 0xce, 0x90, 0x09, 0xad, 0xbf, 0x20,
+ 0x0a, 0xf0, 0xb0, 0x90, 0x0b, 0xe0, 0xaf, 0xa0, 0x0c, 0xd9, 0xcd, 0x10,
+ 0x0d, 0xc0, 0x91, 0xa0, 0x0e, 0xb9, 0xaf, 0x10, 0x0f, 0xa9, 0xae, 0x20,
+ 0x10, 0x99, 0x91, 0x10, 0x11, 0x89, 0x90, 0x20, 0x12, 0x79, 0x73, 0x10,
+ 0x13, 0x69, 0x72, 0x20, 0x14, 0x59, 0x55, 0x10, 0x15, 0x49, 0x54, 0x20,
+ 0x16, 0x39, 0x37, 0x10, 0x17, 0x29, 0x36, 0x20, 0x18, 0x22, 0x53, 0x90,
+ 0x19, 0x09, 0x18, 0x20, 0x1a, 0x02, 0x35, 0x90, 0x1a, 0xf2, 0x34, 0xa0,
+ 0x1b, 0xe2, 0x17, 0x90, 0x1c, 0xd2, 0x16, 0xa0, 0x1d, 0xc1, 0xf9, 0x90,
+ 0x1e, 0xb1, 0xf8, 0xa0, 0x1f, 0xa1, 0xdb, 0x90, 0x20, 0x76, 0x2b, 0x20,
+ 0x21, 0x81, 0xbd, 0x90, 0x22, 0x56, 0x0d, 0x20, 0x23, 0x6a, 0xda, 0x10,
+ 0x24, 0x35, 0xef, 0x20, 0x25, 0x4a, 0xbc, 0x10, 0x26, 0x15, 0xd1, 0x20,
+ 0x27, 0x2a, 0x9e, 0x10, 0x27, 0xfe, 0xed, 0xa0, 0x29, 0x0a, 0x80, 0x10,
+ 0x29, 0xde, 0xcf, 0xa0, 0x2a, 0xea, 0x62, 0x10, 0x2b, 0xbe, 0xb1, 0xa0,
+ 0x2c, 0xd3, 0x7e, 0x90, 0x2d, 0x9e, 0x93, 0xa0, 0x2e, 0xb3, 0x60, 0x90,
+ 0x2f, 0x7e, 0x75, 0xa0, 0x30, 0x93, 0x42, 0x90, 0x31, 0x67, 0x92, 0x20,
+ 0x32, 0x73, 0x24, 0x90, 0x33, 0x47, 0x74, 0x20, 0x34, 0x53, 0x06, 0x90,
+ 0x35, 0x27, 0x56, 0x20, 0x36, 0x32, 0xe8, 0x90, 0x37, 0x07, 0x38, 0x20,
+ 0x38, 0x1c, 0x05, 0x10, 0x38, 0xe7, 0x1a, 0x20, 0x39, 0xfb, 0xe7, 0x10,
+ 0x3a, 0xc6, 0xfc, 0x20, 0x3b, 0xdb, 0xc9, 0x10, 0x3c, 0xb0, 0x18, 0xa0,
+ 0x3d, 0xbb, 0xab, 0x10, 0x3e, 0x8f, 0xfa, 0xa0, 0x3f, 0x9b, 0x8d, 0x10,
+ 0x40, 0x6f, 0xdc, 0xa0, 0x41, 0x84, 0xa9, 0x90, 0x42, 0x4f, 0xbe, 0xa0,
+ 0x43, 0x64, 0x8b, 0x90, 0x44, 0x2f, 0xa0, 0xa0, 0x45, 0x44, 0x6d, 0x90,
+ 0x45, 0xf3, 0xd3, 0x20, 0x47, 0x2d, 0x8a, 0x10, 0x47, 0xd3, 0xb5, 0x20,
+ 0x49, 0x0d, 0x6c, 0x10, 0x49, 0xb3, 0x97, 0x20, 0x4a, 0xed, 0x4e, 0x10,
+ 0x4b, 0x9c, 0xb3, 0xa0, 0x4c, 0xd6, 0x6a, 0x90, 0x4d, 0x7c, 0x95, 0xa0,
+ 0x4e, 0xb6, 0x4c, 0x90, 0x4f, 0x5c, 0x77, 0xa0, 0x50, 0x96, 0x2e, 0x90,
+ 0x51, 0x3c, 0x59, 0xa0, 0x52, 0x76, 0x10, 0x90, 0x53, 0x1c, 0x3b, 0xa0,
+ 0x54, 0x55, 0xf2, 0x90, 0x54, 0xfc, 0x1d, 0xa0, 0x56, 0x35, 0xd4, 0x90,
+ 0x56, 0xe5, 0x3a, 0x20, 0x58, 0x1e, 0xf1, 0x10, 0x58, 0xc5, 0x1c, 0x20,
+ 0x59, 0xfe, 0xd3, 0x10, 0x5a, 0xa4, 0xfe, 0x20, 0x5b, 0xde, 0xb5, 0x10,
+ 0x5c, 0x84, 0xe0, 0x20, 0x5d, 0xbe, 0x97, 0x10, 0x5e, 0x64, 0xc2, 0x20,
+ 0x5f, 0x9e, 0x79, 0x10, 0x60, 0x4d, 0xde, 0xa0, 0x61, 0x87, 0x95, 0x90,
+ 0x62, 0x2d, 0xc0, 0xa0, 0x63, 0x67, 0x77, 0x90, 0x64, 0x0d, 0xa2, 0xa0,
+ 0x65, 0x47, 0x59, 0x90, 0x65, 0xed, 0x84, 0xa0, 0x67, 0x27, 0x3b, 0x90,
+ 0x67, 0xcd, 0x66, 0xa0, 0x69, 0x07, 0x1d, 0x90, 0x69, 0xad, 0x48, 0xa0,
+ 0x6a, 0xe6, 0xff, 0x90, 0x6b, 0x96, 0x65, 0x20, 0x6c, 0xd0, 0x1c, 0x10,
+ 0x6d, 0x76, 0x47, 0x20, 0x6e, 0xaf, 0xfe, 0x10, 0x6f, 0x56, 0x29, 0x20,
+ 0x70, 0x8f, 0xe0, 0x10, 0x71, 0x36, 0x0b, 0x20, 0x72, 0x6f, 0xc2, 0x10,
+ 0x73, 0x15, 0xed, 0x20, 0x74, 0x4f, 0xa4, 0x10, 0x74, 0xff, 0x09, 0xa0,
+ 0x76, 0x38, 0xc0, 0x90, 0x76, 0xde, 0xeb, 0xa0, 0x78, 0x18, 0xa2, 0x90,
+ 0x78, 0xbe, 0xcd, 0xa0, 0x79, 0xf8, 0x84, 0x90, 0x7a, 0x9e, 0xaf, 0xa0,
+ 0x7b, 0xd8, 0x66, 0x90, 0x7c, 0x7e, 0x91, 0xa0, 0x7d, 0xb8, 0x48, 0x90,
+ 0x7e, 0x5e, 0x73, 0xa0, 0x7f, 0x98, 0x2a, 0x90, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0xff, 0xff, 0x91, 0x26, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x90,
+ 0x01, 0x04, 0xff, 0xff, 0x8f, 0x80, 0x00, 0x08, 0xff, 0xff, 0x9d, 0x90,
+ 0x01, 0x0c, 0xff, 0xff, 0x9d, 0x90, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00,
+ 0x50, 0x44, 0x54, 0x00, 0x50, 0x53, 0x54, 0x00, 0x50, 0x57, 0x54, 0x00,
+ 0x50, 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+ 0x00, 0x01, 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x05, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0xbb, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0xf8, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x5e, 0x04,
+ 0x1a, 0xc0, 0xff, 0xff, 0xff, 0xff, 0x9e, 0xa6, 0x48, 0xa0, 0xff, 0xff,
+ 0xff, 0xff, 0x9f, 0xbb, 0x15, 0x90, 0xff, 0xff, 0xff, 0xff, 0xa0, 0x86,
+ 0x2a, 0xa0, 0xff, 0xff, 0xff, 0xff, 0xa1, 0x9a, 0xf7, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xcb, 0x89, 0x1a, 0xa0, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x23,
+ 0xf4, 0x70, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x61, 0x26, 0x10, 0xff, 0xff,
+ 0xff, 0xff, 0xd6, 0xfe, 0x74, 0x5c, 0xff, 0xff, 0xff, 0xff, 0xd8, 0x80,
+ 0xad, 0x90, 0xff, 0xff, 0xff, 0xff, 0xda, 0xfe, 0xc3, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xdb, 0xc0, 0x90, 0x10, 0xff, 0xff, 0xff, 0xff, 0xdc, 0xde,
+ 0xa5, 0x90, 0xff, 0xff, 0xff, 0xff, 0xdd, 0xa9, 0xac, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xde, 0xbe, 0x87, 0x90, 0xff, 0xff, 0xff, 0xff, 0xdf, 0x89,
+ 0x8e, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe0, 0x9e, 0x69, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xe1, 0x69, 0x70, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe2, 0x7e,
+ 0x4b, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe3, 0x49, 0x52, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xe4, 0x5e, 0x2d, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe5, 0x29,
+ 0x34, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x47, 0x4a, 0x10, 0xff, 0xff,
+ 0xff, 0xff, 0xe7, 0x12, 0x51, 0x10, 0xff, 0xff, 0xff, 0xff, 0xe8, 0x27,
+ 0x2c, 0x10, 0xff, 0xff, 0xff, 0xff, 0xe8, 0xf2, 0x33, 0x10, 0xff, 0xff,
+ 0xff, 0xff, 0xea, 0x07, 0x0e, 0x10, 0xff, 0xff, 0xff, 0xff, 0xea, 0xd2,
+ 0x15, 0x10, 0xff, 0xff, 0xff, 0xff, 0xeb, 0xe6, 0xf0, 0x10, 0xff, 0xff,
+ 0xff, 0xff, 0xec, 0xb1, 0xf7, 0x10, 0xff, 0xff, 0xff, 0xff, 0xed, 0xc6,
+ 0xd2, 0x10, 0xff, 0xff, 0xff, 0xff, 0xee, 0x91, 0xd9, 0x10, 0xff, 0xff,
+ 0xff, 0xff, 0xef, 0xaf, 0xee, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf0, 0x71,
+ 0xbb, 0x10, 0xff, 0xff, 0xff, 0xff, 0xf1, 0x8f, 0xd0, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xf2, 0x7f, 0xc1, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf3, 0x6f,
+ 0xb2, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf4, 0x5f, 0xa3, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xf5, 0x4f, 0x94, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x3f,
+ 0x85, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x2f, 0x76, 0x90, 0xff, 0xff,
+ 0xff, 0xff, 0xf8, 0x28, 0xa2, 0x10, 0xff, 0xff, 0xff, 0xff, 0xf9, 0x0f,
+ 0x58, 0x90, 0xff, 0xff, 0xff, 0xff, 0xfa, 0x08, 0x84, 0x10, 0xff, 0xff,
+ 0xff, 0xff, 0xfa, 0xf8, 0x83, 0x20, 0xff, 0xff, 0xff, 0xff, 0xfb, 0xe8,
+ 0x66, 0x10, 0xff, 0xff, 0xff, 0xff, 0xfc, 0xd8, 0x65, 0x20, 0xff, 0xff,
+ 0xff, 0xff, 0xfd, 0xc8, 0x48, 0x10, 0xff, 0xff, 0xff, 0xff, 0xfe, 0xb8,
+ 0x47, 0x20, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa8, 0x2a, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x98, 0x29, 0x20, 0x00, 0x00, 0x00, 0x00, 0x01, 0x88,
+ 0x0c, 0x10, 0x00, 0x00, 0x00, 0x00, 0x02, 0x78, 0x0b, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x03, 0x71, 0x28, 0x90, 0x00, 0x00, 0x00, 0x00, 0x04, 0x61,
+ 0x27, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x05, 0x51, 0x0a, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x06, 0x41, 0x09, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x07, 0x30,
+ 0xec, 0x90, 0x00, 0x00, 0x00, 0x00, 0x07, 0x8d, 0x43, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x09, 0x10, 0xce, 0x90, 0x00, 0x00, 0x00, 0x00, 0x09, 0xad,
+ 0xbf, 0x20, 0x00, 0x00, 0x00, 0x00, 0x0a, 0xf0, 0xb0, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x0b, 0xe0, 0xaf, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x0c, 0xd9,
+ 0xcd, 0x10, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xc0, 0x91, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x0e, 0xb9, 0xaf, 0x10, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xa9,
+ 0xae, 0x20, 0x00, 0x00, 0x00, 0x00, 0x10, 0x99, 0x91, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x11, 0x89, 0x90, 0x20, 0x00, 0x00, 0x00, 0x00, 0x12, 0x79,
+ 0x73, 0x10, 0x00, 0x00, 0x00, 0x00, 0x13, 0x69, 0x72, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x14, 0x59, 0x55, 0x10, 0x00, 0x00, 0x00, 0x00, 0x15, 0x49,
+ 0x54, 0x20, 0x00, 0x00, 0x00, 0x00, 0x16, 0x39, 0x37, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x17, 0x29, 0x36, 0x20, 0x00, 0x00, 0x00, 0x00, 0x18, 0x22,
+ 0x53, 0x90, 0x00, 0x00, 0x00, 0x00, 0x19, 0x09, 0x18, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x1a, 0x02, 0x35, 0x90, 0x00, 0x00, 0x00, 0x00, 0x1a, 0xf2,
+ 0x34, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe2, 0x17, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x1c, 0xd2, 0x16, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x1d, 0xc1,
+ 0xf9, 0x90, 0x00, 0x00, 0x00, 0x00, 0x1e, 0xb1, 0xf8, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x1f, 0xa1, 0xdb, 0x90, 0x00, 0x00, 0x00, 0x00, 0x20, 0x76,
+ 0x2b, 0x20, 0x00, 0x00, 0x00, 0x00, 0x21, 0x81, 0xbd, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x22, 0x56, 0x0d, 0x20, 0x00, 0x00, 0x00, 0x00, 0x23, 0x6a,
+ 0xda, 0x10, 0x00, 0x00, 0x00, 0x00, 0x24, 0x35, 0xef, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x25, 0x4a, 0xbc, 0x10, 0x00, 0x00, 0x00, 0x00, 0x26, 0x15,
+ 0xd1, 0x20, 0x00, 0x00, 0x00, 0x00, 0x27, 0x2a, 0x9e, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x27, 0xfe, 0xed, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x29, 0x0a,
+ 0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x29, 0xde, 0xcf, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x2a, 0xea, 0x62, 0x10, 0x00, 0x00, 0x00, 0x00, 0x2b, 0xbe,
+ 0xb1, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd3, 0x7e, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x2d, 0x9e, 0x93, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x2e, 0xb3,
+ 0x60, 0x90, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x7e, 0x75, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x30, 0x93, 0x42, 0x90, 0x00, 0x00, 0x00, 0x00, 0x31, 0x67,
+ 0x92, 0x20, 0x00, 0x00, 0x00, 0x00, 0x32, 0x73, 0x24, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x33, 0x47, 0x74, 0x20, 0x00, 0x00, 0x00, 0x00, 0x34, 0x53,
+ 0x06, 0x90, 0x00, 0x00, 0x00, 0x00, 0x35, 0x27, 0x56, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x36, 0x32, 0xe8, 0x90, 0x00, 0x00, 0x00, 0x00, 0x37, 0x07,
+ 0x38, 0x20, 0x00, 0x00, 0x00, 0x00, 0x38, 0x1c, 0x05, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x38, 0xe7, 0x1a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x39, 0xfb,
+ 0xe7, 0x10, 0x00, 0x00, 0x00, 0x00, 0x3a, 0xc6, 0xfc, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x3b, 0xdb, 0xc9, 0x10, 0x00, 0x00, 0x00, 0x00, 0x3c, 0xb0,
+ 0x18, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xbb, 0xab, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x3e, 0x8f, 0xfa, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x9b,
+ 0x8d, 0x10, 0x00, 0x00, 0x00, 0x00, 0x40, 0x6f, 0xdc, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x41, 0x84, 0xa9, 0x90, 0x00, 0x00, 0x00, 0x00, 0x42, 0x4f,
+ 0xbe, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x43, 0x64, 0x8b, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x44, 0x2f, 0xa0, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x45, 0x44,
+ 0x6d, 0x90, 0x00, 0x00, 0x00, 0x00, 0x45, 0xf3, 0xd3, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x47, 0x2d, 0x8a, 0x10, 0x00, 0x00, 0x00, 0x00, 0x47, 0xd3,
+ 0xb5, 0x20, 0x00, 0x00, 0x00, 0x00, 0x49, 0x0d, 0x6c, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x49, 0xb3, 0x97, 0x20, 0x00, 0x00, 0x00, 0x00, 0x4a, 0xed,
+ 0x4e, 0x10, 0x00, 0x00, 0x00, 0x00, 0x4b, 0x9c, 0xb3, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x4c, 0xd6, 0x6a, 0x90, 0x00, 0x00, 0x00, 0x00, 0x4d, 0x7c,
+ 0x95, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x4e, 0xb6, 0x4c, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x4f, 0x5c, 0x77, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x50, 0x96,
+ 0x2e, 0x90, 0x00, 0x00, 0x00, 0x00, 0x51, 0x3c, 0x59, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x52, 0x76, 0x10, 0x90, 0x00, 0x00, 0x00, 0x00, 0x53, 0x1c,
+ 0x3b, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0xf2, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x54, 0xfc, 0x1d, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x56, 0x35,
+ 0xd4, 0x90, 0x00, 0x00, 0x00, 0x00, 0x56, 0xe5, 0x3a, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x58, 0x1e, 0xf1, 0x10, 0x00, 0x00, 0x00, 0x00, 0x58, 0xc5,
+ 0x1c, 0x20, 0x00, 0x00, 0x00, 0x00, 0x59, 0xfe, 0xd3, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x5a, 0xa4, 0xfe, 0x20, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xde,
+ 0xb5, 0x10, 0x00, 0x00, 0x00, 0x00, 0x5c, 0x84, 0xe0, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x5d, 0xbe, 0x97, 0x10, 0x00, 0x00, 0x00, 0x00, 0x5e, 0x64,
+ 0xc2, 0x20, 0x00, 0x00, 0x00, 0x00, 0x5f, 0x9e, 0x79, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x60, 0x4d, 0xde, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x61, 0x87,
+ 0x95, 0x90, 0x00, 0x00, 0x00, 0x00, 0x62, 0x2d, 0xc0, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x63, 0x67, 0x77, 0x90, 0x00, 0x00, 0x00, 0x00, 0x64, 0x0d,
+ 0xa2, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x65, 0x47, 0x59, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x65, 0xed, 0x84, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x67, 0x27,
+ 0x3b, 0x90, 0x00, 0x00, 0x00, 0x00, 0x67, 0xcd, 0x66, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x69, 0x07, 0x1d, 0x90, 0x00, 0x00, 0x00, 0x00, 0x69, 0xad,
+ 0x48, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xe6, 0xff, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x6b, 0x96, 0x65, 0x20, 0x00, 0x00, 0x00, 0x00, 0x6c, 0xd0,
+ 0x1c, 0x10, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x76, 0x47, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x6e, 0xaf, 0xfe, 0x10, 0x00, 0x00, 0x00, 0x00, 0x6f, 0x56,
+ 0x29, 0x20, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8f, 0xe0, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x71, 0x36, 0x0b, 0x20, 0x00, 0x00, 0x00, 0x00, 0x72, 0x6f,
+ 0xc2, 0x10, 0x00, 0x00, 0x00, 0x00, 0x73, 0x15, 0xed, 0x20, 0x00, 0x00,
+ 0x00, 0x00, 0x74, 0x4f, 0xa4, 0x10, 0x00, 0x00, 0x00, 0x00, 0x74, 0xff,
+ 0x09, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x76, 0x38, 0xc0, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x76, 0xde, 0xeb, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x78, 0x18,
+ 0xa2, 0x90, 0x00, 0x00, 0x00, 0x00, 0x78, 0xbe, 0xcd, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x79, 0xf8, 0x84, 0x90, 0x00, 0x00, 0x00, 0x00, 0x7a, 0x9e,
+ 0xaf, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xd8, 0x66, 0x90, 0x00, 0x00,
+ 0x00, 0x00, 0x7c, 0x7e, 0x91, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x7d, 0xb8,
+ 0x48, 0x90, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x5e, 0x73, 0xa0, 0x00, 0x00,
+ 0x00, 0x00, 0x7f, 0x98, 0x2a, 0x90, 0x00, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0xff, 0xff, 0x91, 0x26, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x90, 0x01,
+ 0x04, 0xff, 0xff, 0x8f, 0x80, 0x00, 0x08, 0xff, 0xff, 0x9d, 0x90, 0x01,
+ 0x0c, 0xff, 0xff, 0x9d, 0x90, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00, 0x50,
+ 0x44, 0x54, 0x00, 0x50, 0x53, 0x54, 0x00, 0x50, 0x57, 0x54, 0x00, 0x50,
+ 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00,
+ 0x01, 0x0a, 0x50, 0x53, 0x54, 0x38, 0x50, 0x44, 0x54, 0x2c, 0x4d, 0x33,
+ 0x2e, 0x32, 0x2e, 0x30, 0x2c, 0x4d, 0x31, 0x31, 0x2e, 0x31, 0x2e, 0x30,
+ 0x0a
+};
+unsigned int America_Los_Angeles_len = 2845;
+unsigned char America_New_York[] = {
+ 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xec,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0x80, 0x00, 0x00, 0x00,
+ 0x9e, 0xa6, 0x1e, 0x70, 0x9f, 0xba, 0xeb, 0x60, 0xa0, 0x86, 0x00, 0x70,
+ 0xa1, 0x9a, 0xcd, 0x60, 0xa2, 0x65, 0xe2, 0x70, 0xa3, 0x83, 0xe9, 0xe0,
+ 0xa4, 0x6a, 0xae, 0x70, 0xa5, 0x35, 0xa7, 0x60, 0xa6, 0x53, 0xca, 0xf0,
+ 0xa7, 0x15, 0x89, 0x60, 0xa8, 0x33, 0xac, 0xf0, 0xa8, 0xfe, 0xa5, 0xe0,
+ 0xaa, 0x13, 0x8e, 0xf0, 0xaa, 0xde, 0x87, 0xe0, 0xab, 0xf3, 0x70, 0xf0,
+ 0xac, 0xbe, 0x69, 0xe0, 0xad, 0xd3, 0x52, 0xf0, 0xae, 0x9e, 0x4b, 0xe0,
+ 0xaf, 0xb3, 0x34, 0xf0, 0xb0, 0x7e, 0x2d, 0xe0, 0xb1, 0x9c, 0x51, 0x70,
+ 0xb2, 0x67, 0x4a, 0x60, 0xb3, 0x7c, 0x33, 0x70, 0xb4, 0x47, 0x2c, 0x60,
+ 0xb5, 0x5c, 0x15, 0x70, 0xb6, 0x27, 0x0e, 0x60, 0xb7, 0x3b, 0xf7, 0x70,
+ 0xb8, 0x06, 0xf0, 0x60, 0xb9, 0x1b, 0xd9, 0x70, 0xb9, 0xe6, 0xd2, 0x60,
+ 0xbb, 0x04, 0xf5, 0xf0, 0xbb, 0xc6, 0xb4, 0x60, 0xbc, 0xe4, 0xd7, 0xf0,
+ 0xbd, 0xaf, 0xd0, 0xe0, 0xbe, 0xc4, 0xb9, 0xf0, 0xbf, 0x8f, 0xb2, 0xe0,
+ 0xc0, 0xa4, 0x9b, 0xf0, 0xc1, 0x6f, 0x94, 0xe0, 0xc2, 0x84, 0x7d, 0xf0,
+ 0xc3, 0x4f, 0x76, 0xe0, 0xc4, 0x64, 0x5f, 0xf0, 0xc5, 0x2f, 0x58, 0xe0,
+ 0xc6, 0x4d, 0x7c, 0x70, 0xc7, 0x0f, 0x3a, 0xe0, 0xc8, 0x2d, 0x5e, 0x70,
+ 0xc8, 0xf8, 0x57, 0x60, 0xca, 0x0d, 0x40, 0x70, 0xca, 0xd8, 0x39, 0x60,
+ 0xcb, 0x88, 0xf0, 0x70, 0xd2, 0x23, 0xf4, 0x70, 0xd2, 0x60, 0xfb, 0xe0,
+ 0xd3, 0x75, 0xe4, 0xf0, 0xd4, 0x40, 0xdd, 0xe0, 0xd5, 0x55, 0xc6, 0xf0,
+ 0xd6, 0x20, 0xbf, 0xe0, 0xd7, 0x35, 0xa8, 0xf0, 0xd8, 0x00, 0xa1, 0xe0,
+ 0xd9, 0x15, 0x8a, 0xf0, 0xd9, 0xe0, 0x83, 0xe0, 0xda, 0xfe, 0xa7, 0x70,
+ 0xdb, 0xc0, 0x65, 0xe0, 0xdc, 0xde, 0x89, 0x70, 0xdd, 0xa9, 0x82, 0x60,
+ 0xde, 0xbe, 0x6b, 0x70, 0xdf, 0x89, 0x64, 0x60, 0xe0, 0x9e, 0x4d, 0x70,
+ 0xe1, 0x69, 0x46, 0x60, 0xe2, 0x7e, 0x2f, 0x70, 0xe3, 0x49, 0x28, 0x60,
+ 0xe4, 0x5e, 0x11, 0x70, 0xe5, 0x57, 0x2e, 0xe0, 0xe6, 0x47, 0x2d, 0xf0,
+ 0xe7, 0x37, 0x10, 0xe0, 0xe8, 0x27, 0x0f, 0xf0, 0xe9, 0x16, 0xf2, 0xe0,
+ 0xea, 0x06, 0xf1, 0xf0, 0xea, 0xf6, 0xd4, 0xe0, 0xeb, 0xe6, 0xd3, 0xf0,
+ 0xec, 0xd6, 0xb6, 0xe0, 0xed, 0xc6, 0xb5, 0xf0, 0xee, 0xbf, 0xd3, 0x60,
+ 0xef, 0xaf, 0xd2, 0x70, 0xf0, 0x9f, 0xb5, 0x60, 0xf1, 0x8f, 0xb4, 0x70,
+ 0xf2, 0x7f, 0x97, 0x60, 0xf3, 0x6f, 0x96, 0x70, 0xf4, 0x5f, 0x79, 0x60,
+ 0xf5, 0x4f, 0x78, 0x70, 0xf6, 0x3f, 0x5b, 0x60, 0xf7, 0x2f, 0x5a, 0x70,
+ 0xf8, 0x28, 0x77, 0xe0, 0xf9, 0x0f, 0x3c, 0x70, 0xfa, 0x08, 0x59, 0xe0,
+ 0xfa, 0xf8, 0x58, 0xf0, 0xfb, 0xe8, 0x3b, 0xe0, 0xfc, 0xd8, 0x3a, 0xf0,
+ 0xfd, 0xc8, 0x1d, 0xe0, 0xfe, 0xb8, 0x1c, 0xf0, 0xff, 0xa7, 0xff, 0xe0,
+ 0x00, 0x97, 0xfe, 0xf0, 0x01, 0x87, 0xe1, 0xe0, 0x02, 0x77, 0xe0, 0xf0,
+ 0x03, 0x70, 0xfe, 0x60, 0x04, 0x60, 0xfd, 0x70, 0x05, 0x50, 0xe0, 0x60,
+ 0x06, 0x40, 0xdf, 0x70, 0x07, 0x30, 0xc2, 0x60, 0x07, 0x8d, 0x19, 0x70,
+ 0x09, 0x10, 0xa4, 0x60, 0x09, 0xad, 0x94, 0xf0, 0x0a, 0xf0, 0x86, 0x60,
+ 0x0b, 0xe0, 0x85, 0x70, 0x0c, 0xd9, 0xa2, 0xe0, 0x0d, 0xc0, 0x67, 0x70,
+ 0x0e, 0xb9, 0x84, 0xe0, 0x0f, 0xa9, 0x83, 0xf0, 0x10, 0x99, 0x66, 0xe0,
+ 0x11, 0x89, 0x65, 0xf0, 0x12, 0x79, 0x48, 0xe0, 0x13, 0x69, 0x47, 0xf0,
+ 0x14, 0x59, 0x2a, 0xe0, 0x15, 0x49, 0x29, 0xf0, 0x16, 0x39, 0x0c, 0xe0,
+ 0x17, 0x29, 0x0b, 0xf0, 0x18, 0x22, 0x29, 0x60, 0x19, 0x08, 0xed, 0xf0,
+ 0x1a, 0x02, 0x0b, 0x60, 0x1a, 0xf2, 0x0a, 0x70, 0x1b, 0xe1, 0xed, 0x60,
+ 0x1c, 0xd1, 0xec, 0x70, 0x1d, 0xc1, 0xcf, 0x60, 0x1e, 0xb1, 0xce, 0x70,
+ 0x1f, 0xa1, 0xb1, 0x60, 0x20, 0x76, 0x00, 0xf0, 0x21, 0x81, 0x93, 0x60,
+ 0x22, 0x55, 0xe2, 0xf0, 0x23, 0x6a, 0xaf, 0xe0, 0x24, 0x35, 0xc4, 0xf0,
+ 0x25, 0x4a, 0x91, 0xe0, 0x26, 0x15, 0xa6, 0xf0, 0x27, 0x2a, 0x73, 0xe0,
+ 0x27, 0xfe, 0xc3, 0x70, 0x29, 0x0a, 0x55, 0xe0, 0x29, 0xde, 0xa5, 0x70,
+ 0x2a, 0xea, 0x37, 0xe0, 0x2b, 0xbe, 0x87, 0x70, 0x2c, 0xd3, 0x54, 0x60,
+ 0x2d, 0x9e, 0x69, 0x70, 0x2e, 0xb3, 0x36, 0x60, 0x2f, 0x7e, 0x4b, 0x70,
+ 0x30, 0x93, 0x18, 0x60, 0x31, 0x67, 0x67, 0xf0, 0x32, 0x72, 0xfa, 0x60,
+ 0x33, 0x47, 0x49, 0xf0, 0x34, 0x52, 0xdc, 0x60, 0x35, 0x27, 0x2b, 0xf0,
+ 0x36, 0x32, 0xbe, 0x60, 0x37, 0x07, 0x0d, 0xf0, 0x38, 0x1b, 0xda, 0xe0,
+ 0x38, 0xe6, 0xef, 0xf0, 0x39, 0xfb, 0xbc, 0xe0, 0x3a, 0xc6, 0xd1, 0xf0,
+ 0x3b, 0xdb, 0x9e, 0xe0, 0x3c, 0xaf, 0xee, 0x70, 0x3d, 0xbb, 0x80, 0xe0,
+ 0x3e, 0x8f, 0xd0, 0x70, 0x3f, 0x9b, 0x62, 0xe0, 0x40, 0x6f, 0xb2, 0x70,
+ 0x41, 0x84, 0x7f, 0x60, 0x42, 0x4f, 0x94, 0x70, 0x43, 0x64, 0x61, 0x60,
+ 0x44, 0x2f, 0x76, 0x70, 0x45, 0x44, 0x43, 0x60, 0x45, 0xf3, 0xa8, 0xf0,
+ 0x47, 0x2d, 0x5f, 0xe0, 0x47, 0xd3, 0x8a, 0xf0, 0x49, 0x0d, 0x41, 0xe0,
+ 0x49, 0xb3, 0x6c, 0xf0, 0x4a, 0xed, 0x23, 0xe0, 0x4b, 0x9c, 0x89, 0x70,
+ 0x4c, 0xd6, 0x40, 0x60, 0x4d, 0x7c, 0x6b, 0x70, 0x4e, 0xb6, 0x22, 0x60,
+ 0x4f, 0x5c, 0x4d, 0x70, 0x50, 0x96, 0x04, 0x60, 0x51, 0x3c, 0x2f, 0x70,
+ 0x52, 0x75, 0xe6, 0x60, 0x53, 0x1c, 0x11, 0x70, 0x54, 0x55, 0xc8, 0x60,
+ 0x54, 0xfb, 0xf3, 0x70, 0x56, 0x35, 0xaa, 0x60, 0x56, 0xe5, 0x0f, 0xf0,
+ 0x58, 0x1e, 0xc6, 0xe0, 0x58, 0xc4, 0xf1, 0xf0, 0x59, 0xfe, 0xa8, 0xe0,
+ 0x5a, 0xa4, 0xd3, 0xf0, 0x5b, 0xde, 0x8a, 0xe0, 0x5c, 0x84, 0xb5, 0xf0,
+ 0x5d, 0xbe, 0x6c, 0xe0, 0x5e, 0x64, 0x97, 0xf0, 0x5f, 0x9e, 0x4e, 0xe0,
+ 0x60, 0x4d, 0xb4, 0x70, 0x61, 0x87, 0x6b, 0x60, 0x62, 0x2d, 0x96, 0x70,
+ 0x63, 0x67, 0x4d, 0x60, 0x64, 0x0d, 0x78, 0x70, 0x65, 0x47, 0x2f, 0x60,
+ 0x65, 0xed, 0x5a, 0x70, 0x67, 0x27, 0x11, 0x60, 0x67, 0xcd, 0x3c, 0x70,
+ 0x69, 0x06, 0xf3, 0x60, 0x69, 0xad, 0x1e, 0x70, 0x6a, 0xe6, 0xd5, 0x60,
+ 0x6b, 0x96, 0x3a, 0xf0, 0x6c, 0xcf, 0xf1, 0xe0, 0x6d, 0x76, 0x1c, 0xf0,
+ 0x6e, 0xaf, 0xd3, 0xe0, 0x6f, 0x55, 0xfe, 0xf0, 0x70, 0x8f, 0xb5, 0xe0,
+ 0x71, 0x35, 0xe0, 0xf0, 0x72, 0x6f, 0x97, 0xe0, 0x73, 0x15, 0xc2, 0xf0,
+ 0x74, 0x4f, 0x79, 0xe0, 0x74, 0xfe, 0xdf, 0x70, 0x76, 0x38, 0x96, 0x60,
+ 0x76, 0xde, 0xc1, 0x70, 0x78, 0x18, 0x78, 0x60, 0x78, 0xbe, 0xa3, 0x70,
+ 0x79, 0xf8, 0x5a, 0x60, 0x7a, 0x9e, 0x85, 0x70, 0x7b, 0xd8, 0x3c, 0x60,
+ 0x7c, 0x7e, 0x67, 0x70, 0x7d, 0xb8, 0x1e, 0x60, 0x7e, 0x5e, 0x49, 0x70,
+ 0x7f, 0x98, 0x00, 0x60, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0xff, 0xff, 0xba, 0x9e, 0x00, 0x00, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x04,
+ 0xff, 0xff, 0xb9, 0xb0, 0x00, 0x08, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x0c,
+ 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00, 0x45, 0x44,
+ 0x54, 0x00, 0x45, 0x53, 0x54, 0x00, 0x45, 0x57, 0x54, 0x00, 0x45, 0x50,
+ 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x01,
+ 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xed,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0xf8, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x5e, 0x03, 0xf0, 0x90,
+ 0xff, 0xff, 0xff, 0xff, 0x9e, 0xa6, 0x1e, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0x9f, 0xba, 0xeb, 0x60, 0xff, 0xff, 0xff, 0xff, 0xa0, 0x86, 0x00, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xa1, 0x9a, 0xcd, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xa2, 0x65, 0xe2, 0x70, 0xff, 0xff, 0xff, 0xff, 0xa3, 0x83, 0xe9, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xa4, 0x6a, 0xae, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xa5, 0x35, 0xa7, 0x60, 0xff, 0xff, 0xff, 0xff, 0xa6, 0x53, 0xca, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xa7, 0x15, 0x89, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xa8, 0x33, 0xac, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xa8, 0xfe, 0xa5, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xaa, 0x13, 0x8e, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xaa, 0xde, 0x87, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xab, 0xf3, 0x70, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xac, 0xbe, 0x69, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xad, 0xd3, 0x52, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xae, 0x9e, 0x4b, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xaf, 0xb3, 0x34, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xb0, 0x7e, 0x2d, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xb1, 0x9c, 0x51, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xb2, 0x67, 0x4a, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xb3, 0x7c, 0x33, 0x70, 0xff, 0xff, 0xff, 0xff, 0xb4, 0x47, 0x2c, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xb5, 0x5c, 0x15, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xb6, 0x27, 0x0e, 0x60, 0xff, 0xff, 0xff, 0xff, 0xb7, 0x3b, 0xf7, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xb8, 0x06, 0xf0, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xb9, 0x1b, 0xd9, 0x70, 0xff, 0xff, 0xff, 0xff, 0xb9, 0xe6, 0xd2, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xbb, 0x04, 0xf5, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xbb, 0xc6, 0xb4, 0x60, 0xff, 0xff, 0xff, 0xff, 0xbc, 0xe4, 0xd7, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xbd, 0xaf, 0xd0, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xbe, 0xc4, 0xb9, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xbf, 0x8f, 0xb2, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xc0, 0xa4, 0x9b, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xc1, 0x6f, 0x94, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xc2, 0x84, 0x7d, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xc3, 0x4f, 0x76, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xc4, 0x64, 0x5f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xc5, 0x2f, 0x58, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xc6, 0x4d, 0x7c, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xc7, 0x0f, 0x3a, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xc8, 0x2d, 0x5e, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xc8, 0xf8, 0x57, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xca, 0x0d, 0x40, 0x70, 0xff, 0xff, 0xff, 0xff, 0xca, 0xd8, 0x39, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xcb, 0x88, 0xf0, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xd2, 0x23, 0xf4, 0x70, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x60, 0xfb, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xd3, 0x75, 0xe4, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xd4, 0x40, 0xdd, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xd5, 0x55, 0xc6, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xd6, 0x20, 0xbf, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xd7, 0x35, 0xa8, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xd8, 0x00, 0xa1, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xd9, 0x15, 0x8a, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xd9, 0xe0, 0x83, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xda, 0xfe, 0xa7, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xdb, 0xc0, 0x65, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xdc, 0xde, 0x89, 0x70, 0xff, 0xff, 0xff, 0xff, 0xdd, 0xa9, 0x82, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xde, 0xbe, 0x6b, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xdf, 0x89, 0x64, 0x60, 0xff, 0xff, 0xff, 0xff, 0xe0, 0x9e, 0x4d, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xe1, 0x69, 0x46, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xe2, 0x7e, 0x2f, 0x70, 0xff, 0xff, 0xff, 0xff, 0xe3, 0x49, 0x28, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xe4, 0x5e, 0x11, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xe5, 0x57, 0x2e, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x47, 0x2d, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xe7, 0x37, 0x10, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xe8, 0x27, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xe9, 0x16, 0xf2, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xea, 0x06, 0xf1, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xea, 0xf6, 0xd4, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xeb, 0xe6, 0xd3, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xec, 0xd6, 0xb6, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xed, 0xc6, 0xb5, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xee, 0xbf, 0xd3, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xef, 0xaf, 0xd2, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xf0, 0x9f, 0xb5, 0x60, 0xff, 0xff, 0xff, 0xff, 0xf1, 0x8f, 0xb4, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xf2, 0x7f, 0x97, 0x60, 0xff, 0xff, 0xff, 0xff,
+ 0xf3, 0x6f, 0x96, 0x70, 0xff, 0xff, 0xff, 0xff, 0xf4, 0x5f, 0x79, 0x60,
+ 0xff, 0xff, 0xff, 0xff, 0xf5, 0x4f, 0x78, 0x70, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x3f, 0x5b, 0x60, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x2f, 0x5a, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xf8, 0x28, 0x77, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xf9, 0x0f, 0x3c, 0x70, 0xff, 0xff, 0xff, 0xff, 0xfa, 0x08, 0x59, 0xe0,
+ 0xff, 0xff, 0xff, 0xff, 0xfa, 0xf8, 0x58, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xfb, 0xe8, 0x3b, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xfc, 0xd8, 0x3a, 0xf0,
+ 0xff, 0xff, 0xff, 0xff, 0xfd, 0xc8, 0x1d, 0xe0, 0xff, 0xff, 0xff, 0xff,
+ 0xfe, 0xb8, 0x1c, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7, 0xff, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x97, 0xfe, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x01, 0x87, 0xe1, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x02, 0x77, 0xe0, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x03, 0x70, 0xfe, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x04, 0x60, 0xfd, 0x70, 0x00, 0x00, 0x00, 0x00, 0x05, 0x50, 0xe0, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x06, 0x40, 0xdf, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x07, 0x30, 0xc2, 0x60, 0x00, 0x00, 0x00, 0x00, 0x07, 0x8d, 0x19, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x09, 0x10, 0xa4, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x09, 0xad, 0x94, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x0a, 0xf0, 0x86, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x0b, 0xe0, 0x85, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x0c, 0xd9, 0xa2, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xc0, 0x67, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x0e, 0xb9, 0x84, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x0f, 0xa9, 0x83, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x10, 0x99, 0x66, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x11, 0x89, 0x65, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x12, 0x79, 0x48, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x13, 0x69, 0x47, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x14, 0x59, 0x2a, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x15, 0x49, 0x29, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x16, 0x39, 0x0c, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x17, 0x29, 0x0b, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x18, 0x22, 0x29, 0x60, 0x00, 0x00, 0x00, 0x00, 0x19, 0x08, 0xed, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x1a, 0x02, 0x0b, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x1a, 0xf2, 0x0a, 0x70, 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe1, 0xed, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x1c, 0xd1, 0xec, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x1d, 0xc1, 0xcf, 0x60, 0x00, 0x00, 0x00, 0x00, 0x1e, 0xb1, 0xce, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x1f, 0xa1, 0xb1, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x20, 0x76, 0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x21, 0x81, 0x93, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x22, 0x55, 0xe2, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x23, 0x6a, 0xaf, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x24, 0x35, 0xc4, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x25, 0x4a, 0x91, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x26, 0x15, 0xa6, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x27, 0x2a, 0x73, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x27, 0xfe, 0xc3, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x29, 0x0a, 0x55, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x29, 0xde, 0xa5, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x2a, 0xea, 0x37, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x2b, 0xbe, 0x87, 0x70, 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd3, 0x54, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x2d, 0x9e, 0x69, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x2e, 0xb3, 0x36, 0x60, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x7e, 0x4b, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x30, 0x93, 0x18, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x31, 0x67, 0x67, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x32, 0x72, 0xfa, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x33, 0x47, 0x49, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x34, 0x52, 0xdc, 0x60, 0x00, 0x00, 0x00, 0x00, 0x35, 0x27, 0x2b, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x36, 0x32, 0xbe, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x37, 0x07, 0x0d, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x1b, 0xda, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x38, 0xe6, 0xef, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x39, 0xfb, 0xbc, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x3a, 0xc6, 0xd1, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x3b, 0xdb, 0x9e, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x3c, 0xaf, 0xee, 0x70, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xbb, 0x80, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x3e, 0x8f, 0xd0, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x3f, 0x9b, 0x62, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x40, 0x6f, 0xb2, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x41, 0x84, 0x7f, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x42, 0x4f, 0x94, 0x70, 0x00, 0x00, 0x00, 0x00, 0x43, 0x64, 0x61, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x44, 0x2f, 0x76, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x45, 0x44, 0x43, 0x60, 0x00, 0x00, 0x00, 0x00, 0x45, 0xf3, 0xa8, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x47, 0x2d, 0x5f, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x47, 0xd3, 0x8a, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x49, 0x0d, 0x41, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x49, 0xb3, 0x6c, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x4a, 0xed, 0x23, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x4b, 0x9c, 0x89, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x4c, 0xd6, 0x40, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x4d, 0x7c, 0x6b, 0x70, 0x00, 0x00, 0x00, 0x00, 0x4e, 0xb6, 0x22, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x4f, 0x5c, 0x4d, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x50, 0x96, 0x04, 0x60, 0x00, 0x00, 0x00, 0x00, 0x51, 0x3c, 0x2f, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x52, 0x75, 0xe6, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x53, 0x1c, 0x11, 0x70, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0xc8, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x54, 0xfb, 0xf3, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x56, 0x35, 0xaa, 0x60, 0x00, 0x00, 0x00, 0x00, 0x56, 0xe5, 0x0f, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x58, 0x1e, 0xc6, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x58, 0xc4, 0xf1, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x59, 0xfe, 0xa8, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x5a, 0xa4, 0xd3, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x5b, 0xde, 0x8a, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x5c, 0x84, 0xb5, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x5d, 0xbe, 0x6c, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x5e, 0x64, 0x97, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x5f, 0x9e, 0x4e, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x60, 0x4d, 0xb4, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x61, 0x87, 0x6b, 0x60, 0x00, 0x00, 0x00, 0x00, 0x62, 0x2d, 0x96, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x63, 0x67, 0x4d, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x64, 0x0d, 0x78, 0x70, 0x00, 0x00, 0x00, 0x00, 0x65, 0x47, 0x2f, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x65, 0xed, 0x5a, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x67, 0x27, 0x11, 0x60, 0x00, 0x00, 0x00, 0x00, 0x67, 0xcd, 0x3c, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x69, 0x06, 0xf3, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x69, 0xad, 0x1e, 0x70, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xe6, 0xd5, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x6b, 0x96, 0x3a, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x6c, 0xcf, 0xf1, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x76, 0x1c, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x6e, 0xaf, 0xd3, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x6f, 0x55, 0xfe, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8f, 0xb5, 0xe0,
+ 0x00, 0x00, 0x00, 0x00, 0x71, 0x35, 0xe0, 0xf0, 0x00, 0x00, 0x00, 0x00,
+ 0x72, 0x6f, 0x97, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x73, 0x15, 0xc2, 0xf0,
+ 0x00, 0x00, 0x00, 0x00, 0x74, 0x4f, 0x79, 0xe0, 0x00, 0x00, 0x00, 0x00,
+ 0x74, 0xfe, 0xdf, 0x70, 0x00, 0x00, 0x00, 0x00, 0x76, 0x38, 0x96, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x76, 0xde, 0xc1, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x78, 0x18, 0x78, 0x60, 0x00, 0x00, 0x00, 0x00, 0x78, 0xbe, 0xa3, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x79, 0xf8, 0x5a, 0x60, 0x00, 0x00, 0x00, 0x00,
+ 0x7a, 0x9e, 0x85, 0x70, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xd8, 0x3c, 0x60,
+ 0x00, 0x00, 0x00, 0x00, 0x7c, 0x7e, 0x67, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x7d, 0xb8, 0x1e, 0x60, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x5e, 0x49, 0x70,
+ 0x00, 0x00, 0x00, 0x00, 0x7f, 0x98, 0x00, 0x60, 0x00, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0xff, 0xff, 0xba, 0x9e, 0x00, 0x00, 0xff,
+ 0xff, 0xc7, 0xc0, 0x01, 0x04, 0xff, 0xff, 0xb9, 0xb0, 0x00, 0x08, 0xff,
+ 0xff, 0xc7, 0xc0, 0x01, 0x0c, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x10, 0x4c,
+ 0x4d, 0x54, 0x00, 0x45, 0x44, 0x54, 0x00, 0x45, 0x53, 0x54, 0x00, 0x45,
+ 0x57, 0x54, 0x00, 0x45, 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+ 0x00, 0x00, 0x00, 0x00, 0x01, 0x0a, 0x45, 0x53, 0x54, 0x35, 0x45, 0x44,
+ 0x54, 0x2c, 0x4d, 0x33, 0x2e, 0x32, 0x2e, 0x30, 0x2c, 0x4d, 0x31, 0x31,
+ 0x2e, 0x31, 0x2e, 0x30, 0x0a
+};
+unsigned int America_New_York_len = 3545;
+unsigned char Australia_Sydney[] = {
+ 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8e,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x0e, 0x80, 0x00, 0x00, 0x00,
+ 0x9c, 0x4e, 0xa6, 0x9c, 0x9c, 0xbc, 0x20, 0xf0, 0xcb, 0x54, 0xb3, 0x00,
+ 0xcb, 0xc7, 0x57, 0x70, 0xcc, 0xb7, 0x56, 0x80, 0xcd, 0xa7, 0x39, 0x70,
+ 0xce, 0xa0, 0x73, 0x00, 0xcf, 0x87, 0x1b, 0x70, 0x03, 0x70, 0x39, 0x80,
+ 0x04, 0x0d, 0x1c, 0x00, 0x05, 0x50, 0x1b, 0x80, 0x05, 0xf6, 0x38, 0x80,
+ 0x07, 0x2f, 0xfd, 0x80, 0x07, 0xd6, 0x1a, 0x80, 0x09, 0x0f, 0xdf, 0x80,
+ 0x09, 0xb5, 0xfc, 0x80, 0x0a, 0xef, 0xc1, 0x80, 0x0b, 0x9f, 0x19, 0x00,
+ 0x0c, 0xd8, 0xde, 0x00, 0x0d, 0x7e, 0xfb, 0x00, 0x0e, 0xb8, 0xc0, 0x00,
+ 0x0f, 0x5e, 0xdd, 0x00, 0x10, 0x98, 0xa2, 0x00, 0x11, 0x3e, 0xbf, 0x00,
+ 0x12, 0x78, 0x84, 0x00, 0x13, 0x1e, 0xa1, 0x00, 0x14, 0x58, 0x66, 0x00,
+ 0x14, 0xfe, 0x83, 0x00, 0x16, 0x38, 0x48, 0x00, 0x17, 0x0c, 0x89, 0x80,
+ 0x18, 0x21, 0x64, 0x80, 0x18, 0xc7, 0x81, 0x80, 0x1a, 0x01, 0x46, 0x80,
+ 0x1a, 0xa7, 0x63, 0x80, 0x1b, 0xe1, 0x28, 0x80, 0x1c, 0x87, 0x45, 0x80,
+ 0x1d, 0xc1, 0x0a, 0x80, 0x1e, 0x79, 0x9c, 0x80, 0x1f, 0x97, 0xb2, 0x00,
+ 0x20, 0x59, 0x7e, 0x80, 0x21, 0x80, 0xce, 0x80, 0x22, 0x42, 0x9b, 0x00,
+ 0x23, 0x69, 0xeb, 0x00, 0x24, 0x22, 0x7d, 0x00, 0x25, 0x49, 0xcd, 0x00,
+ 0x25, 0xef, 0xea, 0x00, 0x27, 0x29, 0xaf, 0x00, 0x27, 0xcf, 0xcc, 0x00,
+ 0x29, 0x09, 0x91, 0x00, 0x29, 0xaf, 0xae, 0x00, 0x2a, 0xe9, 0x73, 0x00,
+ 0x2b, 0x98, 0xca, 0x80, 0x2c, 0xd2, 0x8f, 0x80, 0x2d, 0x78, 0xac, 0x80,
+ 0x2e, 0xb2, 0x71, 0x80, 0x2f, 0x58, 0x8e, 0x80, 0x30, 0x92, 0x53, 0x80,
+ 0x31, 0x5d, 0x5a, 0x80, 0x32, 0x72, 0x35, 0x80, 0x33, 0x3d, 0x3c, 0x80,
+ 0x34, 0x52, 0x17, 0x80, 0x35, 0x1d, 0x1e, 0x80, 0x36, 0x31, 0xf9, 0x80,
+ 0x36, 0xfd, 0x00, 0x80, 0x38, 0x1b, 0x16, 0x00, 0x38, 0xdc, 0xe2, 0x80,
+ 0x39, 0xa7, 0xe9, 0x80, 0x3a, 0xbc, 0xc4, 0x80, 0x3b, 0xda, 0xda, 0x00,
+ 0x3c, 0xa5, 0xe1, 0x00, 0x3d, 0xba, 0xbc, 0x00, 0x3e, 0x85, 0xc3, 0x00,
+ 0x3f, 0x9a, 0x9e, 0x00, 0x40, 0x65, 0xa5, 0x00, 0x41, 0x83, 0xba, 0x80,
+ 0x42, 0x45, 0x87, 0x00, 0x43, 0x63, 0x9c, 0x80, 0x44, 0x2e, 0xa3, 0x80,
+ 0x45, 0x43, 0x7e, 0x80, 0x46, 0x05, 0x4b, 0x00, 0x47, 0x23, 0x60, 0x80,
+ 0x47, 0xf7, 0xa2, 0x00, 0x48, 0xe7, 0x93, 0x00, 0x49, 0xd7, 0x84, 0x00,
+ 0x4a, 0xc7, 0x75, 0x00, 0x4b, 0xb7, 0x66, 0x00, 0x4c, 0xa7, 0x57, 0x00,
+ 0x4d, 0x97, 0x48, 0x00, 0x4e, 0x87, 0x39, 0x00, 0x4f, 0x77, 0x2a, 0x00,
+ 0x50, 0x70, 0x55, 0x80, 0x51, 0x60, 0x46, 0x80, 0x52, 0x50, 0x37, 0x80,
+ 0x53, 0x40, 0x28, 0x80, 0x54, 0x30, 0x19, 0x80, 0x55, 0x20, 0x0a, 0x80,
+ 0x56, 0x0f, 0xfb, 0x80, 0x56, 0xff, 0xec, 0x80, 0x57, 0xef, 0xdd, 0x80,
+ 0x58, 0xdf, 0xce, 0x80, 0x59, 0xcf, 0xbf, 0x80, 0x5a, 0xbf, 0xb0, 0x80,
+ 0x5b, 0xb8, 0xdc, 0x00, 0x5c, 0xa8, 0xcd, 0x00, 0x5d, 0x98, 0xbe, 0x00,
+ 0x5e, 0x88, 0xaf, 0x00, 0x5f, 0x78, 0xa0, 0x00, 0x60, 0x68, 0x91, 0x00,
+ 0x61, 0x58, 0x82, 0x00, 0x62, 0x48, 0x73, 0x00, 0x63, 0x38, 0x64, 0x00,
+ 0x64, 0x28, 0x55, 0x00, 0x65, 0x18, 0x46, 0x00, 0x66, 0x11, 0x71, 0x80,
+ 0x67, 0x01, 0x62, 0x80, 0x67, 0xf1, 0x53, 0x80, 0x68, 0xe1, 0x44, 0x80,
+ 0x69, 0xd1, 0x35, 0x80, 0x6a, 0xc1, 0x26, 0x80, 0x6b, 0xb1, 0x17, 0x80,
+ 0x6c, 0xa1, 0x08, 0x80, 0x6d, 0x90, 0xf9, 0x80, 0x6e, 0x80, 0xea, 0x80,
+ 0x6f, 0x70, 0xdb, 0x80, 0x70, 0x6a, 0x07, 0x00, 0x71, 0x59, 0xf8, 0x00,
+ 0x72, 0x49, 0xe9, 0x00, 0x73, 0x39, 0xda, 0x00, 0x74, 0x29, 0xcb, 0x00,
+ 0x75, 0x19, 0xbc, 0x00, 0x76, 0x09, 0xad, 0x00, 0x76, 0xf9, 0x9e, 0x00,
+ 0x77, 0xe9, 0x8f, 0x00, 0x78, 0xd9, 0x80, 0x00, 0x79, 0xc9, 0x71, 0x00,
+ 0x7a, 0xb9, 0x62, 0x00, 0x7b, 0xb2, 0x8d, 0x80, 0x7c, 0xa2, 0x7e, 0x80,
+ 0x7d, 0x92, 0x6f, 0x80, 0x7e, 0x82, 0x60, 0x80, 0x7f, 0x72, 0x51, 0x80,
+ 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+ 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x00, 0x00,
+ 0x8d, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x9a, 0xb0, 0x01, 0x04, 0x00, 0x00,
+ 0x8c, 0xa0, 0x00, 0x09, 0x00, 0x00, 0x9a, 0xb0, 0x01, 0x04, 0x00, 0x00,
+ 0x8c, 0xa0, 0x00, 0x09, 0x4c, 0x4d, 0x54, 0x00, 0x41, 0x45, 0x44, 0x54,
+ 0x00, 0x41, 0x45, 0x53, 0x54, 0x00, 0x00, 0x00, 0x00, 0x01, 0x01, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x8f, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x0e,
+ 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff,
+ 0x73, 0x16, 0x7f, 0x3c, 0xff, 0xff, 0xff, 0xff, 0x9c, 0x4e, 0xa6, 0x9c,
+ 0xff, 0xff, 0xff, 0xff, 0x9c, 0xbc, 0x20, 0xf0, 0xff, 0xff, 0xff, 0xff,
+ 0xcb, 0x54, 0xb3, 0x00, 0xff, 0xff, 0xff, 0xff, 0xcb, 0xc7, 0x57, 0x70,
+ 0xff, 0xff, 0xff, 0xff, 0xcc, 0xb7, 0x56, 0x80, 0xff, 0xff, 0xff, 0xff,
+ 0xcd, 0xa7, 0x39, 0x70, 0xff, 0xff, 0xff, 0xff, 0xce, 0xa0, 0x73, 0x00,
+ 0xff, 0xff, 0xff, 0xff, 0xcf, 0x87, 0x1b, 0x70, 0x00, 0x00, 0x00, 0x00,
+ 0x03, 0x70, 0x39, 0x80, 0x00, 0x00, 0x00, 0x00, 0x04, 0x0d, 0x1c, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x05, 0x50, 0x1b, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x05, 0xf6, 0x38, 0x80, 0x00, 0x00, 0x00, 0x00, 0x07, 0x2f, 0xfd, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x07, 0xd6, 0x1a, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x09, 0x0f, 0xdf, 0x80, 0x00, 0x00, 0x00, 0x00, 0x09, 0xb5, 0xfc, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x0a, 0xef, 0xc1, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x0b, 0x9f, 0x19, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0xd8, 0xde, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x0d, 0x7e, 0xfb, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x0e, 0xb8, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x5e, 0xdd, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x98, 0xa2, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x11, 0x3e, 0xbf, 0x00, 0x00, 0x00, 0x00, 0x00, 0x12, 0x78, 0x84, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0x1e, 0xa1, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x14, 0x58, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00, 0x14, 0xfe, 0x83, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x16, 0x38, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x17, 0x0c, 0x89, 0x80, 0x00, 0x00, 0x00, 0x00, 0x18, 0x21, 0x64, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0xc7, 0x81, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x1a, 0x01, 0x46, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1a, 0xa7, 0x63, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe1, 0x28, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x1c, 0x87, 0x45, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1d, 0xc1, 0x0a, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x1e, 0x79, 0x9c, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x1f, 0x97, 0xb2, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x59, 0x7e, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x21, 0x80, 0xce, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x22, 0x42, 0x9b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x23, 0x69, 0xeb, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0x22, 0x7d, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x25, 0x49, 0xcd, 0x00, 0x00, 0x00, 0x00, 0x00, 0x25, 0xef, 0xea, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x27, 0x29, 0xaf, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x27, 0xcf, 0xcc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x29, 0x09, 0x91, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x29, 0xaf, 0xae, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x2a, 0xe9, 0x73, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0x98, 0xca, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd2, 0x8f, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x2d, 0x78, 0xac, 0x80, 0x00, 0x00, 0x00, 0x00, 0x2e, 0xb2, 0x71, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x2f, 0x58, 0x8e, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x30, 0x92, 0x53, 0x80, 0x00, 0x00, 0x00, 0x00, 0x31, 0x5d, 0x5a, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x32, 0x72, 0x35, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x33, 0x3d, 0x3c, 0x80, 0x00, 0x00, 0x00, 0x00, 0x34, 0x52, 0x17, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x35, 0x1d, 0x1e, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x36, 0x31, 0xf9, 0x80, 0x00, 0x00, 0x00, 0x00, 0x36, 0xfd, 0x00, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x38, 0x1b, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x38, 0xdc, 0xe2, 0x80, 0x00, 0x00, 0x00, 0x00, 0x39, 0xa7, 0xe9, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x3a, 0xbc, 0xc4, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x3b, 0xda, 0xda, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0xa5, 0xe1, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x3d, 0xba, 0xbc, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x3e, 0x85, 0xc3, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x9a, 0x9e, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x40, 0x65, 0xa5, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x41, 0x83, 0xba, 0x80, 0x00, 0x00, 0x00, 0x00, 0x42, 0x45, 0x87, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x43, 0x63, 0x9c, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x44, 0x2e, 0xa3, 0x80, 0x00, 0x00, 0x00, 0x00, 0x45, 0x43, 0x7e, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x46, 0x05, 0x4b, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x47, 0x23, 0x60, 0x80, 0x00, 0x00, 0x00, 0x00, 0x47, 0xf7, 0xa2, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x48, 0xe7, 0x93, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x49, 0xd7, 0x84, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4a, 0xc7, 0x75, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x4b, 0xb7, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x4c, 0xa7, 0x57, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4d, 0x97, 0x48, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x4e, 0x87, 0x39, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x4f, 0x77, 0x2a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x70, 0x55, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x51, 0x60, 0x46, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x52, 0x50, 0x37, 0x80, 0x00, 0x00, 0x00, 0x00, 0x53, 0x40, 0x28, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x54, 0x30, 0x19, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x55, 0x20, 0x0a, 0x80, 0x00, 0x00, 0x00, 0x00, 0x56, 0x0f, 0xfb, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x56, 0xff, 0xec, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x57, 0xef, 0xdd, 0x80, 0x00, 0x00, 0x00, 0x00, 0x58, 0xdf, 0xce, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x59, 0xcf, 0xbf, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x5a, 0xbf, 0xb0, 0x80, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xb8, 0xdc, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x5c, 0xa8, 0xcd, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x5d, 0x98, 0xbe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x5e, 0x88, 0xaf, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x5f, 0x78, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x60, 0x68, 0x91, 0x00, 0x00, 0x00, 0x00, 0x00, 0x61, 0x58, 0x82, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x62, 0x48, 0x73, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x63, 0x38, 0x64, 0x00, 0x00, 0x00, 0x00, 0x00, 0x64, 0x28, 0x55, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x65, 0x18, 0x46, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x66, 0x11, 0x71, 0x80, 0x00, 0x00, 0x00, 0x00, 0x67, 0x01, 0x62, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x67, 0xf1, 0x53, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x68, 0xe1, 0x44, 0x80, 0x00, 0x00, 0x00, 0x00, 0x69, 0xd1, 0x35, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x6a, 0xc1, 0x26, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x6b, 0xb1, 0x17, 0x80, 0x00, 0x00, 0x00, 0x00, 0x6c, 0xa1, 0x08, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x6d, 0x90, 0xf9, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x6e, 0x80, 0xea, 0x80, 0x00, 0x00, 0x00, 0x00, 0x6f, 0x70, 0xdb, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x70, 0x6a, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x71, 0x59, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x72, 0x49, 0xe9, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x73, 0x39, 0xda, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x74, 0x29, 0xcb, 0x00, 0x00, 0x00, 0x00, 0x00, 0x75, 0x19, 0xbc, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x76, 0x09, 0xad, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x76, 0xf9, 0x9e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x77, 0xe9, 0x8f, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x78, 0xd9, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x79, 0xc9, 0x71, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7a, 0xb9, 0x62, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x7b, 0xb2, 0x8d, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x7c, 0xa2, 0x7e, 0x80, 0x00, 0x00, 0x00, 0x00, 0x7d, 0x92, 0x6f, 0x80,
+ 0x00, 0x00, 0x00, 0x00, 0x7e, 0x82, 0x60, 0x80, 0x00, 0x00, 0x00, 0x00,
+ 0x7f, 0x72, 0x51, 0x80, 0x00, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+ 0x01, 0x02, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+ 0x03, 0x04, 0x03, 0x00, 0x00, 0x8d, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x9a,
+ 0xb0, 0x01, 0x04, 0x00, 0x00, 0x8c, 0xa0, 0x00, 0x09, 0x00, 0x00, 0x9a,
+ 0xb0, 0x01, 0x04, 0x00, 0x00, 0x8c, 0xa0, 0x00, 0x09, 0x4c, 0x4d, 0x54,
+ 0x00, 0x41, 0x45, 0x44, 0x54, 0x00, 0x41, 0x45, 0x53, 0x54, 0x00, 0x00,
+ 0x00, 0x00, 0x01, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x41, 0x45,
+ 0x53, 0x54, 0x2d, 0x31, 0x30, 0x41, 0x45, 0x44, 0x54, 0x2c, 0x4d, 0x31,
+ 0x30, 0x2e, 0x31, 0x2e, 0x30, 0x2c, 0x4d, 0x34, 0x2e, 0x31, 0x2e, 0x30,
+ 0x2f, 0x33, 0x0a
+};
+unsigned int Australia_Sydney_len = 2223;